\\r\\n\",\n host: {\n 'class': 'ngx-mat-calendar-body',\n 'role': 'grid',\n 'aria-readonly': 'true'\n },\n exportAs: 'NgxMatCalendarBody',\n encapsulation: ViewEncapsulation.None,\n changeDetection: ChangeDetectionStrategy.OnPush,\n styles: [\".mat-calendar-body{min-width:224px}.mat-calendar-body-label{height:0;line-height:0;text-align:left;padding-left:4.7142857143%;padding-right:4.7142857143%}.mat-calendar-body-cell{position:relative;height:0;line-height:0;text-align:center;outline:none;cursor:pointer}.mat-calendar-body-cell-preview,.mat-calendar-body-cell:after,.mat-calendar-body-cell:before{content:\\\"\\\";position:absolute;top:5%;left:0;z-index:0;box-sizing:border-box;height:90%;width:100%}.mat-calendar-body-comparison-start:after,.mat-calendar-body-comparison-start:not(.mat-calendar-body-comparison-bridge-start):before,.mat-calendar-body-preview-start .mat-calendar-body-cell-preview,.mat-calendar-body-range-start:after,.mat-calendar-body-range-start:not(.mat-calendar-body-in-comparison-range):before{left:5%;width:95%;border-top-left-radius:999px;border-bottom-left-radius:999px}[dir=rtl] .mat-calendar-body-comparison-start:after,[dir=rtl] .mat-calendar-body-comparison-start:not(.mat-calendar-body-comparison-bridge-start):before,[dir=rtl] .mat-calendar-body-preview-start .mat-calendar-body-cell-preview,[dir=rtl] .mat-calendar-body-range-start:after,[dir=rtl] .mat-calendar-body-range-start:not(.mat-calendar-body-in-comparison-range):before{left:0;border-radius:0;border-top-right-radius:999px;border-bottom-right-radius:999px}.mat-calendar-body-comparison-end:after,.mat-calendar-body-comparison-end:not(.mat-calendar-body-comparison-bridge-end):before,.mat-calendar-body-preview-end .mat-calendar-body-cell-preview,.mat-calendar-body-range-end:after,.mat-calendar-body-range-end:not(.mat-calendar-body-in-comparison-range):before{width:95%;border-top-right-radius:999px;border-bottom-right-radius:999px}[dir=rtl] .mat-calendar-body-comparison-end:after,[dir=rtl] .mat-calendar-body-comparison-end:not(.mat-calendar-body-comparison-bridge-end):before,[dir=rtl] .mat-calendar-body-preview-end .mat-calendar-body-cell-preview,[dir=rtl] .mat-calendar-body-range-end:after,[dir=rtl] .mat-calendar-body-range-end:not(.mat-calendar-body-in-comparison-range):before{left:5%;border-radius:0;border-top-left-radius:999px;border-bottom-left-radius:999px}[dir=rtl] .mat-calendar-body-comparison-bridge-end.mat-calendar-body-range-start:after,[dir=rtl] .mat-calendar-body-comparison-bridge-start.mat-calendar-body-range-end:after{width:95%;border-top-right-radius:999px;border-bottom-right-radius:999px}.mat-calendar-body-comparison-end.mat-calendar-body-range-start:after,.mat-calendar-body-comparison-start.mat-calendar-body-range-end:after,[dir=rtl] .mat-calendar-body-comparison-end.mat-calendar-body-range-start:after,[dir=rtl] .mat-calendar-body-comparison-start.mat-calendar-body-range-end:after{width:90%}.mat-calendar-body-in-preview .mat-calendar-body-cell-preview{border-top:1px dashed;border-bottom:1px dashed}.mat-calendar-body-preview-start .mat-calendar-body-cell-preview{border-left:1px dashed}[dir=rtl] .mat-calendar-body-preview-start .mat-calendar-body-cell-preview{border-left:0;border-right:1px dashed}.mat-calendar-body-preview-end .mat-calendar-body-cell-preview{border-right:1px dashed}[dir=rtl] .mat-calendar-body-preview-end .mat-calendar-body-cell-preview{border-right:0;border-left:1px dashed}.mat-calendar-body-disabled{cursor:default}.mat-calendar-body-cell-content{top:5%;left:5%;z-index:1;display:flex;align-items:center;justify-content:center;box-sizing:border-box;width:90%;height:90%;line-height:1;border-width:1px;border-style:solid;border-radius:999px}.mat-calendar-body-cell-content.mat-focus-indicator{position:absolute}.cdk-high-contrast-active .mat-calendar-body-cell-content{border:none}.cdk-high-contrast-active .mat-calendar-body-selected,.cdk-high-contrast-active .mat-datepicker-popup:not(:empty){outline:1px solid}.cdk-high-contrast-active .mat-calendar-body-today{outline:1px dotted}.cdk-high-contrast-active .cdk-keyboard-focused .mat-calendar-body-active>.mat-calendar-body-cell-content:not(.mat-calendar-body-selected),.cdk-high-contrast-active .cdk-program-focused .mat-calendar-body-active>.mat-calendar-body-cell-content:not(.mat-calendar-body-selected){outline:2px dotted}[dir=rtl] .mat-calendar-body-label{text-align:right}@media (hover:none){.mat-calendar-body-cell:not(.mat-calendar-body-disabled):hover>.mat-calendar-body-cell-content:not(.mat-calendar-body-selected){background-color:transparent}}\"]\n }]\n }], function () { return [{ type: ɵngcc0.ElementRef }, { type: ɵngcc0.NgZone }]; }, { numCols: [{\n type: Input\n }], activeCell: [{\n type: Input\n }], isRange: [{\n type: Input\n }], cellAspectRatio: [{\n type: Input\n }], previewStart: [{\n type: Input\n }], previewEnd: [{\n type: Input\n }], selectedValueChange: [{\n type: Output\n }], previewChange: [{\n type: Output\n }], label: [{\n type: Input\n }], rows: [{\n type: Input\n }], todayValue: [{\n type: Input\n }], startValue: [{\n type: Input\n }], endValue: [{\n type: Input\n }], labelMinRequiredCells: [{\n type: Input\n }], comparisonStart: [{\n type: Input\n }], comparisonEnd: [{\n type: Input\n }] }); })();\r\n/** Checks whether a node is a table cell element. */\r\nfunction isTableCell(node) {\r\n return node.nodeName === 'TD';\r\n}\r\n/** Checks whether a value is the start of a range. */\r\nfunction isStart(value, start, end) {\r\n return end !== null && start !== end && value < end && value === start;\r\n}\r\n/** Checks whether a value is the end of a range. */\r\nfunction isEnd(value, start, end) {\r\n return start !== null && start !== end && value >= start && value === end;\r\n}\r\n/** Checks whether a value is inside of a range. */\r\nfunction isInRange(value, start, end, rangeEnabled) {\r\n return rangeEnabled && start !== null && end !== null && start !== end &&\r\n value >= start && value <= end;\r\n}\n\n/**\r\n * @license\r\n * Copyright Google LLC All Rights Reserved.\r\n *\r\n * Use of this source code is governed by an MIT-style license that can be\r\n * found in the LICENSE file at https://angular.io/license\r\n */\r\n/** Injection token used to customize the date range selection behavior. */\r\nconst NGX_MAT_DATE_RANGE_SELECTION_STRATEGY = new InjectionToken('NGX_MAT_DATE_RANGE_SELECTION_STRATEGY');\r\n/** Provides the default date range selection behavior. */\r\nclass DefaultNgxMatCalendarRangeStrategy {\r\n constructor(_dateAdapter) {\r\n this._dateAdapter = _dateAdapter;\r\n }\r\n selectionFinished(date, currentRange) {\r\n let { start, end } = currentRange;\r\n if (start == null) {\r\n start = date;\r\n }\r\n else if (end == null && date && this._dateAdapter.compareDate(date, start) >= 0) {\r\n end = date;\r\n }\r\n else {\r\n start = date;\r\n end = null;\r\n }\r\n return new DateRange(start, end);\r\n }\r\n createPreview(activeDate, currentRange) {\r\n let start = null;\r\n let end = null;\r\n if (currentRange.start && !currentRange.end && activeDate) {\r\n start = currentRange.start;\r\n end = activeDate;\r\n }\r\n return new DateRange(start, end);\r\n }\r\n}\nDefaultNgxMatCalendarRangeStrategy.ɵfac = function DefaultNgxMatCalendarRangeStrategy_Factory(t) { return new (t || DefaultNgxMatCalendarRangeStrategy)(ɵngcc0.ɵɵinject(NgxMatDateAdapter)); };\nDefaultNgxMatCalendarRangeStrategy.ɵprov = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjectable({ token: DefaultNgxMatCalendarRangeStrategy, factory: DefaultNgxMatCalendarRangeStrategy.ɵfac });\r\n/** @nocollapse */\r\nDefaultNgxMatCalendarRangeStrategy.ctorParameters = () => [\r\n { type: NgxMatDateAdapter }\r\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(DefaultNgxMatCalendarRangeStrategy, [{\n type: Injectable\n }], function () { return [{ type: NgxMatDateAdapter }]; }, null); })();\n\nconst LIMIT_TIMES = {\r\n minHour: 0,\r\n maxHour: 24,\r\n minMinute: 0,\r\n maxMinute: 60,\r\n minSecond: 0,\r\n maxSecond: 60,\r\n meridian: 12\r\n};\r\nconst MERIDIANS = {\r\n AM: 'AM',\r\n PM: 'PM'\r\n};\r\nconst DEFAULT_STEP = 1;\r\nconst NUMERIC_REGEX = /[^0-9]/g;\r\nconst PATTERN_INPUT_HOUR = /^(2[0-3]|[0-1][0-9]|[0-9])$/;\r\nconst PATTERN_INPUT_MINUTE = /^([0-5][0-9]|[0-9])$/;\r\nconst PATTERN_INPUT_SECOND = /^([0-5][0-9]|[0-9])$/;\r\nfunction formatTwoDigitTimeValue(val) {\r\n const txt = val.toString();\r\n return txt.length > 1 ? txt : `0${txt}`;\r\n}\r\nfunction createMissingDateImplError(provider) {\r\n return Error(`NgxMatDatepicker: No provider found for ${provider}. You must import one of the following ` +\r\n `modules at your application root: NgxMatNativeDateModule, NgxMatMomentModule, or provide a ` +\r\n `custom implementation.`);\r\n}\r\n/** Formats a range of years. */\r\nfunction formatYearRange(start, end) {\r\n return `${start} \\u2013 ${end}`;\r\n}\n\n/**\r\n * @license\r\n * Copyright Google LLC All Rights Reserved.\r\n *\r\n * Use of this source code is governed by an MIT-style license that can be\r\n * found in the LICENSE file at https://angular.io/license\r\n */\r\nconst DAYS_PER_WEEK = 7;\r\n/**\r\n * An internal component used to display a single month in the datepicker.\r\n * @docs-private\r\n */\r\nclass NgxMatMonthView {\r\n constructor(_changeDetectorRef, _dateFormats, _dateAdapter, _dir, _rangeStrategy) {\r\n this._changeDetectorRef = _changeDetectorRef;\r\n this._dateFormats = _dateFormats;\r\n this._dateAdapter = _dateAdapter;\r\n this._dir = _dir;\r\n this._rangeStrategy = _rangeStrategy;\r\n this._rerenderSubscription = Subscription.EMPTY;\r\n /** Emits when a new date is selected. */\r\n this.selectedChange = new EventEmitter();\r\n /** Emits when any date is selected. */\r\n this._userSelection = new EventEmitter();\r\n /** Emits when any date is activated. */\r\n this.activeDateChange = new EventEmitter();\r\n if (!this._dateAdapter) {\r\n throw createMissingDateImplError('NgxMatDateAdapter');\r\n }\r\n if (!this._dateFormats) {\r\n throw createMissingDateImplError('NGX_MAT_DATE_FORMATS');\r\n }\r\n this._activeDate = this._dateAdapter.today();\r\n }\r\n /**\r\n * The date to display in this month view (everything other than the month and year is ignored).\r\n */\r\n get activeDate() { return this._activeDate; }\r\n set activeDate(value) {\r\n const oldActiveDate = this._activeDate;\r\n const validDate = this._getValidDateOrNull(this._dateAdapter.deserialize(value)) || this._dateAdapter.today();\r\n this._activeDate = this._dateAdapter.clampDate(validDate, this.minDate, this.maxDate);\r\n if (!this._hasSameMonthAndYear(oldActiveDate, this._activeDate)) {\r\n this._init();\r\n }\r\n }\r\n /** The currently selected date. */\r\n get selected() { return this._selected; }\r\n set selected(value) {\r\n if (value instanceof DateRange) {\r\n this._selected = value;\r\n }\r\n else {\r\n this._selected = this._getValidDateOrNull(this._dateAdapter.deserialize(value));\r\n }\r\n this._setRanges(this._selected);\r\n }\r\n /** The minimum selectable date. */\r\n get minDate() { return this._minDate; }\r\n set minDate(value) {\r\n this._minDate = this._getValidDateOrNull(this._dateAdapter.deserialize(value));\r\n }\r\n /** The maximum selectable date. */\r\n get maxDate() { return this._maxDate; }\r\n set maxDate(value) {\r\n this._maxDate = this._getValidDateOrNull(this._dateAdapter.deserialize(value));\r\n }\r\n ngAfterContentInit() {\r\n this._rerenderSubscription = this._dateAdapter.localeChanges\r\n .pipe(startWith(null))\r\n .subscribe(() => this._init());\r\n }\r\n ngOnDestroy() {\r\n this._rerenderSubscription.unsubscribe();\r\n }\r\n /** Handles when a new date is selected. */\r\n _dateSelected(event) {\r\n const date = event.value;\r\n const selectedYear = this._dateAdapter.getYear(this.activeDate);\r\n const selectedMonth = this._dateAdapter.getMonth(this.activeDate);\r\n const selectedDate = this._dateAdapter.createDate(selectedYear, selectedMonth, date);\r\n let rangeStartDate;\r\n let rangeEndDate;\r\n if (this._selected instanceof DateRange) {\r\n rangeStartDate = this._getDateInCurrentMonth(this._selected.start);\r\n rangeEndDate = this._getDateInCurrentMonth(this._selected.end);\r\n }\r\n else {\r\n rangeStartDate = rangeEndDate = this._getDateInCurrentMonth(this._selected);\r\n }\r\n if (rangeStartDate !== date || rangeEndDate !== date) {\r\n this.selectedChange.emit(selectedDate);\r\n }\r\n this._userSelection.emit({ value: selectedDate, event: event.event });\r\n }\r\n /** Handles keydown events on the calendar body when calendar is in month view. */\r\n _handleCalendarBodyKeydown(event) {\r\n // TODO(mmalerba): We currently allow keyboard navigation to disabled dates, but just prevent\r\n // disabled ones from being selected. This may not be ideal, we should look into whether\r\n // navigation should skip over disabled dates, and if so, how to implement that efficiently.\r\n const oldActiveDate = this._activeDate;\r\n const isRtl = this._isRtl();\r\n switch (event.keyCode) {\r\n case LEFT_ARROW:\r\n this.activeDate = this._dateAdapter.addCalendarDays(this._activeDate, isRtl ? 1 : -1);\r\n break;\r\n case RIGHT_ARROW:\r\n this.activeDate = this._dateAdapter.addCalendarDays(this._activeDate, isRtl ? -1 : 1);\r\n break;\r\n case UP_ARROW:\r\n this.activeDate = this._dateAdapter.addCalendarDays(this._activeDate, -7);\r\n break;\r\n case DOWN_ARROW:\r\n this.activeDate = this._dateAdapter.addCalendarDays(this._activeDate, 7);\r\n break;\r\n case HOME:\r\n this.activeDate = this._dateAdapter.addCalendarDays(this._activeDate, 1 - this._dateAdapter.getDate(this._activeDate));\r\n break;\r\n case END:\r\n this.activeDate = this._dateAdapter.addCalendarDays(this._activeDate, (this._dateAdapter.getNumDaysInMonth(this._activeDate) -\r\n this._dateAdapter.getDate(this._activeDate)));\r\n break;\r\n case PAGE_UP:\r\n this.activeDate = event.altKey ?\r\n this._dateAdapter.addCalendarYears(this._activeDate, -1) :\r\n this._dateAdapter.addCalendarMonths(this._activeDate, -1);\r\n break;\r\n case PAGE_DOWN:\r\n this.activeDate = event.altKey ?\r\n this._dateAdapter.addCalendarYears(this._activeDate, 1) :\r\n this._dateAdapter.addCalendarMonths(this._activeDate, 1);\r\n break;\r\n case ENTER:\r\n case SPACE:\r\n if (!this.dateFilter || this.dateFilter(this._activeDate)) {\r\n this._dateSelected({ value: this._dateAdapter.getDate(this._activeDate), event });\r\n // Prevent unexpected default actions such as form submission.\r\n event.preventDefault();\r\n }\r\n return;\r\n case ESCAPE:\r\n // Abort the current range selection if the user presses escape mid-selection.\r\n if (this._previewEnd != null) {\r\n this._previewStart = this._previewEnd = null;\r\n this.selectedChange.emit(null);\r\n this._userSelection.emit({ value: null, event });\r\n event.preventDefault();\r\n event.stopPropagation(); // Prevents the overlay from closing.\r\n }\r\n return;\r\n default:\r\n // Don't prevent default or focus active cell on keys that we don't explicitly handle.\r\n return;\r\n }\r\n if (this._dateAdapter.compareDate(oldActiveDate, this.activeDate)) {\r\n this.activeDateChange.emit(this.activeDate);\r\n }\r\n this._focusActiveCell();\r\n // Prevent unexpected default actions such as form submission.\r\n event.preventDefault();\r\n }\r\n /** Initializes this month view. */\r\n _init() {\r\n this._setRanges(this.selected);\r\n this._todayDate = this._getCellCompareValue(this._dateAdapter.today());\r\n this._monthLabel =\r\n this._dateAdapter.getMonthNames('short')[this._dateAdapter.getMonth(this.activeDate)]\r\n .toLocaleUpperCase();\r\n let firstOfMonth = this._dateAdapter.createDate(this._dateAdapter.getYear(this.activeDate), this._dateAdapter.getMonth(this.activeDate), 1);\r\n this._firstWeekOffset =\r\n (DAYS_PER_WEEK + this._dateAdapter.getDayOfWeek(firstOfMonth) -\r\n this._dateAdapter.getFirstDayOfWeek()) % DAYS_PER_WEEK;\r\n this._initWeekdays();\r\n this._createWeekCells();\r\n this._changeDetectorRef.markForCheck();\r\n }\r\n /** Focuses the active cell after the microtask queue is empty. */\r\n _focusActiveCell(movePreview) {\r\n this._matCalendarBody._focusActiveCell(movePreview);\r\n }\r\n /** Called when the user has activated a new cell and the preview needs to be updated. */\r\n _previewChanged({ event, value: cell }) {\r\n if (this._rangeStrategy) {\r\n // We can assume that this will be a range, because preview\r\n // events aren't fired for single date selections.\r\n const value = cell ? cell.rawValue : null;\r\n const previewRange = this._rangeStrategy.createPreview(value, this.selected, event);\r\n this._previewStart = this._getCellCompareValue(previewRange.start);\r\n this._previewEnd = this._getCellCompareValue(previewRange.end);\r\n // Note that here we need to use `detectChanges`, rather than `markForCheck`, because\r\n // the way `_focusActiveCell` is set up at the moment makes it fire at the wrong time\r\n // when navigating one month back using the keyboard which will cause this handler\r\n // to throw a \"changed after checked\" error when updating the preview state.\r\n this._changeDetectorRef.detectChanges();\r\n }\r\n }\r\n /** Initializes the weekdays. */\r\n _initWeekdays() {\r\n const firstDayOfWeek = this._dateAdapter.getFirstDayOfWeek();\r\n const narrowWeekdays = this._dateAdapter.getDayOfWeekNames('narrow');\r\n const longWeekdays = this._dateAdapter.getDayOfWeekNames('long');\r\n // Rotate the labels for days of the week based on the configured first day of the week.\r\n let weekdays = longWeekdays.map((long, i) => {\r\n return { long, narrow: narrowWeekdays[i] };\r\n });\r\n this._weekdays = weekdays.slice(firstDayOfWeek).concat(weekdays.slice(0, firstDayOfWeek));\r\n }\r\n /** Creates MatCalendarCells for the dates in this month. */\r\n _createWeekCells() {\r\n const daysInMonth = this._dateAdapter.getNumDaysInMonth(this.activeDate);\r\n const dateNames = this._dateAdapter.getDateNames();\r\n this._weeks = [[]];\r\n for (let i = 0, cell = this._firstWeekOffset; i < daysInMonth; i++, cell++) {\r\n if (cell == DAYS_PER_WEEK) {\r\n this._weeks.push([]);\r\n cell = 0;\r\n }\r\n const date = this._dateAdapter.createDate(this._dateAdapter.getYear(this.activeDate), this._dateAdapter.getMonth(this.activeDate), i + 1);\r\n const enabled = this._shouldEnableDate(date);\r\n const ariaLabel = this._dateAdapter.format(date, this._dateFormats.display.dateA11yLabel);\r\n const cellClasses = this.dateClass ? this.dateClass(date) : undefined;\r\n this._weeks[this._weeks.length - 1].push(new NgxMatCalendarCell(i + 1, dateNames[i], ariaLabel, enabled, cellClasses, this._getCellCompareValue(date), date));\r\n }\r\n }\r\n /** Date filter for the month */\r\n _shouldEnableDate(date) {\r\n return !!date &&\r\n (!this.minDate || this._dateAdapter.compareDate(date, this.minDate) >= 0) &&\r\n (!this.maxDate || this._dateAdapter.compareDate(date, this.maxDate) <= 0) &&\r\n (!this.dateFilter || this.dateFilter(date));\r\n }\r\n /**\r\n * Gets the date in this month that the given Date falls on.\r\n * Returns null if the given Date is in another month.\r\n */\r\n _getDateInCurrentMonth(date) {\r\n return date && this._hasSameMonthAndYear(date, this.activeDate) ?\r\n this._dateAdapter.getDate(date) : null;\r\n }\r\n /** Checks whether the 2 dates are non-null and fall within the same month of the same year. */\r\n _hasSameMonthAndYear(d1, d2) {\r\n return !!(d1 && d2 && this._dateAdapter.getMonth(d1) == this._dateAdapter.getMonth(d2) &&\r\n this._dateAdapter.getYear(d1) == this._dateAdapter.getYear(d2));\r\n }\r\n /** Gets the value that will be used to one cell to another. */\r\n _getCellCompareValue(date) {\r\n if (date) {\r\n // We use the time since the Unix epoch to compare dates in this view, rather than the\r\n // cell values, because we need to support ranges that span across multiple months/years.\r\n const year = this._dateAdapter.getYear(date);\r\n const month = this._dateAdapter.getMonth(date);\r\n const day = this._dateAdapter.getDate(date);\r\n return new Date(year, month, day).getTime();\r\n }\r\n return null;\r\n }\r\n /**\r\n * @param obj The object to check.\r\n * @returns The given object if it is both a date instance and valid, otherwise null.\r\n */\r\n _getValidDateOrNull(obj) {\r\n return (this._dateAdapter.isDateInstance(obj) && this._dateAdapter.isValid(obj)) ? obj : null;\r\n }\r\n /** Determines whether the user has the RTL layout direction. */\r\n _isRtl() {\r\n return this._dir && this._dir.value === 'rtl';\r\n }\r\n /** Sets the current range based on a model value. */\r\n _setRanges(selectedValue) {\r\n if (selectedValue instanceof DateRange) {\r\n this._rangeStart = this._getCellCompareValue(selectedValue.start);\r\n this._rangeEnd = this._getCellCompareValue(selectedValue.end);\r\n this._isRange = true;\r\n }\r\n else {\r\n this._rangeStart = this._rangeEnd = this._getCellCompareValue(selectedValue);\r\n this._isRange = false;\r\n }\r\n this._comparisonRangeStart = this._getCellCompareValue(this.comparisonStart);\r\n this._comparisonRangeEnd = this._getCellCompareValue(this.comparisonEnd);\r\n }\r\n}\nNgxMatMonthView.ɵfac = function NgxMatMonthView_Factory(t) { return new (t || NgxMatMonthView)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ChangeDetectorRef), ɵngcc0.ɵɵdirectiveInject(NGX_MAT_DATE_FORMATS, 8), ɵngcc0.ɵɵdirectiveInject(NgxMatDateAdapter, 8), ɵngcc0.ɵɵdirectiveInject(ɵngcc2.Directionality, 8), ɵngcc0.ɵɵdirectiveInject(NGX_MAT_DATE_RANGE_SELECTION_STRATEGY, 8)); };\nNgxMatMonthView.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: NgxMatMonthView, selectors: [[\"ngx-mat-month-view\"]], viewQuery: function NgxMatMonthView_Query(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵviewQuery(NgxMatCalendarBody, 5);\n } if (rf & 2) {\n let _t;\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._matCalendarBody = _t.first);\n } }, inputs: { activeDate: \"activeDate\", selected: \"selected\", minDate: \"minDate\", maxDate: \"maxDate\", dateFilter: \"dateFilter\", dateClass: \"dateClass\", comparisonStart: \"comparisonStart\", comparisonEnd: \"comparisonEnd\" }, outputs: { selectedChange: \"selectedChange\", _userSelection: \"_userSelection\", activeDateChange: \"activeDateChange\" }, exportAs: [\"ngxMatMonthView\"], decls: 7, vars: 13, consts: [[\"role\", \"presentation\", 1, \"mat-calendar-table\"], [1, \"mat-calendar-table-header\"], [\"scope\", \"col\", 4, \"ngFor\", \"ngForOf\"], [\"colspan\", \"7\", \"aria-hidden\", \"true\", 1, \"mat-calendar-table-header-divider\"], [\"ngx-mat-calendar-body\", \"\", 3, \"label\", \"rows\", \"todayValue\", \"startValue\", \"endValue\", \"comparisonStart\", \"comparisonEnd\", \"previewStart\", \"previewEnd\", \"isRange\", \"labelMinRequiredCells\", \"activeCell\", \"selectedValueChange\", \"previewChange\", \"keydown\"], [\"scope\", \"col\"]], template: function NgxMatMonthView_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementStart(0, \"table\", 0);\n ɵngcc0.ɵɵelementStart(1, \"thead\", 1);\n ɵngcc0.ɵɵelementStart(2, \"tr\");\n ɵngcc0.ɵɵtemplate(3, NgxMatMonthView_th_3_Template, 2, 2, \"th\", 2);\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelementStart(4, \"tr\");\n ɵngcc0.ɵɵelement(5, \"th\", 3);\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelementStart(6, \"tbody\", 4);\n ɵngcc0.ɵɵlistener(\"selectedValueChange\", function NgxMatMonthView_Template_tbody_selectedValueChange_6_listener($event) { return ctx._dateSelected($event); })(\"previewChange\", function NgxMatMonthView_Template_tbody_previewChange_6_listener($event) { return ctx._previewChanged($event); })(\"keydown\", function NgxMatMonthView_Template_tbody_keydown_6_listener($event) { return ctx._handleCalendarBodyKeydown($event); });\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelementEnd();\n } if (rf & 2) {\n ɵngcc0.ɵɵadvance(3);\n ɵngcc0.ɵɵproperty(\"ngForOf\", ctx._weekdays);\n ɵngcc0.ɵɵadvance(3);\n ɵngcc0.ɵɵproperty(\"label\", ctx._monthLabel)(\"rows\", ctx._weeks)(\"todayValue\", ctx._todayDate)(\"startValue\", ctx._rangeStart)(\"endValue\", ctx._rangeEnd)(\"comparisonStart\", ctx._comparisonRangeStart)(\"comparisonEnd\", ctx._comparisonRangeEnd)(\"previewStart\", ctx._previewStart)(\"previewEnd\", ctx._previewEnd)(\"isRange\", ctx._isRange)(\"labelMinRequiredCells\", 3)(\"activeCell\", ctx._dateAdapter.getDate(ctx.activeDate) - 1);\n } }, directives: [ɵngcc1.NgForOf, NgxMatCalendarBody], encapsulation: 2, changeDetection: 0 });\r\n/** @nocollapse */\r\nNgxMatMonthView.ctorParameters = () => [\r\n { type: ChangeDetectorRef },\r\n { type: undefined, decorators: [{ type: Optional }, { type: Inject, args: [NGX_MAT_DATE_FORMATS,] }] },\r\n { type: NgxMatDateAdapter, decorators: [{ type: Optional }] },\r\n { type: Directionality, decorators: [{ type: Optional }] },\r\n { type: undefined, decorators: [{ type: Inject, args: [NGX_MAT_DATE_RANGE_SELECTION_STRATEGY,] }, { type: Optional }] }\r\n];\r\nNgxMatMonthView.propDecorators = {\r\n activeDate: [{ type: Input }],\r\n selected: [{ type: Input }],\r\n minDate: [{ type: Input }],\r\n maxDate: [{ type: Input }],\r\n dateFilter: [{ type: Input }],\r\n dateClass: [{ type: Input }],\r\n comparisonStart: [{ type: Input }],\r\n comparisonEnd: [{ type: Input }],\r\n selectedChange: [{ type: Output }],\r\n _userSelection: [{ type: Output }],\r\n activeDateChange: [{ type: Output }],\r\n _matCalendarBody: [{ type: ViewChild, args: [NgxMatCalendarBody,] }]\r\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgxMatMonthView, [{\n type: Component,\n args: [{\n selector: 'ngx-mat-month-view',\n template: \"
\\r\\n \\r\\n
\\r\\n
{{day.narrow}}
\\r\\n
\\r\\n
\\r\\n \\r\\n \\r\\n \\r\\n
\\r\\n\",\n exportAs: 'ngxMatMonthView',\n encapsulation: ViewEncapsulation.None,\n changeDetection: ChangeDetectionStrategy.OnPush\n }]\n }], function () { return [{ type: ɵngcc0.ChangeDetectorRef }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [NGX_MAT_DATE_FORMATS]\n }] }, { type: NgxMatDateAdapter, decorators: [{\n type: Optional\n }] }, { type: ɵngcc2.Directionality, decorators: [{\n type: Optional\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [NGX_MAT_DATE_RANGE_SELECTION_STRATEGY]\n }, {\n type: Optional\n }] }]; }, { selectedChange: [{\n type: Output\n }], _userSelection: [{\n type: Output\n }], activeDateChange: [{\n type: Output\n }], activeDate: [{\n type: Input\n }], selected: [{\n type: Input\n }], minDate: [{\n type: Input\n }], maxDate: [{\n type: Input\n }], dateFilter: [{\n type: Input\n }], dateClass: [{\n type: Input\n }], comparisonStart: [{\n type: Input\n }], comparisonEnd: [{\n type: Input\n }], _matCalendarBody: [{\n type: ViewChild,\n args: [NgxMatCalendarBody]\n }] }); })();\n\n/**\r\n * @license\r\n * Copyright Google LLC All Rights Reserved.\r\n *\r\n * Use of this source code is governed by an MIT-style license that can be\r\n * found in the LICENSE file at https://angular.io/license\r\n */\r\nconst yearsPerPage = 24;\r\nconst yearsPerRow = 4;\r\n/**\r\n * An internal component used to display a year selector in the datepicker.\r\n * @docs-private\r\n */\r\nclass NgxMatMultiYearView {\r\n constructor(_changeDetectorRef, _dateAdapter, _dir) {\r\n this._changeDetectorRef = _changeDetectorRef;\r\n this._dateAdapter = _dateAdapter;\r\n this._dir = _dir;\r\n this._rerenderSubscription = Subscription.EMPTY;\r\n /** Emits when a new year is selected. */\r\n this.selectedChange = new EventEmitter();\r\n /** Emits the selected year. This doesn't imply a change on the selected date */\r\n this.yearSelected = new EventEmitter();\r\n /** Emits when any date is activated. */\r\n this.activeDateChange = new EventEmitter();\r\n if (!this._dateAdapter) {\r\n throw createMissingDateImplError('NgxMatDateAdapter');\r\n }\r\n this._activeDate = this._dateAdapter.today();\r\n }\r\n /** The date to display in this multi-year view (everything other than the year is ignored). */\r\n get activeDate() { return this._activeDate; }\r\n set activeDate(value) {\r\n let oldActiveDate = this._activeDate;\r\n const validDate = this._getValidDateOrNull(this._dateAdapter.deserialize(value)) || this._dateAdapter.today();\r\n this._activeDate = this._dateAdapter.clampDate(validDate, this.minDate, this.maxDate);\r\n if (!isSameMultiYearView(this._dateAdapter, oldActiveDate, this._activeDate, this.minDate, this.maxDate)) {\r\n this._init();\r\n }\r\n }\r\n /** The currently selected date. */\r\n get selected() { return this._selected; }\r\n set selected(value) {\r\n if (value instanceof DateRange) {\r\n this._selected = value;\r\n }\r\n else {\r\n this._selected = this._getValidDateOrNull(this._dateAdapter.deserialize(value));\r\n }\r\n this._setSelectedYear(value);\r\n }\r\n /** The minimum selectable date. */\r\n get minDate() { return this._minDate; }\r\n set minDate(value) {\r\n this._minDate = this._getValidDateOrNull(this._dateAdapter.deserialize(value));\r\n }\r\n /** The maximum selectable date. */\r\n get maxDate() { return this._maxDate; }\r\n set maxDate(value) {\r\n this._maxDate = this._getValidDateOrNull(this._dateAdapter.deserialize(value));\r\n }\r\n ngAfterContentInit() {\r\n this._rerenderSubscription = this._dateAdapter.localeChanges\r\n .pipe(startWith(null))\r\n .subscribe(() => this._init());\r\n }\r\n ngOnDestroy() {\r\n this._rerenderSubscription.unsubscribe();\r\n }\r\n /** Initializes this multi-year view. */\r\n _init() {\r\n this._todayYear = this._dateAdapter.getYear(this._dateAdapter.today());\r\n // We want a range years such that we maximize the number of\r\n // enabled dates visible at once. This prevents issues where the minimum year\r\n // is the last item of a page OR the maximum year is the first item of a page.\r\n // The offset from the active year to the \"slot\" for the starting year is the\r\n // *actual* first rendered year in the multi-year view.\r\n const activeYear = this._dateAdapter.getYear(this._activeDate);\r\n const minYearOfPage = activeYear - getActiveOffset(this._dateAdapter, this.activeDate, this.minDate, this.maxDate);\r\n this._years = [];\r\n for (let i = 0, row = []; i < yearsPerPage; i++) {\r\n row.push(minYearOfPage + i);\r\n if (row.length == yearsPerRow) {\r\n this._years.push(row.map(year => this._createCellForYear(year)));\r\n row = [];\r\n }\r\n }\r\n this._changeDetectorRef.markForCheck();\r\n }\r\n /** Handles when a new year is selected. */\r\n _yearSelected(event) {\r\n const year = event.value;\r\n this.yearSelected.emit(this._dateAdapter.createDate(year, 0, 1));\r\n let month = this._dateAdapter.getMonth(this.activeDate);\r\n let daysInMonth = this._dateAdapter.getNumDaysInMonth(this._dateAdapter.createDate(year, month, 1));\r\n this.selectedChange.emit(this._dateAdapter.createDate(year, month, Math.min(this._dateAdapter.getDate(this.activeDate), daysInMonth)));\r\n }\r\n /** Handles keydown events on the calendar body when calendar is in multi-year view. */\r\n _handleCalendarBodyKeydown(event) {\r\n const oldActiveDate = this._activeDate;\r\n const isRtl = this._isRtl();\r\n switch (event.keyCode) {\r\n case LEFT_ARROW:\r\n this.activeDate = this._dateAdapter.addCalendarYears(this._activeDate, isRtl ? 1 : -1);\r\n break;\r\n case RIGHT_ARROW:\r\n this.activeDate = this._dateAdapter.addCalendarYears(this._activeDate, isRtl ? -1 : 1);\r\n break;\r\n case UP_ARROW:\r\n this.activeDate = this._dateAdapter.addCalendarYears(this._activeDate, -yearsPerRow);\r\n break;\r\n case DOWN_ARROW:\r\n this.activeDate = this._dateAdapter.addCalendarYears(this._activeDate, yearsPerRow);\r\n break;\r\n case HOME:\r\n this.activeDate = this._dateAdapter.addCalendarYears(this._activeDate, -getActiveOffset(this._dateAdapter, this.activeDate, this.minDate, this.maxDate));\r\n break;\r\n case END:\r\n this.activeDate = this._dateAdapter.addCalendarYears(this._activeDate, yearsPerPage - getActiveOffset(this._dateAdapter, this.activeDate, this.minDate, this.maxDate) - 1);\r\n break;\r\n case PAGE_UP:\r\n this.activeDate =\r\n this._dateAdapter.addCalendarYears(this._activeDate, event.altKey ? -yearsPerPage * 10 : -yearsPerPage);\r\n break;\r\n case PAGE_DOWN:\r\n this.activeDate =\r\n this._dateAdapter.addCalendarYears(this._activeDate, event.altKey ? yearsPerPage * 10 : yearsPerPage);\r\n break;\r\n case ENTER:\r\n case SPACE:\r\n this._yearSelected({ value: this._dateAdapter.getYear(this._activeDate), event });\r\n break;\r\n default:\r\n // Don't prevent default or focus active cell on keys that we don't explicitly handle.\r\n return;\r\n }\r\n if (this._dateAdapter.compareDate(oldActiveDate, this.activeDate)) {\r\n this.activeDateChange.emit(this.activeDate);\r\n }\r\n this._focusActiveCell();\r\n // Prevent unexpected default actions such as form submission.\r\n event.preventDefault();\r\n }\r\n _getActiveCell() {\r\n return getActiveOffset(this._dateAdapter, this.activeDate, this.minDate, this.maxDate);\r\n }\r\n /** Focuses the active cell after the microtask queue is empty. */\r\n _focusActiveCell() {\r\n this._matCalendarBody._focusActiveCell();\r\n }\r\n /** Creates an MatCalendarCell for the given year. */\r\n _createCellForYear(year) {\r\n let yearName = this._dateAdapter.getYearName(this._dateAdapter.createDate(year, 0, 1));\r\n return new NgxMatCalendarCell(year, yearName, yearName, this._shouldEnableYear(year));\r\n }\r\n /** Whether the given year is enabled. */\r\n _shouldEnableYear(year) {\r\n // disable if the year is greater than maxDate lower than minDate\r\n if (year === undefined || year === null ||\r\n (this.maxDate && year > this._dateAdapter.getYear(this.maxDate)) ||\r\n (this.minDate && year < this._dateAdapter.getYear(this.minDate))) {\r\n return false;\r\n }\r\n // enable if it reaches here and there's no filter defined\r\n if (!this.dateFilter) {\r\n return true;\r\n }\r\n const firstOfYear = this._dateAdapter.createDate(year, 0, 1);\r\n // If any date in the year is enabled count the year as enabled.\r\n for (let date = firstOfYear; this._dateAdapter.getYear(date) == year; date = this._dateAdapter.addCalendarDays(date, 1)) {\r\n if (this.dateFilter(date)) {\r\n return true;\r\n }\r\n }\r\n return false;\r\n }\r\n /**\r\n * @param obj The object to check.\r\n * @returns The given object if it is both a date instance and valid, otherwise null.\r\n */\r\n _getValidDateOrNull(obj) {\r\n return (this._dateAdapter.isDateInstance(obj) && this._dateAdapter.isValid(obj)) ? obj : null;\r\n }\r\n /** Determines whether the user has the RTL layout direction. */\r\n _isRtl() {\r\n return this._dir && this._dir.value === 'rtl';\r\n }\r\n /** Sets the currently-highlighted year based on a model value. */\r\n _setSelectedYear(value) {\r\n this._selectedYear = null;\r\n if (value instanceof DateRange) {\r\n const displayValue = value.start || value.end;\r\n if (displayValue) {\r\n this._selectedYear = this._dateAdapter.getYear(displayValue);\r\n }\r\n }\r\n else if (value) {\r\n this._selectedYear = this._dateAdapter.getYear(value);\r\n }\r\n }\r\n}\nNgxMatMultiYearView.ɵfac = function NgxMatMultiYearView_Factory(t) { return new (t || NgxMatMultiYearView)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ChangeDetectorRef), ɵngcc0.ɵɵdirectiveInject(NgxMatDateAdapter, 8), ɵngcc0.ɵɵdirectiveInject(ɵngcc2.Directionality, 8)); };\nNgxMatMultiYearView.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: NgxMatMultiYearView, selectors: [[\"ngx-mat-multi-year-view\"]], viewQuery: function NgxMatMultiYearView_Query(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵviewQuery(NgxMatCalendarBody, 5);\n } if (rf & 2) {\n let _t;\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._matCalendarBody = _t.first);\n } }, inputs: { activeDate: \"activeDate\", selected: \"selected\", minDate: \"minDate\", maxDate: \"maxDate\", dateFilter: \"dateFilter\" }, outputs: { selectedChange: \"selectedChange\", yearSelected: \"yearSelected\", activeDateChange: \"activeDateChange\" }, exportAs: [\"ngxMatMultiYearView\"], decls: 5, vars: 7, consts: [[\"role\", \"presentation\", 1, \"mat-calendar-table\"], [1, \"mat-calendar-table-header\"], [\"colspan\", \"4\", 1, \"mat-calendar-table-header-divider\"], [\"ngx-mat-calendar-body\", \"\", 3, \"rows\", \"todayValue\", \"startValue\", \"endValue\", \"numCols\", \"cellAspectRatio\", \"activeCell\", \"selectedValueChange\", \"keydown\"]], template: function NgxMatMultiYearView_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementStart(0, \"table\", 0);\n ɵngcc0.ɵɵelementStart(1, \"thead\", 1);\n ɵngcc0.ɵɵelementStart(2, \"tr\");\n ɵngcc0.ɵɵelement(3, \"th\", 2);\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelementStart(4, \"tbody\", 3);\n ɵngcc0.ɵɵlistener(\"selectedValueChange\", function NgxMatMultiYearView_Template_tbody_selectedValueChange_4_listener($event) { return ctx._yearSelected($event); })(\"keydown\", function NgxMatMultiYearView_Template_tbody_keydown_4_listener($event) { return ctx._handleCalendarBodyKeydown($event); });\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelementEnd();\n } if (rf & 2) {\n ɵngcc0.ɵɵadvance(4);\n ɵngcc0.ɵɵproperty(\"rows\", ctx._years)(\"todayValue\", ctx._todayYear)(\"startValue\", ctx._selectedYear)(\"endValue\", ctx._selectedYear)(\"numCols\", 4)(\"cellAspectRatio\", 4 / 7)(\"activeCell\", ctx._getActiveCell());\n } }, directives: [NgxMatCalendarBody], encapsulation: 2, changeDetection: 0 });\r\n/** @nocollapse */\r\nNgxMatMultiYearView.ctorParameters = () => [\r\n { type: ChangeDetectorRef },\r\n { type: NgxMatDateAdapter, decorators: [{ type: Optional }] },\r\n { type: Directionality, decorators: [{ type: Optional }] }\r\n];\r\nNgxMatMultiYearView.propDecorators = {\r\n activeDate: [{ type: Input }],\r\n selected: [{ type: Input }],\r\n minDate: [{ type: Input }],\r\n maxDate: [{ type: Input }],\r\n dateFilter: [{ type: Input }],\r\n selectedChange: [{ type: Output }],\r\n yearSelected: [{ type: Output }],\r\n activeDateChange: [{ type: Output }],\r\n _matCalendarBody: [{ type: ViewChild, args: [NgxMatCalendarBody,] }]\r\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgxMatMultiYearView, [{\n type: Component,\n args: [{\n selector: 'ngx-mat-multi-year-view',\n template: \"
\\r\\n \\r\\n
\\r\\n \\r\\n \\r\\n \\r\\n
\\r\\n\\r\\n\",\n exportAs: 'ngxMatMultiYearView',\n encapsulation: ViewEncapsulation.None,\n changeDetection: ChangeDetectionStrategy.OnPush\n }]\n }], function () { return [{ type: ɵngcc0.ChangeDetectorRef }, { type: NgxMatDateAdapter, decorators: [{\n type: Optional\n }] }, { type: ɵngcc2.Directionality, decorators: [{\n type: Optional\n }] }]; }, { selectedChange: [{\n type: Output\n }], yearSelected: [{\n type: Output\n }], activeDateChange: [{\n type: Output\n }], activeDate: [{\n type: Input\n }], selected: [{\n type: Input\n }], minDate: [{\n type: Input\n }], maxDate: [{\n type: Input\n }], dateFilter: [{\n type: Input\n }], _matCalendarBody: [{\n type: ViewChild,\n args: [NgxMatCalendarBody]\n }] }); })();\r\nfunction isSameMultiYearView(dateAdapter, date1, date2, minDate, maxDate) {\r\n const year1 = dateAdapter.getYear(date1);\r\n const year2 = dateAdapter.getYear(date2);\r\n const startingYear = getStartingYear(dateAdapter, minDate, maxDate);\r\n return Math.floor((year1 - startingYear) / yearsPerPage) ===\r\n Math.floor((year2 - startingYear) / yearsPerPage);\r\n}\r\n/**\r\n * When the multi-year view is first opened, the active year will be in view.\r\n * So we compute how many years are between the active year and the *slot* where our\r\n * \"startingYear\" will render when paged into view.\r\n */\r\nfunction getActiveOffset(dateAdapter, activeDate, minDate, maxDate) {\r\n const activeYear = dateAdapter.getYear(activeDate);\r\n return euclideanModulo((activeYear - getStartingYear(dateAdapter, minDate, maxDate)), yearsPerPage);\r\n}\r\n/**\r\n * We pick a \"starting\" year such that either the maximum year would be at the end\r\n * or the minimum year would be at the beginning of a page.\r\n */\r\nfunction getStartingYear(dateAdapter, minDate, maxDate) {\r\n let startingYear = 0;\r\n if (maxDate) {\r\n const maxYear = dateAdapter.getYear(maxDate);\r\n startingYear = maxYear - yearsPerPage + 1;\r\n }\r\n else if (minDate) {\r\n startingYear = dateAdapter.getYear(minDate);\r\n }\r\n return startingYear;\r\n}\r\n/** Gets remainder that is non-negative, even if first number is negative */\r\nfunction euclideanModulo(a, b) {\r\n return (a % b + b) % b;\r\n}\n\n/**\r\n * @license\r\n * Copyright Google LLC All Rights Reserved.\r\n *\r\n * Use of this source code is governed by an MIT-style license that can be\r\n * found in the LICENSE file at https://angular.io/license\r\n */\r\n/**\r\n * An internal component used to display a single year in the datepicker.\r\n * @docs-private\r\n */\r\nclass NgxMatYearView {\r\n constructor(_changeDetectorRef, _dateFormats, _dateAdapter, _dir) {\r\n this._changeDetectorRef = _changeDetectorRef;\r\n this._dateFormats = _dateFormats;\r\n this._dateAdapter = _dateAdapter;\r\n this._dir = _dir;\r\n this._rerenderSubscription = Subscription.EMPTY;\r\n /** Emits when a new month is selected. */\r\n this.selectedChange = new EventEmitter();\r\n /** Emits the selected month. This doesn't imply a change on the selected date */\r\n this.monthSelected = new EventEmitter();\r\n /** Emits when any date is activated. */\r\n this.activeDateChange = new EventEmitter();\r\n if (!this._dateAdapter) {\r\n throw createMissingDateImplError('NgxMatDateAdapter');\r\n }\r\n if (!this._dateFormats) {\r\n throw createMissingDateImplError('NGX_MAT_DATE_FORMATS');\r\n }\r\n this._activeDate = this._dateAdapter.today();\r\n }\r\n /** The date to display in this year view (everything other than the year is ignored). */\r\n get activeDate() { return this._activeDate; }\r\n set activeDate(value) {\r\n let oldActiveDate = this._activeDate;\r\n const validDate = this._getValidDateOrNull(this._dateAdapter.deserialize(value)) || this._dateAdapter.today();\r\n this._activeDate = this._dateAdapter.clampDate(validDate, this.minDate, this.maxDate);\r\n if (this._dateAdapter.getYear(oldActiveDate) !== this._dateAdapter.getYear(this._activeDate)) {\r\n this._init();\r\n }\r\n }\r\n /** The currently selected date. */\r\n get selected() { return this._selected; }\r\n set selected(value) {\r\n if (value instanceof DateRange) {\r\n this._selected = value;\r\n }\r\n else {\r\n this._selected = this._getValidDateOrNull(this._dateAdapter.deserialize(value));\r\n }\r\n this._setSelectedMonth(value);\r\n }\r\n /** The minimum selectable date. */\r\n get minDate() { return this._minDate; }\r\n set minDate(value) {\r\n this._minDate = this._getValidDateOrNull(this._dateAdapter.deserialize(value));\r\n }\r\n /** The maximum selectable date. */\r\n get maxDate() { return this._maxDate; }\r\n set maxDate(value) {\r\n this._maxDate = this._getValidDateOrNull(this._dateAdapter.deserialize(value));\r\n }\r\n ngAfterContentInit() {\r\n this._rerenderSubscription = this._dateAdapter.localeChanges\r\n .pipe(startWith(null))\r\n .subscribe(() => this._init());\r\n }\r\n ngOnDestroy() {\r\n this._rerenderSubscription.unsubscribe();\r\n }\r\n /** Handles when a new month is selected. */\r\n _monthSelected(event) {\r\n const month = event.value;\r\n const normalizedDate = this._dateAdapter.createDate(this._dateAdapter.getYear(this.activeDate), month, 1);\r\n this.monthSelected.emit(normalizedDate);\r\n const daysInMonth = this._dateAdapter.getNumDaysInMonth(normalizedDate);\r\n this.selectedChange.emit(this._dateAdapter.createDate(this._dateAdapter.getYear(this.activeDate), month, Math.min(this._dateAdapter.getDate(this.activeDate), daysInMonth)));\r\n }\r\n /** Handles keydown events on the calendar body when calendar is in year view. */\r\n _handleCalendarBodyKeydown(event) {\r\n // TODO(mmalerba): We currently allow keyboard navigation to disabled dates, but just prevent\r\n // disabled ones from being selected. This may not be ideal, we should look into whether\r\n // navigation should skip over disabled dates, and if so, how to implement that efficiently.\r\n const oldActiveDate = this._activeDate;\r\n const isRtl = this._isRtl();\r\n switch (event.keyCode) {\r\n case LEFT_ARROW:\r\n this.activeDate = this._dateAdapter.addCalendarMonths(this._activeDate, isRtl ? 1 : -1);\r\n break;\r\n case RIGHT_ARROW:\r\n this.activeDate = this._dateAdapter.addCalendarMonths(this._activeDate, isRtl ? -1 : 1);\r\n break;\r\n case UP_ARROW:\r\n this.activeDate = this._dateAdapter.addCalendarMonths(this._activeDate, -4);\r\n break;\r\n case DOWN_ARROW:\r\n this.activeDate = this._dateAdapter.addCalendarMonths(this._activeDate, 4);\r\n break;\r\n case HOME:\r\n this.activeDate = this._dateAdapter.addCalendarMonths(this._activeDate, -this._dateAdapter.getMonth(this._activeDate));\r\n break;\r\n case END:\r\n this.activeDate = this._dateAdapter.addCalendarMonths(this._activeDate, 11 - this._dateAdapter.getMonth(this._activeDate));\r\n break;\r\n case PAGE_UP:\r\n this.activeDate =\r\n this._dateAdapter.addCalendarYears(this._activeDate, event.altKey ? -10 : -1);\r\n break;\r\n case PAGE_DOWN:\r\n this.activeDate =\r\n this._dateAdapter.addCalendarYears(this._activeDate, event.altKey ? 10 : 1);\r\n break;\r\n case ENTER:\r\n case SPACE:\r\n this._monthSelected({ value: this._dateAdapter.getMonth(this._activeDate), event });\r\n break;\r\n default:\r\n // Don't prevent default or focus active cell on keys that we don't explicitly handle.\r\n return;\r\n }\r\n if (this._dateAdapter.compareDate(oldActiveDate, this.activeDate)) {\r\n this.activeDateChange.emit(this.activeDate);\r\n }\r\n this._focusActiveCell();\r\n // Prevent unexpected default actions such as form submission.\r\n event.preventDefault();\r\n }\r\n /** Initializes this year view. */\r\n _init() {\r\n this._setSelectedMonth(this.selected);\r\n this._todayMonth = this._getMonthInCurrentYear(this._dateAdapter.today());\r\n this._yearLabel = this._dateAdapter.getYearName(this.activeDate);\r\n let monthNames = this._dateAdapter.getMonthNames('short');\r\n // First row of months only contains 5 elements so we can fit the year label on the same row.\r\n this._months = [[0, 1, 2, 3], [4, 5, 6, 7], [8, 9, 10, 11]].map(row => row.map(month => this._createCellForMonth(month, monthNames[month])));\r\n this._changeDetectorRef.markForCheck();\r\n }\r\n /** Focuses the active cell after the microtask queue is empty. */\r\n _focusActiveCell() {\r\n this._matCalendarBody._focusActiveCell();\r\n }\r\n /**\r\n * Gets the month in this year that the given Date falls on.\r\n * Returns null if the given Date is in another year.\r\n */\r\n _getMonthInCurrentYear(date) {\r\n return date && this._dateAdapter.getYear(date) == this._dateAdapter.getYear(this.activeDate) ?\r\n this._dateAdapter.getMonth(date) : null;\r\n }\r\n /** Creates an MatCalendarCell for the given month. */\r\n _createCellForMonth(month, monthName) {\r\n let ariaLabel = this._dateAdapter.format(this._dateAdapter.createDate(this._dateAdapter.getYear(this.activeDate), month, 1), this._dateFormats.display.monthYearA11yLabel);\r\n return new NgxMatCalendarCell(month, monthName.toLocaleUpperCase(), ariaLabel, this._shouldEnableMonth(month));\r\n }\r\n /** Whether the given month is enabled. */\r\n _shouldEnableMonth(month) {\r\n const activeYear = this._dateAdapter.getYear(this.activeDate);\r\n if (month === undefined || month === null ||\r\n this._isYearAndMonthAfterMaxDate(activeYear, month) ||\r\n this._isYearAndMonthBeforeMinDate(activeYear, month)) {\r\n return false;\r\n }\r\n if (!this.dateFilter) {\r\n return true;\r\n }\r\n const firstOfMonth = this._dateAdapter.createDate(activeYear, month, 1);\r\n // If any date in the month is enabled count the month as enabled.\r\n for (let date = firstOfMonth; this._dateAdapter.getMonth(date) == month; date = this._dateAdapter.addCalendarDays(date, 1)) {\r\n if (this.dateFilter(date)) {\r\n return true;\r\n }\r\n }\r\n return false;\r\n }\r\n /**\r\n * Tests whether the combination month/year is after this.maxDate, considering\r\n * just the month and year of this.maxDate\r\n */\r\n _isYearAndMonthAfterMaxDate(year, month) {\r\n if (this.maxDate) {\r\n const maxYear = this._dateAdapter.getYear(this.maxDate);\r\n const maxMonth = this._dateAdapter.getMonth(this.maxDate);\r\n return year > maxYear || (year === maxYear && month > maxMonth);\r\n }\r\n return false;\r\n }\r\n /**\r\n * Tests whether the combination month/year is before this.minDate, considering\r\n * just the month and year of this.minDate\r\n */\r\n _isYearAndMonthBeforeMinDate(year, month) {\r\n if (this.minDate) {\r\n const minYear = this._dateAdapter.getYear(this.minDate);\r\n const minMonth = this._dateAdapter.getMonth(this.minDate);\r\n return year < minYear || (year === minYear && month < minMonth);\r\n }\r\n return false;\r\n }\r\n /**\r\n * @param obj The object to check.\r\n * @returns The given object if it is both a date instance and valid, otherwise null.\r\n */\r\n _getValidDateOrNull(obj) {\r\n return (this._dateAdapter.isDateInstance(obj) && this._dateAdapter.isValid(obj)) ? obj : null;\r\n }\r\n /** Determines whether the user has the RTL layout direction. */\r\n _isRtl() {\r\n return this._dir && this._dir.value === 'rtl';\r\n }\r\n /** Sets the currently-selected month based on a model value. */\r\n _setSelectedMonth(value) {\r\n if (value instanceof DateRange) {\r\n this._selectedMonth = this._getMonthInCurrentYear(value.start) ||\r\n this._getMonthInCurrentYear(value.end);\r\n }\r\n else {\r\n this._selectedMonth = this._getMonthInCurrentYear(value);\r\n }\r\n }\r\n}\nNgxMatYearView.ɵfac = function NgxMatYearView_Factory(t) { return new (t || NgxMatYearView)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ChangeDetectorRef), ɵngcc0.ɵɵdirectiveInject(NGX_MAT_DATE_FORMATS, 8), ɵngcc0.ɵɵdirectiveInject(NgxMatDateAdapter, 8), ɵngcc0.ɵɵdirectiveInject(ɵngcc2.Directionality, 8)); };\nNgxMatYearView.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: NgxMatYearView, selectors: [[\"ngx-mat-year-view\"]], viewQuery: function NgxMatYearView_Query(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵviewQuery(NgxMatCalendarBody, 5);\n } if (rf & 2) {\n let _t;\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._matCalendarBody = _t.first);\n } }, inputs: { activeDate: \"activeDate\", selected: \"selected\", minDate: \"minDate\", maxDate: \"maxDate\", dateFilter: \"dateFilter\" }, outputs: { selectedChange: \"selectedChange\", monthSelected: \"monthSelected\", activeDateChange: \"activeDateChange\" }, exportAs: [\"ngxMatYearView\"], decls: 5, vars: 9, consts: [[\"role\", \"presentation\", 1, \"mat-calendar-table\"], [1, \"mat-calendar-table-header\"], [\"colspan\", \"4\", 1, \"mat-calendar-table-header-divider\"], [\"ngx-mat-calendar-body\", \"\", 3, \"label\", \"rows\", \"todayValue\", \"startValue\", \"endValue\", \"labelMinRequiredCells\", \"numCols\", \"cellAspectRatio\", \"activeCell\", \"selectedValueChange\", \"keydown\"]], template: function NgxMatYearView_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementStart(0, \"table\", 0);\n ɵngcc0.ɵɵelementStart(1, \"thead\", 1);\n ɵngcc0.ɵɵelementStart(2, \"tr\");\n ɵngcc0.ɵɵelement(3, \"th\", 2);\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelementStart(4, \"tbody\", 3);\n ɵngcc0.ɵɵlistener(\"selectedValueChange\", function NgxMatYearView_Template_tbody_selectedValueChange_4_listener($event) { return ctx._monthSelected($event); })(\"keydown\", function NgxMatYearView_Template_tbody_keydown_4_listener($event) { return ctx._handleCalendarBodyKeydown($event); });\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelementEnd();\n } if (rf & 2) {\n ɵngcc0.ɵɵadvance(4);\n ɵngcc0.ɵɵproperty(\"label\", ctx._yearLabel)(\"rows\", ctx._months)(\"todayValue\", ctx._todayMonth)(\"startValue\", ctx._selectedMonth)(\"endValue\", ctx._selectedMonth)(\"labelMinRequiredCells\", 2)(\"numCols\", 4)(\"cellAspectRatio\", 4 / 7)(\"activeCell\", ctx._dateAdapter.getMonth(ctx.activeDate));\n } }, directives: [NgxMatCalendarBody], encapsulation: 2, changeDetection: 0 });\r\n/** @nocollapse */\r\nNgxMatYearView.ctorParameters = () => [\r\n { type: ChangeDetectorRef },\r\n { type: undefined, decorators: [{ type: Optional }, { type: Inject, args: [NGX_MAT_DATE_FORMATS,] }] },\r\n { type: NgxMatDateAdapter, decorators: [{ type: Optional }] },\r\n { type: Directionality, decorators: [{ type: Optional }] }\r\n];\r\nNgxMatYearView.propDecorators = {\r\n activeDate: [{ type: Input }],\r\n selected: [{ type: Input }],\r\n minDate: [{ type: Input }],\r\n maxDate: [{ type: Input }],\r\n dateFilter: [{ type: Input }],\r\n selectedChange: [{ type: Output }],\r\n monthSelected: [{ type: Output }],\r\n activeDateChange: [{ type: Output }],\r\n _matCalendarBody: [{ type: ViewChild, args: [NgxMatCalendarBody,] }]\r\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgxMatYearView, [{\n type: Component,\n args: [{\n selector: 'ngx-mat-year-view',\n template: \"
\\r\\n \\r\\n
\\r\\n \\r\\n \\r\\n \\r\\n
\\r\\n\",\n exportAs: 'ngxMatYearView',\n encapsulation: ViewEncapsulation.None,\n changeDetection: ChangeDetectionStrategy.OnPush\n }]\n }], function () { return [{ type: ɵngcc0.ChangeDetectorRef }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [NGX_MAT_DATE_FORMATS]\n }] }, { type: NgxMatDateAdapter, decorators: [{\n type: Optional\n }] }, { type: ɵngcc2.Directionality, decorators: [{\n type: Optional\n }] }]; }, { selectedChange: [{\n type: Output\n }], monthSelected: [{\n type: Output\n }], activeDateChange: [{\n type: Output\n }], activeDate: [{\n type: Input\n }], selected: [{\n type: Input\n }], minDate: [{\n type: Input\n }], maxDate: [{\n type: Input\n }], dateFilter: [{\n type: Input\n }], _matCalendarBody: [{\n type: ViewChild,\n args: [NgxMatCalendarBody]\n }] }); })();\n\n/**\r\n * @license\r\n * Copyright Google LLC All Rights Reserved.\r\n *\r\n * Use of this source code is governed by an MIT-style license that can be\r\n * found in the LICENSE file at https://angular.io/license\r\n */\r\n/** Default header for NgxMatCalendar */\r\nclass NgxMatCalendarHeader {\r\n constructor(_intl, calendar, _dateAdapter, _dateFormats, changeDetectorRef) {\r\n this._intl = _intl;\r\n this.calendar = calendar;\r\n this._dateAdapter = _dateAdapter;\r\n this._dateFormats = _dateFormats;\r\n this.calendar.stateChanges.subscribe(() => changeDetectorRef.markForCheck());\r\n }\r\n /** The label for the current calendar view. */\r\n get periodButtonText() {\r\n if (this.calendar.currentView == 'month') {\r\n return this._dateAdapter\r\n .format(this.calendar.activeDate, this._dateFormats.display.monthYearLabel)\r\n .toLocaleUpperCase();\r\n }\r\n if (this.calendar.currentView == 'year') {\r\n return this._dateAdapter.getYearName(this.calendar.activeDate);\r\n }\r\n // The offset from the active year to the \"slot\" for the starting year is the\r\n // *actual* first rendered year in the multi-year view, and the last year is\r\n // just yearsPerPage - 1 away.\r\n const activeYear = this._dateAdapter.getYear(this.calendar.activeDate);\r\n const minYearOfPage = activeYear - getActiveOffset(this._dateAdapter, this.calendar.activeDate, this.calendar.minDate, this.calendar.maxDate);\r\n const maxYearOfPage = minYearOfPage + yearsPerPage - 1;\r\n const minYearName = this._dateAdapter.getYearName(this._dateAdapter.createDate(minYearOfPage, 0, 1));\r\n const maxYearName = this._dateAdapter.getYearName(this._dateAdapter.createDate(maxYearOfPage, 0, 1));\r\n return formatYearRange(minYearName, maxYearName);\r\n }\r\n get periodButtonLabel() {\r\n return this.calendar.currentView == 'month' ?\r\n this._intl.switchToMultiYearViewLabel : this._intl.switchToMonthViewLabel;\r\n }\r\n /** The label for the previous button. */\r\n get prevButtonLabel() {\r\n return {\r\n 'month': this._intl.prevMonthLabel,\r\n 'year': this._intl.prevYearLabel,\r\n 'multi-year': this._intl.prevMultiYearLabel\r\n }[this.calendar.currentView];\r\n }\r\n /** The label for the next button. */\r\n get nextButtonLabel() {\r\n return {\r\n 'month': this._intl.nextMonthLabel,\r\n 'year': this._intl.nextYearLabel,\r\n 'multi-year': this._intl.nextMultiYearLabel\r\n }[this.calendar.currentView];\r\n }\r\n /** Handles user clicks on the period label. */\r\n currentPeriodClicked() {\r\n this.calendar.currentView = this.calendar.currentView == 'month' ? 'multi-year' : 'month';\r\n }\r\n /** Handles user clicks on the previous button. */\r\n previousClicked() {\r\n this.calendar.activeDate = this.calendar.currentView == 'month' ?\r\n this._dateAdapter.addCalendarMonths(this.calendar.activeDate, -1) :\r\n this._dateAdapter.addCalendarYears(this.calendar.activeDate, this.calendar.currentView == 'year' ? -1 : -yearsPerPage);\r\n }\r\n /** Handles user clicks on the next button. */\r\n nextClicked() {\r\n this.calendar.activeDate = this.calendar.currentView == 'month' ?\r\n this._dateAdapter.addCalendarMonths(this.calendar.activeDate, 1) :\r\n this._dateAdapter.addCalendarYears(this.calendar.activeDate, this.calendar.currentView == 'year' ? 1 : yearsPerPage);\r\n }\r\n /** Whether the previous period button is enabled. */\r\n previousEnabled() {\r\n if (!this.calendar.minDate) {\r\n return true;\r\n }\r\n return !this.calendar.minDate ||\r\n !this._isSameView(this.calendar.activeDate, this.calendar.minDate);\r\n }\r\n /** Whether the next period button is enabled. */\r\n nextEnabled() {\r\n return !this.calendar.maxDate ||\r\n !this._isSameView(this.calendar.activeDate, this.calendar.maxDate);\r\n }\r\n /** Whether the two dates represent the same view in the current view mode (month or year). */\r\n _isSameView(date1, date2) {\r\n if (this.calendar.currentView == 'month') {\r\n return this._dateAdapter.getYear(date1) == this._dateAdapter.getYear(date2) &&\r\n this._dateAdapter.getMonth(date1) == this._dateAdapter.getMonth(date2);\r\n }\r\n if (this.calendar.currentView == 'year') {\r\n return this._dateAdapter.getYear(date1) == this._dateAdapter.getYear(date2);\r\n }\r\n // Otherwise we are in 'multi-year' view.\r\n return isSameMultiYearView(this._dateAdapter, date1, date2, this.calendar.minDate, this.calendar.maxDate);\r\n }\r\n}\nNgxMatCalendarHeader.ɵfac = function NgxMatCalendarHeader_Factory(t) { return new (t || NgxMatCalendarHeader)(ɵngcc0.ɵɵdirectiveInject(ɵngcc3.MatDatepickerIntl), ɵngcc0.ɵɵdirectiveInject(forwardRef(() => NgxMatCalendar)), ɵngcc0.ɵɵdirectiveInject(NgxMatDateAdapter, 8), ɵngcc0.ɵɵdirectiveInject(NGX_MAT_DATE_FORMATS, 8), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ChangeDetectorRef)); };\nNgxMatCalendarHeader.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: NgxMatCalendarHeader, selectors: [[\"ngx-mat-calendar-header\"]], exportAs: [\"ngxMatCalendarHeader\"], ngContentSelectors: _c1, decls: 9, vars: 8, consts: [[1, \"mat-calendar-header\"], [1, \"mat-calendar-controls\"], [\"mat-button\", \"\", \"type\", \"button\", \"cdkAriaLive\", \"polite\", 1, \"mat-calendar-period-button\", 3, \"click\"], [1, \"mat-calendar-arrow\"], [1, \"mat-calendar-spacer\"], [\"mat-icon-button\", \"\", \"type\", \"button\", 1, \"mat-calendar-previous-button\", 3, \"disabled\", \"click\"], [\"mat-icon-button\", \"\", \"type\", \"button\", 1, \"mat-calendar-next-button\", 3, \"disabled\", \"click\"]], template: function NgxMatCalendarHeader_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵprojectionDef();\n ɵngcc0.ɵɵelementStart(0, \"div\", 0);\n ɵngcc0.ɵɵelementStart(1, \"div\", 1);\n ɵngcc0.ɵɵelementStart(2, \"button\", 2);\n ɵngcc0.ɵɵlistener(\"click\", function NgxMatCalendarHeader_Template_button_click_2_listener() { return ctx.currentPeriodClicked(); });\n ɵngcc0.ɵɵtext(3);\n ɵngcc0.ɵɵelement(4, \"div\", 3);\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelement(5, \"div\", 4);\n ɵngcc0.ɵɵprojection(6);\n ɵngcc0.ɵɵelementStart(7, \"button\", 5);\n ɵngcc0.ɵɵlistener(\"click\", function NgxMatCalendarHeader_Template_button_click_7_listener() { return ctx.previousClicked(); });\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelementStart(8, \"button\", 6);\n ɵngcc0.ɵɵlistener(\"click\", function NgxMatCalendarHeader_Template_button_click_8_listener() { return ctx.nextClicked(); });\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelementEnd();\n } if (rf & 2) {\n ɵngcc0.ɵɵadvance(2);\n ɵngcc0.ɵɵattribute(\"aria-label\", ctx.periodButtonLabel);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵtextInterpolate1(\" \", ctx.periodButtonText, \" \");\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵclassProp(\"mat-calendar-invert\", ctx.calendar.currentView != \"month\");\n ɵngcc0.ɵɵadvance(3);\n ɵngcc0.ɵɵproperty(\"disabled\", !ctx.previousEnabled());\n ɵngcc0.ɵɵattribute(\"aria-label\", ctx.prevButtonLabel);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"disabled\", !ctx.nextEnabled());\n ɵngcc0.ɵɵattribute(\"aria-label\", ctx.nextButtonLabel);\n } }, directives: [ɵngcc4.MatButton], encapsulation: 2, changeDetection: 0 });\r\n/** @nocollapse */\r\nNgxMatCalendarHeader.ctorParameters = () => [\r\n { type: MatDatepickerIntl },\r\n { type: NgxMatCalendar, decorators: [{ type: Inject, args: [forwardRef(() => NgxMatCalendar),] }] },\r\n { type: NgxMatDateAdapter, decorators: [{ type: Optional }] },\r\n { type: undefined, decorators: [{ type: Optional }, { type: Inject, args: [NGX_MAT_DATE_FORMATS,] }] },\r\n { type: ChangeDetectorRef }\r\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgxMatCalendarHeader, [{\n type: Component,\n args: [{\n selector: 'ngx-mat-calendar-header',\n template: \"
\\r\\n\",\n host: {\n 'class': 'mat-calendar'\n },\n exportAs: 'ngxMatCalendar',\n encapsulation: ViewEncapsulation.None,\n changeDetection: ChangeDetectionStrategy.OnPush,\n styles: [\".mat-calendar{display:block}.mat-calendar-header{padding:8px 8px 0}.mat-calendar-content{padding:0 8px 8px;outline:none}.mat-calendar-controls{display:flex;margin:5% calc(33% / 7 - 16px)}.mat-calendar-spacer{flex:1 1 auto}.mat-calendar-period-button{min-width:0}.mat-calendar-arrow{display:inline-block;width:0;height:0;border-left:5px solid transparent;border-right:5px solid transparent;border-top-width:5px;border-top-style:solid;margin:0 0 0 5px;vertical-align:middle}.mat-calendar-arrow.mat-calendar-invert{transform:rotate(180deg)}[dir=rtl] .mat-calendar-arrow{margin:0 5px 0 0}.mat-calendar-next-button,.mat-calendar-previous-button{position:relative}.mat-calendar-next-button:after,.mat-calendar-previous-button:after{top:0;left:0;right:0;bottom:0;position:absolute;content:\\\"\\\";margin:15.5px;border:solid;border-width:2px 0 0}[dir=rtl] .mat-calendar-next-button,[dir=rtl] .mat-calendar-previous-button{transform:rotate(180deg)}.mat-calendar-previous-button:after{border-left-width:2px;transform:translateX(2px) rotate(-45deg)}.mat-calendar-next-button:after{border-right-width:2px;transform:translateX(-2px) rotate(45deg)}.mat-calendar-table{border-spacing:0;border-collapse:collapse;width:100%}.mat-calendar-table-header th{text-align:center;padding:0 0 8px}.mat-calendar-table-header-divider{position:relative;height:1px}.mat-calendar-table-header-divider:after{content:\\\"\\\";position:absolute;top:0;left:-8px;right:-8px;height:1px}\"]\n }]\n }], function () { return [{ type: ɵngcc3.MatDatepickerIntl }, { type: NgxMatDateAdapter, decorators: [{\n type: Optional\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [NGX_MAT_DATE_FORMATS]\n }] }, { type: ɵngcc0.ChangeDetectorRef }]; }, { startView: [{\n type: Input\n }], selectedChange: [{\n type: Output\n }], yearSelected: [{\n type: Output\n }], monthSelected: [{\n type: Output\n }], _userSelection: [{\n type: Output\n }], startAt: [{\n type: Input\n }], selected: [{\n type: Input\n }], minDate: [{\n type: Input\n }], maxDate: [{\n type: Input\n }], headerComponent: [{\n type: Input\n }], dateFilter: [{\n type: Input\n }], dateClass: [{\n type: Input\n }], monthView: [{\n type: ViewChild,\n args: [NgxMatMonthView]\n }], yearView: [{\n type: ViewChild,\n args: [NgxMatYearView]\n }], multiYearView: [{\n type: ViewChild,\n args: [NgxMatMultiYearView]\n }] }); })();\n\nclass NgxMatTimepickerComponent {\r\n constructor(_dateAdapter, cd, formBuilder) {\r\n this._dateAdapter = _dateAdapter;\r\n this.cd = cd;\r\n this.formBuilder = formBuilder;\r\n this.disabled = false;\r\n this.showSpinners = true;\r\n this.stepHour = DEFAULT_STEP;\r\n this.stepMinute = DEFAULT_STEP;\r\n this.stepSecond = DEFAULT_STEP;\r\n this.showSeconds = false;\r\n this.disableMinute = false;\r\n this.enableMeridian = false;\r\n this.color = 'primary';\r\n this.meridian = MERIDIANS.AM;\r\n this._onChange = () => { };\r\n this._onTouched = () => { };\r\n this._destroyed = new Subject();\r\n this.pattern = PATTERN_INPUT_HOUR;\r\n if (!this._dateAdapter) {\r\n throw createMissingDateImplError('NgxMatDateAdapter');\r\n }\r\n this.form = this.formBuilder.group({\r\n hour: [{ value: null, disabled: this.disabled }, [Validators.required, Validators.pattern(PATTERN_INPUT_HOUR)]],\r\n minute: [{ value: null, disabled: this.disabled }, [Validators.required, Validators.pattern(PATTERN_INPUT_MINUTE)]],\r\n second: [{ value: null, disabled: this.disabled }, [Validators.required, Validators.pattern(PATTERN_INPUT_SECOND)]]\r\n });\r\n }\r\n /** Hour */\r\n get hour() {\r\n let val = Number(this.form.controls['hour'].value);\r\n return isNaN(val) ? 0 : val;\r\n }\r\n ;\r\n get minute() {\r\n let val = Number(this.form.controls['minute'].value);\r\n return isNaN(val) ? 0 : val;\r\n }\r\n ;\r\n get second() {\r\n let val = Number(this.form.controls['second'].value);\r\n return isNaN(val) ? 0 : val;\r\n }\r\n ;\r\n /** Whether or not the form is valid */\r\n get valid() {\r\n return this.form.valid;\r\n }\r\n ngOnInit() {\r\n this.form.valueChanges.pipe(takeUntil(this._destroyed), debounceTime(400)).subscribe(val => {\r\n this._updateModel();\r\n });\r\n }\r\n ngOnChanges(changes) {\r\n if (changes.disabled || changes.disableMinute) {\r\n this._setDisableStates();\r\n }\r\n }\r\n ngOnDestroy() {\r\n this._destroyed.next();\r\n this._destroyed.complete();\r\n }\r\n /**\r\n * Writes a new value to the element.\r\n * @param obj\r\n */\r\n writeValue(val) {\r\n if (val != null) {\r\n this._model = val;\r\n }\r\n else {\r\n this._model = this._dateAdapter.today();\r\n if (this.defaultTime != null) {\r\n this._dateAdapter.setTimeByDefaultValues(this._model, this.defaultTime);\r\n }\r\n }\r\n this._updateHourMinuteSecond();\r\n }\r\n /** Registers a callback function that is called when the control's value changes in the UI. */\r\n registerOnChange(fn) {\r\n this._onChange = fn;\r\n }\r\n /**\r\n * Set the function to be called when the control receives a touch event.\r\n */\r\n registerOnTouched(fn) {\r\n this._onTouched = fn;\r\n }\r\n /** Enables or disables the appropriate DOM element */\r\n setDisabledState(isDisabled) {\r\n this._disabled = isDisabled;\r\n this.cd.markForCheck();\r\n }\r\n /**\r\n * Format input\r\n * @param input\r\n */\r\n formatInput(input) {\r\n input.value = input.value.replace(NUMERIC_REGEX, '');\r\n }\r\n /** Toggle meridian */\r\n toggleMeridian() {\r\n this.meridian = (this.meridian === MERIDIANS.AM) ? MERIDIANS.PM : MERIDIANS.AM;\r\n this.change('hour');\r\n }\r\n /** Change property of time */\r\n change(prop, up) {\r\n const next = this._getNextValueByProp(prop, up);\r\n this.form.controls[prop].setValue(formatTwoDigitTimeValue(next), { onlySelf: false, emitEvent: false });\r\n this._updateModel();\r\n }\r\n /** Update controls of form by model */\r\n _updateHourMinuteSecond() {\r\n let _hour = this._dateAdapter.getHour(this._model);\r\n const _minute = this._dateAdapter.getMinute(this._model);\r\n const _second = this._dateAdapter.getSecond(this._model);\r\n if (this.enableMeridian) {\r\n if (_hour >= LIMIT_TIMES.meridian) {\r\n _hour = _hour - LIMIT_TIMES.meridian;\r\n this.meridian = MERIDIANS.PM;\r\n }\r\n else {\r\n this.meridian = MERIDIANS.AM;\r\n }\r\n if (_hour === 0) {\r\n _hour = LIMIT_TIMES.meridian;\r\n }\r\n }\r\n this.form.controls['hour'].setValue(formatTwoDigitTimeValue(_hour));\r\n this.form.controls['minute'].setValue(formatTwoDigitTimeValue(_minute));\r\n this.form.controls['second'].setValue(formatTwoDigitTimeValue(_second));\r\n }\r\n /** Update model */\r\n _updateModel() {\r\n let _hour = this.hour;\r\n if (this.enableMeridian) {\r\n if (this.meridian === MERIDIANS.AM && _hour === LIMIT_TIMES.meridian) {\r\n _hour = 0;\r\n }\r\n else if (this.meridian === MERIDIANS.PM && _hour !== LIMIT_TIMES.meridian) {\r\n _hour = _hour + LIMIT_TIMES.meridian;\r\n }\r\n }\r\n this._dateAdapter.setHour(this._model, _hour);\r\n this._dateAdapter.setMinute(this._model, this.minute);\r\n this._dateAdapter.setSecond(this._model, this.second);\r\n this._onChange(this._model);\r\n }\r\n /**\r\n * Get next value by property\r\n * @param prop\r\n * @param up\r\n */\r\n _getNextValueByProp(prop, up) {\r\n const keyProp = prop[0].toUpperCase() + prop.slice(1);\r\n const min = LIMIT_TIMES[`min${keyProp}`];\r\n let max = LIMIT_TIMES[`max${keyProp}`];\r\n if (prop === 'hour' && this.enableMeridian) {\r\n max = LIMIT_TIMES.meridian;\r\n }\r\n let next;\r\n if (up == null) {\r\n next = this[prop] % (max);\r\n if (prop === 'hour' && this.enableMeridian) {\r\n if (next === 0)\r\n next = max;\r\n }\r\n }\r\n else {\r\n next = up ? this[prop] + this[`step${keyProp}`] : this[prop] - this[`step${keyProp}`];\r\n if (prop === 'hour' && this.enableMeridian) {\r\n next = next % (max + 1);\r\n if (next === 0)\r\n next = up ? 1 : max;\r\n }\r\n else {\r\n next = next % max;\r\n }\r\n if (up) {\r\n next = next > max ? (next - max + min) : next;\r\n }\r\n else {\r\n next = next < min ? (next - min + max) : next;\r\n }\r\n }\r\n return next;\r\n }\r\n /**\r\n * Set disable states\r\n */\r\n _setDisableStates() {\r\n if (this.disabled) {\r\n this.form.disable();\r\n }\r\n else {\r\n this.form.enable();\r\n if (this.disableMinute) {\r\n this.form.get('minute').disable();\r\n if (this.showSeconds) {\r\n this.form.get('second').disable();\r\n }\r\n }\r\n }\r\n }\r\n}\nNgxMatTimepickerComponent.ɵfac = function NgxMatTimepickerComponent_Factory(t) { return new (t || NgxMatTimepickerComponent)(ɵngcc0.ɵɵdirectiveInject(NgxMatDateAdapter, 8), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ChangeDetectorRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc6.FormBuilder)); };\nNgxMatTimepickerComponent.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: NgxMatTimepickerComponent, selectors: [[\"ngx-mat-timepicker\"]], hostAttrs: [1, \"ngx-mat-timepicker\"], inputs: { disabled: \"disabled\", showSpinners: \"showSpinners\", stepHour: \"stepHour\", stepMinute: \"stepMinute\", stepSecond: \"stepSecond\", showSeconds: \"showSeconds\", disableMinute: \"disableMinute\", enableMeridian: \"enableMeridian\", color: \"color\", defaultTime: \"defaultTime\" }, exportAs: [\"ngxMatTimepicker\"], features: [ɵngcc0.ɵɵProvidersFeature([\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: forwardRef(() => NgxMatTimepickerComponent),\n multi: true\n }\n ]), ɵngcc0.ɵɵNgOnChangesFeature], decls: 18, vars: 7, consts: [[3, \"formGroup\"], [1, \"ngx-mat-timepicker-table\"], [1, \"ngx-mat-timepicker-tbody\"], [4, \"ngIf\"], [\"appearance\", \"legacy\"], [\"type\", \"text\", \"matInput\", \"\", \"maxlength\", \"2\", \"formControlName\", \"hour\", 3, \"input\", \"keydown.ArrowUp\", \"keydown.ArrowDown\", \"blur\"], [1, \"ngx-mat-timepicker-spacer\"], [\"type\", \"text\", \"matInput\", \"\", \"maxlength\", \"2\", \"formControlName\", \"minute\", 3, \"input\", \"keydown.ArrowUp\", \"keydown.ArrowDown\", \"blur\"], [\"class\", \"ngx-mat-timepicker-spacer\", 4, \"ngIf\"], [\"class\", \"ngx-mat-timepicker-meridian\", 4, \"ngIf\"], [\"type\", \"button\", \"mat-icon-button\", \"\", \"aria-label\", \"expand_less icon\", 3, \"disabled\", \"click\"], [\"type\", \"text\", \"matInput\", \"\", \"maxlength\", \"2\", \"formControlName\", \"second\", 3, \"input\", \"keydown.ArrowUp\", \"keydown.ArrowDown\", \"blur\"], [1, \"ngx-mat-timepicker-meridian\"], [\"mat-button\", \"\", \"mat-stroked-button\", \"\", 3, \"color\", \"disabled\", \"click\"], [\"type\", \"button\", \"mat-icon-button\", \"\", \"aria-label\", \"expand_more icon\", 3, \"disabled\", \"click\"]], template: function NgxMatTimepickerComponent_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementStart(0, \"form\", 0);\n ɵngcc0.ɵɵelementStart(1, \"table\", 1);\n ɵngcc0.ɵɵelementStart(2, \"tbody\", 2);\n ɵngcc0.ɵɵtemplate(3, NgxMatTimepickerComponent_tr_3_Template, 14, 5, \"tr\", 3);\n ɵngcc0.ɵɵelementStart(4, \"tr\");\n ɵngcc0.ɵɵelementStart(5, \"td\");\n ɵngcc0.ɵɵelementStart(6, \"mat-form-field\", 4);\n ɵngcc0.ɵɵelementStart(7, \"input\", 5);\n ɵngcc0.ɵɵlistener(\"input\", function NgxMatTimepickerComponent_Template_input_input_7_listener($event) { return ctx.formatInput($event.target); })(\"keydown.ArrowUp\", function NgxMatTimepickerComponent_Template_input_keydown_ArrowUp_7_listener($event) { ctx.change(\"hour\", true); return $event.preventDefault(); })(\"keydown.ArrowDown\", function NgxMatTimepickerComponent_Template_input_keydown_ArrowDown_7_listener($event) { ctx.change(\"hour\", false); return $event.preventDefault(); })(\"blur\", function NgxMatTimepickerComponent_Template_input_blur_7_listener() { return ctx.change(\"hour\"); });\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelementStart(8, \"td\", 6);\n ɵngcc0.ɵɵtext(9, \":\");\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelementStart(10, \"td\");\n ɵngcc0.ɵɵelementStart(11, \"mat-form-field\", 4);\n ɵngcc0.ɵɵelementStart(12, \"input\", 7);\n ɵngcc0.ɵɵlistener(\"input\", function NgxMatTimepickerComponent_Template_input_input_12_listener($event) { return ctx.formatInput($event.target); })(\"keydown.ArrowUp\", function NgxMatTimepickerComponent_Template_input_keydown_ArrowUp_12_listener($event) { ctx.change(\"minute\", true); return $event.preventDefault(); })(\"keydown.ArrowDown\", function NgxMatTimepickerComponent_Template_input_keydown_ArrowDown_12_listener($event) { ctx.change(\"minute\", false); return $event.preventDefault(); })(\"blur\", function NgxMatTimepickerComponent_Template_input_blur_12_listener() { return ctx.change(\"minute\"); });\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵtemplate(13, NgxMatTimepickerComponent_td_13_Template, 2, 0, \"td\", 8);\n ɵngcc0.ɵɵtemplate(14, NgxMatTimepickerComponent_td_14_Template, 3, 0, \"td\", 3);\n ɵngcc0.ɵɵtemplate(15, NgxMatTimepickerComponent_td_15_Template, 1, 0, \"td\", 8);\n ɵngcc0.ɵɵtemplate(16, NgxMatTimepickerComponent_td_16_Template, 3, 3, \"td\", 9);\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵtemplate(17, NgxMatTimepickerComponent_tr_17_Template, 14, 6, \"tr\", 3);\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelementEnd();\n } if (rf & 2) {\n ɵngcc0.ɵɵproperty(\"formGroup\", ctx.form);\n ɵngcc0.ɵɵadvance(3);\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx.showSpinners);\n ɵngcc0.ɵɵadvance(10);\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx.showSeconds);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx.showSeconds);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx.enableMeridian);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx.enableMeridian);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx.showSpinners);\n } }, directives: [ɵngcc6.ɵNgNoValidate, ɵngcc6.NgControlStatusGroup, ɵngcc6.FormGroupDirective, ɵngcc1.NgIf, ɵngcc7.MatFormField, ɵngcc8.MatInput, ɵngcc6.DefaultValueAccessor, ɵngcc6.MaxLengthValidator, ɵngcc6.NgControlStatus, ɵngcc6.FormControlName, ɵngcc4.MatButton, ɵngcc9.MatIcon], styles: [\".ngx-mat-timepicker{font-size:13px}.ngx-mat-timepicker form{min-width:90px}.ngx-mat-timepicker form .ngx-mat-timepicker-table .ngx-mat-timepicker-tbody tr td{text-align:center}.ngx-mat-timepicker form .ngx-mat-timepicker-table .ngx-mat-timepicker-tbody tr td.ngx-mat-timepicker-spacer{font-weight:700}.ngx-mat-timepicker form .ngx-mat-timepicker-table .ngx-mat-timepicker-tbody tr td.ngx-mat-timepicker-meridian .mat-button{min-width:64px;line-height:36px;border-radius:4px;min-width:0;border-radius:50%;width:36px;height:36px;padding:0;flex-shrink:0}.ngx-mat-timepicker form .ngx-mat-timepicker-table .ngx-mat-timepicker-tbody tr td .mat-icon-button{height:24px;width:24px;line-height:24px}.ngx-mat-timepicker form .ngx-mat-timepicker-table .ngx-mat-timepicker-tbody tr td .mat-icon-button .mat-icon{font-size:24px}.ngx-mat-timepicker form .ngx-mat-timepicker-table .ngx-mat-timepicker-tbody tr td .mat-form-field{width:20px;max-width:20px;text-align:center}\"], encapsulation: 2 });\r\n/** @nocollapse */\r\nNgxMatTimepickerComponent.ctorParameters = () => [\r\n { type: NgxMatDateAdapter, decorators: [{ type: Optional }] },\r\n { type: ChangeDetectorRef },\r\n { type: FormBuilder }\r\n];\r\nNgxMatTimepickerComponent.propDecorators = {\r\n disabled: [{ type: Input }],\r\n showSpinners: [{ type: Input }],\r\n stepHour: [{ type: Input }],\r\n stepMinute: [{ type: Input }],\r\n stepSecond: [{ type: Input }],\r\n showSeconds: [{ type: Input }],\r\n disableMinute: [{ type: Input }],\r\n enableMeridian: [{ type: Input }],\r\n defaultTime: [{ type: Input }],\r\n color: [{ type: Input }]\r\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgxMatTimepickerComponent, [{\n type: Component,\n args: [{\n selector: 'ngx-mat-timepicker',\n template: \"\",\n host: {\n 'class': 'ngx-mat-timepicker'\n },\n providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: forwardRef(() => NgxMatTimepickerComponent),\n multi: true\n }\n ],\n exportAs: 'ngxMatTimepicker',\n encapsulation: ViewEncapsulation.None,\n styles: [\".ngx-mat-timepicker{font-size:13px}.ngx-mat-timepicker form{min-width:90px}.ngx-mat-timepicker form .ngx-mat-timepicker-table .ngx-mat-timepicker-tbody tr td{text-align:center}.ngx-mat-timepicker form .ngx-mat-timepicker-table .ngx-mat-timepicker-tbody tr td.ngx-mat-timepicker-spacer{font-weight:700}.ngx-mat-timepicker form .ngx-mat-timepicker-table .ngx-mat-timepicker-tbody tr td.ngx-mat-timepicker-meridian .mat-button{min-width:64px;line-height:36px;border-radius:4px;min-width:0;border-radius:50%;width:36px;height:36px;padding:0;flex-shrink:0}.ngx-mat-timepicker form .ngx-mat-timepicker-table .ngx-mat-timepicker-tbody tr td .mat-icon-button{height:24px;width:24px;line-height:24px}.ngx-mat-timepicker form .ngx-mat-timepicker-table .ngx-mat-timepicker-tbody tr td .mat-icon-button .mat-icon{font-size:24px}.ngx-mat-timepicker form .ngx-mat-timepicker-table .ngx-mat-timepicker-tbody tr td .mat-form-field{width:20px;max-width:20px;text-align:center}\"]\n }]\n }], function () { return [{ type: NgxMatDateAdapter, decorators: [{\n type: Optional\n }] }, { type: ɵngcc0.ChangeDetectorRef }, { type: ɵngcc6.FormBuilder }]; }, { disabled: [{\n type: Input\n }], showSpinners: [{\n type: Input\n }], stepHour: [{\n type: Input\n }], stepMinute: [{\n type: Input\n }], stepSecond: [{\n type: Input\n }], showSeconds: [{\n type: Input\n }], disableMinute: [{\n type: Input\n }], enableMeridian: [{\n type: Input\n }], color: [{\n type: Input\n }], defaultTime: [{\n type: Input\n }] }); })();\n\n/**\r\n * @license\r\n * Copyright Google LLC All Rights Reserved.\r\n *\r\n * Use of this source code is governed by an MIT-style license that can be\r\n * found in the LICENSE file at https://angular.io/license\r\n */\r\n/** Used to generate a unique ID for each datepicker instance. */\r\nlet datepickerUid = 0;\r\n// Boilerplate for applying mixins to MatDatepickerContent.\r\n/** @docs-private */\r\nclass MatDatepickerContentBase {\r\n constructor(_elementRef) {\r\n this._elementRef = _elementRef;\r\n }\r\n}\r\nconst _MatDatepickerContentMixinBase = mixinColor(MatDatepickerContentBase);\r\n/**\r\n * Component used as the content for the datepicker dialog and popup. We use this instead of using\r\n * NgxMatCalendar directly as the content so we can control the initial focus. This also gives us a\r\n * place to put additional features of the popup that are not part of the calendar itself in the\r\n * future. (e.g. confirmation buttons).\r\n * @docs-private\r\n */\r\nclass NgxMatDatetimeContent extends _MatDatepickerContentMixinBase {\r\n constructor(elementRef, cd, _viewContainerRef) {\r\n super(elementRef);\r\n this.cd = cd;\r\n this._viewContainerRef = _viewContainerRef;\r\n }\r\n /** Whether or not the selected date is valid (min,max...) */\r\n get valid() {\r\n if (this.datepicker.hideTime)\r\n return this.datepicker.valid;\r\n return this._timePicker && this._timePicker.valid && this.datepicker.valid;\r\n }\r\n get isViewMonth() {\r\n if (!this._calendar || this._calendar.currentView == null)\r\n return true;\r\n return this._calendar.currentView == 'month';\r\n }\r\n ngAfterViewInit() {\r\n this._calendar.focusActiveCell();\r\n if (this.datepicker._customIcon) {\r\n this._templateCustomIconPortal = new TemplatePortal(this.datepicker._customIcon, this._viewContainerRef);\r\n this.cd.detectChanges();\r\n }\r\n }\r\n}\nNgxMatDatetimeContent.ɵfac = function NgxMatDatetimeContent_Factory(t) { return new (t || NgxMatDatetimeContent)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ChangeDetectorRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef)); };\nNgxMatDatetimeContent.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: NgxMatDatetimeContent, selectors: [[\"ngx-mat-datetime-content\"]], viewQuery: function NgxMatDatetimeContent_Query(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵviewQuery(NgxMatCalendar, 5);\n ɵngcc0.ɵɵviewQuery(NgxMatTimepickerComponent, 5);\n } if (rf & 2) {\n let _t;\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._calendar = _t.first);\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._timePicker = _t.first);\n } }, hostAttrs: [1, \"mat-datepicker-content\"], hostVars: 3, hostBindings: function NgxMatDatetimeContent_HostBindings(rf, ctx) { if (rf & 2) {\n ɵngcc0.ɵɵsyntheticHostProperty(\"@transformPanel\", \"enter\");\n ɵngcc0.ɵɵclassProp(\"mat-datepicker-content-touch\", ctx.datepicker.touchUi);\n } }, inputs: { color: \"color\" }, exportAs: [\"ngxMatDatetimeContent\"], features: [ɵngcc0.ɵɵInheritDefinitionFeature], decls: 2, vars: 12, consts: [[\"cdkTrapFocus\", \"\", 3, \"id\", \"ngClass\", \"startAt\", \"startView\", \"minDate\", \"maxDate\", \"dateFilter\", \"headerComponent\", \"selected\", \"dateClass\", \"selectedChange\", \"yearSelected\", \"monthSelected\"], [4, \"ngIf\"], [\"class\", \"time-container\", 3, \"disable-seconds\", 4, \"ngIf\"], [1, \"actions\"], [\"mat-button\", \"\", \"mat-stroked-button\", \"\", \"cdkFocusInitial\", \"\", 3, \"color\", \"disabled\", \"click\"], [3, \"cdkPortalOutlet\"], [1, \"time-container\"], [3, \"showSpinners\", \"showSeconds\", \"disabled\", \"stepHour\", \"stepMinute\", \"stepSecond\", \"ngModel\", \"color\", \"enableMeridian\", \"disableMinute\", \"ngModelChange\"]], template: function NgxMatDatetimeContent_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementStart(0, \"ngx-mat-calendar\", 0);\n ɵngcc0.ɵɵlistener(\"selectedChange\", function NgxMatDatetimeContent_Template_ngx_mat_calendar_selectedChange_0_listener($event) { return ctx.datepicker.select($event); })(\"yearSelected\", function NgxMatDatetimeContent_Template_ngx_mat_calendar_yearSelected_0_listener($event) { return ctx.datepicker._selectYear($event); })(\"monthSelected\", function NgxMatDatetimeContent_Template_ngx_mat_calendar_monthSelected_0_listener($event) { return ctx.datepicker._selectMonth($event); });\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵtemplate(1, NgxMatDatetimeContent_ng_container_1_Template, 6, 5, \"ng-container\", 1);\n } if (rf & 2) {\n ɵngcc0.ɵɵproperty(\"id\", ctx.datepicker.id)(\"ngClass\", ctx.datepicker.panelClass)(\"startAt\", ctx.datepicker.startAt)(\"startView\", ctx.datepicker.startView)(\"minDate\", ctx.datepicker._minDate)(\"maxDate\", ctx.datepicker._maxDate)(\"dateFilter\", ctx.datepicker._dateFilter)(\"headerComponent\", ctx.datepicker.calendarHeaderComponent)(\"selected\", ctx.datepicker._selected)(\"dateClass\", ctx.datepicker.dateClass)(\"@fadeInCalendar\", \"enter\");\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵproperty(\"ngIf\", ctx.isViewMonth);\n } }, directives: [NgxMatCalendar, ɵngcc1.NgClass, ɵngcc1.NgIf, ɵngcc4.MatButton, ɵngcc5.CdkPortalOutlet, NgxMatTimepickerComponent, ɵngcc6.NgControlStatus, ɵngcc6.NgModel, ɵngcc9.MatIcon], styles: [\".mat-datepicker-content{display:block;border-radius:4px;box-shadow:0 2px 4px -1px rgba(0,0,0,.2),0 4px 5px 0 rgba(0,0,0,.14),0 1px 10px 0 rgba(0,0,0,.12)}.mat-datepicker-content .mat-calendar{width:296px}.mat-datepicker-content .time-container{display:flex;position:relative;padding-top:5px;justify-content:center}.mat-datepicker-content .time-container.disable-seconds .ngx-mat-timepicker .table{margin-left:9px}.mat-datepicker-content .time-container:before{content:\\\"\\\";position:absolute;top:0;left:0;right:0;height:1px;background-color:rgba(0,0,0,.12)}.mat-datepicker-content .actions{display:flex;padding:5px 15px 10px;justify-content:flex-end}\"], encapsulation: 2, data: { animation: [\n matDatepickerAnimations.transformPanel,\n matDatepickerAnimations.fadeInCalendar,\n ] }, changeDetection: 0 });\r\n/** @nocollapse */\r\nNgxMatDatetimeContent.ctorParameters = () => [\r\n { type: ElementRef },\r\n { type: ChangeDetectorRef },\r\n { type: ViewContainerRef }\r\n];\r\nNgxMatDatetimeContent.propDecorators = {\r\n _calendar: [{ type: ViewChild, args: [NgxMatCalendar,] }],\r\n _timePicker: [{ type: ViewChild, args: [NgxMatTimepickerComponent,] }]\r\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgxMatDatetimeContent, [{\n type: Component,\n args: [{\n selector: 'ngx-mat-datetime-content',\n template: \"\\r\\n\\r\\n\\r\\n
\\r\\n \\r\\n \\r\\n
\\r\\n
\\r\\n \\r\\n
\\r\\n\",\n host: {\n 'class': 'mat-datepicker-content',\n '[@transformPanel]': '\"enter\"',\n '[class.mat-datepicker-content-touch]': 'datepicker.touchUi'\n },\n animations: [\n matDatepickerAnimations.transformPanel,\n matDatepickerAnimations.fadeInCalendar,\n ],\n exportAs: 'ngxMatDatetimeContent',\n encapsulation: ViewEncapsulation.None,\n changeDetection: ChangeDetectionStrategy.OnPush,\n inputs: ['color'],\n styles: [\".mat-datepicker-content{display:block;border-radius:4px;box-shadow:0 2px 4px -1px rgba(0,0,0,.2),0 4px 5px 0 rgba(0,0,0,.14),0 1px 10px 0 rgba(0,0,0,.12)}.mat-datepicker-content .mat-calendar{width:296px}.mat-datepicker-content .time-container{display:flex;position:relative;padding-top:5px;justify-content:center}.mat-datepicker-content .time-container.disable-seconds .ngx-mat-timepicker .table{margin-left:9px}.mat-datepicker-content .time-container:before{content:\\\"\\\";position:absolute;top:0;left:0;right:0;height:1px;background-color:rgba(0,0,0,.12)}.mat-datepicker-content .actions{display:flex;padding:5px 15px 10px;justify-content:flex-end}\"]\n }]\n }], function () { return [{ type: ɵngcc0.ElementRef }, { type: ɵngcc0.ChangeDetectorRef }, { type: ɵngcc0.ViewContainerRef }]; }, { _calendar: [{\n type: ViewChild,\n args: [NgxMatCalendar]\n }], _timePicker: [{\n type: ViewChild,\n args: [NgxMatTimepickerComponent]\n }] }); })();\r\n// TODO(mmalerba): We use a component instead of a directive here so the user can use implicit\r\n// template reference variables (e.g. #d vs #d=\"matDatepicker\"). We can change this to a directive\r\n// if angular adds support for `exportAs: '$implicit'` on directives.\r\n/** Component responsible for managing the datepicker popup/dialog. */\r\nclass NgxMatDatetimePicker {\r\n constructor(_dialog, _overlay, _ngZone, _viewContainerRef, scrollStrategy, _dateAdapter, _dir, _document) {\r\n this._dialog = _dialog;\r\n this._overlay = _overlay;\r\n this._ngZone = _ngZone;\r\n this._viewContainerRef = _viewContainerRef;\r\n this._dateAdapter = _dateAdapter;\r\n this._dir = _dir;\r\n this._document = _document;\r\n /** The view that the calendar should start in. */\r\n this.startView = 'month';\r\n this._defaultColor = 'primary';\r\n this._touchUi = false;\r\n this._hideTime = false;\r\n /**\r\n * Emits selected year in multiyear view.\r\n * This doesn't imply a change on the selected date.\r\n */\r\n this.yearSelected = new EventEmitter();\r\n /**\r\n * Emits selected month in year view.\r\n * This doesn't imply a change on the selected date.\r\n */\r\n this.monthSelected = new EventEmitter();\r\n /** Emits when the datepicker has been opened. */\r\n this.openedStream = new EventEmitter();\r\n /** Emits when the datepicker has been closed. */\r\n this.closedStream = new EventEmitter();\r\n this._opened = false;\r\n this._showSpinners = true;\r\n this._showSeconds = false;\r\n this._stepHour = DEFAULT_STEP;\r\n this._stepMinute = DEFAULT_STEP;\r\n this._stepSecond = DEFAULT_STEP;\r\n this._enableMeridian = false;\r\n this._hasBackdrop = true;\r\n /** The id for the datepicker calendar. */\r\n this.id = `mat-datepicker-${datepickerUid++}`;\r\n this._validSelected = null;\r\n /** The element that was focused before the datepicker was opened. */\r\n this._focusedElementBeforeOpen = null;\r\n /** Subscription to value changes in the associated input element. */\r\n this._inputSubscription = Subscription.EMPTY;\r\n /** Emits when the datepicker is disabled. */\r\n this.stateChanges = new Subject();\r\n /** Emits new selected date when selected date changes. */\r\n this._selectedChanged = new Subject();\r\n /** The form control validator for the min date. */\r\n this._minValidator = () => {\r\n return (!this._minDate || !this._selected ||\r\n this._dateAdapter.compareDateWithTime(this._minDate, this._selected, this.showSeconds) <= 0) ?\r\n null : { 'matDatetimePickerMin': { 'min': this._minDate, 'actual': this._selected } };\r\n };\r\n /** The form control validator for the max date. */\r\n this._maxValidator = () => {\r\n return (!this._maxDate || !this._selected ||\r\n this._dateAdapter.compareDateWithTime(this._maxDate, this._selected, this.showSeconds) >= 0) ?\r\n null : { 'matDatetimePickerMax': { 'max': this._maxDate, 'actual': this._selected } };\r\n };\r\n if (!this._dateAdapter) {\r\n throw createMissingDateImplError('NgxMatDateAdapter');\r\n }\r\n this._scrollStrategy = scrollStrategy;\r\n }\r\n /** The date to open the calendar to initially. */\r\n get startAt() {\r\n // If an explicit startAt is set we start there, otherwise we start at whatever the currently\r\n // selected value is.\r\n return this._startAt || (this.datepickerInput ? this.datepickerInput.value : null);\r\n }\r\n set startAt(value) {\r\n this._startAt = this._getValidDateOrNull(this._dateAdapter.deserialize(value));\r\n }\r\n /** Default Color palette to use on the datepicker's calendar. */\r\n get defaultColor() {\r\n return this._defaultColor;\r\n }\r\n set defaultColor(value) {\r\n this._defaultColor = value;\r\n }\r\n /** Color palette to use on the datepicker's calendar. */\r\n get color() {\r\n return this._color ||\r\n (this.datepickerInput ? this.datepickerInput._getThemePalette() : 'primary');\r\n }\r\n set color(value) {\r\n this._color = value;\r\n }\r\n /**\r\n * Whether the calendar UI is in touch mode. In touch mode the calendar opens in a dialog rather\r\n * than a popup and elements have more padding to allow for bigger touch targets.\r\n */\r\n get touchUi() { return this._touchUi; }\r\n set touchUi(value) {\r\n this._touchUi = coerceBooleanProperty(value);\r\n }\r\n get hideTime() { return this._hideTime; }\r\n set hideTime(value) {\r\n this._hideTime = coerceBooleanProperty(value);\r\n }\r\n /** Whether the datepicker pop-up should be disabled. */\r\n get disabled() {\r\n return this._disabled === undefined && this.datepickerInput ?\r\n this.datepickerInput.disabled : !!this._disabled;\r\n }\r\n set disabled(value) {\r\n const newValue = coerceBooleanProperty(value);\r\n if (newValue !== this._disabled) {\r\n this._disabled = newValue;\r\n this.stateChanges.next(newValue);\r\n }\r\n }\r\n /** Whether the calendar is open. */\r\n get opened() { return this._opened; }\r\n set opened(value) { value ? this.open() : this.close(); }\r\n /** Whether the timepicker'spinners is shown. */\r\n get showSpinners() { return this._showSpinners; }\r\n set showSpinners(value) { this._showSpinners = value; }\r\n /** Whether the second part is disabled. */\r\n get showSeconds() { return this._showSeconds; }\r\n set showSeconds(value) { this._showSeconds = value; }\r\n /** Step hour */\r\n get stepHour() { return this._stepHour; }\r\n set stepHour(value) { this._stepHour = value; }\r\n /** Step minute */\r\n get stepMinute() { return this._stepMinute; }\r\n set stepMinute(value) { this._stepMinute = value; }\r\n /** Step second */\r\n get stepSecond() { return this._stepSecond; }\r\n set stepSecond(value) { this._stepSecond = value; }\r\n /** Enable meridian */\r\n get enableMeridian() { return this._enableMeridian; }\r\n set enableMeridian(value) { this._enableMeridian = value; }\r\n /** disable minute */\r\n get disableMinute() { return this._disableMinute; }\r\n set disableMinute(value) { this._disableMinute = value; }\r\n /** Step second */\r\n get defaultTime() { return this._defaultTime; }\r\n set defaultTime(value) { this._defaultTime = value; }\r\n /** The currently selected date. */\r\n get _selected() { return this._validSelected; }\r\n set _selected(value) { this._validSelected = value; }\r\n /** The minimum selectable date. */\r\n get _minDate() {\r\n return this.datepickerInput && this.datepickerInput.min;\r\n }\r\n /** The maximum selectable date. */\r\n get _maxDate() {\r\n return this.datepickerInput && this.datepickerInput.max;\r\n }\r\n get valid() {\r\n const minValidators = this._minValidator();\r\n const maxValidators = this._maxValidator();\r\n return minValidators == null && maxValidators == null;\r\n }\r\n get _dateFilter() {\r\n return this.datepickerInput && this.datepickerInput._dateFilter;\r\n }\r\n ngOnDestroy() {\r\n this.close();\r\n if (this._popupRef) {\r\n this._popupRef.dispose();\r\n this._popupComponentRef = null;\r\n }\r\n this._inputSubscription.unsubscribe();\r\n this.stateChanges.complete();\r\n }\r\n /** Selects the given date */\r\n select(date) {\r\n this._dateAdapter.copyTime(date, this._selected);\r\n this._selected = date;\r\n }\r\n /** Emits the selected year in multiyear view */\r\n _selectYear(normalizedYear) {\r\n this.yearSelected.emit(normalizedYear);\r\n }\r\n /** Emits selected month in year view */\r\n _selectMonth(normalizedMonth) {\r\n this.monthSelected.emit(normalizedMonth);\r\n }\r\n /** OK button handler and close*/\r\n ok() {\r\n const cloned = this._dateAdapter.clone(this._selected);\r\n this._selectedChanged.next(cloned);\r\n this.close();\r\n }\r\n /** Cancel and close */\r\n cancel() {\r\n this._selected = this._rawValue;\r\n this.close();\r\n }\r\n /**\r\n * Register an input with this datepicker.\r\n * @param input The datepicker input to register with this datepicker.\r\n */\r\n _registerInput(input) {\r\n if (this.datepickerInput) {\r\n throw Error('A NgxMatDatepicker can only be associated with a single input.');\r\n }\r\n this.datepickerInput = input;\r\n this._inputSubscription =\r\n this.datepickerInput._valueChange.subscribe((value) => this._selected = value);\r\n }\r\n /** Open the calendar. */\r\n open() {\r\n this._rawValue = this._selected != null\r\n ? this._dateAdapter.clone(this._selected) : null;\r\n if (this._selected == null) {\r\n this._selected = this._dateAdapter.today();\r\n if (this.defaultTime != null) {\r\n this._dateAdapter.setTimeByDefaultValues(this._selected, this.defaultTime);\r\n }\r\n }\r\n if (this._opened || this.disabled) {\r\n return;\r\n }\r\n if (!this.datepickerInput) {\r\n throw Error('Attempted to open an NgxMatDatepicker with no associated input.');\r\n }\r\n if (this._document) {\r\n this._focusedElementBeforeOpen = this._document.activeElement;\r\n }\r\n this.touchUi ? this._openAsDialog() : this._openAsPopup();\r\n this._opened = true;\r\n this.openedStream.emit();\r\n }\r\n /** Close the calendar. */\r\n close() {\r\n if (!this._opened) {\r\n return;\r\n }\r\n if (this._popupRef && this._popupRef.hasAttached()) {\r\n this._popupRef.detach();\r\n }\r\n if (this._dialogRef) {\r\n this._dialogRef.close();\r\n this._dialogRef = null;\r\n }\r\n if (this._calendarPortal && this._calendarPortal.isAttached) {\r\n this._calendarPortal.detach();\r\n }\r\n const completeClose = () => {\r\n // The `_opened` could've been reset already if\r\n // we got two events in quick succession.\r\n if (this._opened) {\r\n this._opened = false;\r\n this.closedStream.emit();\r\n this._focusedElementBeforeOpen = null;\r\n }\r\n };\r\n if (this._focusedElementBeforeOpen &&\r\n typeof this._focusedElementBeforeOpen.focus === 'function') {\r\n // Because IE moves focus asynchronously, we can't count on it being restored before we've\r\n // marked the datepicker as closed. If the event fires out of sequence and the element that\r\n // we're refocusing opens the datepicker on focus, the user could be stuck with not being\r\n // able to close the calendar at all. We work around it by making the logic, that marks\r\n // the datepicker as closed, async as well.\r\n this._focusedElementBeforeOpen.focus();\r\n setTimeout(completeClose);\r\n }\r\n else {\r\n completeClose();\r\n }\r\n }\r\n /** Open the calendar as a dialog. */\r\n _openAsDialog() {\r\n // Usually this would be handled by `open` which ensures that we can only have one overlay\r\n // open at a time, however since we reset the variables in async handlers some overlays\r\n // may slip through if the user opens and closes multiple times in quick succession (e.g.\r\n // by holding down the enter key).\r\n if (this._dialogRef) {\r\n this._dialogRef.close();\r\n }\r\n this._dialogRef = this._dialog.open(NgxMatDatetimeContent, {\r\n direction: this._dir ? this._dir.value : 'ltr',\r\n viewContainerRef: this._viewContainerRef,\r\n panelClass: 'mat-datepicker-dialog',\r\n hasBackdrop: this._hasBackdrop\r\n });\r\n this._dialogRef.afterClosed().subscribe(() => this.close());\r\n this._dialogRef.componentInstance.datepicker = this;\r\n this._setColor();\r\n }\r\n /** Open the calendar as a popup. */\r\n _openAsPopup() {\r\n if (!this._calendarPortal) {\r\n this._calendarPortal = new ComponentPortal(NgxMatDatetimeContent, this._viewContainerRef);\r\n }\r\n if (!this._popupRef) {\r\n this._createPopup();\r\n }\r\n if (!this._popupRef.hasAttached()) {\r\n this._popupComponentRef = this._popupRef.attach(this._calendarPortal);\r\n this._popupComponentRef.instance.datepicker = this;\r\n this._setColor();\r\n // Update the position once the calendar has rendered.\r\n this._ngZone.onStable.asObservable().pipe(take(1)).subscribe(() => {\r\n this._popupRef.updatePosition();\r\n });\r\n }\r\n }\r\n /** Create the popup. */\r\n _createPopup() {\r\n const overlayConfig = new OverlayConfig({\r\n positionStrategy: this._createPopupPositionStrategy(),\r\n hasBackdrop: this._hasBackdrop,\r\n backdropClass: 'mat-overlay-transparent-backdrop',\r\n direction: this._dir,\r\n scrollStrategy: this._scrollStrategy(),\r\n panelClass: 'mat-datepicker-popup',\r\n });\r\n this._popupRef = this._overlay.create(overlayConfig);\r\n this._popupRef.overlayElement.setAttribute('role', 'dialog');\r\n merge(this._popupRef.backdropClick(), this._popupRef.detachments(), this._popupRef.keydownEvents().pipe(filter(event => {\r\n // Closing on alt + up is only valid when there's an input associated with the datepicker.\r\n return event.keyCode === ESCAPE ||\r\n (this.datepickerInput && event.altKey && event.keyCode === UP_ARROW);\r\n }))).subscribe(event => {\r\n if (event) {\r\n event.preventDefault();\r\n }\r\n (this._hasBackdrop && event) ? this.cancel() : this.close();\r\n });\r\n }\r\n /** Create the popup PositionStrategy. */\r\n _createPopupPositionStrategy() {\r\n return this._overlay.position()\r\n .flexibleConnectedTo(this.datepickerInput.getConnectedOverlayOrigin())\r\n .withTransformOriginOn('.mat-datepicker-content')\r\n .withFlexibleDimensions(false)\r\n .withViewportMargin(8)\r\n .withLockedPosition()\r\n .withPositions([\r\n {\r\n originX: 'start',\r\n originY: 'bottom',\r\n overlayX: 'start',\r\n overlayY: 'top'\r\n },\r\n {\r\n originX: 'start',\r\n originY: 'top',\r\n overlayX: 'start',\r\n overlayY: 'bottom'\r\n },\r\n {\r\n originX: 'end',\r\n originY: 'bottom',\r\n overlayX: 'end',\r\n overlayY: 'top'\r\n },\r\n {\r\n originX: 'end',\r\n originY: 'top',\r\n overlayX: 'end',\r\n overlayY: 'bottom'\r\n }\r\n ]);\r\n }\r\n /**\r\n * @param obj The object to check.\r\n * @returns The given object if it is both a date instance and valid, otherwise null.\r\n */\r\n _getValidDateOrNull(obj) {\r\n return (this._dateAdapter.isDateInstance(obj) && this._dateAdapter.isValid(obj)) ? obj : null;\r\n }\r\n /** Passes the current theme color along to the calendar overlay. */\r\n _setColor() {\r\n const color = this.color;\r\n if (this._popupComponentRef) {\r\n this._popupComponentRef.instance.color = color;\r\n }\r\n if (this._dialogRef) {\r\n this._dialogRef.componentInstance.color = color;\r\n }\r\n }\r\n}\nNgxMatDatetimePicker.ɵfac = function NgxMatDatetimePicker_Factory(t) { return new (t || NgxMatDatetimePicker)(ɵngcc0.ɵɵdirectiveInject(ɵngcc10.MatDialog), ɵngcc0.ɵɵdirectiveInject(ɵngcc11.Overlay), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.NgZone), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef), ɵngcc0.ɵɵdirectiveInject(MAT_DATEPICKER_SCROLL_STRATEGY), ɵngcc0.ɵɵdirectiveInject(NgxMatDateAdapter, 8), ɵngcc0.ɵɵdirectiveInject(ɵngcc2.Directionality, 8), ɵngcc0.ɵɵdirectiveInject(DOCUMENT, 8)); };\nNgxMatDatetimePicker.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: NgxMatDatetimePicker, selectors: [[\"ngx-mat-datetime-picker\"]], contentQueries: function NgxMatDatetimePicker_ContentQueries(rf, ctx, dirIndex) { if (rf & 1) {\n ɵngcc0.ɵɵcontentQuery(dirIndex, TemplateRef, 5);\n } if (rf & 2) {\n let _t;\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._customIcon = _t.first);\n } }, inputs: { startView: \"startView\", startAt: \"startAt\", defaultColor: \"defaultColor\", color: \"color\", touchUi: \"touchUi\", hideTime: \"hideTime\", disabled: \"disabled\", opened: \"opened\", showSpinners: \"showSpinners\", showSeconds: \"showSeconds\", stepHour: \"stepHour\", stepMinute: \"stepMinute\", stepSecond: \"stepSecond\", enableMeridian: \"enableMeridian\", disableMinute: \"disableMinute\", defaultTime: \"defaultTime\", calendarHeaderComponent: \"calendarHeaderComponent\", panelClass: \"panelClass\", dateClass: \"dateClass\" }, outputs: { yearSelected: \"yearSelected\", monthSelected: \"monthSelected\", openedStream: \"opened\", closedStream: \"closed\" }, exportAs: [\"ngxMatDatetimePicker\"], decls: 0, vars: 0, template: function NgxMatDatetimePicker_Template(rf, ctx) { }, encapsulation: 2, changeDetection: 0 });\r\n/** @nocollapse */\r\nNgxMatDatetimePicker.ctorParameters = () => [\r\n { type: MatDialog },\r\n { type: Overlay },\r\n { type: NgZone },\r\n { type: ViewContainerRef },\r\n { type: undefined, decorators: [{ type: Inject, args: [MAT_DATEPICKER_SCROLL_STRATEGY,] }] },\r\n { type: NgxMatDateAdapter, decorators: [{ type: Optional }] },\r\n { type: Directionality, decorators: [{ type: Optional }] },\r\n { type: undefined, decorators: [{ type: Optional }, { type: Inject, args: [DOCUMENT,] }] }\r\n];\r\nNgxMatDatetimePicker.propDecorators = {\r\n calendarHeaderComponent: [{ type: Input }],\r\n _customIcon: [{ type: ContentChild, args: [TemplateRef,] }],\r\n startAt: [{ type: Input }],\r\n startView: [{ type: Input }],\r\n defaultColor: [{ type: Input }],\r\n color: [{ type: Input }],\r\n touchUi: [{ type: Input }],\r\n hideTime: [{ type: Input }],\r\n disabled: [{ type: Input }],\r\n yearSelected: [{ type: Output }],\r\n monthSelected: [{ type: Output }],\r\n panelClass: [{ type: Input }],\r\n dateClass: [{ type: Input }],\r\n openedStream: [{ type: Output, args: ['opened',] }],\r\n closedStream: [{ type: Output, args: ['closed',] }],\r\n opened: [{ type: Input }],\r\n showSpinners: [{ type: Input }],\r\n showSeconds: [{ type: Input }],\r\n stepHour: [{ type: Input }],\r\n stepMinute: [{ type: Input }],\r\n stepSecond: [{ type: Input }],\r\n enableMeridian: [{ type: Input }],\r\n disableMinute: [{ type: Input }],\r\n defaultTime: [{ type: Input }]\r\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgxMatDatetimePicker, [{\n type: Component,\n args: [{\n selector: 'ngx-mat-datetime-picker',\n template: '',\n exportAs: 'ngxMatDatetimePicker',\n changeDetection: ChangeDetectionStrategy.OnPush,\n encapsulation: ViewEncapsulation.None\n }]\n }], function () { return [{ type: ɵngcc10.MatDialog }, { type: ɵngcc11.Overlay }, { type: ɵngcc0.NgZone }, { type: ɵngcc0.ViewContainerRef }, { type: undefined, decorators: [{\n type: Inject,\n args: [MAT_DATEPICKER_SCROLL_STRATEGY]\n }] }, { type: NgxMatDateAdapter, decorators: [{\n type: Optional\n }] }, { type: ɵngcc2.Directionality, decorators: [{\n type: Optional\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, { startView: [{\n type: Input\n }], yearSelected: [{\n type: Output\n }], monthSelected: [{\n type: Output\n }], openedStream: [{\n type: Output,\n args: ['opened']\n }], closedStream: [{\n type: Output,\n args: ['closed']\n }], startAt: [{\n type: Input\n }], defaultColor: [{\n type: Input\n }], color: [{\n type: Input\n }], touchUi: [{\n type: Input\n }], hideTime: [{\n type: Input\n }], disabled: [{\n type: Input\n }], opened: [{\n type: Input\n }], showSpinners: [{\n type: Input\n }], showSeconds: [{\n type: Input\n }], stepHour: [{\n type: Input\n }], stepMinute: [{\n type: Input\n }], stepSecond: [{\n type: Input\n }], enableMeridian: [{\n type: Input\n }], disableMinute: [{\n type: Input\n }], defaultTime: [{\n type: Input\n }], calendarHeaderComponent: [{\n type: Input\n }], _customIcon: [{\n type: ContentChild,\n args: [TemplateRef]\n }], panelClass: [{\n type: Input\n }], dateClass: [{\n type: Input\n }] }); })();\n\n/**\r\n * @license\r\n * Copyright Google LLC All Rights Reserved.\r\n *\r\n * Use of this source code is governed by an MIT-style license that can be\r\n * found in the LICENSE file at https://angular.io/license\r\n */\r\n/** @docs-private */\r\nconst MAT_DATEPICKER_VALUE_ACCESSOR = {\r\n provide: NG_VALUE_ACCESSOR,\r\n useExisting: forwardRef(() => NgxMatDatetimeInput),\r\n multi: true\r\n};\r\n/** @docs-private */\r\nconst MAT_DATEPICKER_VALIDATORS = {\r\n provide: NG_VALIDATORS,\r\n useExisting: forwardRef(() => NgxMatDatetimeInput),\r\n multi: true\r\n};\r\n/**\r\n * An event used for datepicker input and change events. We don't always have access to a native\r\n * input or change event because the event may have been triggered by the user clicking on the\r\n * calendar popup. For consistency, we always use MatDatetimePickerInputEvent instead.\r\n */\r\nclass MatDatetimePickerInputEvent {\r\n constructor(\r\n /** Reference to the datepicker input component that emitted the event. */\r\n target, \r\n /** Reference to the native input element associated with the datepicker input. */\r\n targetElement) {\r\n this.target = target;\r\n this.targetElement = targetElement;\r\n this.value = this.target.value;\r\n }\r\n}\r\n/** Directive used to connect an input to a matDatetimePicker. */\r\nclass NgxMatDatetimeInput {\r\n constructor(_elementRef, _dateAdapter, _dateFormats, _formField) {\r\n this._elementRef = _elementRef;\r\n this._dateAdapter = _dateAdapter;\r\n this._dateFormats = _dateFormats;\r\n this._formField = _formField;\r\n /** Emits when a `change` event is fired on this ``. */\r\n this.dateChange = new EventEmitter();\r\n /** Emits when an `input` event is fired on this ``. */\r\n this.dateInput = new EventEmitter();\r\n /** Emits when the value changes (either due to user input or programmatic change). */\r\n this._valueChange = new EventEmitter();\r\n /** Emits when the disabled state has changed */\r\n this.stateChanges = new EventEmitter();\r\n this._onTouched = () => { };\r\n this._cvaOnChange = () => { };\r\n this._validatorOnChange = () => { };\r\n this._datepickerSubscription = Subscription.EMPTY;\r\n this._localeSubscription = Subscription.EMPTY;\r\n /** The form control validator for whether the input parses. */\r\n this._parseValidator = () => {\r\n return this._lastValueValid ?\r\n null : { 'matDatetimePickerParse': { 'text': this._elementRef.nativeElement.value } };\r\n };\r\n /** The form control validator for the min date. */\r\n this._minValidator = (control) => {\r\n const controlValue = this._getValidDateOrNull(this._dateAdapter.deserialize(control.value));\r\n return (!this.min || !controlValue ||\r\n this._dateAdapter.compareDateWithTime(this.min, controlValue, this._datepicker.showSeconds) <= 0) ?\r\n null : { 'matDatetimePickerMin': { 'min': this.min, 'actual': controlValue } };\r\n };\r\n /** The form control validator for the max date. */\r\n this._maxValidator = (control) => {\r\n const controlValue = this._getValidDateOrNull(this._dateAdapter.deserialize(control.value));\r\n return (!this.max || !controlValue ||\r\n this._dateAdapter.compareDateWithTime(this.max, controlValue, this._datepicker.showSeconds) >= 0) ?\r\n null : { 'matDatetimePickerMax': { 'max': this.max, 'actual': controlValue } };\r\n };\r\n /** The form control validator for the date filter. */\r\n this._filterValidator = (control) => {\r\n const controlValue = this._getValidDateOrNull(this._dateAdapter.deserialize(control.value));\r\n return !this._dateFilter || !controlValue || this._dateFilter(controlValue) ?\r\n null : { 'matDatetimePickerFilter': true };\r\n };\r\n /** The combined form control validator for this input. */\r\n this._validator = Validators.compose([this._parseValidator, this._minValidator, this._maxValidator, this._filterValidator]);\r\n /** Whether the last value set on the input was valid. */\r\n this._lastValueValid = false;\r\n if (!this._dateAdapter) {\r\n throw createMissingDateImplError('NgxMatDateAdapter');\r\n }\r\n if (!this._dateFormats) {\r\n throw createMissingDateImplError('NGX_MAT_DATE_FORMATS');\r\n }\r\n // Update the displayed date when the locale changes.\r\n this._localeSubscription = _dateAdapter.localeChanges.subscribe(() => {\r\n this.value = this.value;\r\n });\r\n }\r\n /** The datepicker that this input is associated with. */\r\n set ngxMatDatetimePicker(value) {\r\n if (!value) {\r\n return;\r\n }\r\n this._datepicker = value;\r\n this._datepicker._registerInput(this);\r\n this._datepickerSubscription.unsubscribe();\r\n this._datepickerSubscription = this._datepicker._selectedChanged.subscribe((selected) => {\r\n this.value = selected;\r\n this._cvaOnChange(selected);\r\n this._onTouched();\r\n this.dateInput.emit(new MatDatetimePickerInputEvent(this, this._elementRef.nativeElement));\r\n this.dateChange.emit(new MatDatetimePickerInputEvent(this, this._elementRef.nativeElement));\r\n });\r\n }\r\n /** Function that can be used to filter out dates within the datepicker. */\r\n set ngxMatDatetimePickerFilter(value) {\r\n this._dateFilter = value;\r\n this._validatorOnChange();\r\n }\r\n /** The value of the input. */\r\n get value() { return this._value; }\r\n set value(value) {\r\n value = this._dateAdapter.deserialize(value);\r\n this._lastValueValid = !value || this._dateAdapter.isValid(value);\r\n value = this._getValidDateOrNull(value);\r\n const oldDate = this.value;\r\n this._value = value;\r\n this._formatValue(value);\r\n if (!this._dateAdapter.sameDate(oldDate, value)) {\r\n this._valueChange.emit(value);\r\n }\r\n }\r\n /** The minimum valid date. */\r\n get min() { return this._min; }\r\n set min(value) {\r\n this._min = this._getValidDateOrNull(this._dateAdapter.deserialize(value));\r\n this._validatorOnChange();\r\n }\r\n /** The maximum valid date. */\r\n get max() { return this._max; }\r\n set max(value) {\r\n this._max = this._getValidDateOrNull(this._dateAdapter.deserialize(value));\r\n this._validatorOnChange();\r\n }\r\n /** Whether the datepicker-input is disabled. */\r\n get disabled() { return !!this._disabled; }\r\n set disabled(value) {\r\n const newValue = value != null && `${value}` !== 'false';\r\n const element = this._elementRef.nativeElement;\r\n if (this._disabled !== newValue) {\r\n this._disabled = newValue;\r\n this.stateChanges.emit(undefined);\r\n }\r\n // We need to null check the `blur` method, because it's undefined during SSR.\r\n if (newValue && element.blur) {\r\n // Normally, native input elements automatically blur if they turn disabled. This behavior\r\n // is problematic, because it would mean that it triggers another change detection cycle,\r\n // which then causes a changed after checked error if the input element was focused before.\r\n element.blur();\r\n }\r\n }\r\n ngOnDestroy() {\r\n this._datepickerSubscription.unsubscribe();\r\n this._localeSubscription.unsubscribe();\r\n this._valueChange.complete();\r\n this.stateChanges.complete();\r\n }\r\n /** @docs-private */\r\n registerOnValidatorChange(fn) {\r\n this._validatorOnChange = fn;\r\n }\r\n /** @docs-private */\r\n validate(c) {\r\n return this._validator ? this._validator(c) : null;\r\n }\r\n /**\r\n * @deprecated\r\n * @breaking-change 8.0.0 Use `getConnectedOverlayOrigin` instead\r\n */\r\n getPopupConnectionElementRef() {\r\n return this.getConnectedOverlayOrigin();\r\n }\r\n /**\r\n * Gets the element that the datepicker popup should be connected to.\r\n * @return The element to connect the popup to.\r\n */\r\n getConnectedOverlayOrigin() {\r\n return this._formField ? this._formField.getConnectedOverlayOrigin() : this._elementRef;\r\n }\r\n // Implemented as part of ControlValueAccessor.\r\n writeValue(value) {\r\n this.value = value;\r\n }\r\n // Implemented as part of ControlValueAccessor.\r\n registerOnChange(fn) {\r\n this._cvaOnChange = fn;\r\n }\r\n // Implemented as part of ControlValueAccessor.\r\n registerOnTouched(fn) {\r\n this._onTouched = fn;\r\n }\r\n // Implemented as part of ControlValueAccessor.\r\n setDisabledState(isDisabled) {\r\n this.disabled = isDisabled;\r\n }\r\n _onKeydown(event) {\r\n const isAltDownArrow = event.altKey && event.keyCode === DOWN_ARROW;\r\n if (this._datepicker && isAltDownArrow && !this._elementRef.nativeElement.readOnly) {\r\n this._datepicker.open();\r\n event.preventDefault();\r\n }\r\n }\r\n _onInput(value) {\r\n const lastValueWasValid = this._lastValueValid;\r\n let date = this._dateAdapter.parse(value, this._dateFormats.parse.dateInput);\r\n this._lastValueValid = !date || this._dateAdapter.isValid(date);\r\n date = this._getValidDateOrNull(date);\r\n const isSameTime = this._dateAdapter.isSameTime(date, this._value);\r\n if ((date != null && (!isSameTime || !this._dateAdapter.sameDate(date, this._value)))\r\n || (date == null && this._value != null)) {\r\n this._value = date;\r\n this._cvaOnChange(date);\r\n this._valueChange.emit(date);\r\n this.dateInput.emit(new MatDatetimePickerInputEvent(this, this._elementRef.nativeElement));\r\n }\r\n else if (lastValueWasValid !== this._lastValueValid) {\r\n this._validatorOnChange();\r\n }\r\n }\r\n _onChange() {\r\n this.dateChange.emit(new MatDatetimePickerInputEvent(this, this._elementRef.nativeElement));\r\n }\r\n /** Returns the palette used by the input's form field, if any. */\r\n _getThemePalette() {\r\n return this._formField ? this._formField.color : undefined;\r\n }\r\n /** Handles blur events on the input. */\r\n _onBlur() {\r\n // Reformat the input only if we have a valid value.\r\n if (this.value) {\r\n this._formatValue(this.value);\r\n }\r\n this._onTouched();\r\n }\r\n /** Handles focus events on the input. */\r\n _onFocus() {\r\n // Close datetime picker if opened\r\n if (this._datepicker && this._datepicker.opened) {\r\n this._datepicker.cancel();\r\n }\r\n }\r\n /** Formats a value and sets it on the input element. */\r\n _formatValue(value) {\r\n this._elementRef.nativeElement.value =\r\n value ? this._dateAdapter.format(value, this._dateFormats.display.dateInput) : '';\r\n }\r\n /**\r\n * @param obj The object to check.\r\n * @returns The given object if it is both a date instance and valid, otherwise null.\r\n */\r\n _getValidDateOrNull(obj) {\r\n return (this._dateAdapter.isDateInstance(obj) && this._dateAdapter.isValid(obj)) ? obj : null;\r\n }\r\n}\nNgxMatDatetimeInput.ɵfac = function NgxMatDatetimeInput_Factory(t) { return new (t || NgxMatDatetimeInput)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(NgxMatDateAdapter, 8), ɵngcc0.ɵɵdirectiveInject(NGX_MAT_DATE_FORMATS, 8), ɵngcc0.ɵɵdirectiveInject(ɵngcc7.MatFormField, 8)); };\nNgxMatDatetimeInput.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: NgxMatDatetimeInput, selectors: [[\"input\", \"ngxMatDatetimePicker\", \"\"]], hostVars: 5, hostBindings: function NgxMatDatetimeInput_HostBindings(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵlistener(\"input\", function NgxMatDatetimeInput_input_HostBindingHandler($event) { return ctx._onInput($event.target.value); })(\"change\", function NgxMatDatetimeInput_change_HostBindingHandler() { return ctx._onChange(); })(\"blur\", function NgxMatDatetimeInput_blur_HostBindingHandler() { return ctx._onBlur(); })(\"focus\", function NgxMatDatetimeInput_focus_HostBindingHandler() { return ctx._onFocus(); })(\"keydown\", function NgxMatDatetimeInput_keydown_HostBindingHandler($event) { return ctx._onKeydown($event); });\n } if (rf & 2) {\n ɵngcc0.ɵɵhostProperty(\"disabled\", ctx.disabled);\n ɵngcc0.ɵɵattribute(\"aria-haspopup\", ctx._datepicker ? \"dialog\" : null)(\"aria-owns\", (ctx._datepicker == null ? null : ctx._datepicker.opened) && ctx._datepicker.id || null)(\"min\", ctx.min ? ctx._dateAdapter.toIso8601(ctx.min) : null)(\"max\", ctx.max ? ctx._dateAdapter.toIso8601(ctx.max) : null);\n } }, inputs: { value: \"value\", ngxMatDatetimePicker: \"ngxMatDatetimePicker\", ngxMatDatetimePickerFilter: \"ngxMatDatetimePickerFilter\", min: \"min\", max: \"max\", disabled: \"disabled\" }, outputs: { dateChange: \"dateChange\", dateInput: \"dateInput\" }, exportAs: [\"ngxMatDatetimePickerInput\"], features: [ɵngcc0.ɵɵProvidersFeature([\n MAT_DATEPICKER_VALUE_ACCESSOR,\n MAT_DATEPICKER_VALIDATORS,\n { provide: MAT_INPUT_VALUE_ACCESSOR, useExisting: NgxMatDatetimeInput },\n ])] });\r\n/** @nocollapse */\r\nNgxMatDatetimeInput.ctorParameters = () => [\r\n { type: ElementRef },\r\n { type: NgxMatDateAdapter, decorators: [{ type: Optional }] },\r\n { type: undefined, decorators: [{ type: Optional }, { type: Inject, args: [NGX_MAT_DATE_FORMATS,] }] },\r\n { type: MatFormField, decorators: [{ type: Optional }] }\r\n];\r\nNgxMatDatetimeInput.propDecorators = {\r\n ngxMatDatetimePicker: [{ type: Input }],\r\n ngxMatDatetimePickerFilter: [{ type: Input }],\r\n value: [{ type: Input }],\r\n min: [{ type: Input }],\r\n max: [{ type: Input }],\r\n disabled: [{ type: Input }],\r\n dateChange: [{ type: Output }],\r\n dateInput: [{ type: Output }]\r\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgxMatDatetimeInput, [{\n type: Directive,\n args: [{\n selector: 'input[ngxMatDatetimePicker]',\n providers: [\n MAT_DATEPICKER_VALUE_ACCESSOR,\n MAT_DATEPICKER_VALIDATORS,\n { provide: MAT_INPUT_VALUE_ACCESSOR, useExisting: NgxMatDatetimeInput },\n ],\n host: {\n '[attr.aria-haspopup]': '_datepicker ? \"dialog\" : null',\n '[attr.aria-owns]': '(_datepicker?.opened && _datepicker.id) || null',\n '[attr.min]': 'min ? _dateAdapter.toIso8601(min) : null',\n '[attr.max]': 'max ? _dateAdapter.toIso8601(max) : null',\n '[disabled]': 'disabled',\n '(input)': '_onInput($event.target.value)',\n '(change)': '_onChange()',\n '(blur)': '_onBlur()',\n '(focus)': '_onFocus()',\n '(keydown)': '_onKeydown($event)'\n },\n exportAs: 'ngxMatDatetimePickerInput'\n }]\n }], function () { return [{ type: ɵngcc0.ElementRef }, { type: NgxMatDateAdapter, decorators: [{\n type: Optional\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [NGX_MAT_DATE_FORMATS]\n }] }, { type: ɵngcc7.MatFormField, decorators: [{\n type: Optional\n }] }]; }, { dateChange: [{\n type: Output\n }], dateInput: [{\n type: Output\n }], value: [{\n type: Input\n }], ngxMatDatetimePicker: [{\n type: Input\n }], ngxMatDatetimePickerFilter: [{\n type: Input\n }], min: [{\n type: Input\n }], max: [{\n type: Input\n }], disabled: [{\n type: Input\n }] }); })();\n\nclass NgxMatTimepickerModule {\r\n}\nNgxMatTimepickerModule.ɵfac = function NgxMatTimepickerModule_Factory(t) { return new (t || NgxMatTimepickerModule)(); };\nNgxMatTimepickerModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: NgxMatTimepickerModule });\nNgxMatTimepickerModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({ imports: [[\n CommonModule,\n MatInputModule,\n ReactiveFormsModule,\n FormsModule,\n MatIconModule,\n MatButtonModule,\n ]] });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgxMatTimepickerModule, [{\n type: NgModule,\n args: [{\n imports: [\n CommonModule,\n MatInputModule,\n ReactiveFormsModule,\n FormsModule,\n MatIconModule,\n MatButtonModule,\n ],\n exports: [\n NgxMatTimepickerComponent\n ],\n declarations: [\n NgxMatTimepickerComponent\n ]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(NgxMatTimepickerModule, { declarations: function () { return [NgxMatTimepickerComponent]; }, imports: function () { return [CommonModule,\n MatInputModule,\n ReactiveFormsModule,\n FormsModule,\n MatIconModule,\n MatButtonModule]; }, exports: function () { return [NgxMatTimepickerComponent]; } }); })();\n\nclass NgxMatDatetimePickerModule {\r\n}\nNgxMatDatetimePickerModule.ɵfac = function NgxMatDatetimePickerModule_Factory(t) { return new (t || NgxMatDatetimePickerModule)(); };\nNgxMatDatetimePickerModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: NgxMatDatetimePickerModule });\nNgxMatDatetimePickerModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({ providers: [\n MAT_DATEPICKER_SCROLL_STRATEGY_FACTORY_PROVIDER,\n {\n provide: NGX_MAT_DATE_RANGE_SELECTION_STRATEGY,\n useClass: DefaultNgxMatCalendarRangeStrategy\n }\n ], imports: [[\n CommonModule,\n MatDatepickerModule,\n MatDialogModule,\n PortalModule,\n FormsModule,\n MatIconModule,\n MatButtonModule,\n MatInputModule,\n NgxMatTimepickerModule\n ]] });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgxMatDatetimePickerModule, [{\n type: NgModule,\n args: [{\n imports: [\n CommonModule,\n MatDatepickerModule,\n MatDialogModule,\n PortalModule,\n FormsModule,\n MatIconModule,\n MatButtonModule,\n MatInputModule,\n NgxMatTimepickerModule\n ],\n exports: [\n NgxMatDatetimePicker,\n NgxMatDatetimeInput,\n NgxMatCalendar,\n NgxMatMonthView,\n NgxMatCalendarBody,\n NgxMatYearView,\n NgxMatMultiYearView,\n NgxMatCalendarHeader\n ],\n declarations: [\n NgxMatDatetimePicker,\n NgxMatDatetimeContent,\n NgxMatDatetimeInput,\n NgxMatCalendar,\n NgxMatMonthView,\n NgxMatCalendarBody,\n NgxMatYearView,\n NgxMatMultiYearView,\n NgxMatCalendarHeader\n ],\n entryComponents: [\n NgxMatDatetimeContent,\n NgxMatCalendarHeader\n ],\n providers: [\n MAT_DATEPICKER_SCROLL_STRATEGY_FACTORY_PROVIDER,\n {\n provide: NGX_MAT_DATE_RANGE_SELECTION_STRATEGY,\n useClass: DefaultNgxMatCalendarRangeStrategy\n }\n ]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(NgxMatDatetimePickerModule, { declarations: function () { return [NgxMatDatetimePicker, NgxMatDatetimeContent, NgxMatDatetimeInput, NgxMatCalendar, NgxMatMonthView, NgxMatCalendarBody, NgxMatYearView, NgxMatMultiYearView, NgxMatCalendarHeader]; }, imports: function () { return [CommonModule,\n MatDatepickerModule,\n MatDialogModule,\n PortalModule,\n FormsModule,\n MatIconModule,\n MatButtonModule,\n MatInputModule, NgxMatTimepickerModule]; }, exports: function () { return [NgxMatDatetimePicker, NgxMatDatetimeInput, NgxMatCalendar, NgxMatMonthView, NgxMatCalendarBody, NgxMatYearView, NgxMatMultiYearView, NgxMatCalendarHeader]; } }); })();\n\n/**\r\n * @license\r\n * Copyright Google LLC All Rights Reserved.\r\n *\r\n * Use of this source code is governed by an MIT-style license that can be\r\n * found in the LICENSE file at https://angular.io/license\r\n */\r\n// TODO(mmalerba): Remove when we no longer support safari 9.\r\n/** Whether the browser supports the Intl API. */\r\nlet SUPPORTS_INTL_API;\r\n// We need a try/catch around the reference to `Intl`, because accessing it in some cases can\r\n// cause IE to throw. These cases are tied to particular versions of Windows and can happen if\r\n// the consumer is providing a polyfilled `Map`. See:\r\n// https://github.com/Microsoft/ChakraCore/issues/3189\r\n// https://github.com/angular/components/issues/15687\r\ntry {\r\n SUPPORTS_INTL_API = typeof Intl != 'undefined';\r\n}\r\ncatch (_a) {\r\n SUPPORTS_INTL_API = false;\r\n}\r\n/** The default month names to use if Intl API is not available. */\r\nconst DEFAULT_MONTH_NAMES = {\r\n 'long': [\r\n 'January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September',\r\n 'October', 'November', 'December'\r\n ],\r\n 'short': ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],\r\n 'narrow': ['J', 'F', 'M', 'A', 'M', 'J', 'J', 'A', 'S', 'O', 'N', 'D']\r\n};\r\nconst ɵ0$1 = i => String(i + 1);\r\n/** The default date names to use if Intl API is not available. */\r\nconst DEFAULT_DATE_NAMES = range(31, ɵ0$1);\r\n/** The default day of the week names to use if Intl API is not available. */\r\nconst DEFAULT_DAY_OF_WEEK_NAMES = {\r\n 'long': ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'],\r\n 'short': ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'],\r\n 'narrow': ['S', 'M', 'T', 'W', 'T', 'F', 'S']\r\n};\r\n/**\r\n * Matches strings that have the form of a valid RFC 3339 string\r\n * (https://tools.ietf.org/html/rfc3339). Note that the string may not actually be a valid date\r\n * because the regex will match strings an with out of bounds month, date, etc.\r\n */\r\nconst ISO_8601_REGEX = /^\\d{4}-\\d{2}-\\d{2}(?:T\\d{2}:\\d{2}:\\d{2}(?:\\.\\d+)?(?:Z|(?:(?:\\+|-)\\d{2}:\\d{2}))?)?$/;\r\n/** Creates an array and fills it with values. */\r\nfunction range(length, valueFunction) {\r\n const valuesArray = Array(length);\r\n for (let i = 0; i < length; i++) {\r\n valuesArray[i] = valueFunction(i);\r\n }\r\n return valuesArray;\r\n}\r\n/** Adapts the native JS Date for use with cdk-based components that work with dates. */\r\nclass NgxMatNativeDateAdapter extends NgxMatDateAdapter {\r\n constructor(matDateLocale, platform) {\r\n super();\r\n /**\r\n * Whether to use `timeZone: 'utc'` with `Intl.DateTimeFormat` when formatting dates.\r\n * Without this `Intl.DateTimeFormat` sometimes chooses the wrong timeZone, which can throw off\r\n * the result. (e.g. in the en-US locale `new Date(1800, 7, 14).toLocaleDateString()`\r\n * will produce `'8/13/1800'`.\r\n *\r\n * TODO(mmalerba): drop this variable. It's not being used in the code right now. We're now\r\n * getting the string representation of a Date object from its utc representation. We're keeping\r\n * it here for sometime, just for precaution, in case we decide to revert some of these changes\r\n * though.\r\n */\r\n this.useUtcForDisplay = true;\r\n super.setLocale(matDateLocale);\r\n // IE does its own time zone correction, so we disable this on IE.\r\n this.useUtcForDisplay = !platform.TRIDENT;\r\n this._clampDate = platform.TRIDENT || platform.EDGE;\r\n }\r\n getYear(date) {\r\n return date.getFullYear();\r\n }\r\n getMonth(date) {\r\n return date.getMonth();\r\n }\r\n getDate(date) {\r\n return date.getDate();\r\n }\r\n getDayOfWeek(date) {\r\n return date.getDay();\r\n }\r\n getMonthNames(style) {\r\n if (SUPPORTS_INTL_API) {\r\n const dtf = new Intl.DateTimeFormat(this.locale, { month: style, timeZone: 'utc' });\r\n return range(12, i => this._stripDirectionalityCharacters(this._format(dtf, new Date(2017, i, 1))));\r\n }\r\n return DEFAULT_MONTH_NAMES[style];\r\n }\r\n getDateNames() {\r\n if (SUPPORTS_INTL_API) {\r\n const dtf = new Intl.DateTimeFormat(this.locale, { day: 'numeric', timeZone: 'utc' });\r\n return range(31, i => this._stripDirectionalityCharacters(this._format(dtf, new Date(2017, 0, i + 1))));\r\n }\r\n return DEFAULT_DATE_NAMES;\r\n }\r\n getDayOfWeekNames(style) {\r\n if (SUPPORTS_INTL_API) {\r\n const dtf = new Intl.DateTimeFormat(this.locale, { weekday: style, timeZone: 'utc' });\r\n return range(7, i => this._stripDirectionalityCharacters(this._format(dtf, new Date(2017, 0, i + 1))));\r\n }\r\n return DEFAULT_DAY_OF_WEEK_NAMES[style];\r\n }\r\n getYearName(date) {\r\n if (SUPPORTS_INTL_API) {\r\n const dtf = new Intl.DateTimeFormat(this.locale, { year: 'numeric', timeZone: 'utc' });\r\n return this._stripDirectionalityCharacters(this._format(dtf, date));\r\n }\r\n return String(this.getYear(date));\r\n }\r\n getFirstDayOfWeek() {\r\n // We can't tell using native JS Date what the first day of the week is, we default to Sunday.\r\n return 0;\r\n }\r\n getNumDaysInMonth(date) {\r\n return this.getDate(this._createDateWithOverflow(this.getYear(date), this.getMonth(date) + 1, 0));\r\n }\r\n clone(date) {\r\n return new Date(date.getTime());\r\n }\r\n createDate(year, month, date) {\r\n // Check for invalid month and date (except upper bound on date which we have to check after\r\n // creating the Date).\r\n if (month < 0 || month > 11) {\r\n throw Error(`Invalid month index \"${month}\". Month index has to be between 0 and 11.`);\r\n }\r\n if (date < 1) {\r\n throw Error(`Invalid date \"${date}\". Date has to be greater than 0.`);\r\n }\r\n let result = this._createDateWithOverflow(year, month, date);\r\n // Check that the date wasn't above the upper bound for the month, causing the month to overflow\r\n if (result.getMonth() != month) {\r\n throw Error(`Invalid date \"${date}\" for month with index \"${month}\".`);\r\n }\r\n return result;\r\n }\r\n today() {\r\n return new Date();\r\n }\r\n parse(value) {\r\n // We have no way using the native JS Date to set the parse format or locale, so we ignore these\r\n // parameters.\r\n if (typeof value == 'number') {\r\n return new Date(value);\r\n }\r\n return value ? new Date(Date.parse(value)) : null;\r\n }\r\n format(date, displayFormat) {\r\n if (!this.isValid(date)) {\r\n throw Error('NativeDateAdapter: Cannot format invalid date.');\r\n }\r\n if (SUPPORTS_INTL_API) {\r\n // On IE and Edge the i18n API will throw a hard error that can crash the entire app\r\n // if we attempt to format a date whose year is less than 1 or greater than 9999.\r\n if (this._clampDate && (date.getFullYear() < 1 || date.getFullYear() > 9999)) {\r\n date = this.clone(date);\r\n date.setFullYear(Math.max(1, Math.min(9999, date.getFullYear())));\r\n }\r\n displayFormat = Object.assign(Object.assign({}, displayFormat), { timeZone: 'utc' });\r\n const dtf = new Intl.DateTimeFormat(this.locale, displayFormat);\r\n return this._stripDirectionalityCharacters(this._format(dtf, date));\r\n }\r\n return this._stripDirectionalityCharacters(date.toDateString());\r\n }\r\n addCalendarYears(date, years) {\r\n return this.addCalendarMonths(date, years * 12);\r\n }\r\n addCalendarMonths(date, months) {\r\n let newDate = this._createDateWithOverflow(this.getYear(date), this.getMonth(date) + months, this.getDate(date));\r\n // It's possible to wind up in the wrong month if the original month has more days than the new\r\n // month. In this case we want to go to the last day of the desired month.\r\n // Note: the additional + 12 % 12 ensures we end up with a positive number, since JS % doesn't\r\n // guarantee this.\r\n if (this.getMonth(newDate) != ((this.getMonth(date) + months) % 12 + 12) % 12) {\r\n newDate = this._createDateWithOverflow(this.getYear(newDate), this.getMonth(newDate), 0);\r\n }\r\n return newDate;\r\n }\r\n addCalendarDays(date, days) {\r\n return this._createDateWithOverflow(this.getYear(date), this.getMonth(date), this.getDate(date) + days);\r\n }\r\n toIso8601(date) {\r\n return [\r\n date.getUTCFullYear(),\r\n this._2digit(date.getUTCMonth() + 1),\r\n this._2digit(date.getUTCDate())\r\n ].join('-');\r\n }\r\n /**\r\n * Returns the given value if given a valid Date or null. Deserializes valid ISO 8601 strings\r\n * (https://www.ietf.org/rfc/rfc3339.txt) into valid Dates and empty string into null. Returns an\r\n * invalid date for all other values.\r\n */\r\n deserialize(value) {\r\n if (typeof value === 'string') {\r\n if (!value) {\r\n return null;\r\n }\r\n // The `Date` constructor accepts formats other than ISO 8601, so we need to make sure the\r\n // string is the right format first.\r\n if (ISO_8601_REGEX.test(value)) {\r\n let date = new Date(value);\r\n if (this.isValid(date)) {\r\n return date;\r\n }\r\n }\r\n }\r\n return super.deserialize(value);\r\n }\r\n isDateInstance(obj) {\r\n return obj instanceof Date;\r\n }\r\n isValid(date) {\r\n return !isNaN(date.getTime());\r\n }\r\n invalid() {\r\n return new Date(NaN);\r\n }\r\n getHour(date) {\r\n return date.getHours();\r\n }\r\n getMinute(date) {\r\n return date.getMinutes();\r\n }\r\n getSecond(date) {\r\n return date.getSeconds();\r\n }\r\n setHour(date, value) {\r\n date.setHours(value);\r\n }\r\n setMinute(date, value) {\r\n date.setMinutes(value);\r\n }\r\n setSecond(date, value) {\r\n date.setSeconds(value);\r\n }\r\n /** Creates a date but allows the month and date to overflow. */\r\n _createDateWithOverflow(year, month, date) {\r\n const result = new Date(year, month, date);\r\n // We need to correct for the fact that JS native Date treats years in range [0, 99] as\r\n // abbreviations for 19xx.\r\n if (year >= 0 && year < 100) {\r\n result.setFullYear(this.getYear(result) - 1900);\r\n }\r\n return result;\r\n }\r\n /**\r\n * Pads a number to make it two digits.\r\n * @param n The number to pad.\r\n * @returns The padded number.\r\n */\r\n _2digit(n) {\r\n return ('00' + n).slice(-2);\r\n }\r\n /**\r\n * Strip out unicode LTR and RTL characters. Edge and IE insert these into formatted dates while\r\n * other browsers do not. We remove them to make output consistent and because they interfere with\r\n * date parsing.\r\n * @param str The string to strip direction characters from.\r\n * @returns The stripped string.\r\n */\r\n _stripDirectionalityCharacters(str) {\r\n return str.replace(/[\\u200e\\u200f]/g, '');\r\n }\r\n /**\r\n * When converting Date object to string, javascript built-in functions may return wrong\r\n * results because it applies its internal DST rules. The DST rules around the world change\r\n * very frequently, and the current valid rule is not always valid in previous years though.\r\n * We work around this problem building a new Date object which has its internal UTC\r\n * representation with the local date and time.\r\n * @param dtf Intl.DateTimeFormat object, containg the desired string format. It must have\r\n * timeZone set to 'utc' to work fine.\r\n * @param date Date from which we want to get the string representation according to dtf\r\n * @returns A Date object with its UTC representation based on the passed in date info\r\n */\r\n _format(dtf, date) {\r\n // Passing the year to the constructor causes year numbers <100 to be converted to 19xx.\r\n // To work around this we use `setUTCFullYear` and `setUTCHours` instead.\r\n const d = new Date();\r\n d.setUTCFullYear(date.getFullYear(), date.getMonth(), date.getDate());\r\n d.setUTCHours(date.getHours(), date.getMinutes(), date.getSeconds(), date.getMilliseconds());\r\n return dtf.format(d);\r\n }\r\n}\nNgxMatNativeDateAdapter.ɵfac = function NgxMatNativeDateAdapter_Factory(t) { return new (t || NgxMatNativeDateAdapter)(ɵngcc0.ɵɵinject(MAT_DATE_LOCALE, 8), ɵngcc0.ɵɵinject(ɵngcc12.Platform)); };\nNgxMatNativeDateAdapter.ɵprov = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjectable({ token: NgxMatNativeDateAdapter, factory: NgxMatNativeDateAdapter.ɵfac });\r\n/** @nocollapse */\r\nNgxMatNativeDateAdapter.ctorParameters = () => [\r\n { type: String, decorators: [{ type: Optional }, { type: Inject, args: [MAT_DATE_LOCALE,] }] },\r\n { type: Platform }\r\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgxMatNativeDateAdapter, [{\n type: Injectable\n }], function () { return [{ type: String, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [MAT_DATE_LOCALE]\n }] }, { type: ɵngcc12.Platform }]; }, null); })();\n\n/**\r\n * @license\r\n * Copyright Google LLC All Rights Reserved.\r\n *\r\n * Use of this source code is governed by an MIT-style license that can be\r\n * found in the LICENSE file at https://angular.io/license\r\n */\r\nconst DEFAULT_DATE_INPUT = {\r\n year: 'numeric', month: 'numeric', day: 'numeric',\r\n hour12: false, hour: \"2-digit\", minute: \"2-digit\", second: \"2-digit\"\r\n};\r\nconst NGX_MAT_NATIVE_DATE_FORMATS = {\r\n parse: {\r\n dateInput: DEFAULT_DATE_INPUT,\r\n },\r\n display: {\r\n dateInput: DEFAULT_DATE_INPUT,\r\n monthYearLabel: { year: 'numeric', month: 'short' },\r\n dateA11yLabel: { year: 'numeric', month: 'long', day: 'numeric' },\r\n monthYearA11yLabel: { year: 'numeric', month: 'long' },\r\n }\r\n};\n\n/**\r\n * @license\r\n * Copyright Google LLC All Rights Reserved.\r\n *\r\n * Use of this source code is governed by an MIT-style license that can be\r\n * found in the LICENSE file at https://angular.io/license\r\n */\r\nclass NgxNativeDateModule {\r\n}\nNgxNativeDateModule.ɵfac = function NgxNativeDateModule_Factory(t) { return new (t || NgxNativeDateModule)(); };\nNgxNativeDateModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: NgxNativeDateModule });\nNgxNativeDateModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({ providers: [\n { provide: NgxMatDateAdapter, useClass: NgxMatNativeDateAdapter },\n ], imports: [[PlatformModule]] });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgxNativeDateModule, [{\n type: NgModule,\n args: [{\n imports: [PlatformModule],\n providers: [\n { provide: NgxMatDateAdapter, useClass: NgxMatNativeDateAdapter },\n ]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(NgxNativeDateModule, { imports: function () { return [PlatformModule]; } }); })();\r\nconst ɵ0 = NGX_MAT_NATIVE_DATE_FORMATS;\r\nclass NgxMatNativeDateModule {\r\n}\nNgxMatNativeDateModule.ɵfac = function NgxMatNativeDateModule_Factory(t) { return new (t || NgxMatNativeDateModule)(); };\nNgxMatNativeDateModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: NgxMatNativeDateModule });\nNgxMatNativeDateModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({ providers: [{ provide: NGX_MAT_DATE_FORMATS, useValue: ɵ0 }], imports: [[NgxNativeDateModule]] });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgxMatNativeDateModule, [{\n type: NgModule,\n args: [{\n imports: [NgxNativeDateModule],\n providers: [{ provide: NGX_MAT_DATE_FORMATS, useValue: ɵ0 }]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(NgxMatNativeDateModule, { imports: [NgxNativeDateModule] }); })();\n\n/*\r\n * Public API Surface of ngx-mat-datetime-picker\r\n */\n\n/**\r\n * Generated bundle index. Do not edit.\r\n */\n\nexport { DefaultNgxMatCalendarRangeStrategy, MAT_DATEPICKER_VALIDATORS, MAT_DATEPICKER_VALUE_ACCESSOR, MatDatetimePickerInputEvent, NGX_MAT_DATE_FORMATS, NGX_MAT_DATE_RANGE_SELECTION_STRATEGY, NGX_MAT_NATIVE_DATE_FORMATS, NgxMatCalendar, NgxMatCalendarBody, NgxMatCalendarCell, NgxMatCalendarHeader, NgxMatDateAdapter, NgxMatDatetimeContent, NgxMatDatetimeInput, NgxMatDatetimePicker, NgxMatDatetimePickerModule, NgxMatMonthView, NgxMatMultiYearView, NgxMatNativeDateAdapter, NgxMatNativeDateModule, NgxMatTimepickerComponent, NgxMatTimepickerModule, NgxMatYearView, NgxNativeDateModule, getActiveOffset, isSameMultiYearView, yearsPerPage, yearsPerRow };\n\n//# sourceMappingURL=angular-material-components-datetime-picker.js.map","/**\n * @license Angular v12.1.3\n * (c) 2010-2021 Google LLC. https://angular.io/\n * License: MIT\n */\n\n/**\n * An injectable service that produces an animation sequence programmatically within an\n * Angular component or directive.\n * Provided by the `BrowserAnimationsModule` or `NoopAnimationsModule`.\n *\n * @usageNotes\n *\n * To use this service, add it to your component or directive as a dependency.\n * The service is instantiated along with your component.\n *\n * Apps do not typically need to create their own animation players, but if you\n * do need to, follow these steps:\n *\n * 1. Use the `build()` method to create a programmatic animation using the\n * `animate()` function. The method returns an `AnimationFactory` instance.\n *\n * 2. Use the factory object to create an `AnimationPlayer` and attach it to a DOM element.\n *\n * 3. Use the player object to control the animation programmatically.\n *\n * For example:\n *\n * ```ts\n * // import the service from BrowserAnimationsModule\n * import {AnimationBuilder} from '@angular/animations';\n * // require the service as a dependency\n * class MyCmp {\n * constructor(private _builder: AnimationBuilder) {}\n *\n * makeAnimation(element: any) {\n * // first define a reusable animation\n * const myAnimation = this._builder.build([\n * style({ width: 0 }),\n * animate(1000, style({ width: '100px' }))\n * ]);\n *\n * // use the returned factory object to create a player\n * const player = myAnimation.create(element);\n *\n * player.play();\n * }\n * }\n * ```\n *\n * @publicApi\n */\nclass AnimationBuilder {\n}\n/**\n * A factory object returned from the `AnimationBuilder`.`build()` method.\n *\n * @publicApi\n */\nclass AnimationFactory {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Specifies automatic styling.\n *\n * @publicApi\n */\nconst AUTO_STYLE = '*';\n/**\n * Creates a named animation trigger, containing a list of `state()`\n * and `transition()` entries to be evaluated when the expression\n * bound to the trigger changes.\n *\n * @param name An identifying string.\n * @param definitions An animation definition object, containing an array of `state()`\n * and `transition()` declarations.\n *\n * @return An object that encapsulates the trigger data.\n *\n * @usageNotes\n * Define an animation trigger in the `animations` section of `@Component` metadata.\n * In the template, reference the trigger by name and bind it to a trigger expression that\n * evaluates to a defined animation state, using the following format:\n *\n * `[@triggerName]=\"expression\"`\n *\n * Animation trigger bindings convert all values to strings, and then match the\n * previous and current values against any linked transitions.\n * Booleans can be specified as `1` or `true` and `0` or `false`.\n *\n * ### Usage Example\n *\n * The following example creates an animation trigger reference based on the provided\n * name value.\n * The provided animation value is expected to be an array consisting of state and\n * transition declarations.\n *\n * ```typescript\n * @Component({\n * selector: \"my-component\",\n * templateUrl: \"my-component-tpl.html\",\n * animations: [\n * trigger(\"myAnimationTrigger\", [\n * state(...),\n * state(...),\n * transition(...),\n * transition(...)\n * ])\n * ]\n * })\n * class MyComponent {\n * myStatusExp = \"something\";\n * }\n * ```\n *\n * The template associated with this component makes use of the defined trigger\n * by binding to an element within its template code.\n *\n * ```html\n * \n *
...
\n * ```\n *\n * ### Using an inline function\n * The `transition` animation method also supports reading an inline function which can decide\n * if its associated animation should be run.\n *\n * ```typescript\n * // this method is run each time the `myAnimationTrigger` trigger value changes.\n * function myInlineMatcherFn(fromState: string, toState: string, element: any, params: {[key:\n string]: any}): boolean {\n * // notice that `element` and `params` are also available here\n * return toState == 'yes-please-animate';\n * }\n *\n * @Component({\n * selector: 'my-component',\n * templateUrl: 'my-component-tpl.html',\n * animations: [\n * trigger('myAnimationTrigger', [\n * transition(myInlineMatcherFn, [\n * // the animation sequence code\n * ]),\n * ])\n * ]\n * })\n * class MyComponent {\n * myStatusExp = \"yes-please-animate\";\n * }\n * ```\n *\n * ### Disabling Animations\n * When true, the special animation control binding `@.disabled` binding prevents\n * all animations from rendering.\n * Place the `@.disabled` binding on an element to disable\n * animations on the element itself, as well as any inner animation triggers\n * within the element.\n *\n * The following example shows how to use this feature:\n *\n * ```typescript\n * @Component({\n * selector: 'my-component',\n * template: `\n *
\n * \n *
\n * `,\n * animations: [\n * trigger(\"childAnimation\", [\n * // ...\n * ])\n * ]\n * })\n * class MyComponent {\n * isDisabled = true;\n * exp = '...';\n * }\n * ```\n *\n * When `@.disabled` is true, it prevents the `@childAnimation` trigger from animating,\n * along with any inner animations.\n *\n * ### Disable animations application-wide\n * When an area of the template is set to have animations disabled,\n * **all** inner components have their animations disabled as well.\n * This means that you can disable all animations for an app\n * by placing a host binding set on `@.disabled` on the topmost Angular component.\n *\n * ```typescript\n * import {Component, HostBinding} from '@angular/core';\n *\n * @Component({\n * selector: 'app-component',\n * templateUrl: 'app.component.html',\n * })\n * class AppComponent {\n * @HostBinding('@.disabled')\n * public animationsDisabled = true;\n * }\n * ```\n *\n * ### Overriding disablement of inner animations\n * Despite inner animations being disabled, a parent animation can `query()`\n * for inner elements located in disabled areas of the template and still animate\n * them if needed. This is also the case for when a sub animation is\n * queried by a parent and then later animated using `animateChild()`.\n *\n * ### Detecting when an animation is disabled\n * If a region of the DOM (or the entire application) has its animations disabled, the animation\n * trigger callbacks still fire, but for zero seconds. When the callback fires, it provides\n * an instance of an `AnimationEvent`. If animations are disabled,\n * the `.disabled` flag on the event is true.\n *\n * @publicApi\n */\nfunction trigger(name, definitions) {\n return { type: 7 /* Trigger */, name, definitions, options: {} };\n}\n/**\n * Defines an animation step that combines styling information with timing information.\n *\n * @param timings Sets `AnimateTimings` for the parent animation.\n * A string in the format \"duration [delay] [easing]\".\n * - Duration and delay are expressed as a number and optional time unit,\n * such as \"1s\" or \"10ms\" for one second and 10 milliseconds, respectively.\n * The default unit is milliseconds.\n * - The easing value controls how the animation accelerates and decelerates\n * during its runtime. Value is one of `ease`, `ease-in`, `ease-out`,\n * `ease-in-out`, or a `cubic-bezier()` function call.\n * If not supplied, no easing is applied.\n *\n * For example, the string \"1s 100ms ease-out\" specifies a duration of\n * 1000 milliseconds, and delay of 100 ms, and the \"ease-out\" easing style,\n * which decelerates near the end of the duration.\n * @param styles Sets AnimationStyles for the parent animation.\n * A function call to either `style()` or `keyframes()`\n * that returns a collection of CSS style entries to be applied to the parent animation.\n * When null, uses the styles from the destination state.\n * This is useful when describing an animation step that will complete an animation;\n * see \"Animating to the final state\" in `transitions()`.\n * @returns An object that encapsulates the animation step.\n *\n * @usageNotes\n * Call within an animation `sequence()`, `{@link animations/group group()}`, or\n * `transition()` call to specify an animation step\n * that applies given style data to the parent animation for a given amount of time.\n *\n * ### Syntax Examples\n * **Timing examples**\n *\n * The following examples show various `timings` specifications.\n * - `animate(500)` : Duration is 500 milliseconds.\n * - `animate(\"1s\")` : Duration is 1000 milliseconds.\n * - `animate(\"100ms 0.5s\")` : Duration is 100 milliseconds, delay is 500 milliseconds.\n * - `animate(\"5s ease-in\")` : Duration is 5000 milliseconds, easing in.\n * - `animate(\"5s 10ms cubic-bezier(.17,.67,.88,.1)\")` : Duration is 5000 milliseconds, delay is 10\n * milliseconds, easing according to a bezier curve.\n *\n * **Style examples**\n *\n * The following example calls `style()` to set a single CSS style.\n * ```typescript\n * animate(500, style({ background: \"red\" }))\n * ```\n * The following example calls `keyframes()` to set a CSS style\n * to different values for successive keyframes.\n * ```typescript\n * animate(500, keyframes(\n * [\n * style({ background: \"blue\" }),\n * style({ background: \"red\" })\n * ])\n * ```\n *\n * @publicApi\n */\nfunction animate(timings, styles = null) {\n return { type: 4 /* Animate */, styles, timings };\n}\n/**\n * @description Defines a list of animation steps to be run in parallel.\n *\n * @param steps An array of animation step objects.\n * - When steps are defined by `style()` or `animate()`\n * function calls, each call within the group is executed instantly.\n * - To specify offset styles to be applied at a later time, define steps with\n * `keyframes()`, or use `animate()` calls with a delay value.\n * For example:\n *\n * ```typescript\n * group([\n * animate(\"1s\", style({ background: \"black\" })),\n * animate(\"2s\", style({ color: \"white\" }))\n * ])\n * ```\n *\n * @param options An options object containing a delay and\n * developer-defined parameters that provide styling defaults and\n * can be overridden on invocation.\n *\n * @return An object that encapsulates the group data.\n *\n * @usageNotes\n * Grouped animations are useful when a series of styles must be\n * animated at different starting times and closed off at different ending times.\n *\n * When called within a `sequence()` or a\n * `transition()` call, does not continue to the next\n * instruction until all of the inner animation steps have completed.\n *\n * @publicApi\n */\nfunction group(steps, options = null) {\n return { type: 3 /* Group */, steps, options };\n}\n/**\n * Defines a list of animation steps to be run sequentially, one by one.\n *\n * @param steps An array of animation step objects.\n * - Steps defined by `style()` calls apply the styling data immediately.\n * - Steps defined by `animate()` calls apply the styling data over time\n * as specified by the timing data.\n *\n * ```typescript\n * sequence([\n * style({ opacity: 0 }),\n * animate(\"1s\", style({ opacity: 1 }))\n * ])\n * ```\n *\n * @param options An options object containing a delay and\n * developer-defined parameters that provide styling defaults and\n * can be overridden on invocation.\n *\n * @return An object that encapsulates the sequence data.\n *\n * @usageNotes\n * When you pass an array of steps to a\n * `transition()` call, the steps run sequentially by default.\n * Compare this to the `{@link animations/group group()}` call, which runs animation steps in\n *parallel.\n *\n * When a sequence is used within a `{@link animations/group group()}` or a `transition()` call,\n * execution continues to the next instruction only after each of the inner animation\n * steps have completed.\n *\n * @publicApi\n **/\nfunction sequence(steps, options = null) {\n return { type: 2 /* Sequence */, steps, options };\n}\n/**\n * Declares a key/value object containing CSS properties/styles that\n * can then be used for an animation `state`, within an animation `sequence`,\n * or as styling data for calls to `animate()` and `keyframes()`.\n *\n * @param tokens A set of CSS styles or HTML styles associated with an animation state.\n * The value can be any of the following:\n * - A key-value style pair associating a CSS property with a value.\n * - An array of key-value style pairs.\n * - An asterisk (*), to use auto-styling, where styles are derived from the element\n * being animated and applied to the animation when it starts.\n *\n * Auto-styling can be used to define a state that depends on layout or other\n * environmental factors.\n *\n * @return An object that encapsulates the style data.\n *\n * @usageNotes\n * The following examples create animation styles that collect a set of\n * CSS property values:\n *\n * ```typescript\n * // string values for CSS properties\n * style({ background: \"red\", color: \"blue\" })\n *\n * // numerical pixel values\n * style({ width: 100, height: 0 })\n * ```\n *\n * The following example uses auto-styling to allow a component to animate from\n * a height of 0 up to the height of the parent element:\n *\n * ```\n * style({ height: 0 }),\n * animate(\"1s\", style({ height: \"*\" }))\n * ```\n *\n * @publicApi\n **/\nfunction style(tokens) {\n return { type: 6 /* Style */, styles: tokens, offset: null };\n}\n/**\n * Declares an animation state within a trigger attached to an element.\n *\n * @param name One or more names for the defined state in a comma-separated string.\n * The following reserved state names can be supplied to define a style for specific use\n * cases:\n *\n * - `void` You can associate styles with this name to be used when\n * the element is detached from the application. For example, when an `ngIf` evaluates\n * to false, the state of the associated element is void.\n * - `*` (asterisk) Indicates the default state. You can associate styles with this name\n * to be used as the fallback when the state that is being animated is not declared\n * within the trigger.\n *\n * @param styles A set of CSS styles associated with this state, created using the\n * `style()` function.\n * This set of styles persists on the element once the state has been reached.\n * @param options Parameters that can be passed to the state when it is invoked.\n * 0 or more key-value pairs.\n * @return An object that encapsulates the new state data.\n *\n * @usageNotes\n * Use the `trigger()` function to register states to an animation trigger.\n * Use the `transition()` function to animate between states.\n * When a state is active within a component, its associated styles persist on the element,\n * even when the animation ends.\n *\n * @publicApi\n **/\nfunction state(name, styles, options) {\n return { type: 0 /* State */, name, styles, options };\n}\n/**\n * Defines a set of animation styles, associating each style with an optional `offset` value.\n *\n * @param steps A set of animation styles with optional offset data.\n * The optional `offset` value for a style specifies a percentage of the total animation\n * time at which that style is applied.\n * @returns An object that encapsulates the keyframes data.\n *\n * @usageNotes\n * Use with the `animate()` call. Instead of applying animations\n * from the current state\n * to the destination state, keyframes describe how each style entry is applied and at what point\n * within the animation arc.\n * Compare [CSS Keyframe Animations](https://www.w3schools.com/css/css3_animations.asp).\n *\n * ### Usage\n *\n * In the following example, the offset values describe\n * when each `backgroundColor` value is applied. The color is red at the start, and changes to\n * blue when 20% of the total time has elapsed.\n *\n * ```typescript\n * // the provided offset values\n * animate(\"5s\", keyframes([\n * style({ backgroundColor: \"red\", offset: 0 }),\n * style({ backgroundColor: \"blue\", offset: 0.2 }),\n * style({ backgroundColor: \"orange\", offset: 0.3 }),\n * style({ backgroundColor: \"black\", offset: 1 })\n * ]))\n * ```\n *\n * If there are no `offset` values specified in the style entries, the offsets\n * are calculated automatically.\n *\n * ```typescript\n * animate(\"5s\", keyframes([\n * style({ backgroundColor: \"red\" }) // offset = 0\n * style({ backgroundColor: \"blue\" }) // offset = 0.33\n * style({ backgroundColor: \"orange\" }) // offset = 0.66\n * style({ backgroundColor: \"black\" }) // offset = 1\n * ]))\n *```\n\n * @publicApi\n */\nfunction keyframes(steps) {\n return { type: 5 /* Keyframes */, steps };\n}\n/**\n * Declares an animation transition as a sequence of animation steps to run when a given\n * condition is satisfied. The condition is a Boolean expression or function that compares\n * the previous and current animation states, and returns true if this transition should occur.\n * When the state criteria of a defined transition are met, the associated animation is\n * triggered.\n *\n * @param stateChangeExpr A Boolean expression or function that compares the previous and current\n * animation states, and returns true if this transition should occur. Note that \"true\" and \"false\"\n * match 1 and 0, respectively. An expression is evaluated each time a state change occurs in the\n * animation trigger element.\n * The animation steps run when the expression evaluates to true.\n *\n * - A state-change string takes the form \"state1 => state2\", where each side is a defined animation\n * state, or an asterix (*) to refer to a dynamic start or end state.\n * - The expression string can contain multiple comma-separated statements;\n * for example \"state1 => state2, state3 => state4\".\n * - Special values `:enter` and `:leave` initiate a transition on the entry and exit states,\n * equivalent to \"void => *\" and \"* => void\".\n * - Special values `:increment` and `:decrement` initiate a transition when a numeric value has\n * increased or decreased in value.\n * - A function is executed each time a state change occurs in the animation trigger element.\n * The animation steps run when the function returns true.\n *\n * @param steps One or more animation objects, as returned by the `animate()` or\n * `sequence()` function, that form a transformation from one state to another.\n * A sequence is used by default when you pass an array.\n * @param options An options object that can contain a delay value for the start of the animation,\n * and additional developer-defined parameters. Provided values for additional parameters are used\n * as defaults, and override values can be passed to the caller on invocation.\n * @returns An object that encapsulates the transition data.\n *\n * @usageNotes\n * The template associated with a component binds an animation trigger to an element.\n *\n * ```HTML\n * \n *
...
\n * ```\n *\n * All transitions are defined within an animation trigger,\n * along with named states that the transitions change to and from.\n *\n * ```typescript\n * trigger(\"myAnimationTrigger\", [\n * // define states\n * state(\"on\", style({ background: \"green\" })),\n * state(\"off\", style({ background: \"grey\" })),\n * ...]\n * ```\n *\n * Note that when you call the `sequence()` function within a `{@link animations/group group()}`\n * or a `transition()` call, execution does not continue to the next instruction\n * until each of the inner animation steps have completed.\n *\n * ### Syntax examples\n *\n * The following examples define transitions between the two defined states (and default states),\n * using various options:\n *\n * ```typescript\n * // Transition occurs when the state value\n * // bound to \"myAnimationTrigger\" changes from \"on\" to \"off\"\n * transition(\"on => off\", animate(500))\n * // Run the same animation for both directions\n * transition(\"on <=> off\", animate(500))\n * // Define multiple state-change pairs separated by commas\n * transition(\"on => off, off => void\", animate(500))\n * ```\n *\n * ### Special values for state-change expressions\n *\n * - Catch-all state change for when an element is inserted into the page and the\n * destination state is unknown:\n *\n * ```typescript\n * transition(\"void => *\", [\n * style({ opacity: 0 }),\n * animate(500)\n * ])\n * ```\n *\n * - Capture a state change between any states:\n *\n * `transition(\"* => *\", animate(\"1s 0s\"))`\n *\n * - Entry and exit transitions:\n *\n * ```typescript\n * transition(\":enter\", [\n * style({ opacity: 0 }),\n * animate(500, style({ opacity: 1 }))\n * ]),\n * transition(\":leave\", [\n * animate(500, style({ opacity: 0 }))\n * ])\n * ```\n *\n * - Use `:increment` and `:decrement` to initiate transitions:\n *\n * ```typescript\n * transition(\":increment\", group([\n * query(':enter', [\n * style({ left: '100%' }),\n * animate('0.5s ease-out', style('*'))\n * ]),\n * query(':leave', [\n * animate('0.5s ease-out', style({ left: '-100%' }))\n * ])\n * ]))\n *\n * transition(\":decrement\", group([\n * query(':enter', [\n * style({ left: '100%' }),\n * animate('0.5s ease-out', style('*'))\n * ]),\n * query(':leave', [\n * animate('0.5s ease-out', style({ left: '-100%' }))\n * ])\n * ]))\n * ```\n *\n * ### State-change functions\n *\n * Here is an example of a `fromState` specified as a state-change function that invokes an\n * animation when true:\n *\n * ```typescript\n * transition((fromState, toState) =>\n * {\n * return fromState == \"off\" && toState == \"on\";\n * },\n * animate(\"1s 0s\"))\n * ```\n *\n * ### Animating to the final state\n *\n * If the final step in a transition is a call to `animate()` that uses a timing value\n * with no style data, that step is automatically considered the final animation arc,\n * for the element to reach the final state. Angular automatically adds or removes\n * CSS styles to ensure that the element is in the correct final state.\n *\n * The following example defines a transition that starts by hiding the element,\n * then makes sure that it animates properly to whatever state is currently active for trigger:\n *\n * ```typescript\n * transition(\"void => *\", [\n * style({ opacity: 0 }),\n * animate(500)\n * ])\n * ```\n * ### Boolean value matching\n * If a trigger binding value is a Boolean, it can be matched using a transition expression\n * that compares true and false or 1 and 0. For example:\n *\n * ```\n * // in the template\n *
...
\n * // in the component metadata\n * trigger('openClose', [\n * state('true', style({ height: '*' })),\n * state('false', style({ height: '0px' })),\n * transition('false <=> true', animate(500))\n * ])\n * ```\n *\n * @publicApi\n **/\nfunction transition(stateChangeExpr, steps, options = null) {\n return { type: 1 /* Transition */, expr: stateChangeExpr, animation: steps, options };\n}\n/**\n * Produces a reusable animation that can be invoked in another animation or sequence,\n * by calling the `useAnimation()` function.\n *\n * @param steps One or more animation objects, as returned by the `animate()`\n * or `sequence()` function, that form a transformation from one state to another.\n * A sequence is used by default when you pass an array.\n * @param options An options object that can contain a delay value for the start of the\n * animation, and additional developer-defined parameters.\n * Provided values for additional parameters are used as defaults,\n * and override values can be passed to the caller on invocation.\n * @returns An object that encapsulates the animation data.\n *\n * @usageNotes\n * The following example defines a reusable animation, providing some default parameter\n * values.\n *\n * ```typescript\n * var fadeAnimation = animation([\n * style({ opacity: '{{ start }}' }),\n * animate('{{ time }}',\n * style({ opacity: '{{ end }}'}))\n * ],\n * { params: { time: '1000ms', start: 0, end: 1 }});\n * ```\n *\n * The following invokes the defined animation with a call to `useAnimation()`,\n * passing in override parameter values.\n *\n * ```js\n * useAnimation(fadeAnimation, {\n * params: {\n * time: '2s',\n * start: 1,\n * end: 0\n * }\n * })\n * ```\n *\n * If any of the passed-in parameter values are missing from this call,\n * the default values are used. If one or more parameter values are missing before a step is\n * animated, `useAnimation()` throws an error.\n *\n * @publicApi\n */\nfunction animation(steps, options = null) {\n return { type: 8 /* Reference */, animation: steps, options };\n}\n/**\n * Executes a queried inner animation element within an animation sequence.\n *\n * @param options An options object that can contain a delay value for the start of the\n * animation, and additional override values for developer-defined parameters.\n * @return An object that encapsulates the child animation data.\n *\n * @usageNotes\n * Each time an animation is triggered in Angular, the parent animation\n * has priority and any child animations are blocked. In order\n * for a child animation to run, the parent animation must query each of the elements\n * containing child animations, and run them using this function.\n *\n * Note that this feature is designed to be used with `query()` and it will only work\n * with animations that are assigned using the Angular animation library. CSS keyframes\n * and transitions are not handled by this API.\n *\n * @publicApi\n */\nfunction animateChild(options = null) {\n return { type: 9 /* AnimateChild */, options };\n}\n/**\n * Starts a reusable animation that is created using the `animation()` function.\n *\n * @param animation The reusable animation to start.\n * @param options An options object that can contain a delay value for the start of\n * the animation, and additional override values for developer-defined parameters.\n * @return An object that contains the animation parameters.\n *\n * @publicApi\n */\nfunction useAnimation(animation, options = null) {\n return { type: 10 /* AnimateRef */, animation, options };\n}\n/**\n * Finds one or more inner elements within the current element that is\n * being animated within a sequence. Use with `animate()`.\n *\n * @param selector The element to query, or a set of elements that contain Angular-specific\n * characteristics, specified with one or more of the following tokens.\n * - `query(\":enter\")` or `query(\":leave\")` : Query for newly inserted/removed elements.\n * - `query(\":animating\")` : Query all currently animating elements.\n * - `query(\"@triggerName\")` : Query elements that contain an animation trigger.\n * - `query(\"@*\")` : Query all elements that contain an animation triggers.\n * - `query(\":self\")` : Include the current element into the animation sequence.\n *\n * @param animation One or more animation steps to apply to the queried element or elements.\n * An array is treated as an animation sequence.\n * @param options An options object. Use the 'limit' field to limit the total number of\n * items to collect.\n * @return An object that encapsulates the query data.\n *\n * @usageNotes\n * Tokens can be merged into a combined query selector string. For example:\n *\n * ```typescript\n * query(':self, .record:enter, .record:leave, @subTrigger', [...])\n * ```\n *\n * The `query()` function collects multiple elements and works internally by using\n * `element.querySelectorAll`. Use the `limit` field of an options object to limit\n * the total number of items to be collected. For example:\n *\n * ```js\n * query('div', [\n * animate(...),\n * animate(...)\n * ], { limit: 1 })\n * ```\n *\n * By default, throws an error when zero items are found. Set the\n * `optional` flag to ignore this error. For example:\n *\n * ```js\n * query('.some-element-that-may-not-be-there', [\n * animate(...),\n * animate(...)\n * ], { optional: true })\n * ```\n *\n * ### Usage Example\n *\n * The following example queries for inner elements and animates them\n * individually using `animate()`.\n *\n * ```typescript\n * @Component({\n * selector: 'inner',\n * template: `\n *
\n *
Title
\n *
\n * Blah blah blah\n *
\n *
\n * `,\n * animations: [\n * trigger('queryAnimation', [\n * transition('* => goAnimate', [\n * // hide the inner elements\n * query('h1', style({ opacity: 0 })),\n * query('.content', style({ opacity: 0 })),\n *\n * // animate the inner elements in, one by one\n * query('h1', animate(1000, style({ opacity: 1 }))),\n * query('.content', animate(1000, style({ opacity: 1 }))),\n * ])\n * ])\n * ]\n * })\n * class Cmp {\n * exp = '';\n *\n * goAnimate() {\n * this.exp = 'goAnimate';\n * }\n * }\n * ```\n *\n * @publicApi\n */\nfunction query(selector, animation, options = null) {\n return { type: 11 /* Query */, selector, animation, options };\n}\n/**\n * Use within an animation `query()` call to issue a timing gap after\n * each queried item is animated.\n *\n * @param timings A delay value.\n * @param animation One ore more animation steps.\n * @returns An object that encapsulates the stagger data.\n *\n * @usageNotes\n * In the following example, a container element wraps a list of items stamped out\n * by an `ngFor`. The container element contains an animation trigger that will later be set\n * to query for each of the inner items.\n *\n * Each time items are added, the opacity fade-in animation runs,\n * and each removed item is faded out.\n * When either of these animations occur, the stagger effect is\n * applied after each item's animation is started.\n *\n * ```html\n * \n * \n * \n *
\n *
\n * {{ item }}\n *
\n *
\n * ```\n *\n * Here is the component code:\n *\n * ```typescript\n * import {trigger, transition, style, animate, query, stagger} from '@angular/animations';\n * @Component({\n * templateUrl: 'list.component.html',\n * animations: [\n * trigger('listAnimation', [\n * ...\n * ])\n * ]\n * })\n * class ListComponent {\n * items = [];\n *\n * showItems() {\n * this.items = [0,1,2,3,4];\n * }\n *\n * hideItems() {\n * this.items = [];\n * }\n *\n * toggle() {\n * this.items.length ? this.hideItems() : this.showItems();\n * }\n * }\n * ```\n *\n * Here is the animation trigger code:\n *\n * ```typescript\n * trigger('listAnimation', [\n * transition('* => *', [ // each time the binding value changes\n * query(':leave', [\n * stagger(100, [\n * animate('0.5s', style({ opacity: 0 }))\n * ])\n * ]),\n * query(':enter', [\n * style({ opacity: 0 }),\n * stagger(100, [\n * animate('0.5s', style({ opacity: 1 }))\n * ])\n * ])\n * ])\n * ])\n * ```\n *\n * @publicApi\n */\nfunction stagger(timings, animation) {\n return { type: 12 /* Stagger */, timings, animation };\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction scheduleMicroTask(cb) {\n Promise.resolve(null).then(cb);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * An empty programmatic controller for reusable animations.\n * Used internally when animations are disabled, to avoid\n * checking for the null case when an animation player is expected.\n *\n * @see `animate()`\n * @see `AnimationPlayer`\n * @see `GroupPlayer`\n *\n * @publicApi\n */\nclass NoopAnimationPlayer {\n constructor(duration = 0, delay = 0) {\n this._onDoneFns = [];\n this._onStartFns = [];\n this._onDestroyFns = [];\n this._started = false;\n this._destroyed = false;\n this._finished = false;\n this._position = 0;\n this.parentPlayer = null;\n this.totalTime = duration + delay;\n }\n _onFinish() {\n if (!this._finished) {\n this._finished = true;\n this._onDoneFns.forEach(fn => fn());\n this._onDoneFns = [];\n }\n }\n onStart(fn) {\n this._onStartFns.push(fn);\n }\n onDone(fn) {\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n hasStarted() {\n return this._started;\n }\n init() { }\n play() {\n if (!this.hasStarted()) {\n this._onStart();\n this.triggerMicrotask();\n }\n this._started = true;\n }\n /** @internal */\n triggerMicrotask() {\n scheduleMicroTask(() => this._onFinish());\n }\n _onStart() {\n this._onStartFns.forEach(fn => fn());\n this._onStartFns = [];\n }\n pause() { }\n restart() { }\n finish() {\n this._onFinish();\n }\n destroy() {\n if (!this._destroyed) {\n this._destroyed = true;\n if (!this.hasStarted()) {\n this._onStart();\n }\n this.finish();\n this._onDestroyFns.forEach(fn => fn());\n this._onDestroyFns = [];\n }\n }\n reset() {\n this._started = false;\n }\n setPosition(position) {\n this._position = this.totalTime ? position * this.totalTime : 1;\n }\n getPosition() {\n return this.totalTime ? this._position / this.totalTime : 1;\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach(fn => fn());\n methods.length = 0;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A programmatic controller for a group of reusable animations.\n * Used internally to control animations.\n *\n * @see `AnimationPlayer`\n * @see `{@link animations/group group()}`\n *\n */\nclass AnimationGroupPlayer {\n constructor(_players) {\n this._onDoneFns = [];\n this._onStartFns = [];\n this._finished = false;\n this._started = false;\n this._destroyed = false;\n this._onDestroyFns = [];\n this.parentPlayer = null;\n this.totalTime = 0;\n this.players = _players;\n let doneCount = 0;\n let destroyCount = 0;\n let startCount = 0;\n const total = this.players.length;\n if (total == 0) {\n scheduleMicroTask(() => this._onFinish());\n }\n else {\n this.players.forEach(player => {\n player.onDone(() => {\n if (++doneCount == total) {\n this._onFinish();\n }\n });\n player.onDestroy(() => {\n if (++destroyCount == total) {\n this._onDestroy();\n }\n });\n player.onStart(() => {\n if (++startCount == total) {\n this._onStart();\n }\n });\n });\n }\n this.totalTime = this.players.reduce((time, player) => Math.max(time, player.totalTime), 0);\n }\n _onFinish() {\n if (!this._finished) {\n this._finished = true;\n this._onDoneFns.forEach(fn => fn());\n this._onDoneFns = [];\n }\n }\n init() {\n this.players.forEach(player => player.init());\n }\n onStart(fn) {\n this._onStartFns.push(fn);\n }\n _onStart() {\n if (!this.hasStarted()) {\n this._started = true;\n this._onStartFns.forEach(fn => fn());\n this._onStartFns = [];\n }\n }\n onDone(fn) {\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n hasStarted() {\n return this._started;\n }\n play() {\n if (!this.parentPlayer) {\n this.init();\n }\n this._onStart();\n this.players.forEach(player => player.play());\n }\n pause() {\n this.players.forEach(player => player.pause());\n }\n restart() {\n this.players.forEach(player => player.restart());\n }\n finish() {\n this._onFinish();\n this.players.forEach(player => player.finish());\n }\n destroy() {\n this._onDestroy();\n }\n _onDestroy() {\n if (!this._destroyed) {\n this._destroyed = true;\n this._onFinish();\n this.players.forEach(player => player.destroy());\n this._onDestroyFns.forEach(fn => fn());\n this._onDestroyFns = [];\n }\n }\n reset() {\n this.players.forEach(player => player.reset());\n this._destroyed = false;\n this._finished = false;\n this._started = false;\n }\n setPosition(p) {\n const timeAtPosition = p * this.totalTime;\n this.players.forEach(player => {\n const position = player.totalTime ? Math.min(1, timeAtPosition / player.totalTime) : 1;\n player.setPosition(position);\n });\n }\n getPosition() {\n const longestPlayer = this.players.reduce((longestSoFar, player) => {\n const newPlayerIsLongest = longestSoFar === null || player.totalTime > longestSoFar.totalTime;\n return newPlayerIsLongest ? player : longestSoFar;\n }, null);\n return longestPlayer != null ? longestPlayer.getPosition() : 0;\n }\n beforeDestroy() {\n this.players.forEach(player => {\n if (player.beforeDestroy) {\n player.beforeDestroy();\n }\n });\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach(fn => fn());\n methods.length = 0;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ɵPRE_STYLE = '!';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { AUTO_STYLE, AnimationBuilder, AnimationFactory, NoopAnimationPlayer, animate, animateChild, animation, group, keyframes, query, sequence, stagger, state, style, transition, trigger, useAnimation, AnimationGroupPlayer as ɵAnimationGroupPlayer, ɵPRE_STYLE };\n\n//# sourceMappingURL=animations.js.map","import * as i2 from '@angular/common';\nimport { DOCUMENT } from '@angular/common';\nimport * as i0 from '@angular/core';\nimport { Injectable, Inject, QueryList, NgZone, Directive, ElementRef, Input, InjectionToken, Optional, EventEmitter, Output, NgModule } from '@angular/core';\nimport { Subject, Subscription, BehaviorSubject, of } from 'rxjs';\nimport { hasModifierKey, A, Z, ZERO, NINE, END, HOME, LEFT_ARROW, RIGHT_ARROW, UP_ARROW, DOWN_ARROW, TAB, ALT, CONTROL, MAC_META, META, SHIFT } from '@angular/cdk/keycodes';\nimport { tap, debounceTime, filter, map, take, skip, distinctUntilChanged, takeUntil } from 'rxjs/operators';\nimport { coerceBooleanProperty, coerceElement } from '@angular/cdk/coercion';\nimport * as i1 from '@angular/cdk/platform';\nimport { Platform, _getFocusedElementPierceShadowDom, normalizePassiveListenerOptions, _getShadowRoot, PlatformModule } from '@angular/cdk/platform';\nimport { ContentObserver, ObserversModule } from '@angular/cdk/observers';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** IDs are delimited by an empty space, as per the spec. */\nimport * as ɵngcc0 from '@angular/core';\nimport * as ɵngcc1 from '@angular/cdk/platform';\nimport * as ɵngcc2 from '@angular/cdk/observers';\nconst ID_DELIMITER = ' ';\n/**\n * Adds the given ID to the specified ARIA attribute on an element.\n * Used for attributes such as aria-labelledby, aria-owns, etc.\n */\nfunction addAriaReferencedId(el, attr, id) {\n const ids = getAriaReferenceIds(el, attr);\n if (ids.some(existingId => existingId.trim() == id.trim())) {\n return;\n }\n ids.push(id.trim());\n el.setAttribute(attr, ids.join(ID_DELIMITER));\n}\n/**\n * Removes the given ID from the specified ARIA attribute on an element.\n * Used for attributes such as aria-labelledby, aria-owns, etc.\n */\nfunction removeAriaReferencedId(el, attr, id) {\n const ids = getAriaReferenceIds(el, attr);\n const filteredIds = ids.filter(val => val != id.trim());\n if (filteredIds.length) {\n el.setAttribute(attr, filteredIds.join(ID_DELIMITER));\n }\n else {\n el.removeAttribute(attr);\n }\n}\n/**\n * Gets the list of IDs referenced by the given ARIA attribute on an element.\n * Used for attributes such as aria-labelledby, aria-owns, etc.\n */\nfunction getAriaReferenceIds(el, attr) {\n // Get string array of all individual ids (whitespace delimited) in the attribute value\n return (el.getAttribute(attr) || '').match(/\\S+/g) || [];\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** ID used for the body container where all messages are appended. */\nconst MESSAGES_CONTAINER_ID = 'cdk-describedby-message-container';\n/** ID prefix used for each created message element. */\nconst CDK_DESCRIBEDBY_ID_PREFIX = 'cdk-describedby-message';\n/** Attribute given to each host element that is described by a message element. */\nconst CDK_DESCRIBEDBY_HOST_ATTRIBUTE = 'cdk-describedby-host';\n/** Global incremental identifier for each registered message element. */\nlet nextId = 0;\n/** Global map of all registered message elements that have been placed into the document. */\nconst messageRegistry = new Map();\n/** Container for all registered messages. */\nlet messagesContainer = null;\n/**\n * Utility that creates visually hidden elements with a message content. Useful for elements that\n * want to use aria-describedby to further describe themselves without adding additional visual\n * content.\n */\nclass AriaDescriber {\n constructor(_document) {\n this._document = _document;\n }\n describe(hostElement, message, role) {\n if (!this._canBeDescribed(hostElement, message)) {\n return;\n }\n const key = getKey(message, role);\n if (typeof message !== 'string') {\n // We need to ensure that the element has an ID.\n setMessageId(message);\n messageRegistry.set(key, { messageElement: message, referenceCount: 0 });\n }\n else if (!messageRegistry.has(key)) {\n this._createMessageElement(message, role);\n }\n if (!this._isElementDescribedByMessage(hostElement, key)) {\n this._addMessageReference(hostElement, key);\n }\n }\n removeDescription(hostElement, message, role) {\n if (!message || !this._isElementNode(hostElement)) {\n return;\n }\n const key = getKey(message, role);\n if (this._isElementDescribedByMessage(hostElement, key)) {\n this._removeMessageReference(hostElement, key);\n }\n // If the message is a string, it means that it's one that we created for the\n // consumer so we can remove it safely, otherwise we should leave it in place.\n if (typeof message === 'string') {\n const registeredMessage = messageRegistry.get(key);\n if (registeredMessage && registeredMessage.referenceCount === 0) {\n this._deleteMessageElement(key);\n }\n }\n if (messagesContainer && messagesContainer.childNodes.length === 0) {\n this._deleteMessagesContainer();\n }\n }\n /** Unregisters all created message elements and removes the message container. */\n ngOnDestroy() {\n const describedElements = this._document.querySelectorAll(`[${CDK_DESCRIBEDBY_HOST_ATTRIBUTE}]`);\n for (let i = 0; i < describedElements.length; i++) {\n this._removeCdkDescribedByReferenceIds(describedElements[i]);\n describedElements[i].removeAttribute(CDK_DESCRIBEDBY_HOST_ATTRIBUTE);\n }\n if (messagesContainer) {\n this._deleteMessagesContainer();\n }\n messageRegistry.clear();\n }\n /**\n * Creates a new element in the visually hidden message container element with the message\n * as its content and adds it to the message registry.\n */\n _createMessageElement(message, role) {\n const messageElement = this._document.createElement('div');\n setMessageId(messageElement);\n messageElement.textContent = message;\n if (role) {\n messageElement.setAttribute('role', role);\n }\n this._createMessagesContainer();\n messagesContainer.appendChild(messageElement);\n messageRegistry.set(getKey(message, role), { messageElement, referenceCount: 0 });\n }\n /** Deletes the message element from the global messages container. */\n _deleteMessageElement(key) {\n const registeredMessage = messageRegistry.get(key);\n const messageElement = registeredMessage && registeredMessage.messageElement;\n if (messagesContainer && messageElement) {\n messagesContainer.removeChild(messageElement);\n }\n messageRegistry.delete(key);\n }\n /** Creates the global container for all aria-describedby messages. */\n _createMessagesContainer() {\n if (!messagesContainer) {\n const preExistingContainer = this._document.getElementById(MESSAGES_CONTAINER_ID);\n // When going from the server to the client, we may end up in a situation where there's\n // already a container on the page, but we don't have a reference to it. Clear the\n // old container so we don't get duplicates. Doing this, instead of emptying the previous\n // container, should be slightly faster.\n if (preExistingContainer && preExistingContainer.parentNode) {\n preExistingContainer.parentNode.removeChild(preExistingContainer);\n }\n messagesContainer = this._document.createElement('div');\n messagesContainer.id = MESSAGES_CONTAINER_ID;\n // We add `visibility: hidden` in order to prevent text in this container from\n // being searchable by the browser's Ctrl + F functionality.\n // Screen-readers will still read the description for elements with aria-describedby even\n // when the description element is not visible.\n messagesContainer.style.visibility = 'hidden';\n // Even though we use `visibility: hidden`, we still apply `cdk-visually-hidden` so that\n // the description element doesn't impact page layout.\n messagesContainer.classList.add('cdk-visually-hidden');\n this._document.body.appendChild(messagesContainer);\n }\n }\n /** Deletes the global messages container. */\n _deleteMessagesContainer() {\n if (messagesContainer && messagesContainer.parentNode) {\n messagesContainer.parentNode.removeChild(messagesContainer);\n messagesContainer = null;\n }\n }\n /** Removes all cdk-describedby messages that are hosted through the element. */\n _removeCdkDescribedByReferenceIds(element) {\n // Remove all aria-describedby reference IDs that are prefixed by CDK_DESCRIBEDBY_ID_PREFIX\n const originalReferenceIds = getAriaReferenceIds(element, 'aria-describedby')\n .filter(id => id.indexOf(CDK_DESCRIBEDBY_ID_PREFIX) != 0);\n element.setAttribute('aria-describedby', originalReferenceIds.join(' '));\n }\n /**\n * Adds a message reference to the element using aria-describedby and increments the registered\n * message's reference count.\n */\n _addMessageReference(element, key) {\n const registeredMessage = messageRegistry.get(key);\n // Add the aria-describedby reference and set the\n // describedby_host attribute to mark the element.\n addAriaReferencedId(element, 'aria-describedby', registeredMessage.messageElement.id);\n element.setAttribute(CDK_DESCRIBEDBY_HOST_ATTRIBUTE, '');\n registeredMessage.referenceCount++;\n }\n /**\n * Removes a message reference from the element using aria-describedby\n * and decrements the registered message's reference count.\n */\n _removeMessageReference(element, key) {\n const registeredMessage = messageRegistry.get(key);\n registeredMessage.referenceCount--;\n removeAriaReferencedId(element, 'aria-describedby', registeredMessage.messageElement.id);\n element.removeAttribute(CDK_DESCRIBEDBY_HOST_ATTRIBUTE);\n }\n /** Returns true if the element has been described by the provided message ID. */\n _isElementDescribedByMessage(element, key) {\n const referenceIds = getAriaReferenceIds(element, 'aria-describedby');\n const registeredMessage = messageRegistry.get(key);\n const messageId = registeredMessage && registeredMessage.messageElement.id;\n return !!messageId && referenceIds.indexOf(messageId) != -1;\n }\n /** Determines whether a message can be described on a particular element. */\n _canBeDescribed(element, message) {\n if (!this._isElementNode(element)) {\n return false;\n }\n if (message && typeof message === 'object') {\n // We'd have to make some assumptions about the description element's text, if the consumer\n // passed in an element. Assume that if an element is passed in, the consumer has verified\n // that it can be used as a description.\n return true;\n }\n const trimmedMessage = message == null ? '' : `${message}`.trim();\n const ariaLabel = element.getAttribute('aria-label');\n // We shouldn't set descriptions if they're exactly the same as the `aria-label` of the\n // element, because screen readers will end up reading out the same text twice in a row.\n return trimmedMessage ? (!ariaLabel || ariaLabel.trim() !== trimmedMessage) : false;\n }\n /** Checks whether a node is an Element node. */\n _isElementNode(element) {\n return element.nodeType === this._document.ELEMENT_NODE;\n }\n}\nAriaDescriber.ɵfac = function AriaDescriber_Factory(t) { return new (t || AriaDescriber)(ɵngcc0.ɵɵinject(DOCUMENT)); };\nAriaDescriber.ɵprov = i0.ɵɵdefineInjectable({ factory: function AriaDescriber_Factory() { return new AriaDescriber(i0.ɵɵinject(i2.DOCUMENT)); }, token: AriaDescriber, providedIn: \"root\" });\nAriaDescriber.ctorParameters = () => [\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(AriaDescriber, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, null); })();\n/** Gets a key that can be used to look messages up in the registry. */\nfunction getKey(message, role) {\n return typeof message === 'string' ? `${role || ''}/${message}` : message;\n}\n/** Assigns a unique ID to an element, if it doesn't have one already. */\nfunction setMessageId(element) {\n if (!element.id) {\n element.id = `${CDK_DESCRIBEDBY_ID_PREFIX}-${nextId++}`;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * This class manages keyboard events for selectable lists. If you pass it a query list\n * of items, it will set the active item correctly when arrow events occur.\n */\nclass ListKeyManager {\n constructor(_items) {\n this._items = _items;\n this._activeItemIndex = -1;\n this._activeItem = null;\n this._wrap = false;\n this._letterKeyStream = new Subject();\n this._typeaheadSubscription = Subscription.EMPTY;\n this._vertical = true;\n this._allowedModifierKeys = [];\n this._homeAndEnd = false;\n /**\n * Predicate function that can be used to check whether an item should be skipped\n * by the key manager. By default, disabled items are skipped.\n */\n this._skipPredicateFn = (item) => item.disabled;\n // Buffer for the letters that the user has pressed when the typeahead option is turned on.\n this._pressedLetters = [];\n /**\n * Stream that emits any time the TAB key is pressed, so components can react\n * when focus is shifted off of the list.\n */\n this.tabOut = new Subject();\n /** Stream that emits whenever the active item of the list manager changes. */\n this.change = new Subject();\n // We allow for the items to be an array because, in some cases, the consumer may\n // not have access to a QueryList of the items they want to manage (e.g. when the\n // items aren't being collected via `ViewChildren` or `ContentChildren`).\n if (_items instanceof QueryList) {\n _items.changes.subscribe((newItems) => {\n if (this._activeItem) {\n const itemArray = newItems.toArray();\n const newIndex = itemArray.indexOf(this._activeItem);\n if (newIndex > -1 && newIndex !== this._activeItemIndex) {\n this._activeItemIndex = newIndex;\n }\n }\n });\n }\n }\n /**\n * Sets the predicate function that determines which items should be skipped by the\n * list key manager.\n * @param predicate Function that determines whether the given item should be skipped.\n */\n skipPredicate(predicate) {\n this._skipPredicateFn = predicate;\n return this;\n }\n /**\n * Configures wrapping mode, which determines whether the active item will wrap to\n * the other end of list when there are no more items in the given direction.\n * @param shouldWrap Whether the list should wrap when reaching the end.\n */\n withWrap(shouldWrap = true) {\n this._wrap = shouldWrap;\n return this;\n }\n /**\n * Configures whether the key manager should be able to move the selection vertically.\n * @param enabled Whether vertical selection should be enabled.\n */\n withVerticalOrientation(enabled = true) {\n this._vertical = enabled;\n return this;\n }\n /**\n * Configures the key manager to move the selection horizontally.\n * Passing in `null` will disable horizontal movement.\n * @param direction Direction in which the selection can be moved.\n */\n withHorizontalOrientation(direction) {\n this._horizontal = direction;\n return this;\n }\n /**\n * Modifier keys which are allowed to be held down and whose default actions will be prevented\n * as the user is pressing the arrow keys. Defaults to not allowing any modifier keys.\n */\n withAllowedModifierKeys(keys) {\n this._allowedModifierKeys = keys;\n return this;\n }\n /**\n * Turns on typeahead mode which allows users to set the active item by typing.\n * @param debounceInterval Time to wait after the last keystroke before setting the active item.\n */\n withTypeAhead(debounceInterval = 200) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && (this._items.length &&\n this._items.some(item => typeof item.getLabel !== 'function'))) {\n throw Error('ListKeyManager items in typeahead mode must implement the `getLabel` method.');\n }\n this._typeaheadSubscription.unsubscribe();\n // Debounce the presses of non-navigational keys, collect the ones that correspond to letters\n // and convert those letters back into a string. Afterwards find the first item that starts\n // with that string and select it.\n this._typeaheadSubscription = this._letterKeyStream.pipe(tap(letter => this._pressedLetters.push(letter)), debounceTime(debounceInterval), filter(() => this._pressedLetters.length > 0), map(() => this._pressedLetters.join(''))).subscribe(inputString => {\n const items = this._getItemsArray();\n // Start at 1 because we want to start searching at the item immediately\n // following the current active item.\n for (let i = 1; i < items.length + 1; i++) {\n const index = (this._activeItemIndex + i) % items.length;\n const item = items[index];\n if (!this._skipPredicateFn(item) &&\n item.getLabel().toUpperCase().trim().indexOf(inputString) === 0) {\n this.setActiveItem(index);\n break;\n }\n }\n this._pressedLetters = [];\n });\n return this;\n }\n /**\n * Configures the key manager to activate the first and last items\n * respectively when the Home or End key is pressed.\n * @param enabled Whether pressing the Home or End key activates the first/last item.\n */\n withHomeAndEnd(enabled = true) {\n this._homeAndEnd = enabled;\n return this;\n }\n setActiveItem(item) {\n const previousActiveItem = this._activeItem;\n this.updateActiveItem(item);\n if (this._activeItem !== previousActiveItem) {\n this.change.next(this._activeItemIndex);\n }\n }\n /**\n * Sets the active item depending on the key event passed in.\n * @param event Keyboard event to be used for determining which element should be active.\n */\n onKeydown(event) {\n const keyCode = event.keyCode;\n const modifiers = ['altKey', 'ctrlKey', 'metaKey', 'shiftKey'];\n const isModifierAllowed = modifiers.every(modifier => {\n return !event[modifier] || this._allowedModifierKeys.indexOf(modifier) > -1;\n });\n switch (keyCode) {\n case TAB:\n this.tabOut.next();\n return;\n case DOWN_ARROW:\n if (this._vertical && isModifierAllowed) {\n this.setNextItemActive();\n break;\n }\n else {\n return;\n }\n case UP_ARROW:\n if (this._vertical && isModifierAllowed) {\n this.setPreviousItemActive();\n break;\n }\n else {\n return;\n }\n case RIGHT_ARROW:\n if (this._horizontal && isModifierAllowed) {\n this._horizontal === 'rtl' ? this.setPreviousItemActive() : this.setNextItemActive();\n break;\n }\n else {\n return;\n }\n case LEFT_ARROW:\n if (this._horizontal && isModifierAllowed) {\n this._horizontal === 'rtl' ? this.setNextItemActive() : this.setPreviousItemActive();\n break;\n }\n else {\n return;\n }\n case HOME:\n if (this._homeAndEnd && isModifierAllowed) {\n this.setFirstItemActive();\n break;\n }\n else {\n return;\n }\n case END:\n if (this._homeAndEnd && isModifierAllowed) {\n this.setLastItemActive();\n break;\n }\n else {\n return;\n }\n default:\n if (isModifierAllowed || hasModifierKey(event, 'shiftKey')) {\n // Attempt to use the `event.key` which also maps it to the user's keyboard language,\n // otherwise fall back to resolving alphanumeric characters via the keyCode.\n if (event.key && event.key.length === 1) {\n this._letterKeyStream.next(event.key.toLocaleUpperCase());\n }\n else if ((keyCode >= A && keyCode <= Z) || (keyCode >= ZERO && keyCode <= NINE)) {\n this._letterKeyStream.next(String.fromCharCode(keyCode));\n }\n }\n // Note that we return here, in order to avoid preventing\n // the default action of non-navigational keys.\n return;\n }\n this._pressedLetters = [];\n event.preventDefault();\n }\n /** Index of the currently active item. */\n get activeItemIndex() {\n return this._activeItemIndex;\n }\n /** The active item. */\n get activeItem() {\n return this._activeItem;\n }\n /** Gets whether the user is currently typing into the manager using the typeahead feature. */\n isTyping() {\n return this._pressedLetters.length > 0;\n }\n /** Sets the active item to the first enabled item in the list. */\n setFirstItemActive() {\n this._setActiveItemByIndex(0, 1);\n }\n /** Sets the active item to the last enabled item in the list. */\n setLastItemActive() {\n this._setActiveItemByIndex(this._items.length - 1, -1);\n }\n /** Sets the active item to the next enabled item in the list. */\n setNextItemActive() {\n this._activeItemIndex < 0 ? this.setFirstItemActive() : this._setActiveItemByDelta(1);\n }\n /** Sets the active item to a previous enabled item in the list. */\n setPreviousItemActive() {\n this._activeItemIndex < 0 && this._wrap ? this.setLastItemActive()\n : this._setActiveItemByDelta(-1);\n }\n updateActiveItem(item) {\n const itemArray = this._getItemsArray();\n const index = typeof item === 'number' ? item : itemArray.indexOf(item);\n const activeItem = itemArray[index];\n // Explicitly check for `null` and `undefined` because other falsy values are valid.\n this._activeItem = activeItem == null ? null : activeItem;\n this._activeItemIndex = index;\n }\n /**\n * This method sets the active item, given a list of items and the delta between the\n * currently active item and the new active item. It will calculate differently\n * depending on whether wrap mode is turned on.\n */\n _setActiveItemByDelta(delta) {\n this._wrap ? this._setActiveInWrapMode(delta) : this._setActiveInDefaultMode(delta);\n }\n /**\n * Sets the active item properly given \"wrap\" mode. In other words, it will continue to move\n * down the list until it finds an item that is not disabled, and it will wrap if it\n * encounters either end of the list.\n */\n _setActiveInWrapMode(delta) {\n const items = this._getItemsArray();\n for (let i = 1; i <= items.length; i++) {\n const index = (this._activeItemIndex + (delta * i) + items.length) % items.length;\n const item = items[index];\n if (!this._skipPredicateFn(item)) {\n this.setActiveItem(index);\n return;\n }\n }\n }\n /**\n * Sets the active item properly given the default mode. In other words, it will\n * continue to move down the list until it finds an item that is not disabled. If\n * it encounters either end of the list, it will stop and not wrap.\n */\n _setActiveInDefaultMode(delta) {\n this._setActiveItemByIndex(this._activeItemIndex + delta, delta);\n }\n /**\n * Sets the active item to the first enabled item starting at the index specified. If the\n * item is disabled, it will move in the fallbackDelta direction until it either\n * finds an enabled item or encounters the end of the list.\n */\n _setActiveItemByIndex(index, fallbackDelta) {\n const items = this._getItemsArray();\n if (!items[index]) {\n return;\n }\n while (this._skipPredicateFn(items[index])) {\n index += fallbackDelta;\n if (!items[index]) {\n return;\n }\n }\n this.setActiveItem(index);\n }\n /** Returns the items as an array. */\n _getItemsArray() {\n return this._items instanceof QueryList ? this._items.toArray() : this._items;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass ActiveDescendantKeyManager extends ListKeyManager {\n setActiveItem(index) {\n if (this.activeItem) {\n this.activeItem.setInactiveStyles();\n }\n super.setActiveItem(index);\n if (this.activeItem) {\n this.activeItem.setActiveStyles();\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass FocusKeyManager extends ListKeyManager {\n constructor() {\n super(...arguments);\n this._origin = 'program';\n }\n /**\n * Sets the focus origin that will be passed in to the items for any subsequent `focus` calls.\n * @param origin Focus origin to be used when focusing items.\n */\n setFocusOrigin(origin) {\n this._origin = origin;\n return this;\n }\n setActiveItem(item) {\n super.setActiveItem(item);\n if (this.activeItem) {\n this.activeItem.focus(this._origin);\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Configuration for the isFocusable method.\n */\nclass IsFocusableConfig {\n constructor() {\n /**\n * Whether to count an element as focusable even if it is not currently visible.\n */\n this.ignoreVisibility = false;\n }\n}\n// The InteractivityChecker leans heavily on the ally.js accessibility utilities.\n// Methods like `isTabbable` are only covering specific edge-cases for the browsers which are\n// supported.\n/**\n * Utility for checking the interactivity of an element, such as whether is is focusable or\n * tabbable.\n */\nclass InteractivityChecker {\n constructor(_platform) {\n this._platform = _platform;\n }\n /**\n * Gets whether an element is disabled.\n *\n * @param element Element to be checked.\n * @returns Whether the element is disabled.\n */\n isDisabled(element) {\n // This does not capture some cases, such as a non-form control with a disabled attribute or\n // a form control inside of a disabled form, but should capture the most common cases.\n return element.hasAttribute('disabled');\n }\n /**\n * Gets whether an element is visible for the purposes of interactivity.\n *\n * This will capture states like `display: none` and `visibility: hidden`, but not things like\n * being clipped by an `overflow: hidden` parent or being outside the viewport.\n *\n * @returns Whether the element is visible.\n */\n isVisible(element) {\n return hasGeometry(element) && getComputedStyle(element).visibility === 'visible';\n }\n /**\n * Gets whether an element can be reached via Tab key.\n * Assumes that the element has already been checked with isFocusable.\n *\n * @param element Element to be checked.\n * @returns Whether the element is tabbable.\n */\n isTabbable(element) {\n // Nothing is tabbable on the server 😎\n if (!this._platform.isBrowser) {\n return false;\n }\n const frameElement = getFrameElement(getWindow(element));\n if (frameElement) {\n // Frame elements inherit their tabindex onto all child elements.\n if (getTabIndexValue(frameElement) === -1) {\n return false;\n }\n // Browsers disable tabbing to an element inside of an invisible frame.\n if (!this.isVisible(frameElement)) {\n return false;\n }\n }\n let nodeName = element.nodeName.toLowerCase();\n let tabIndexValue = getTabIndexValue(element);\n if (element.hasAttribute('contenteditable')) {\n return tabIndexValue !== -1;\n }\n if (nodeName === 'iframe' || nodeName === 'object') {\n // The frame or object's content may be tabbable depending on the content, but it's\n // not possibly to reliably detect the content of the frames. We always consider such\n // elements as non-tabbable.\n return false;\n }\n // In iOS, the browser only considers some specific elements as tabbable.\n if (this._platform.WEBKIT && this._platform.IOS && !isPotentiallyTabbableIOS(element)) {\n return false;\n }\n if (nodeName === 'audio') {\n // Audio elements without controls enabled are never tabbable, regardless\n // of the tabindex attribute explicitly being set.\n if (!element.hasAttribute('controls')) {\n return false;\n }\n // Audio elements with controls are by default tabbable unless the\n // tabindex attribute is set to `-1` explicitly.\n return tabIndexValue !== -1;\n }\n if (nodeName === 'video') {\n // For all video elements, if the tabindex attribute is set to `-1`, the video\n // is not tabbable. Note: We cannot rely on the default `HTMLElement.tabIndex`\n // property as that one is set to `-1` in Chrome, Edge and Safari v13.1. The\n // tabindex attribute is the source of truth here.\n if (tabIndexValue === -1) {\n return false;\n }\n // If the tabindex is explicitly set, and not `-1` (as per check before), the\n // video element is always tabbable (regardless of whether it has controls or not).\n if (tabIndexValue !== null) {\n return true;\n }\n // Otherwise (when no explicit tabindex is set), a video is only tabbable if it\n // has controls enabled. Firefox is special as videos are always tabbable regardless\n // of whether there are controls or not.\n return this._platform.FIREFOX || element.hasAttribute('controls');\n }\n return element.tabIndex >= 0;\n }\n /**\n * Gets whether an element can be focused by the user.\n *\n * @param element Element to be checked.\n * @param config The config object with options to customize this method's behavior\n * @returns Whether the element is focusable.\n */\n isFocusable(element, config) {\n // Perform checks in order of left to most expensive.\n // Again, naive approach that does not capture many edge cases and browser quirks.\n return isPotentiallyFocusable(element) && !this.isDisabled(element) &&\n ((config === null || config === void 0 ? void 0 : config.ignoreVisibility) || this.isVisible(element));\n }\n}\nInteractivityChecker.ɵfac = function InteractivityChecker_Factory(t) { return new (t || InteractivityChecker)(ɵngcc0.ɵɵinject(ɵngcc1.Platform)); };\nInteractivityChecker.ɵprov = i0.ɵɵdefineInjectable({ factory: function InteractivityChecker_Factory() { return new InteractivityChecker(i0.ɵɵinject(i1.Platform)); }, token: InteractivityChecker, providedIn: \"root\" });\nInteractivityChecker.ctorParameters = () => [\n { type: Platform }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(InteractivityChecker, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: ɵngcc1.Platform }]; }, null); })();\n/**\n * Returns the frame element from a window object. Since browsers like MS Edge throw errors if\n * the frameElement property is being accessed from a different host address, this property\n * should be accessed carefully.\n */\nfunction getFrameElement(window) {\n try {\n return window.frameElement;\n }\n catch (_a) {\n return null;\n }\n}\n/** Checks whether the specified element has any geometry / rectangles. */\nfunction hasGeometry(element) {\n // Use logic from jQuery to check for an invisible element.\n // See https://github.com/jquery/jquery/blob/master/src/css/hiddenVisibleSelectors.js#L12\n return !!(element.offsetWidth || element.offsetHeight ||\n (typeof element.getClientRects === 'function' && element.getClientRects().length));\n}\n/** Gets whether an element's */\nfunction isNativeFormElement(element) {\n let nodeName = element.nodeName.toLowerCase();\n return nodeName === 'input' ||\n nodeName === 'select' ||\n nodeName === 'button' ||\n nodeName === 'textarea';\n}\n/** Gets whether an element is an ``. */\nfunction isHiddenInput(element) {\n return isInputElement(element) && element.type == 'hidden';\n}\n/** Gets whether an element is an anchor that has an href attribute. */\nfunction isAnchorWithHref(element) {\n return isAnchorElement(element) && element.hasAttribute('href');\n}\n/** Gets whether an element is an input element. */\nfunction isInputElement(element) {\n return element.nodeName.toLowerCase() == 'input';\n}\n/** Gets whether an element is an anchor element. */\nfunction isAnchorElement(element) {\n return element.nodeName.toLowerCase() == 'a';\n}\n/** Gets whether an element has a valid tabindex. */\nfunction hasValidTabIndex(element) {\n if (!element.hasAttribute('tabindex') || element.tabIndex === undefined) {\n return false;\n }\n let tabIndex = element.getAttribute('tabindex');\n // IE11 parses tabindex=\"\" as the value \"-32768\"\n if (tabIndex == '-32768') {\n return false;\n }\n return !!(tabIndex && !isNaN(parseInt(tabIndex, 10)));\n}\n/**\n * Returns the parsed tabindex from the element attributes instead of returning the\n * evaluated tabindex from the browsers defaults.\n */\nfunction getTabIndexValue(element) {\n if (!hasValidTabIndex(element)) {\n return null;\n }\n // See browser issue in Gecko https://bugzilla.mozilla.org/show_bug.cgi?id=1128054\n const tabIndex = parseInt(element.getAttribute('tabindex') || '', 10);\n return isNaN(tabIndex) ? -1 : tabIndex;\n}\n/** Checks whether the specified element is potentially tabbable on iOS */\nfunction isPotentiallyTabbableIOS(element) {\n let nodeName = element.nodeName.toLowerCase();\n let inputType = nodeName === 'input' && element.type;\n return inputType === 'text'\n || inputType === 'password'\n || nodeName === 'select'\n || nodeName === 'textarea';\n}\n/**\n * Gets whether an element is potentially focusable without taking current visible/disabled state\n * into account.\n */\nfunction isPotentiallyFocusable(element) {\n // Inputs are potentially focusable *unless* they're type=\"hidden\".\n if (isHiddenInput(element)) {\n return false;\n }\n return isNativeFormElement(element) ||\n isAnchorWithHref(element) ||\n element.hasAttribute('contenteditable') ||\n hasValidTabIndex(element);\n}\n/** Gets the parent window of a DOM node with regards of being inside of an iframe. */\nfunction getWindow(node) {\n // ownerDocument is null if `node` itself *is* a document.\n return node.ownerDocument && node.ownerDocument.defaultView || window;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Class that allows for trapping focus within a DOM element.\n *\n * This class currently uses a relatively simple approach to focus trapping.\n * It assumes that the tab order is the same as DOM order, which is not necessarily true.\n * Things like `tabIndex > 0`, flex `order`, and shadow roots can cause the two to be misaligned.\n *\n * @deprecated Use `ConfigurableFocusTrap` instead.\n * @breaking-change 11.0.0\n */\nclass FocusTrap {\n constructor(_element, _checker, _ngZone, _document, deferAnchors = false) {\n this._element = _element;\n this._checker = _checker;\n this._ngZone = _ngZone;\n this._document = _document;\n this._hasAttached = false;\n // Event listeners for the anchors. Need to be regular functions so that we can unbind them later.\n this.startAnchorListener = () => this.focusLastTabbableElement();\n this.endAnchorListener = () => this.focusFirstTabbableElement();\n this._enabled = true;\n if (!deferAnchors) {\n this.attachAnchors();\n }\n }\n /** Whether the focus trap is active. */\n get enabled() { return this._enabled; }\n set enabled(value) {\n this._enabled = value;\n if (this._startAnchor && this._endAnchor) {\n this._toggleAnchorTabIndex(value, this._startAnchor);\n this._toggleAnchorTabIndex(value, this._endAnchor);\n }\n }\n /** Destroys the focus trap by cleaning up the anchors. */\n destroy() {\n const startAnchor = this._startAnchor;\n const endAnchor = this._endAnchor;\n if (startAnchor) {\n startAnchor.removeEventListener('focus', this.startAnchorListener);\n if (startAnchor.parentNode) {\n startAnchor.parentNode.removeChild(startAnchor);\n }\n }\n if (endAnchor) {\n endAnchor.removeEventListener('focus', this.endAnchorListener);\n if (endAnchor.parentNode) {\n endAnchor.parentNode.removeChild(endAnchor);\n }\n }\n this._startAnchor = this._endAnchor = null;\n this._hasAttached = false;\n }\n /**\n * Inserts the anchors into the DOM. This is usually done automatically\n * in the constructor, but can be deferred for cases like directives with `*ngIf`.\n * @returns Whether the focus trap managed to attach successfully. This may not be the case\n * if the target element isn't currently in the DOM.\n */\n attachAnchors() {\n // If we're not on the browser, there can be no focus to trap.\n if (this._hasAttached) {\n return true;\n }\n this._ngZone.runOutsideAngular(() => {\n if (!this._startAnchor) {\n this._startAnchor = this._createAnchor();\n this._startAnchor.addEventListener('focus', this.startAnchorListener);\n }\n if (!this._endAnchor) {\n this._endAnchor = this._createAnchor();\n this._endAnchor.addEventListener('focus', this.endAnchorListener);\n }\n });\n if (this._element.parentNode) {\n this._element.parentNode.insertBefore(this._startAnchor, this._element);\n this._element.parentNode.insertBefore(this._endAnchor, this._element.nextSibling);\n this._hasAttached = true;\n }\n return this._hasAttached;\n }\n /**\n * Waits for the zone to stabilize, then either focuses the first element that the\n * user specified, or the first tabbable element.\n * @returns Returns a promise that resolves with a boolean, depending\n * on whether focus was moved successfully.\n */\n focusInitialElementWhenReady(options) {\n return new Promise(resolve => {\n this._executeOnStable(() => resolve(this.focusInitialElement(options)));\n });\n }\n /**\n * Waits for the zone to stabilize, then focuses\n * the first tabbable element within the focus trap region.\n * @returns Returns a promise that resolves with a boolean, depending\n * on whether focus was moved successfully.\n */\n focusFirstTabbableElementWhenReady(options) {\n return new Promise(resolve => {\n this._executeOnStable(() => resolve(this.focusFirstTabbableElement(options)));\n });\n }\n /**\n * Waits for the zone to stabilize, then focuses\n * the last tabbable element within the focus trap region.\n * @returns Returns a promise that resolves with a boolean, depending\n * on whether focus was moved successfully.\n */\n focusLastTabbableElementWhenReady(options) {\n return new Promise(resolve => {\n this._executeOnStable(() => resolve(this.focusLastTabbableElement(options)));\n });\n }\n /**\n * Get the specified boundary element of the trapped region.\n * @param bound The boundary to get (start or end of trapped region).\n * @returns The boundary element.\n */\n _getRegionBoundary(bound) {\n // Contains the deprecated version of selector, for temporary backwards comparability.\n let markers = this._element.querySelectorAll(`[cdk-focus-region-${bound}], ` +\n `[cdkFocusRegion${bound}], ` +\n `[cdk-focus-${bound}]`);\n for (let i = 0; i < markers.length; i++) {\n // @breaking-change 8.0.0\n if (markers[i].hasAttribute(`cdk-focus-${bound}`)) {\n console.warn(`Found use of deprecated attribute 'cdk-focus-${bound}', ` +\n `use 'cdkFocusRegion${bound}' instead. The deprecated ` +\n `attribute will be removed in 8.0.0.`, markers[i]);\n }\n else if (markers[i].hasAttribute(`cdk-focus-region-${bound}`)) {\n console.warn(`Found use of deprecated attribute 'cdk-focus-region-${bound}', ` +\n `use 'cdkFocusRegion${bound}' instead. The deprecated attribute ` +\n `will be removed in 8.0.0.`, markers[i]);\n }\n }\n if (bound == 'start') {\n return markers.length ? markers[0] : this._getFirstTabbableElement(this._element);\n }\n return markers.length ?\n markers[markers.length - 1] : this._getLastTabbableElement(this._element);\n }\n /**\n * Focuses the element that should be focused when the focus trap is initialized.\n * @returns Whether focus was moved successfully.\n */\n focusInitialElement(options) {\n // Contains the deprecated version of selector, for temporary backwards comparability.\n const redirectToElement = this._element.querySelector(`[cdk-focus-initial], ` +\n `[cdkFocusInitial]`);\n if (redirectToElement) {\n // @breaking-change 8.0.0\n if (redirectToElement.hasAttribute(`cdk-focus-initial`)) {\n console.warn(`Found use of deprecated attribute 'cdk-focus-initial', ` +\n `use 'cdkFocusInitial' instead. The deprecated attribute ` +\n `will be removed in 8.0.0`, redirectToElement);\n }\n // Warn the consumer if the element they've pointed to\n // isn't focusable, when not in production mode.\n if ((typeof ngDevMode === 'undefined' || ngDevMode) &&\n !this._checker.isFocusable(redirectToElement)) {\n console.warn(`Element matching '[cdkFocusInitial]' is not focusable.`, redirectToElement);\n }\n if (!this._checker.isFocusable(redirectToElement)) {\n const focusableChild = this._getFirstTabbableElement(redirectToElement);\n focusableChild === null || focusableChild === void 0 ? void 0 : focusableChild.focus(options);\n return !!focusableChild;\n }\n redirectToElement.focus(options);\n return true;\n }\n return this.focusFirstTabbableElement(options);\n }\n /**\n * Focuses the first tabbable element within the focus trap region.\n * @returns Whether focus was moved successfully.\n */\n focusFirstTabbableElement(options) {\n const redirectToElement = this._getRegionBoundary('start');\n if (redirectToElement) {\n redirectToElement.focus(options);\n }\n return !!redirectToElement;\n }\n /**\n * Focuses the last tabbable element within the focus trap region.\n * @returns Whether focus was moved successfully.\n */\n focusLastTabbableElement(options) {\n const redirectToElement = this._getRegionBoundary('end');\n if (redirectToElement) {\n redirectToElement.focus(options);\n }\n return !!redirectToElement;\n }\n /**\n * Checks whether the focus trap has successfully been attached.\n */\n hasAttached() {\n return this._hasAttached;\n }\n /** Get the first tabbable element from a DOM subtree (inclusive). */\n _getFirstTabbableElement(root) {\n if (this._checker.isFocusable(root) && this._checker.isTabbable(root)) {\n return root;\n }\n // Iterate in DOM order. Note that IE doesn't have `children` for SVG so we fall\n // back to `childNodes` which includes text nodes, comments etc.\n let children = root.children || root.childNodes;\n for (let i = 0; i < children.length; i++) {\n let tabbableChild = children[i].nodeType === this._document.ELEMENT_NODE ?\n this._getFirstTabbableElement(children[i]) :\n null;\n if (tabbableChild) {\n return tabbableChild;\n }\n }\n return null;\n }\n /** Get the last tabbable element from a DOM subtree (inclusive). */\n _getLastTabbableElement(root) {\n if (this._checker.isFocusable(root) && this._checker.isTabbable(root)) {\n return root;\n }\n // Iterate in reverse DOM order.\n let children = root.children || root.childNodes;\n for (let i = children.length - 1; i >= 0; i--) {\n let tabbableChild = children[i].nodeType === this._document.ELEMENT_NODE ?\n this._getLastTabbableElement(children[i]) :\n null;\n if (tabbableChild) {\n return tabbableChild;\n }\n }\n return null;\n }\n /** Creates an anchor element. */\n _createAnchor() {\n const anchor = this._document.createElement('div');\n this._toggleAnchorTabIndex(this._enabled, anchor);\n anchor.classList.add('cdk-visually-hidden');\n anchor.classList.add('cdk-focus-trap-anchor');\n anchor.setAttribute('aria-hidden', 'true');\n return anchor;\n }\n /**\n * Toggles the `tabindex` of an anchor, based on the enabled state of the focus trap.\n * @param isEnabled Whether the focus trap is enabled.\n * @param anchor Anchor on which to toggle the tabindex.\n */\n _toggleAnchorTabIndex(isEnabled, anchor) {\n // Remove the tabindex completely, rather than setting it to -1, because if the\n // element has a tabindex, the user might still hit it when navigating with the arrow keys.\n isEnabled ? anchor.setAttribute('tabindex', '0') : anchor.removeAttribute('tabindex');\n }\n /**\n * Toggles the`tabindex` of both anchors to either trap Tab focus or allow it to escape.\n * @param enabled: Whether the anchors should trap Tab.\n */\n toggleAnchors(enabled) {\n if (this._startAnchor && this._endAnchor) {\n this._toggleAnchorTabIndex(enabled, this._startAnchor);\n this._toggleAnchorTabIndex(enabled, this._endAnchor);\n }\n }\n /** Executes a function when the zone is stable. */\n _executeOnStable(fn) {\n if (this._ngZone.isStable) {\n fn();\n }\n else {\n this._ngZone.onStable.pipe(take(1)).subscribe(fn);\n }\n }\n}\n/**\n * Factory that allows easy instantiation of focus traps.\n * @deprecated Use `ConfigurableFocusTrapFactory` instead.\n * @breaking-change 11.0.0\n */\nclass FocusTrapFactory {\n constructor(_checker, _ngZone, _document) {\n this._checker = _checker;\n this._ngZone = _ngZone;\n this._document = _document;\n }\n /**\n * Creates a focus-trapped region around the given element.\n * @param element The element around which focus will be trapped.\n * @param deferCaptureElements Defers the creation of focus-capturing elements to be done\n * manually by the user.\n * @returns The created focus trap instance.\n */\n create(element, deferCaptureElements = false) {\n return new FocusTrap(element, this._checker, this._ngZone, this._document, deferCaptureElements);\n }\n}\nFocusTrapFactory.ɵfac = function FocusTrapFactory_Factory(t) { return new (t || FocusTrapFactory)(ɵngcc0.ɵɵinject(InteractivityChecker), ɵngcc0.ɵɵinject(ɵngcc0.NgZone), ɵngcc0.ɵɵinject(DOCUMENT)); };\nFocusTrapFactory.ɵprov = i0.ɵɵdefineInjectable({ factory: function FocusTrapFactory_Factory() { return new FocusTrapFactory(i0.ɵɵinject(InteractivityChecker), i0.ɵɵinject(i0.NgZone), i0.ɵɵinject(i2.DOCUMENT)); }, token: FocusTrapFactory, providedIn: \"root\" });\nFocusTrapFactory.ctorParameters = () => [\n { type: InteractivityChecker },\n { type: NgZone },\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(FocusTrapFactory, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: InteractivityChecker }, { type: ɵngcc0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, null); })();\n/** Directive for trapping focus within a region. */\nclass CdkTrapFocus {\n constructor(_elementRef, _focusTrapFactory, \n /**\n * @deprecated No longer being used. To be removed.\n * @breaking-change 13.0.0\n */\n _document) {\n this._elementRef = _elementRef;\n this._focusTrapFactory = _focusTrapFactory;\n /** Previously focused element to restore focus to upon destroy when using autoCapture. */\n this._previouslyFocusedElement = null;\n this.focusTrap = this._focusTrapFactory.create(this._elementRef.nativeElement, true);\n }\n /** Whether the focus trap is active. */\n get enabled() { return this.focusTrap.enabled; }\n set enabled(value) { this.focusTrap.enabled = coerceBooleanProperty(value); }\n /**\n * Whether the directive should automatically move focus into the trapped region upon\n * initialization and return focus to the previous activeElement upon destruction.\n */\n get autoCapture() { return this._autoCapture; }\n set autoCapture(value) { this._autoCapture = coerceBooleanProperty(value); }\n ngOnDestroy() {\n this.focusTrap.destroy();\n // If we stored a previously focused element when using autoCapture, return focus to that\n // element now that the trapped region is being destroyed.\n if (this._previouslyFocusedElement) {\n this._previouslyFocusedElement.focus();\n this._previouslyFocusedElement = null;\n }\n }\n ngAfterContentInit() {\n this.focusTrap.attachAnchors();\n if (this.autoCapture) {\n this._captureFocus();\n }\n }\n ngDoCheck() {\n if (!this.focusTrap.hasAttached()) {\n this.focusTrap.attachAnchors();\n }\n }\n ngOnChanges(changes) {\n const autoCaptureChange = changes['autoCapture'];\n if (autoCaptureChange && !autoCaptureChange.firstChange && this.autoCapture &&\n this.focusTrap.hasAttached()) {\n this._captureFocus();\n }\n }\n _captureFocus() {\n this._previouslyFocusedElement = _getFocusedElementPierceShadowDom();\n this.focusTrap.focusInitialElementWhenReady();\n }\n}\nCdkTrapFocus.ɵfac = function CdkTrapFocus_Factory(t) { return new (t || CdkTrapFocus)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(FocusTrapFactory), ɵngcc0.ɵɵdirectiveInject(DOCUMENT)); };\nCdkTrapFocus.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkTrapFocus, selectors: [[\"\", \"cdkTrapFocus\", \"\"]], inputs: { enabled: [\"cdkTrapFocus\", \"enabled\"], autoCapture: [\"cdkTrapFocusAutoCapture\", \"autoCapture\"] }, exportAs: [\"cdkTrapFocus\"], features: [ɵngcc0.ɵɵNgOnChangesFeature] });\nCdkTrapFocus.ctorParameters = () => [\n { type: ElementRef },\n { type: FocusTrapFactory },\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] }\n];\nCdkTrapFocus.propDecorators = {\n enabled: [{ type: Input, args: ['cdkTrapFocus',] }],\n autoCapture: [{ type: Input, args: ['cdkTrapFocusAutoCapture',] }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkTrapFocus, [{\n type: Directive,\n args: [{\n selector: '[cdkTrapFocus]',\n exportAs: 'cdkTrapFocus'\n }]\n }], function () { return [{ type: ɵngcc0.ElementRef }, { type: FocusTrapFactory }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, { enabled: [{\n type: Input,\n args: ['cdkTrapFocus']\n }], autoCapture: [{\n type: Input,\n args: ['cdkTrapFocusAutoCapture']\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Class that allows for trapping focus within a DOM element.\n *\n * This class uses a strategy pattern that determines how it traps focus.\n * See FocusTrapInertStrategy.\n */\nclass ConfigurableFocusTrap extends FocusTrap {\n constructor(_element, _checker, _ngZone, _document, _focusTrapManager, _inertStrategy, config) {\n super(_element, _checker, _ngZone, _document, config.defer);\n this._focusTrapManager = _focusTrapManager;\n this._inertStrategy = _inertStrategy;\n this._focusTrapManager.register(this);\n }\n /** Whether the FocusTrap is enabled. */\n get enabled() { return this._enabled; }\n set enabled(value) {\n this._enabled = value;\n if (this._enabled) {\n this._focusTrapManager.register(this);\n }\n else {\n this._focusTrapManager.deregister(this);\n }\n }\n /** Notifies the FocusTrapManager that this FocusTrap will be destroyed. */\n destroy() {\n this._focusTrapManager.deregister(this);\n super.destroy();\n }\n /** @docs-private Implemented as part of ManagedFocusTrap. */\n _enable() {\n this._inertStrategy.preventFocus(this);\n this.toggleAnchors(true);\n }\n /** @docs-private Implemented as part of ManagedFocusTrap. */\n _disable() {\n this._inertStrategy.allowFocus(this);\n this.toggleAnchors(false);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** The injection token used to specify the inert strategy. */\nconst FOCUS_TRAP_INERT_STRATEGY = new InjectionToken('FOCUS_TRAP_INERT_STRATEGY');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** IE 11 compatible closest implementation that is able to start from non-Element Nodes. */\nfunction closest(element, selector) {\n if (!(element instanceof Node)) {\n return null;\n }\n let curr = element;\n while (curr != null && !(curr instanceof Element)) {\n curr = curr.parentNode;\n }\n return curr && (hasNativeClosest ?\n curr.closest(selector) : polyfillClosest(curr, selector));\n}\n/** Polyfill for browsers without Element.closest. */\nfunction polyfillClosest(element, selector) {\n let curr = element;\n while (curr != null && !(curr instanceof Element && matches(curr, selector))) {\n curr = curr.parentNode;\n }\n return (curr || null);\n}\nconst hasNativeClosest = typeof Element != 'undefined' && !!Element.prototype.closest;\n/** IE 11 compatible matches implementation. */\nfunction matches(element, selector) {\n return element.matches ?\n element.matches(selector) :\n element['msMatchesSelector'](selector);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Lightweight FocusTrapInertStrategy that adds a document focus event\n * listener to redirect focus back inside the FocusTrap.\n */\nclass EventListenerFocusTrapInertStrategy {\n constructor() {\n /** Focus event handler. */\n this._listener = null;\n }\n /** Adds a document event listener that keeps focus inside the FocusTrap. */\n preventFocus(focusTrap) {\n // Ensure there's only one listener per document\n if (this._listener) {\n focusTrap._document.removeEventListener('focus', this._listener, true);\n }\n this._listener = (e) => this._trapFocus(focusTrap, e);\n focusTrap._ngZone.runOutsideAngular(() => {\n focusTrap._document.addEventListener('focus', this._listener, true);\n });\n }\n /** Removes the event listener added in preventFocus. */\n allowFocus(focusTrap) {\n if (!this._listener) {\n return;\n }\n focusTrap._document.removeEventListener('focus', this._listener, true);\n this._listener = null;\n }\n /**\n * Refocuses the first element in the FocusTrap if the focus event target was outside\n * the FocusTrap.\n *\n * This is an event listener callback. The event listener is added in runOutsideAngular,\n * so all this code runs outside Angular as well.\n */\n _trapFocus(focusTrap, event) {\n const target = event.target;\n const focusTrapRoot = focusTrap._element;\n // Don't refocus if target was in an overlay, because the overlay might be associated\n // with an element inside the FocusTrap, ex. mat-select.\n if (!focusTrapRoot.contains(target) && closest(target, 'div.cdk-overlay-pane') === null) {\n // Some legacy FocusTrap usages have logic that focuses some element on the page\n // just before FocusTrap is destroyed. For backwards compatibility, wait\n // to be sure FocusTrap is still enabled before refocusing.\n setTimeout(() => {\n // Check whether focus wasn't put back into the focus trap while the timeout was pending.\n if (focusTrap.enabled && !focusTrapRoot.contains(focusTrap._document.activeElement)) {\n focusTrap.focusFirstTabbableElement();\n }\n });\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Injectable that ensures only the most recently enabled FocusTrap is active. */\nclass FocusTrapManager {\n constructor() {\n // A stack of the FocusTraps on the page. Only the FocusTrap at the\n // top of the stack is active.\n this._focusTrapStack = [];\n }\n /**\n * Disables the FocusTrap at the top of the stack, and then pushes\n * the new FocusTrap onto the stack.\n */\n register(focusTrap) {\n // Dedupe focusTraps that register multiple times.\n this._focusTrapStack = this._focusTrapStack.filter((ft) => ft !== focusTrap);\n let stack = this._focusTrapStack;\n if (stack.length) {\n stack[stack.length - 1]._disable();\n }\n stack.push(focusTrap);\n focusTrap._enable();\n }\n /**\n * Removes the FocusTrap from the stack, and activates the\n * FocusTrap that is the new top of the stack.\n */\n deregister(focusTrap) {\n focusTrap._disable();\n const stack = this._focusTrapStack;\n const i = stack.indexOf(focusTrap);\n if (i !== -1) {\n stack.splice(i, 1);\n if (stack.length) {\n stack[stack.length - 1]._enable();\n }\n }\n }\n}\nFocusTrapManager.ɵfac = function FocusTrapManager_Factory(t) { return new (t || FocusTrapManager)(); };\nFocusTrapManager.ɵprov = i0.ɵɵdefineInjectable({ factory: function FocusTrapManager_Factory() { return new FocusTrapManager(); }, token: FocusTrapManager, providedIn: \"root\" });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(FocusTrapManager, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return []; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Factory that allows easy instantiation of configurable focus traps. */\nclass ConfigurableFocusTrapFactory {\n constructor(_checker, _ngZone, _focusTrapManager, _document, _inertStrategy) {\n this._checker = _checker;\n this._ngZone = _ngZone;\n this._focusTrapManager = _focusTrapManager;\n this._document = _document;\n // TODO split up the strategies into different modules, similar to DateAdapter.\n this._inertStrategy = _inertStrategy || new EventListenerFocusTrapInertStrategy();\n }\n create(element, config = { defer: false }) {\n let configObject;\n if (typeof config === 'boolean') {\n configObject = { defer: config };\n }\n else {\n configObject = config;\n }\n return new ConfigurableFocusTrap(element, this._checker, this._ngZone, this._document, this._focusTrapManager, this._inertStrategy, configObject);\n }\n}\nConfigurableFocusTrapFactory.ɵfac = function ConfigurableFocusTrapFactory_Factory(t) { return new (t || ConfigurableFocusTrapFactory)(ɵngcc0.ɵɵinject(InteractivityChecker), ɵngcc0.ɵɵinject(ɵngcc0.NgZone), ɵngcc0.ɵɵinject(FocusTrapManager), ɵngcc0.ɵɵinject(DOCUMENT), ɵngcc0.ɵɵinject(FOCUS_TRAP_INERT_STRATEGY, 8)); };\nConfigurableFocusTrapFactory.ɵprov = i0.ɵɵdefineInjectable({ factory: function ConfigurableFocusTrapFactory_Factory() { return new ConfigurableFocusTrapFactory(i0.ɵɵinject(InteractivityChecker), i0.ɵɵinject(i0.NgZone), i0.ɵɵinject(FocusTrapManager), i0.ɵɵinject(i2.DOCUMENT), i0.ɵɵinject(FOCUS_TRAP_INERT_STRATEGY, 8)); }, token: ConfigurableFocusTrapFactory, providedIn: \"root\" });\nConfigurableFocusTrapFactory.ctorParameters = () => [\n { type: InteractivityChecker },\n { type: NgZone },\n { type: FocusTrapManager },\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] },\n { type: undefined, decorators: [{ type: Optional }, { type: Inject, args: [FOCUS_TRAP_INERT_STRATEGY,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(ConfigurableFocusTrapFactory, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: InteractivityChecker }, { type: ɵngcc0.NgZone }, { type: FocusTrapManager }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [FOCUS_TRAP_INERT_STRATEGY]\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Gets whether an event could be a faked `mousedown` event dispatched by a screen reader. */\nfunction isFakeMousedownFromScreenReader(event) {\n // We can typically distinguish between these faked mousedown events and real mousedown events\n // using the \"buttons\" property. While real mousedowns will indicate the mouse button that was\n // pressed (e.g. \"1\" for the left mouse button), faked mousedowns will usually set the property\n // value to 0.\n return event.buttons === 0;\n}\n/** Gets whether an event could be a faked `touchstart` event dispatched by a screen reader. */\nfunction isFakeTouchstartFromScreenReader(event) {\n const touch = (event.touches && event.touches[0]) ||\n (event.changedTouches && event.changedTouches[0]);\n // A fake `touchstart` can be distinguished from a real one by looking at the `identifier`\n // which is typically >= 0 on a real device versus -1 from a screen reader. Just to be safe,\n // we can also look at `radiusX` and `radiusY`. This behavior was observed against a Windows 10\n // device with a touch screen running NVDA v2020.4 and Firefox 85 or Chrome 88.\n return !!touch && touch.identifier === -1 && (touch.radiusX == null || touch.radiusX === 1) &&\n (touch.radiusY == null || touch.radiusY === 1);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injectable options for the InputModalityDetector. These are shallowly merged with the default\n * options.\n */\nconst INPUT_MODALITY_DETECTOR_OPTIONS = new InjectionToken('cdk-input-modality-detector-options');\n/**\n * Default options for the InputModalityDetector.\n *\n * Modifier keys are ignored by default (i.e. when pressed won't cause the service to detect\n * keyboard input modality) for two reasons:\n *\n * 1. Modifier keys are commonly used with mouse to perform actions such as 'right click' or 'open\n * in new tab', and are thus less representative of actual keyboard interaction.\n * 2. VoiceOver triggers some keyboard events when linearly navigating with Control + Option (but\n * confusingly not with Caps Lock). Thus, to have parity with other screen readers, we ignore\n * these keys so as to not update the input modality.\n *\n * Note that we do not by default ignore the right Meta key on Safari because it has the same key\n * code as the ContextMenu key on other browsers. When we switch to using event.key, we can\n * distinguish between the two.\n */\nconst INPUT_MODALITY_DETECTOR_DEFAULT_OPTIONS = {\n ignoreKeys: [ALT, CONTROL, MAC_META, META, SHIFT],\n};\n/**\n * The amount of time needed to pass after a touchstart event in order for a subsequent mousedown\n * event to be attributed as mouse and not touch.\n *\n * This is the value used by AngularJS Material. Through trial and error (on iPhone 6S) they found\n * that a value of around 650ms seems appropriate.\n */\nconst TOUCH_BUFFER_MS = 650;\n/**\n * Event listener options that enable capturing and also mark the listener as passive if the browser\n * supports it.\n */\nconst modalityEventListenerOptions = normalizePassiveListenerOptions({\n passive: true,\n capture: true,\n});\n/**\n * Service that detects the user's input modality.\n *\n * This service does not update the input modality when a user navigates with a screen reader\n * (e.g. linear navigation with VoiceOver, object navigation / browse mode with NVDA, virtual PC\n * cursor mode with JAWS). This is in part due to technical limitations (i.e. keyboard events do not\n * fire as expected in these modes) but is also arguably the correct behavior. Navigating with a\n * screen reader is akin to visually scanning a page, and should not be interpreted as actual user\n * input interaction.\n *\n * When a user is not navigating but *interacting* with a screen reader, this service attempts to\n * update the input modality to keyboard, but in general this service's behavior is largely\n * undefined.\n */\nclass InputModalityDetector {\n constructor(_platform, ngZone, document, options) {\n this._platform = _platform;\n /**\n * The most recently detected input modality event target. Is null if no input modality has been\n * detected or if the associated event target is null for some unknown reason.\n */\n this._mostRecentTarget = null;\n /** The underlying BehaviorSubject that emits whenever an input modality is detected. */\n this._modality = new BehaviorSubject(null);\n /**\n * The timestamp of the last touch input modality. Used to determine whether mousedown events\n * should be attributed to mouse or touch.\n */\n this._lastTouchMs = 0;\n /**\n * Handles keydown events. Must be an arrow function in order to preserve the context when it gets\n * bound.\n */\n this._onKeydown = (event) => {\n var _a, _b;\n // If this is one of the keys we should ignore, then ignore it and don't update the input\n // modality to keyboard.\n if ((_b = (_a = this._options) === null || _a === void 0 ? void 0 : _a.ignoreKeys) === null || _b === void 0 ? void 0 : _b.some(keyCode => keyCode === event.keyCode)) {\n return;\n }\n this._modality.next('keyboard');\n this._mostRecentTarget = getTarget(event);\n };\n /**\n * Handles mousedown events. Must be an arrow function in order to preserve the context when it\n * gets bound.\n */\n this._onMousedown = (event) => {\n // Touches trigger both touch and mouse events, so we need to distinguish between mouse events\n // that were triggered via mouse vs touch. To do so, check if the mouse event occurs closely\n // after the previous touch event.\n if (Date.now() - this._lastTouchMs < TOUCH_BUFFER_MS) {\n return;\n }\n // Fake mousedown events are fired by some screen readers when controls are activated by the\n // screen reader. Attribute them to keyboard input modality.\n this._modality.next(isFakeMousedownFromScreenReader(event) ? 'keyboard' : 'mouse');\n this._mostRecentTarget = getTarget(event);\n };\n /**\n * Handles touchstart events. Must be an arrow function in order to preserve the context when it\n * gets bound.\n */\n this._onTouchstart = (event) => {\n // Same scenario as mentioned in _onMousedown, but on touch screen devices, fake touchstart\n // events are fired. Again, attribute to keyboard input modality.\n if (isFakeTouchstartFromScreenReader(event)) {\n this._modality.next('keyboard');\n return;\n }\n // Store the timestamp of this touch event, as it's used to distinguish between mouse events\n // triggered via mouse vs touch.\n this._lastTouchMs = Date.now();\n this._modality.next('touch');\n this._mostRecentTarget = getTarget(event);\n };\n this._options = Object.assign(Object.assign({}, INPUT_MODALITY_DETECTOR_DEFAULT_OPTIONS), options);\n // Skip the first emission as it's null.\n this.modalityDetected = this._modality.pipe(skip(1));\n this.modalityChanged = this.modalityDetected.pipe(distinctUntilChanged());\n // If we're not in a browser, this service should do nothing, as there's no relevant input\n // modality to detect.\n if (!_platform.isBrowser) {\n return;\n }\n // Add the event listeners used to detect the user's input modality.\n ngZone.runOutsideAngular(() => {\n document.addEventListener('keydown', this._onKeydown, modalityEventListenerOptions);\n document.addEventListener('mousedown', this._onMousedown, modalityEventListenerOptions);\n document.addEventListener('touchstart', this._onTouchstart, modalityEventListenerOptions);\n });\n }\n /** The most recently detected input modality. */\n get mostRecentModality() {\n return this._modality.value;\n }\n ngOnDestroy() {\n if (!this._platform.isBrowser) {\n return;\n }\n document.removeEventListener('keydown', this._onKeydown, modalityEventListenerOptions);\n document.removeEventListener('mousedown', this._onMousedown, modalityEventListenerOptions);\n document.removeEventListener('touchstart', this._onTouchstart, modalityEventListenerOptions);\n }\n}\nInputModalityDetector.ɵfac = function InputModalityDetector_Factory(t) { return new (t || InputModalityDetector)(ɵngcc0.ɵɵinject(ɵngcc1.Platform), ɵngcc0.ɵɵinject(ɵngcc0.NgZone), ɵngcc0.ɵɵinject(DOCUMENT), ɵngcc0.ɵɵinject(INPUT_MODALITY_DETECTOR_OPTIONS, 8)); };\nInputModalityDetector.ɵprov = i0.ɵɵdefineInjectable({ factory: function InputModalityDetector_Factory() { return new InputModalityDetector(i0.ɵɵinject(i1.Platform), i0.ɵɵinject(i0.NgZone), i0.ɵɵinject(i2.DOCUMENT), i0.ɵɵinject(INPUT_MODALITY_DETECTOR_OPTIONS, 8)); }, token: InputModalityDetector, providedIn: \"root\" });\nInputModalityDetector.ctorParameters = () => [\n { type: Platform },\n { type: NgZone },\n { type: Document, decorators: [{ type: Inject, args: [DOCUMENT,] }] },\n { type: undefined, decorators: [{ type: Optional }, { type: Inject, args: [INPUT_MODALITY_DETECTOR_OPTIONS,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(InputModalityDetector, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: ɵngcc1.Platform }, { type: ɵngcc0.NgZone }, { type: Document, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [INPUT_MODALITY_DETECTOR_OPTIONS]\n }] }]; }, null); })();\n/** Gets the target of an event, accounting for Shadow DOM. */\nfunction getTarget(event) {\n // If an event is bound outside the Shadow DOM, the `event.target` will\n // point to the shadow root so we have to use `composedPath` instead.\n return (event.composedPath ? event.composedPath()[0] : event.target);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst LIVE_ANNOUNCER_ELEMENT_TOKEN = new InjectionToken('liveAnnouncerElement', {\n providedIn: 'root',\n factory: LIVE_ANNOUNCER_ELEMENT_TOKEN_FACTORY,\n});\n/** @docs-private */\nfunction LIVE_ANNOUNCER_ELEMENT_TOKEN_FACTORY() {\n return null;\n}\n/** Injection token that can be used to configure the default options for the LiveAnnouncer. */\nconst LIVE_ANNOUNCER_DEFAULT_OPTIONS = new InjectionToken('LIVE_ANNOUNCER_DEFAULT_OPTIONS');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass LiveAnnouncer {\n constructor(elementToken, _ngZone, _document, _defaultOptions) {\n this._ngZone = _ngZone;\n this._defaultOptions = _defaultOptions;\n // We inject the live element and document as `any` because the constructor signature cannot\n // reference browser globals (HTMLElement, Document) on non-browser environments, since having\n // a class decorator causes TypeScript to preserve the constructor signature types.\n this._document = _document;\n this._liveElement = elementToken || this._createLiveElement();\n }\n announce(message, ...args) {\n const defaultOptions = this._defaultOptions;\n let politeness;\n let duration;\n if (args.length === 1 && typeof args[0] === 'number') {\n duration = args[0];\n }\n else {\n [politeness, duration] = args;\n }\n this.clear();\n clearTimeout(this._previousTimeout);\n if (!politeness) {\n politeness =\n (defaultOptions && defaultOptions.politeness) ? defaultOptions.politeness : 'polite';\n }\n if (duration == null && defaultOptions) {\n duration = defaultOptions.duration;\n }\n // TODO: ensure changing the politeness works on all environments we support.\n this._liveElement.setAttribute('aria-live', politeness);\n // This 100ms timeout is necessary for some browser + screen-reader combinations:\n // - Both JAWS and NVDA over IE11 will not announce anything without a non-zero timeout.\n // - With Chrome and IE11 with NVDA or JAWS, a repeated (identical) message won't be read a\n // second time without clearing and then using a non-zero delay.\n // (using JAWS 17 at time of this writing).\n return this._ngZone.runOutsideAngular(() => {\n return new Promise(resolve => {\n clearTimeout(this._previousTimeout);\n this._previousTimeout = setTimeout(() => {\n this._liveElement.textContent = message;\n resolve();\n if (typeof duration === 'number') {\n this._previousTimeout = setTimeout(() => this.clear(), duration);\n }\n }, 100);\n });\n });\n }\n /**\n * Clears the current text from the announcer element. Can be used to prevent\n * screen readers from reading the text out again while the user is going\n * through the page landmarks.\n */\n clear() {\n if (this._liveElement) {\n this._liveElement.textContent = '';\n }\n }\n ngOnDestroy() {\n clearTimeout(this._previousTimeout);\n if (this._liveElement && this._liveElement.parentNode) {\n this._liveElement.parentNode.removeChild(this._liveElement);\n this._liveElement = null;\n }\n }\n _createLiveElement() {\n const elementClass = 'cdk-live-announcer-element';\n const previousElements = this._document.getElementsByClassName(elementClass);\n const liveEl = this._document.createElement('div');\n // Remove any old containers. This can happen when coming in from a server-side-rendered page.\n for (let i = 0; i < previousElements.length; i++) {\n previousElements[i].parentNode.removeChild(previousElements[i]);\n }\n liveEl.classList.add(elementClass);\n liveEl.classList.add('cdk-visually-hidden');\n liveEl.setAttribute('aria-atomic', 'true');\n liveEl.setAttribute('aria-live', 'polite');\n this._document.body.appendChild(liveEl);\n return liveEl;\n }\n}\nLiveAnnouncer.ɵfac = function LiveAnnouncer_Factory(t) { return new (t || LiveAnnouncer)(ɵngcc0.ɵɵinject(LIVE_ANNOUNCER_ELEMENT_TOKEN, 8), ɵngcc0.ɵɵinject(ɵngcc0.NgZone), ɵngcc0.ɵɵinject(DOCUMENT), ɵngcc0.ɵɵinject(LIVE_ANNOUNCER_DEFAULT_OPTIONS, 8)); };\nLiveAnnouncer.ɵprov = i0.ɵɵdefineInjectable({ factory: function LiveAnnouncer_Factory() { return new LiveAnnouncer(i0.ɵɵinject(LIVE_ANNOUNCER_ELEMENT_TOKEN, 8), i0.ɵɵinject(i0.NgZone), i0.ɵɵinject(i2.DOCUMENT), i0.ɵɵinject(LIVE_ANNOUNCER_DEFAULT_OPTIONS, 8)); }, token: LiveAnnouncer, providedIn: \"root\" });\nLiveAnnouncer.ctorParameters = () => [\n { type: undefined, decorators: [{ type: Optional }, { type: Inject, args: [LIVE_ANNOUNCER_ELEMENT_TOKEN,] }] },\n { type: NgZone },\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] },\n { type: undefined, decorators: [{ type: Optional }, { type: Inject, args: [LIVE_ANNOUNCER_DEFAULT_OPTIONS,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(LiveAnnouncer, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [LIVE_ANNOUNCER_ELEMENT_TOKEN]\n }] }, { type: ɵngcc0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [LIVE_ANNOUNCER_DEFAULT_OPTIONS]\n }] }]; }, null); })();\n/**\n * A directive that works similarly to aria-live, but uses the LiveAnnouncer to ensure compatibility\n * with a wider range of browsers and screen readers.\n */\nclass CdkAriaLive {\n constructor(_elementRef, _liveAnnouncer, _contentObserver, _ngZone) {\n this._elementRef = _elementRef;\n this._liveAnnouncer = _liveAnnouncer;\n this._contentObserver = _contentObserver;\n this._ngZone = _ngZone;\n this._politeness = 'polite';\n }\n /** The aria-live politeness level to use when announcing messages. */\n get politeness() { return this._politeness; }\n set politeness(value) {\n this._politeness = value === 'off' || value === 'assertive' ? value : 'polite';\n if (this._politeness === 'off') {\n if (this._subscription) {\n this._subscription.unsubscribe();\n this._subscription = null;\n }\n }\n else if (!this._subscription) {\n this._subscription = this._ngZone.runOutsideAngular(() => {\n return this._contentObserver\n .observe(this._elementRef)\n .subscribe(() => {\n // Note that we use textContent here, rather than innerText, in order to avoid a reflow.\n const elementText = this._elementRef.nativeElement.textContent;\n // The `MutationObserver` fires also for attribute\n // changes which we don't want to announce.\n if (elementText !== this._previousAnnouncedText) {\n this._liveAnnouncer.announce(elementText, this._politeness);\n this._previousAnnouncedText = elementText;\n }\n });\n });\n }\n }\n ngOnDestroy() {\n if (this._subscription) {\n this._subscription.unsubscribe();\n }\n }\n}\nCdkAriaLive.ɵfac = function CdkAriaLive_Factory(t) { return new (t || CdkAriaLive)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(LiveAnnouncer), ɵngcc0.ɵɵdirectiveInject(ɵngcc2.ContentObserver), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.NgZone)); };\nCdkAriaLive.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkAriaLive, selectors: [[\"\", \"cdkAriaLive\", \"\"]], inputs: { politeness: [\"cdkAriaLive\", \"politeness\"] }, exportAs: [\"cdkAriaLive\"] });\nCdkAriaLive.ctorParameters = () => [\n { type: ElementRef },\n { type: LiveAnnouncer },\n { type: ContentObserver },\n { type: NgZone }\n];\nCdkAriaLive.propDecorators = {\n politeness: [{ type: Input, args: ['cdkAriaLive',] }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkAriaLive, [{\n type: Directive,\n args: [{\n selector: '[cdkAriaLive]',\n exportAs: 'cdkAriaLive'\n }]\n }], function () { return [{ type: ɵngcc0.ElementRef }, { type: LiveAnnouncer }, { type: ɵngcc2.ContentObserver }, { type: ɵngcc0.NgZone }]; }, { politeness: [{\n type: Input,\n args: ['cdkAriaLive']\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** InjectionToken for FocusMonitorOptions. */\nconst FOCUS_MONITOR_DEFAULT_OPTIONS = new InjectionToken('cdk-focus-monitor-default-options');\n/**\n * Event listener options that enable capturing and also\n * mark the listener as passive if the browser supports it.\n */\nconst captureEventListenerOptions = normalizePassiveListenerOptions({\n passive: true,\n capture: true\n});\n/** Monitors mouse and keyboard events to determine the cause of focus events. */\nclass FocusMonitor {\n constructor(_ngZone, _platform, _inputModalityDetector, \n /** @breaking-change 11.0.0 make document required */\n document, options) {\n this._ngZone = _ngZone;\n this._platform = _platform;\n this._inputModalityDetector = _inputModalityDetector;\n /** The focus origin that the next focus event is a result of. */\n this._origin = null;\n /** Whether the window has just been focused. */\n this._windowFocused = false;\n /**\n * Whether the origin was determined via a touch interaction. Necessary as properly attributing\n * focus events to touch interactions requires special logic.\n */\n this._originFromTouchInteraction = false;\n /** Map of elements being monitored to their info. */\n this._elementInfo = new Map();\n /** The number of elements currently being monitored. */\n this._monitoredElementCount = 0;\n /**\n * Keeps track of the root nodes to which we've currently bound a focus/blur handler,\n * as well as the number of monitored elements that they contain. We have to treat focus/blur\n * handlers differently from the rest of the events, because the browser won't emit events\n * to the document when focus moves inside of a shadow root.\n */\n this._rootNodeFocusListenerCount = new Map();\n /**\n * Event listener for `focus` events on the window.\n * Needs to be an arrow function in order to preserve the context when it gets bound.\n */\n this._windowFocusListener = () => {\n // Make a note of when the window regains focus, so we can\n // restore the origin info for the focused element.\n this._windowFocused = true;\n this._windowFocusTimeoutId = setTimeout(() => this._windowFocused = false);\n };\n /** Subject for stopping our InputModalityDetector subscription. */\n this._stopInputModalityDetector = new Subject();\n /**\n * Event listener for `focus` and 'blur' events on the document.\n * Needs to be an arrow function in order to preserve the context when it gets bound.\n */\n this._rootNodeFocusAndBlurListener = (event) => {\n const target = getTarget(event);\n const handler = event.type === 'focus' ? this._onFocus : this._onBlur;\n // We need to walk up the ancestor chain in order to support `checkChildren`.\n for (let element = target; element; element = element.parentElement) {\n handler.call(this, event, element);\n }\n };\n this._document = document;\n this._detectionMode = (options === null || options === void 0 ? void 0 : options.detectionMode) || 0 /* IMMEDIATE */;\n }\n monitor(element, checkChildren = false) {\n const nativeElement = coerceElement(element);\n // Do nothing if we're not on the browser platform or the passed in node isn't an element.\n if (!this._platform.isBrowser || nativeElement.nodeType !== 1) {\n return of(null);\n }\n // If the element is inside the shadow DOM, we need to bind our focus/blur listeners to\n // the shadow root, rather than the `document`, because the browser won't emit focus events\n // to the `document`, if focus is moving within the same shadow root.\n const rootNode = _getShadowRoot(nativeElement) || this._getDocument();\n const cachedInfo = this._elementInfo.get(nativeElement);\n // Check if we're already monitoring this element.\n if (cachedInfo) {\n if (checkChildren) {\n // TODO(COMP-318): this can be problematic, because it'll turn all non-checkChildren\n // observers into ones that behave as if `checkChildren` was turned on. We need a more\n // robust solution.\n cachedInfo.checkChildren = true;\n }\n return cachedInfo.subject;\n }\n // Create monitored element info.\n const info = {\n checkChildren: checkChildren,\n subject: new Subject(),\n rootNode\n };\n this._elementInfo.set(nativeElement, info);\n this._registerGlobalListeners(info);\n return info.subject;\n }\n stopMonitoring(element) {\n const nativeElement = coerceElement(element);\n const elementInfo = this._elementInfo.get(nativeElement);\n if (elementInfo) {\n elementInfo.subject.complete();\n this._setClasses(nativeElement);\n this._elementInfo.delete(nativeElement);\n this._removeGlobalListeners(elementInfo);\n }\n }\n focusVia(element, origin, options) {\n const nativeElement = coerceElement(element);\n const focusedElement = this._getDocument().activeElement;\n // If the element is focused already, calling `focus` again won't trigger the event listener\n // which means that the focus classes won't be updated. If that's the case, update the classes\n // directly without waiting for an event.\n if (nativeElement === focusedElement) {\n this._getClosestElementsInfo(nativeElement)\n .forEach(([currentElement, info]) => this._originChanged(currentElement, origin, info));\n }\n else {\n this._setOrigin(origin);\n // `focus` isn't available on the server\n if (typeof nativeElement.focus === 'function') {\n nativeElement.focus(options);\n }\n }\n }\n ngOnDestroy() {\n this._elementInfo.forEach((_info, element) => this.stopMonitoring(element));\n }\n /** Access injected document if available or fallback to global document reference */\n _getDocument() {\n return this._document || document;\n }\n /** Use defaultView of injected document if available or fallback to global window reference */\n _getWindow() {\n const doc = this._getDocument();\n return doc.defaultView || window;\n }\n _toggleClass(element, className, shouldSet) {\n if (shouldSet) {\n element.classList.add(className);\n }\n else {\n element.classList.remove(className);\n }\n }\n _getFocusOrigin(focusEventTarget) {\n if (this._origin) {\n // If the origin was realized via a touch interaction, we need to perform additional checks\n // to determine whether the focus origin should be attributed to touch or program.\n if (this._originFromTouchInteraction) {\n return this._shouldBeAttributedToTouch(focusEventTarget) ? 'touch' : 'program';\n }\n else {\n return this._origin;\n }\n }\n // If the window has just regained focus, we can restore the most recent origin from before the\n // window blurred. Otherwise, we've reached the point where we can't identify the source of the\n // focus. This typically means one of two things happened:\n //\n // 1) The element was programmatically focused, or\n // 2) The element was focused via screen reader navigation (which generally doesn't fire\n // events).\n //\n // Because we can't distinguish between these two cases, we default to setting `program`.\n return (this._windowFocused && this._lastFocusOrigin) ? this._lastFocusOrigin : 'program';\n }\n /**\n * Returns whether the focus event should be attributed to touch. Recall that in IMMEDIATE mode, a\n * touch origin isn't immediately reset at the next tick (see _setOrigin). This means that when we\n * handle a focus event following a touch interaction, we need to determine whether (1) the focus\n * event was directly caused by the touch interaction or (2) the focus event was caused by a\n * subsequent programmatic focus call triggered by the touch interaction.\n * @param focusEventTarget The target of the focus event under examination.\n */\n _shouldBeAttributedToTouch(focusEventTarget) {\n // Please note that this check is not perfect. Consider the following edge case:\n //\n //
\n // \n //
\n //\n // Suppose there is a FocusMonitor in IMMEDIATE mode attached to #parent. When the user touches\n // #child, #parent is programmatically focused. This code will attribute the focus to touch\n // instead of program. This is a relatively minor edge-case that can be worked around by using\n // focusVia(parent, 'program') to focus #parent.\n return (this._detectionMode === 1 /* EVENTUAL */) ||\n !!(focusEventTarget === null || focusEventTarget === void 0 ? void 0 : focusEventTarget.contains(this._inputModalityDetector._mostRecentTarget));\n }\n /**\n * Sets the focus classes on the element based on the given focus origin.\n * @param element The element to update the classes on.\n * @param origin The focus origin.\n */\n _setClasses(element, origin) {\n this._toggleClass(element, 'cdk-focused', !!origin);\n this._toggleClass(element, 'cdk-touch-focused', origin === 'touch');\n this._toggleClass(element, 'cdk-keyboard-focused', origin === 'keyboard');\n this._toggleClass(element, 'cdk-mouse-focused', origin === 'mouse');\n this._toggleClass(element, 'cdk-program-focused', origin === 'program');\n }\n /**\n * Updates the focus origin. If we're using immediate detection mode, we schedule an async\n * function to clear the origin at the end of a timeout. The duration of the timeout depends on\n * the origin being set.\n * @param origin The origin to set.\n * @param isFromInteraction Whether we are setting the origin from an interaction event.\n */\n _setOrigin(origin, isFromInteraction = false) {\n this._ngZone.runOutsideAngular(() => {\n this._origin = origin;\n this._originFromTouchInteraction = (origin === 'touch') && isFromInteraction;\n // If we're in IMMEDIATE mode, reset the origin at the next tick (or in `TOUCH_BUFFER_MS` ms\n // for a touch event). We reset the origin at the next tick because Firefox focuses one tick\n // after the interaction event. We wait `TOUCH_BUFFER_MS` ms before resetting the origin for\n // a touch event because when a touch event is fired, the associated focus event isn't yet in\n // the event queue. Before doing so, clear any pending timeouts.\n if (this._detectionMode === 0 /* IMMEDIATE */) {\n clearTimeout(this._originTimeoutId);\n const ms = this._originFromTouchInteraction ? TOUCH_BUFFER_MS : 1;\n this._originTimeoutId = setTimeout(() => this._origin = null, ms);\n }\n });\n }\n /**\n * Handles focus events on a registered element.\n * @param event The focus event.\n * @param element The monitored element.\n */\n _onFocus(event, element) {\n // NOTE(mmalerba): We currently set the classes based on the focus origin of the most recent\n // focus event affecting the monitored element. If we want to use the origin of the first event\n // instead we should check for the cdk-focused class here and return if the element already has\n // it. (This only matters for elements that have includesChildren = true).\n // If we are not counting child-element-focus as focused, make sure that the event target is the\n // monitored element itself.\n const elementInfo = this._elementInfo.get(element);\n const focusEventTarget = getTarget(event);\n if (!elementInfo || (!elementInfo.checkChildren && element !== focusEventTarget)) {\n return;\n }\n this._originChanged(element, this._getFocusOrigin(focusEventTarget), elementInfo);\n }\n /**\n * Handles blur events on a registered element.\n * @param event The blur event.\n * @param element The monitored element.\n */\n _onBlur(event, element) {\n // If we are counting child-element-focus as focused, make sure that we aren't just blurring in\n // order to focus another child of the monitored element.\n const elementInfo = this._elementInfo.get(element);\n if (!elementInfo || (elementInfo.checkChildren && event.relatedTarget instanceof Node &&\n element.contains(event.relatedTarget))) {\n return;\n }\n this._setClasses(element);\n this._emitOrigin(elementInfo.subject, null);\n }\n _emitOrigin(subject, origin) {\n this._ngZone.run(() => subject.next(origin));\n }\n _registerGlobalListeners(elementInfo) {\n if (!this._platform.isBrowser) {\n return;\n }\n const rootNode = elementInfo.rootNode;\n const rootNodeFocusListeners = this._rootNodeFocusListenerCount.get(rootNode) || 0;\n if (!rootNodeFocusListeners) {\n this._ngZone.runOutsideAngular(() => {\n rootNode.addEventListener('focus', this._rootNodeFocusAndBlurListener, captureEventListenerOptions);\n rootNode.addEventListener('blur', this._rootNodeFocusAndBlurListener, captureEventListenerOptions);\n });\n }\n this._rootNodeFocusListenerCount.set(rootNode, rootNodeFocusListeners + 1);\n // Register global listeners when first element is monitored.\n if (++this._monitoredElementCount === 1) {\n // Note: we listen to events in the capture phase so we\n // can detect them even if the user stops propagation.\n this._ngZone.runOutsideAngular(() => {\n const window = this._getWindow();\n window.addEventListener('focus', this._windowFocusListener);\n });\n // The InputModalityDetector is also just a collection of global listeners.\n this._inputModalityDetector.modalityDetected\n .pipe(takeUntil(this._stopInputModalityDetector))\n .subscribe(modality => { this._setOrigin(modality, true /* isFromInteraction */); });\n }\n }\n _removeGlobalListeners(elementInfo) {\n const rootNode = elementInfo.rootNode;\n if (this._rootNodeFocusListenerCount.has(rootNode)) {\n const rootNodeFocusListeners = this._rootNodeFocusListenerCount.get(rootNode);\n if (rootNodeFocusListeners > 1) {\n this._rootNodeFocusListenerCount.set(rootNode, rootNodeFocusListeners - 1);\n }\n else {\n rootNode.removeEventListener('focus', this._rootNodeFocusAndBlurListener, captureEventListenerOptions);\n rootNode.removeEventListener('blur', this._rootNodeFocusAndBlurListener, captureEventListenerOptions);\n this._rootNodeFocusListenerCount.delete(rootNode);\n }\n }\n // Unregister global listeners when last element is unmonitored.\n if (!--this._monitoredElementCount) {\n const window = this._getWindow();\n window.removeEventListener('focus', this._windowFocusListener);\n // Equivalently, stop our InputModalityDetector subscription.\n this._stopInputModalityDetector.next();\n // Clear timeouts for all potentially pending timeouts to prevent the leaks.\n clearTimeout(this._windowFocusTimeoutId);\n clearTimeout(this._originTimeoutId);\n }\n }\n /** Updates all the state on an element once its focus origin has changed. */\n _originChanged(element, origin, elementInfo) {\n this._setClasses(element, origin);\n this._emitOrigin(elementInfo.subject, origin);\n this._lastFocusOrigin = origin;\n }\n /**\n * Collects the `MonitoredElementInfo` of a particular element and\n * all of its ancestors that have enabled `checkChildren`.\n * @param element Element from which to start the search.\n */\n _getClosestElementsInfo(element) {\n const results = [];\n this._elementInfo.forEach((info, currentElement) => {\n if (currentElement === element || (info.checkChildren && currentElement.contains(element))) {\n results.push([currentElement, info]);\n }\n });\n return results;\n }\n}\nFocusMonitor.ɵfac = function FocusMonitor_Factory(t) { return new (t || FocusMonitor)(ɵngcc0.ɵɵinject(ɵngcc0.NgZone), ɵngcc0.ɵɵinject(ɵngcc1.Platform), ɵngcc0.ɵɵinject(InputModalityDetector), ɵngcc0.ɵɵinject(DOCUMENT, 8), ɵngcc0.ɵɵinject(FOCUS_MONITOR_DEFAULT_OPTIONS, 8)); };\nFocusMonitor.ɵprov = i0.ɵɵdefineInjectable({ factory: function FocusMonitor_Factory() { return new FocusMonitor(i0.ɵɵinject(i0.NgZone), i0.ɵɵinject(i1.Platform), i0.ɵɵinject(InputModalityDetector), i0.ɵɵinject(i2.DOCUMENT, 8), i0.ɵɵinject(FOCUS_MONITOR_DEFAULT_OPTIONS, 8)); }, token: FocusMonitor, providedIn: \"root\" });\nFocusMonitor.ctorParameters = () => [\n { type: NgZone },\n { type: Platform },\n { type: InputModalityDetector },\n { type: undefined, decorators: [{ type: Optional }, { type: Inject, args: [DOCUMENT,] }] },\n { type: undefined, decorators: [{ type: Optional }, { type: Inject, args: [FOCUS_MONITOR_DEFAULT_OPTIONS,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(FocusMonitor, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: ɵngcc0.NgZone }, { type: ɵngcc1.Platform }, { type: InputModalityDetector }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [FOCUS_MONITOR_DEFAULT_OPTIONS]\n }] }]; }, null); })();\n/**\n * Directive that determines how a particular element was focused (via keyboard, mouse, touch, or\n * programmatically) and adds corresponding classes to the element.\n *\n * There are two variants of this directive:\n * 1) cdkMonitorElementFocus: does not consider an element to be focused if one of its children is\n * focused.\n * 2) cdkMonitorSubtreeFocus: considers an element focused if it or any of its children are focused.\n */\nclass CdkMonitorFocus {\n constructor(_elementRef, _focusMonitor) {\n this._elementRef = _elementRef;\n this._focusMonitor = _focusMonitor;\n this.cdkFocusChange = new EventEmitter();\n }\n ngAfterViewInit() {\n const element = this._elementRef.nativeElement;\n this._monitorSubscription = this._focusMonitor.monitor(element, element.nodeType === 1 && element.hasAttribute('cdkMonitorSubtreeFocus'))\n .subscribe(origin => this.cdkFocusChange.emit(origin));\n }\n ngOnDestroy() {\n this._focusMonitor.stopMonitoring(this._elementRef);\n if (this._monitorSubscription) {\n this._monitorSubscription.unsubscribe();\n }\n }\n}\nCdkMonitorFocus.ɵfac = function CdkMonitorFocus_Factory(t) { return new (t || CdkMonitorFocus)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(FocusMonitor)); };\nCdkMonitorFocus.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkMonitorFocus, selectors: [[\"\", \"cdkMonitorElementFocus\", \"\"], [\"\", \"cdkMonitorSubtreeFocus\", \"\"]], outputs: { cdkFocusChange: \"cdkFocusChange\" } });\nCdkMonitorFocus.ctorParameters = () => [\n { type: ElementRef },\n { type: FocusMonitor }\n];\nCdkMonitorFocus.propDecorators = {\n cdkFocusChange: [{ type: Output }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkMonitorFocus, [{\n type: Directive,\n args: [{\n selector: '[cdkMonitorElementFocus], [cdkMonitorSubtreeFocus]'\n }]\n }], function () { return [{ type: ɵngcc0.ElementRef }, { type: FocusMonitor }]; }, { cdkFocusChange: [{\n type: Output\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** CSS class applied to the document body when in black-on-white high-contrast mode. */\nconst BLACK_ON_WHITE_CSS_CLASS = 'cdk-high-contrast-black-on-white';\n/** CSS class applied to the document body when in white-on-black high-contrast mode. */\nconst WHITE_ON_BLACK_CSS_CLASS = 'cdk-high-contrast-white-on-black';\n/** CSS class applied to the document body when in high-contrast mode. */\nconst HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS = 'cdk-high-contrast-active';\n/**\n * Service to determine whether the browser is currently in a high-contrast-mode environment.\n *\n * Microsoft Windows supports an accessibility feature called \"High Contrast Mode\". This mode\n * changes the appearance of all applications, including web applications, to dramatically increase\n * contrast.\n *\n * IE, Edge, and Firefox currently support this mode. Chrome does not support Windows High Contrast\n * Mode. This service does not detect high-contrast mode as added by the Chrome \"High Contrast\"\n * browser extension.\n */\nclass HighContrastModeDetector {\n constructor(_platform, document) {\n this._platform = _platform;\n this._document = document;\n }\n /** Gets the current high-contrast-mode for the page. */\n getHighContrastMode() {\n if (!this._platform.isBrowser) {\n return 0 /* NONE */;\n }\n // Create a test element with an arbitrary background-color that is neither black nor\n // white; high-contrast mode will coerce the color to either black or white. Also ensure that\n // appending the test element to the DOM does not affect layout by absolutely positioning it\n const testElement = this._document.createElement('div');\n testElement.style.backgroundColor = 'rgb(1,2,3)';\n testElement.style.position = 'absolute';\n this._document.body.appendChild(testElement);\n // Get the computed style for the background color, collapsing spaces to normalize between\n // browsers. Once we get this color, we no longer need the test element. Access the `window`\n // via the document so we can fake it in tests. Note that we have extra null checks, because\n // this logic will likely run during app bootstrap and throwing can break the entire app.\n const documentWindow = this._document.defaultView || window;\n const computedStyle = (documentWindow && documentWindow.getComputedStyle) ?\n documentWindow.getComputedStyle(testElement) : null;\n const computedColor = (computedStyle && computedStyle.backgroundColor || '').replace(/ /g, '');\n this._document.body.removeChild(testElement);\n switch (computedColor) {\n case 'rgb(0,0,0)': return 2 /* WHITE_ON_BLACK */;\n case 'rgb(255,255,255)': return 1 /* BLACK_ON_WHITE */;\n }\n return 0 /* NONE */;\n }\n /** Applies CSS classes indicating high-contrast mode to document body (browser-only). */\n _applyBodyHighContrastModeCssClasses() {\n if (!this._hasCheckedHighContrastMode && this._platform.isBrowser && this._document.body) {\n const bodyClasses = this._document.body.classList;\n // IE11 doesn't support `classList` operations with multiple arguments\n bodyClasses.remove(HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS);\n bodyClasses.remove(BLACK_ON_WHITE_CSS_CLASS);\n bodyClasses.remove(WHITE_ON_BLACK_CSS_CLASS);\n this._hasCheckedHighContrastMode = true;\n const mode = this.getHighContrastMode();\n if (mode === 1 /* BLACK_ON_WHITE */) {\n bodyClasses.add(HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS);\n bodyClasses.add(BLACK_ON_WHITE_CSS_CLASS);\n }\n else if (mode === 2 /* WHITE_ON_BLACK */) {\n bodyClasses.add(HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS);\n bodyClasses.add(WHITE_ON_BLACK_CSS_CLASS);\n }\n }\n }\n}\nHighContrastModeDetector.ɵfac = function HighContrastModeDetector_Factory(t) { return new (t || HighContrastModeDetector)(ɵngcc0.ɵɵinject(ɵngcc1.Platform), ɵngcc0.ɵɵinject(DOCUMENT)); };\nHighContrastModeDetector.ɵprov = i0.ɵɵdefineInjectable({ factory: function HighContrastModeDetector_Factory() { return new HighContrastModeDetector(i0.ɵɵinject(i1.Platform), i0.ɵɵinject(i2.DOCUMENT)); }, token: HighContrastModeDetector, providedIn: \"root\" });\nHighContrastModeDetector.ctorParameters = () => [\n { type: Platform },\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(HighContrastModeDetector, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: ɵngcc1.Platform }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass A11yModule {\n constructor(highContrastModeDetector) {\n highContrastModeDetector._applyBodyHighContrastModeCssClasses();\n }\n}\nA11yModule.ɵfac = function A11yModule_Factory(t) { return new (t || A11yModule)(ɵngcc0.ɵɵinject(HighContrastModeDetector)); };\nA11yModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: A11yModule });\nA11yModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({ imports: [[PlatformModule, ObserversModule]] });\nA11yModule.ctorParameters = () => [\n { type: HighContrastModeDetector }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(A11yModule, [{\n type: NgModule,\n args: [{\n imports: [PlatformModule, ObserversModule],\n declarations: [CdkAriaLive, CdkTrapFocus, CdkMonitorFocus],\n exports: [CdkAriaLive, CdkTrapFocus, CdkMonitorFocus]\n }]\n }], function () { return [{ type: HighContrastModeDetector }]; }, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(A11yModule, { declarations: function () { return [CdkAriaLive, CdkTrapFocus, CdkMonitorFocus]; }, imports: function () { return [PlatformModule, ObserversModule]; }, exports: function () { return [CdkAriaLive, CdkTrapFocus, CdkMonitorFocus]; } }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { A11yModule, ActiveDescendantKeyManager, AriaDescriber, CDK_DESCRIBEDBY_HOST_ATTRIBUTE, CDK_DESCRIBEDBY_ID_PREFIX, CdkAriaLive, CdkMonitorFocus, CdkTrapFocus, ConfigurableFocusTrap, ConfigurableFocusTrapFactory, EventListenerFocusTrapInertStrategy, FOCUS_MONITOR_DEFAULT_OPTIONS, FOCUS_TRAP_INERT_STRATEGY, FocusKeyManager, FocusMonitor, FocusTrap, FocusTrapFactory, HighContrastModeDetector, INPUT_MODALITY_DETECTOR_DEFAULT_OPTIONS, INPUT_MODALITY_DETECTOR_OPTIONS, InputModalityDetector, InteractivityChecker, IsFocusableConfig, LIVE_ANNOUNCER_DEFAULT_OPTIONS, LIVE_ANNOUNCER_ELEMENT_TOKEN, LIVE_ANNOUNCER_ELEMENT_TOKEN_FACTORY, ListKeyManager, LiveAnnouncer, MESSAGES_CONTAINER_ID, isFakeMousedownFromScreenReader, isFakeTouchstartFromScreenReader, FocusTrapManager as ɵangular_material_src_cdk_a11y_a11y_a };\n\n//# sourceMappingURL=a11y.js.map","import * as i0 from '@angular/core';\nimport { InjectionToken, inject, EventEmitter, Injectable, Optional, Inject, Directive, Output, Input, NgModule } from '@angular/core';\nimport { DOCUMENT } from '@angular/common';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injection token used to inject the document into Directionality.\n * This is used so that the value can be faked in tests.\n *\n * We can't use the real document in tests because changing the real `dir` causes geometry-based\n * tests in Safari to fail.\n *\n * We also can't re-provide the DOCUMENT token from platform-brower because the unit tests\n * themselves use things like `querySelector` in test code.\n *\n * This token is defined in a separate file from Directionality as a workaround for\n * https://github.com/angular/angular/issues/22559\n *\n * @docs-private\n */\nimport * as ɵngcc0 from '@angular/core';\nconst DIR_DOCUMENT = new InjectionToken('cdk-dir-doc', {\n providedIn: 'root',\n factory: DIR_DOCUMENT_FACTORY,\n});\n/** @docs-private */\nfunction DIR_DOCUMENT_FACTORY() {\n return inject(DOCUMENT);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * The directionality (LTR / RTL) context for the application (or a subtree of it).\n * Exposes the current direction and a stream of direction changes.\n */\nclass Directionality {\n constructor(_document) {\n /** The current 'ltr' or 'rtl' value. */\n this.value = 'ltr';\n /** Stream that emits whenever the 'ltr' / 'rtl' state changes. */\n this.change = new EventEmitter();\n if (_document) {\n // TODO: handle 'auto' value -\n // We still need to account for dir=\"auto\".\n // It looks like HTMLElemenet.dir is also \"auto\" when that's set to the attribute,\n // but getComputedStyle return either \"ltr\" or \"rtl\". avoiding getComputedStyle for now\n const bodyDir = _document.body ? _document.body.dir : null;\n const htmlDir = _document.documentElement ? _document.documentElement.dir : null;\n const value = bodyDir || htmlDir;\n this.value = (value === 'ltr' || value === 'rtl') ? value : 'ltr';\n }\n }\n ngOnDestroy() {\n this.change.complete();\n }\n}\nDirectionality.ɵfac = function Directionality_Factory(t) { return new (t || Directionality)(ɵngcc0.ɵɵinject(DIR_DOCUMENT, 8)); };\nDirectionality.ɵprov = i0.ɵɵdefineInjectable({ factory: function Directionality_Factory() { return new Directionality(i0.ɵɵinject(DIR_DOCUMENT, 8)); }, token: Directionality, providedIn: \"root\" });\nDirectionality.ctorParameters = () => [\n { type: undefined, decorators: [{ type: Optional }, { type: Inject, args: [DIR_DOCUMENT,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(Directionality, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DIR_DOCUMENT]\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Directive to listen for changes of direction of part of the DOM.\n *\n * Provides itself as Directionality such that descendant directives only need to ever inject\n * Directionality to get the closest direction.\n */\nclass Dir {\n constructor() {\n /** Normalized direction that accounts for invalid/unsupported values. */\n this._dir = 'ltr';\n /** Whether the `value` has been set to its initial value. */\n this._isInitialized = false;\n /** Event emitted when the direction changes. */\n this.change = new EventEmitter();\n }\n /** @docs-private */\n get dir() { return this._dir; }\n set dir(value) {\n const old = this._dir;\n const normalizedValue = value ? value.toLowerCase() : value;\n this._rawDir = value;\n this._dir = (normalizedValue === 'ltr' || normalizedValue === 'rtl') ? normalizedValue : 'ltr';\n if (old !== this._dir && this._isInitialized) {\n this.change.emit(this._dir);\n }\n }\n /** Current layout direction of the element. */\n get value() { return this.dir; }\n /** Initialize once default value has been set. */\n ngAfterContentInit() {\n this._isInitialized = true;\n }\n ngOnDestroy() {\n this.change.complete();\n }\n}\nDir.ɵfac = function Dir_Factory(t) { return new (t || Dir)(); };\nDir.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: Dir, selectors: [[\"\", \"dir\", \"\"]], hostVars: 1, hostBindings: function Dir_HostBindings(rf, ctx) { if (rf & 2) {\n ɵngcc0.ɵɵattribute(\"dir\", ctx._rawDir);\n } }, inputs: { dir: \"dir\" }, outputs: { change: \"dirChange\" }, exportAs: [\"dir\"], features: [ɵngcc0.ɵɵProvidersFeature([{ provide: Directionality, useExisting: Dir }])] });\nDir.propDecorators = {\n change: [{ type: Output, args: ['dirChange',] }],\n dir: [{ type: Input }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(Dir, [{\n type: Directive,\n args: [{\n selector: '[dir]',\n providers: [{ provide: Directionality, useExisting: Dir }],\n host: { '[attr.dir]': '_rawDir' },\n exportAs: 'dir'\n }]\n }], function () { return []; }, { change: [{\n type: Output,\n args: ['dirChange']\n }], dir: [{\n type: Input\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass BidiModule {\n}\nBidiModule.ɵfac = function BidiModule_Factory(t) { return new (t || BidiModule)(); };\nBidiModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: BidiModule });\nBidiModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({});\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(BidiModule, [{\n type: NgModule,\n args: [{\n exports: [Dir],\n declarations: [Dir]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(BidiModule, { declarations: [Dir], exports: [Dir] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BidiModule, DIR_DOCUMENT, Dir, Directionality, DIR_DOCUMENT_FACTORY as ɵangular_material_src_cdk_bidi_bidi_a };\n\n//# sourceMappingURL=bidi.js.map","import * as i1 from '@angular/common';\nimport { DOCUMENT } from '@angular/common';\nimport * as i0 from '@angular/core';\nimport { Injectable, Inject, InjectionToken, EventEmitter, Directive, NgZone, Optional, Input, Output, NgModule } from '@angular/core';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A pending copy-to-clipboard operation.\n *\n * The implementation of copying text to the clipboard modifies the DOM and\n * forces a relayout. This relayout can take too long if the string is large,\n * causing the execCommand('copy') to happen too long after the user clicked.\n * This results in the browser refusing to copy. This object lets the\n * relayout happen in a separate tick from copying by providing a copy function\n * that can be called later.\n *\n * Destroy must be called when no longer in use, regardless of whether `copy` is\n * called.\n */\nimport * as ɵngcc0 from '@angular/core';\nclass PendingCopy {\n constructor(text, _document) {\n this._document = _document;\n const textarea = this._textarea = this._document.createElement('textarea');\n const styles = textarea.style;\n // Hide the element for display and accessibility. Set a fixed position so the page layout\n // isn't affected. We use `fixed` with `top: 0`, because focus is moved into the textarea\n // for a split second and if it's off-screen, some browsers will attempt to scroll it into view.\n styles.position = 'fixed';\n styles.top = styles.opacity = '0';\n styles.left = '-999em';\n textarea.setAttribute('aria-hidden', 'true');\n textarea.value = text;\n this._document.body.appendChild(textarea);\n }\n /** Finishes copying the text. */\n copy() {\n const textarea = this._textarea;\n let successful = false;\n try { // Older browsers could throw if copy is not supported.\n if (textarea) {\n const currentFocus = this._document.activeElement;\n textarea.select();\n textarea.setSelectionRange(0, textarea.value.length);\n successful = this._document.execCommand('copy');\n if (currentFocus) {\n currentFocus.focus();\n }\n }\n }\n catch (_a) {\n // Discard error.\n // Initial setting of {@code successful} will represent failure here.\n }\n return successful;\n }\n /** Cleans up DOM changes used to perform the copy operation. */\n destroy() {\n const textarea = this._textarea;\n if (textarea) {\n if (textarea.parentNode) {\n textarea.parentNode.removeChild(textarea);\n }\n this._textarea = undefined;\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A service for copying text to the clipboard.\n */\nclass Clipboard {\n constructor(document) {\n this._document = document;\n }\n /**\n * Copies the provided text into the user's clipboard.\n *\n * @param text The string to copy.\n * @returns Whether the operation was successful.\n */\n copy(text) {\n const pendingCopy = this.beginCopy(text);\n const successful = pendingCopy.copy();\n pendingCopy.destroy();\n return successful;\n }\n /**\n * Prepares a string to be copied later. This is useful for large strings\n * which take too long to successfully render and be copied in the same tick.\n *\n * The caller must call `destroy` on the returned `PendingCopy`.\n *\n * @param text The string to copy.\n * @returns the pending copy operation.\n */\n beginCopy(text) {\n return new PendingCopy(text, this._document);\n }\n}\nClipboard.ɵfac = function Clipboard_Factory(t) { return new (t || Clipboard)(ɵngcc0.ɵɵinject(DOCUMENT)); };\nClipboard.ɵprov = i0.ɵɵdefineInjectable({ factory: function Clipboard_Factory() { return new Clipboard(i0.ɵɵinject(i1.DOCUMENT)); }, token: Clipboard, providedIn: \"root\" });\nClipboard.ctorParameters = () => [\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(Clipboard, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Injection token that can be used to provide the default options to `CdkCopyToClipboard`. */\nconst CDK_COPY_TO_CLIPBOARD_CONFIG = new InjectionToken('CDK_COPY_TO_CLIPBOARD_CONFIG');\n/**\n * @deprecated Use `CDK_COPY_TO_CLIPBOARD_CONFIG` instead.\n * @breaking-change 13.0.0\n */\nconst CKD_COPY_TO_CLIPBOARD_CONFIG = CDK_COPY_TO_CLIPBOARD_CONFIG;\n/**\n * Provides behavior for a button that when clicked copies content into user's\n * clipboard.\n */\nclass CdkCopyToClipboard {\n constructor(_clipboard, _ngZone, config) {\n this._clipboard = _clipboard;\n this._ngZone = _ngZone;\n /** Content to be copied. */\n this.text = '';\n /**\n * How many times to attempt to copy the text. This may be necessary for longer text, because\n * the browser needs time to fill an intermediate textarea element and copy the content.\n */\n this.attempts = 1;\n /**\n * Emits when some text is copied to the clipboard. The\n * emitted value indicates whether copying was successful.\n */\n this.copied = new EventEmitter();\n /** Copies that are currently being attempted. */\n this._pending = new Set();\n if (config && config.attempts != null) {\n this.attempts = config.attempts;\n }\n }\n /** Copies the current text to the clipboard. */\n copy(attempts = this.attempts) {\n if (attempts > 1) {\n let remainingAttempts = attempts;\n const pending = this._clipboard.beginCopy(this.text);\n this._pending.add(pending);\n const attempt = () => {\n const successful = pending.copy();\n if (!successful && --remainingAttempts && !this._destroyed) {\n // We use 1 for the timeout since it's more predictable when flushing in unit tests.\n this._currentTimeout = this._ngZone.runOutsideAngular(() => setTimeout(attempt, 1));\n }\n else {\n this._currentTimeout = null;\n this._pending.delete(pending);\n pending.destroy();\n this.copied.emit(successful);\n }\n };\n attempt();\n }\n else {\n this.copied.emit(this._clipboard.copy(this.text));\n }\n }\n ngOnDestroy() {\n if (this._currentTimeout) {\n clearTimeout(this._currentTimeout);\n }\n this._pending.forEach(copy => copy.destroy());\n this._pending.clear();\n this._destroyed = true;\n }\n}\nCdkCopyToClipboard.ɵfac = function CdkCopyToClipboard_Factory(t) { return new (t || CdkCopyToClipboard)(ɵngcc0.ɵɵdirectiveInject(Clipboard), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.NgZone), ɵngcc0.ɵɵdirectiveInject(CKD_COPY_TO_CLIPBOARD_CONFIG, 8)); };\nCdkCopyToClipboard.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkCopyToClipboard, selectors: [[\"\", \"cdkCopyToClipboard\", \"\"]], hostBindings: function CdkCopyToClipboard_HostBindings(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵlistener(\"click\", function CdkCopyToClipboard_click_HostBindingHandler() { return ctx.copy(); });\n } }, inputs: { text: [\"cdkCopyToClipboard\", \"text\"], attempts: [\"cdkCopyToClipboardAttempts\", \"attempts\"] }, outputs: { copied: \"cdkCopyToClipboardCopied\" } });\nCdkCopyToClipboard.ctorParameters = () => [\n { type: Clipboard },\n { type: NgZone },\n { type: undefined, decorators: [{ type: Optional }, { type: Inject, args: [CKD_COPY_TO_CLIPBOARD_CONFIG,] }] }\n];\nCdkCopyToClipboard.propDecorators = {\n text: [{ type: Input, args: ['cdkCopyToClipboard',] }],\n attempts: [{ type: Input, args: ['cdkCopyToClipboardAttempts',] }],\n copied: [{ type: Output, args: ['cdkCopyToClipboardCopied',] }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkCopyToClipboard, [{\n type: Directive,\n args: [{\n selector: '[cdkCopyToClipboard]',\n host: {\n '(click)': 'copy()'\n }\n }]\n }], function () { return [{ type: Clipboard }, { type: ɵngcc0.NgZone }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [CKD_COPY_TO_CLIPBOARD_CONFIG]\n }] }]; }, { text: [{\n type: Input,\n args: ['cdkCopyToClipboard']\n }], attempts: [{\n type: Input,\n args: ['cdkCopyToClipboardAttempts']\n }], copied: [{\n type: Output,\n args: ['cdkCopyToClipboardCopied']\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass ClipboardModule {\n}\nClipboardModule.ɵfac = function ClipboardModule_Factory(t) { return new (t || ClipboardModule)(); };\nClipboardModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: ClipboardModule });\nClipboardModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({});\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(ClipboardModule, [{\n type: NgModule,\n args: [{\n declarations: [CdkCopyToClipboard],\n exports: [CdkCopyToClipboard]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(ClipboardModule, { declarations: [CdkCopyToClipboard], exports: [CdkCopyToClipboard] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { CDK_COPY_TO_CLIPBOARD_CONFIG, CKD_COPY_TO_CLIPBOARD_CONFIG, CdkCopyToClipboard, Clipboard, ClipboardModule, PendingCopy };\n\n//# sourceMappingURL=clipboard.js.map","import { isObservable, of, Subject } from 'rxjs';\nimport * as i0 from '@angular/core';\nimport { Injectable, InjectionToken } from '@angular/core';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nimport * as ɵngcc0 from '@angular/core';\nclass DataSource {\n}\n/** Checks whether an object is a data source. */\nfunction isDataSource(value) {\n // Check if the value is a DataSource by observing if it has a connect function. Cannot\n // be checked as an `instanceof DataSource` since people could create their own sources\n // that match the interface, but don't extend DataSource.\n return value && typeof value.connect === 'function';\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** DataSource wrapper for a native array. */\nclass ArrayDataSource extends DataSource {\n constructor(_data) {\n super();\n this._data = _data;\n }\n connect() {\n return isObservable(this._data) ? this._data : of(this._data);\n }\n disconnect() { }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A repeater that destroys views when they are removed from a\n * {@link ViewContainerRef}. When new items are inserted into the container,\n * the repeater will always construct a new embedded view for each item.\n *\n * @template T The type for the embedded view's $implicit property.\n * @template R The type for the item in each IterableDiffer change record.\n * @template C The type for the context passed to each embedded view.\n */\nclass _DisposeViewRepeaterStrategy {\n applyChanges(changes, viewContainerRef, itemContextFactory, itemValueResolver, itemViewChanged) {\n changes.forEachOperation((record, adjustedPreviousIndex, currentIndex) => {\n let view;\n let operation;\n if (record.previousIndex == null) {\n const insertContext = itemContextFactory(record, adjustedPreviousIndex, currentIndex);\n view = viewContainerRef.createEmbeddedView(insertContext.templateRef, insertContext.context, insertContext.index);\n operation = 1 /* INSERTED */;\n }\n else if (currentIndex == null) {\n viewContainerRef.remove(adjustedPreviousIndex);\n operation = 3 /* REMOVED */;\n }\n else {\n view = viewContainerRef.get(adjustedPreviousIndex);\n viewContainerRef.move(view, currentIndex);\n operation = 2 /* MOVED */;\n }\n if (itemViewChanged) {\n itemViewChanged({\n context: view === null || view === void 0 ? void 0 : view.context,\n operation,\n record,\n });\n }\n });\n }\n detach() {\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A repeater that caches views when they are removed from a\n * {@link ViewContainerRef}. When new items are inserted into the container,\n * the repeater will reuse one of the cached views instead of creating a new\n * embedded view. Recycling cached views reduces the quantity of expensive DOM\n * inserts.\n *\n * @template T The type for the embedded view's $implicit property.\n * @template R The type for the item in each IterableDiffer change record.\n * @template C The type for the context passed to each embedded view.\n */\nclass _RecycleViewRepeaterStrategy {\n constructor() {\n /**\n * The size of the cache used to store unused views.\n * Setting the cache size to `0` will disable caching. Defaults to 20 views.\n */\n this.viewCacheSize = 20;\n /**\n * View cache that stores embedded view instances that have been previously stamped out,\n * but don't are not currently rendered. The view repeater will reuse these views rather than\n * creating brand new ones.\n *\n * TODO(michaeljamesparsons) Investigate whether using a linked list would improve performance.\n */\n this._viewCache = [];\n }\n /** Apply changes to the DOM. */\n applyChanges(changes, viewContainerRef, itemContextFactory, itemValueResolver, itemViewChanged) {\n // Rearrange the views to put them in the right location.\n changes.forEachOperation((record, adjustedPreviousIndex, currentIndex) => {\n let view;\n let operation;\n if (record.previousIndex == null) { // Item added.\n const viewArgsFactory = () => itemContextFactory(record, adjustedPreviousIndex, currentIndex);\n view = this._insertView(viewArgsFactory, currentIndex, viewContainerRef, itemValueResolver(record));\n operation = view ? 1 /* INSERTED */ : 0 /* REPLACED */;\n }\n else if (currentIndex == null) { // Item removed.\n this._detachAndCacheView(adjustedPreviousIndex, viewContainerRef);\n operation = 3 /* REMOVED */;\n }\n else { // Item moved.\n view = this._moveView(adjustedPreviousIndex, currentIndex, viewContainerRef, itemValueResolver(record));\n operation = 2 /* MOVED */;\n }\n if (itemViewChanged) {\n itemViewChanged({\n context: view === null || view === void 0 ? void 0 : view.context,\n operation,\n record,\n });\n }\n });\n }\n detach() {\n for (const view of this._viewCache) {\n view.destroy();\n }\n this._viewCache = [];\n }\n /**\n * Inserts a view for a new item, either from the cache or by creating a new\n * one. Returns `undefined` if the item was inserted into a cached view.\n */\n _insertView(viewArgsFactory, currentIndex, viewContainerRef, value) {\n const cachedView = this._insertViewFromCache(currentIndex, viewContainerRef);\n if (cachedView) {\n cachedView.context.$implicit = value;\n return undefined;\n }\n const viewArgs = viewArgsFactory();\n return viewContainerRef.createEmbeddedView(viewArgs.templateRef, viewArgs.context, viewArgs.index);\n }\n /** Detaches the view at the given index and inserts into the view cache. */\n _detachAndCacheView(index, viewContainerRef) {\n const detachedView = viewContainerRef.detach(index);\n this._maybeCacheView(detachedView, viewContainerRef);\n }\n /** Moves view at the previous index to the current index. */\n _moveView(adjustedPreviousIndex, currentIndex, viewContainerRef, value) {\n const view = viewContainerRef.get(adjustedPreviousIndex);\n viewContainerRef.move(view, currentIndex);\n view.context.$implicit = value;\n return view;\n }\n /**\n * Cache the given detached view. If the cache is full, the view will be\n * destroyed.\n */\n _maybeCacheView(view, viewContainerRef) {\n if (this._viewCache.length < this.viewCacheSize) {\n this._viewCache.push(view);\n }\n else {\n const index = viewContainerRef.indexOf(view);\n // The host component could remove views from the container outside of\n // the view repeater. It's unlikely this will occur, but just in case,\n // destroy the view on its own, otherwise destroy it through the\n // container to ensure that all the references are removed.\n if (index === -1) {\n view.destroy();\n }\n else {\n viewContainerRef.remove(index);\n }\n }\n }\n /** Inserts a recycled view from the cache at the given index. */\n _insertViewFromCache(index, viewContainerRef) {\n const cachedView = this._viewCache.pop();\n if (cachedView) {\n viewContainerRef.insert(cachedView, index);\n }\n return cachedView || null;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Class to be used to power selecting one or more options from a list.\n */\nclass SelectionModel {\n constructor(_multiple = false, initiallySelectedValues, _emitChanges = true) {\n this._multiple = _multiple;\n this._emitChanges = _emitChanges;\n /** Currently-selected values. */\n this._selection = new Set();\n /** Keeps track of the deselected options that haven't been emitted by the change event. */\n this._deselectedToEmit = [];\n /** Keeps track of the selected options that haven't been emitted by the change event. */\n this._selectedToEmit = [];\n /** Event emitted when the value has changed. */\n this.changed = new Subject();\n if (initiallySelectedValues && initiallySelectedValues.length) {\n if (_multiple) {\n initiallySelectedValues.forEach(value => this._markSelected(value));\n }\n else {\n this._markSelected(initiallySelectedValues[0]);\n }\n // Clear the array in order to avoid firing the change event for preselected values.\n this._selectedToEmit.length = 0;\n }\n }\n /** Selected values. */\n get selected() {\n if (!this._selected) {\n this._selected = Array.from(this._selection.values());\n }\n return this._selected;\n }\n /**\n * Selects a value or an array of values.\n */\n select(...values) {\n this._verifyValueAssignment(values);\n values.forEach(value => this._markSelected(value));\n this._emitChangeEvent();\n }\n /**\n * Deselects a value or an array of values.\n */\n deselect(...values) {\n this._verifyValueAssignment(values);\n values.forEach(value => this._unmarkSelected(value));\n this._emitChangeEvent();\n }\n /**\n * Toggles a value between selected and deselected.\n */\n toggle(value) {\n this.isSelected(value) ? this.deselect(value) : this.select(value);\n }\n /**\n * Clears all of the selected values.\n */\n clear() {\n this._unmarkAll();\n this._emitChangeEvent();\n }\n /**\n * Determines whether a value is selected.\n */\n isSelected(value) {\n return this._selection.has(value);\n }\n /**\n * Determines whether the model does not have a value.\n */\n isEmpty() {\n return this._selection.size === 0;\n }\n /**\n * Determines whether the model has a value.\n */\n hasValue() {\n return !this.isEmpty();\n }\n /**\n * Sorts the selected values based on a predicate function.\n */\n sort(predicate) {\n if (this._multiple && this.selected) {\n this._selected.sort(predicate);\n }\n }\n /**\n * Gets whether multiple values can be selected.\n */\n isMultipleSelection() {\n return this._multiple;\n }\n /** Emits a change event and clears the records of selected and deselected values. */\n _emitChangeEvent() {\n // Clear the selected values so they can be re-cached.\n this._selected = null;\n if (this._selectedToEmit.length || this._deselectedToEmit.length) {\n this.changed.next({\n source: this,\n added: this._selectedToEmit,\n removed: this._deselectedToEmit\n });\n this._deselectedToEmit = [];\n this._selectedToEmit = [];\n }\n }\n /** Selects a value. */\n _markSelected(value) {\n if (!this.isSelected(value)) {\n if (!this._multiple) {\n this._unmarkAll();\n }\n this._selection.add(value);\n if (this._emitChanges) {\n this._selectedToEmit.push(value);\n }\n }\n }\n /** Deselects a value. */\n _unmarkSelected(value) {\n if (this.isSelected(value)) {\n this._selection.delete(value);\n if (this._emitChanges) {\n this._deselectedToEmit.push(value);\n }\n }\n }\n /** Clears out the selected values. */\n _unmarkAll() {\n if (!this.isEmpty()) {\n this._selection.forEach(value => this._unmarkSelected(value));\n }\n }\n /**\n * Verifies the value assignment and throws an error if the specified value array is\n * including multiple values while the selection model is not supporting multiple values.\n */\n _verifyValueAssignment(values) {\n if (values.length > 1 && !this._multiple && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getMultipleValuesInSingleSelectionError();\n }\n }\n}\n/**\n * Returns an error that reports that multiple values are passed into a selection model\n * with a single value.\n * @docs-private\n */\nfunction getMultipleValuesInSingleSelectionError() {\n return Error('Cannot pass multiple values into SelectionModel with single-value mode.');\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Class to coordinate unique selection based on name.\n * Intended to be consumed as an Angular service.\n * This service is needed because native radio change events are only fired on the item currently\n * being selected, and we still need to uncheck the previous selection.\n *\n * This service does not *store* any IDs and names because they may change at any time, so it is\n * less error-prone if they are simply passed through when the events occur.\n */\nclass UniqueSelectionDispatcher {\n constructor() {\n this._listeners = [];\n }\n /**\n * Notify other items that selection for the given name has been set.\n * @param id ID of the item.\n * @param name Name of the item.\n */\n notify(id, name) {\n for (let listener of this._listeners) {\n listener(id, name);\n }\n }\n /**\n * Listen for future changes to item selection.\n * @return Function used to deregister listener\n */\n listen(listener) {\n this._listeners.push(listener);\n return () => {\n this._listeners = this._listeners.filter((registered) => {\n return listener !== registered;\n });\n };\n }\n ngOnDestroy() {\n this._listeners = [];\n }\n}\nUniqueSelectionDispatcher.ɵfac = function UniqueSelectionDispatcher_Factory(t) { return new (t || UniqueSelectionDispatcher)(); };\nUniqueSelectionDispatcher.ɵprov = i0.ɵɵdefineInjectable({ factory: function UniqueSelectionDispatcher_Factory() { return new UniqueSelectionDispatcher(); }, token: UniqueSelectionDispatcher, providedIn: \"root\" });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(UniqueSelectionDispatcher, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return []; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injection token for {@link _ViewRepeater}. This token is for use by Angular Material only.\n * @docs-private\n */\nconst _VIEW_REPEATER_STRATEGY = new InjectionToken('_ViewRepeater');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { ArrayDataSource, DataSource, SelectionModel, UniqueSelectionDispatcher, _DisposeViewRepeaterStrategy, _RecycleViewRepeaterStrategy, _VIEW_REPEATER_STRATEGY, getMultipleValuesInSingleSelectionError, isDataSource };\n\n//# sourceMappingURL=collections.js.map","import * as i0 from '@angular/core';\nimport { Injectable, NgZone, Inject, InjectionToken, Directive, Input, EventEmitter, ElementRef, ChangeDetectorRef, Optional, SkipSelf, Output, TemplateRef, ViewContainerRef, Self, ContentChildren, ContentChild, NgModule } from '@angular/core';\nimport * as i1 from '@angular/common';\nimport { DOCUMENT } from '@angular/common';\nimport * as i2 from '@angular/cdk/scrolling';\nimport { ViewportRuler, ScrollDispatcher, CdkScrollableModule } from '@angular/cdk/scrolling';\nimport { normalizePassiveListenerOptions, _getShadowRoot } from '@angular/cdk/platform';\nimport { coerceBooleanProperty, coerceElement, coerceArray, coerceNumberProperty } from '@angular/cdk/coercion';\nimport { Subject, Subscription, interval, animationFrameScheduler, Observable, merge } from 'rxjs';\nimport { takeUntil, startWith, map, take, tap, switchMap } from 'rxjs/operators';\nimport { Directionality } from '@angular/cdk/bidi';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Shallow-extends a stylesheet object with another stylesheet object.\n * @docs-private\n */\nimport * as ɵngcc0 from '@angular/core';\nimport * as ɵngcc1 from '@angular/cdk/scrolling';\nimport * as ɵngcc2 from '@angular/cdk/bidi';\nfunction extendStyles(dest, source) {\n for (let key in source) {\n if (source.hasOwnProperty(key)) {\n dest[key] = source[key];\n }\n }\n return dest;\n}\n/**\n * Toggles whether the native drag interactions should be enabled for an element.\n * @param element Element on which to toggle the drag interactions.\n * @param enable Whether the drag interactions should be enabled.\n * @docs-private\n */\nfunction toggleNativeDragInteractions(element, enable) {\n const userSelect = enable ? '' : 'none';\n extendStyles(element.style, {\n touchAction: enable ? '' : 'none',\n webkitUserDrag: enable ? '' : 'none',\n webkitTapHighlightColor: enable ? '' : 'transparent',\n userSelect: userSelect,\n msUserSelect: userSelect,\n webkitUserSelect: userSelect,\n MozUserSelect: userSelect\n });\n}\n/**\n * Toggles whether an element is visible while preserving its dimensions.\n * @param element Element whose visibility to toggle\n * @param enable Whether the element should be visible.\n * @docs-private\n */\nfunction toggleVisibility(element, enable) {\n const styles = element.style;\n styles.position = enable ? '' : 'fixed';\n styles.top = styles.opacity = enable ? '' : '0';\n styles.left = enable ? '' : '-999em';\n}\n/**\n * Combines a transform string with an optional other transform\n * that exited before the base transform was applied.\n */\nfunction combineTransforms(transform, initialTransform) {\n return initialTransform ? (transform + ' ' + initialTransform) : transform;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Parses a CSS time value to milliseconds. */\nfunction parseCssTimeUnitsToMs(value) {\n // Some browsers will return it in seconds, whereas others will return milliseconds.\n const multiplier = value.toLowerCase().indexOf('ms') > -1 ? 1 : 1000;\n return parseFloat(value) * multiplier;\n}\n/** Gets the transform transition duration, including the delay, of an element in milliseconds. */\nfunction getTransformTransitionDurationInMs(element) {\n const computedStyle = getComputedStyle(element);\n const transitionedProperties = parseCssPropertyValue(computedStyle, 'transition-property');\n const property = transitionedProperties.find(prop => prop === 'transform' || prop === 'all');\n // If there's no transition for `all` or `transform`, we shouldn't do anything.\n if (!property) {\n return 0;\n }\n // Get the index of the property that we're interested in and match\n // it up to the same index in `transition-delay` and `transition-duration`.\n const propertyIndex = transitionedProperties.indexOf(property);\n const rawDurations = parseCssPropertyValue(computedStyle, 'transition-duration');\n const rawDelays = parseCssPropertyValue(computedStyle, 'transition-delay');\n return parseCssTimeUnitsToMs(rawDurations[propertyIndex]) +\n parseCssTimeUnitsToMs(rawDelays[propertyIndex]);\n}\n/** Parses out multiple values from a computed style into an array. */\nfunction parseCssPropertyValue(computedStyle, name) {\n const value = computedStyle.getPropertyValue(name);\n return value.split(',').map(part => part.trim());\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Gets a mutable version of an element's bounding `ClientRect`. */\nfunction getMutableClientRect(element) {\n const clientRect = element.getBoundingClientRect();\n // We need to clone the `clientRect` here, because all the values on it are readonly\n // and we need to be able to update them. Also we can't use a spread here, because\n // the values on a `ClientRect` aren't own properties. See:\n // https://developer.mozilla.org/en-US/docs/Web/API/Element/getBoundingClientRect#Notes\n return {\n top: clientRect.top,\n right: clientRect.right,\n bottom: clientRect.bottom,\n left: clientRect.left,\n width: clientRect.width,\n height: clientRect.height\n };\n}\n/**\n * Checks whether some coordinates are within a `ClientRect`.\n * @param clientRect ClientRect that is being checked.\n * @param x Coordinates along the X axis.\n * @param y Coordinates along the Y axis.\n */\nfunction isInsideClientRect(clientRect, x, y) {\n const { top, bottom, left, right } = clientRect;\n return y >= top && y <= bottom && x >= left && x <= right;\n}\n/**\n * Updates the top/left positions of a `ClientRect`, as well as their bottom/right counterparts.\n * @param clientRect `ClientRect` that should be updated.\n * @param top Amount to add to the `top` position.\n * @param left Amount to add to the `left` position.\n */\nfunction adjustClientRect(clientRect, top, left) {\n clientRect.top += top;\n clientRect.bottom = clientRect.top + clientRect.height;\n clientRect.left += left;\n clientRect.right = clientRect.left + clientRect.width;\n}\n/**\n * Checks whether the pointer coordinates are close to a ClientRect.\n * @param rect ClientRect to check against.\n * @param threshold Threshold around the ClientRect.\n * @param pointerX Coordinates along the X axis.\n * @param pointerY Coordinates along the Y axis.\n */\nfunction isPointerNearClientRect(rect, threshold, pointerX, pointerY) {\n const { top, right, bottom, left, width, height } = rect;\n const xThreshold = width * threshold;\n const yThreshold = height * threshold;\n return pointerY > top - yThreshold && pointerY < bottom + yThreshold &&\n pointerX > left - xThreshold && pointerX < right + xThreshold;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Keeps track of the scroll position and dimensions of the parents of an element. */\nclass ParentPositionTracker {\n constructor(_document, _viewportRuler) {\n this._document = _document;\n this._viewportRuler = _viewportRuler;\n /** Cached positions of the scrollable parent elements. */\n this.positions = new Map();\n }\n /** Clears the cached positions. */\n clear() {\n this.positions.clear();\n }\n /** Caches the positions. Should be called at the beginning of a drag sequence. */\n cache(elements) {\n this.clear();\n this.positions.set(this._document, {\n scrollPosition: this._viewportRuler.getViewportScrollPosition(),\n });\n elements.forEach(element => {\n this.positions.set(element, {\n scrollPosition: { top: element.scrollTop, left: element.scrollLeft },\n clientRect: getMutableClientRect(element)\n });\n });\n }\n /** Handles scrolling while a drag is taking place. */\n handleScroll(event) {\n const target = getEventTarget(event);\n const cachedPosition = this.positions.get(target);\n if (!cachedPosition) {\n return null;\n }\n // Used when figuring out whether an element is inside the scroll parent. If the scrolled\n // parent is the `document`, we use the `documentElement`, because IE doesn't support\n // `contains` on the `document`.\n const scrolledParentNode = target === this._document ? target.documentElement : target;\n const scrollPosition = cachedPosition.scrollPosition;\n let newTop;\n let newLeft;\n if (target === this._document) {\n const viewportScrollPosition = this._viewportRuler.getViewportScrollPosition();\n newTop = viewportScrollPosition.top;\n newLeft = viewportScrollPosition.left;\n }\n else {\n newTop = target.scrollTop;\n newLeft = target.scrollLeft;\n }\n const topDifference = scrollPosition.top - newTop;\n const leftDifference = scrollPosition.left - newLeft;\n // Go through and update the cached positions of the scroll\n // parents that are inside the element that was scrolled.\n this.positions.forEach((position, node) => {\n if (position.clientRect && target !== node && scrolledParentNode.contains(node)) {\n adjustClientRect(position.clientRect, topDifference, leftDifference);\n }\n });\n scrollPosition.top = newTop;\n scrollPosition.left = newLeft;\n return { top: topDifference, left: leftDifference };\n }\n}\n/** Gets the target of an event while accounting for shadow dom. */\nfunction getEventTarget(event) {\n return (event.composedPath ? event.composedPath()[0] : event.target);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Creates a deep clone of an element. */\nfunction deepCloneNode(node) {\n const clone = node.cloneNode(true);\n const descendantsWithId = clone.querySelectorAll('[id]');\n const nodeName = node.nodeName.toLowerCase();\n // Remove the `id` to avoid having multiple elements with the same id on the page.\n clone.removeAttribute('id');\n for (let i = 0; i < descendantsWithId.length; i++) {\n descendantsWithId[i].removeAttribute('id');\n }\n if (nodeName === 'canvas') {\n transferCanvasData(node, clone);\n }\n else if (nodeName === 'input' || nodeName === 'select' || nodeName === 'textarea') {\n transferInputData(node, clone);\n }\n transferData('canvas', node, clone, transferCanvasData);\n transferData('input, textarea, select', node, clone, transferInputData);\n return clone;\n}\n/** Matches elements between an element and its clone and allows for their data to be cloned. */\nfunction transferData(selector, node, clone, callback) {\n const descendantElements = node.querySelectorAll(selector);\n if (descendantElements.length) {\n const cloneElements = clone.querySelectorAll(selector);\n for (let i = 0; i < descendantElements.length; i++) {\n callback(descendantElements[i], cloneElements[i]);\n }\n }\n}\n// Counter for unique cloned radio button names.\nlet cloneUniqueId = 0;\n/** Transfers the data of one input element to another. */\nfunction transferInputData(source, clone) {\n // Browsers throw an error when assigning the value of a file input programmatically.\n if (clone.type !== 'file') {\n clone.value = source.value;\n }\n // Radio button `name` attributes must be unique for radio button groups\n // otherwise original radio buttons can lose their checked state\n // once the clone is inserted in the DOM.\n if (clone.type === 'radio' && clone.name) {\n clone.name = `mat-clone-${clone.name}-${cloneUniqueId++}`;\n }\n}\n/** Transfers the data of one canvas element to another. */\nfunction transferCanvasData(source, clone) {\n const context = clone.getContext('2d');\n if (context) {\n // In some cases `drawImage` can throw (e.g. if the canvas size is 0x0).\n // We can't do much about it so just ignore the error.\n try {\n context.drawImage(source, 0, 0);\n }\n catch (_a) { }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Options that can be used to bind a passive event listener. */\nconst passiveEventListenerOptions = normalizePassiveListenerOptions({ passive: true });\n/** Options that can be used to bind an active event listener. */\nconst activeEventListenerOptions = normalizePassiveListenerOptions({ passive: false });\n/**\n * Time in milliseconds for which to ignore mouse events, after\n * receiving a touch event. Used to avoid doing double work for\n * touch devices where the browser fires fake mouse events, in\n * addition to touch events.\n */\nconst MOUSE_EVENT_IGNORE_TIME = 800;\n/**\n * Reference to a draggable item. Used to manipulate or dispose of the item.\n */\nclass DragRef {\n constructor(element, _config, _document, _ngZone, _viewportRuler, _dragDropRegistry) {\n this._config = _config;\n this._document = _document;\n this._ngZone = _ngZone;\n this._viewportRuler = _viewportRuler;\n this._dragDropRegistry = _dragDropRegistry;\n /**\n * CSS `transform` applied to the element when it isn't being dragged. We need a\n * passive transform in order for the dragged element to retain its new position\n * after the user has stopped dragging and because we need to know the relative\n * position in case they start dragging again. This corresponds to `element.style.transform`.\n */\n this._passiveTransform = { x: 0, y: 0 };\n /** CSS `transform` that is applied to the element while it's being dragged. */\n this._activeTransform = { x: 0, y: 0 };\n /**\n * Whether the dragging sequence has been started. Doesn't\n * necessarily mean that the element has been moved.\n */\n this._hasStartedDragging = false;\n /** Emits when the item is being moved. */\n this._moveEvents = new Subject();\n /** Subscription to pointer movement events. */\n this._pointerMoveSubscription = Subscription.EMPTY;\n /** Subscription to the event that is dispatched when the user lifts their pointer. */\n this._pointerUpSubscription = Subscription.EMPTY;\n /** Subscription to the viewport being scrolled. */\n this._scrollSubscription = Subscription.EMPTY;\n /** Subscription to the viewport being resized. */\n this._resizeSubscription = Subscription.EMPTY;\n /** Cached reference to the boundary element. */\n this._boundaryElement = null;\n /** Whether the native dragging interactions have been enabled on the root element. */\n this._nativeInteractionsEnabled = true;\n /** Elements that can be used to drag the draggable item. */\n this._handles = [];\n /** Registered handles that are currently disabled. */\n this._disabledHandles = new Set();\n /** Layout direction of the item. */\n this._direction = 'ltr';\n /**\n * Amount of milliseconds to wait after the user has put their\n * pointer down before starting to drag the element.\n */\n this.dragStartDelay = 0;\n this._disabled = false;\n /** Emits as the drag sequence is being prepared. */\n this.beforeStarted = new Subject();\n /** Emits when the user starts dragging the item. */\n this.started = new Subject();\n /** Emits when the user has released a drag item, before any animations have started. */\n this.released = new Subject();\n /** Emits when the user stops dragging an item in the container. */\n this.ended = new Subject();\n /** Emits when the user has moved the item into a new container. */\n this.entered = new Subject();\n /** Emits when the user removes the item its container by dragging it into another container. */\n this.exited = new Subject();\n /** Emits when the user drops the item inside a container. */\n this.dropped = new Subject();\n /**\n * Emits as the user is dragging the item. Use with caution,\n * because this event will fire for every pixel that the user has dragged.\n */\n this.moved = this._moveEvents;\n /** Handler for the `mousedown`/`touchstart` events. */\n this._pointerDown = (event) => {\n this.beforeStarted.next();\n // Delegate the event based on whether it started from a handle or the element itself.\n if (this._handles.length) {\n const targetHandle = this._handles.find(handle => {\n const target = getEventTarget(event);\n return !!target && (target === handle || handle.contains(target));\n });\n if (targetHandle && !this._disabledHandles.has(targetHandle) && !this.disabled) {\n this._initializeDragSequence(targetHandle, event);\n }\n }\n else if (!this.disabled) {\n this._initializeDragSequence(this._rootElement, event);\n }\n };\n /** Handler that is invoked when the user moves their pointer after they've initiated a drag. */\n this._pointerMove = (event) => {\n const pointerPosition = this._getPointerPositionOnPage(event);\n if (!this._hasStartedDragging) {\n const distanceX = Math.abs(pointerPosition.x - this._pickupPositionOnPage.x);\n const distanceY = Math.abs(pointerPosition.y - this._pickupPositionOnPage.y);\n const isOverThreshold = distanceX + distanceY >= this._config.dragStartThreshold;\n // Only start dragging after the user has moved more than the minimum distance in either\n // direction. Note that this is preferrable over doing something like `skip(minimumDistance)`\n // in the `pointerMove` subscription, because we're not guaranteed to have one move event\n // per pixel of movement (e.g. if the user moves their pointer quickly).\n if (isOverThreshold) {\n const isDelayElapsed = Date.now() >= this._dragStartTime + this._getDragStartDelay(event);\n const container = this._dropContainer;\n if (!isDelayElapsed) {\n this._endDragSequence(event);\n return;\n }\n // Prevent other drag sequences from starting while something in the container is still\n // being dragged. This can happen while we're waiting for the drop animation to finish\n // and can cause errors, because some elements might still be moving around.\n if (!container || (!container.isDragging() && !container.isReceiving())) {\n // Prevent the default action as soon as the dragging sequence is considered as\n // \"started\" since waiting for the next event can allow the device to begin scrolling.\n event.preventDefault();\n this._hasStartedDragging = true;\n this._ngZone.run(() => this._startDragSequence(event));\n }\n }\n return;\n }\n // We only need the preview dimensions if we have a boundary element.\n if (this._boundaryElement) {\n // Cache the preview element rect if we haven't cached it already or if\n // we cached it too early before the element dimensions were computed.\n if (!this._previewRect || (!this._previewRect.width && !this._previewRect.height)) {\n this._previewRect = (this._preview || this._rootElement).getBoundingClientRect();\n }\n }\n // We prevent the default action down here so that we know that dragging has started. This is\n // important for touch devices where doing this too early can unnecessarily block scrolling,\n // if there's a dragging delay.\n event.preventDefault();\n const constrainedPointerPosition = this._getConstrainedPointerPosition(pointerPosition);\n this._hasMoved = true;\n this._lastKnownPointerPosition = pointerPosition;\n this._updatePointerDirectionDelta(constrainedPointerPosition);\n if (this._dropContainer) {\n this._updateActiveDropContainer(constrainedPointerPosition, pointerPosition);\n }\n else {\n const activeTransform = this._activeTransform;\n activeTransform.x =\n constrainedPointerPosition.x - this._pickupPositionOnPage.x + this._passiveTransform.x;\n activeTransform.y =\n constrainedPointerPosition.y - this._pickupPositionOnPage.y + this._passiveTransform.y;\n this._applyRootElementTransform(activeTransform.x, activeTransform.y);\n // Apply transform as attribute if dragging and svg element to work for IE\n if (typeof SVGElement !== 'undefined' && this._rootElement instanceof SVGElement) {\n const appliedTransform = `translate(${activeTransform.x} ${activeTransform.y})`;\n this._rootElement.setAttribute('transform', appliedTransform);\n }\n }\n // Since this event gets fired for every pixel while dragging, we only\n // want to fire it if the consumer opted into it. Also we have to\n // re-enter the zone because we run all of the events on the outside.\n if (this._moveEvents.observers.length) {\n this._ngZone.run(() => {\n this._moveEvents.next({\n source: this,\n pointerPosition: constrainedPointerPosition,\n event,\n distance: this._getDragDistance(constrainedPointerPosition),\n delta: this._pointerDirectionDelta\n });\n });\n }\n };\n /** Handler that is invoked when the user lifts their pointer up, after initiating a drag. */\n this._pointerUp = (event) => {\n this._endDragSequence(event);\n };\n this.withRootElement(element).withParent(_config.parentDragRef || null);\n this._parentPositions = new ParentPositionTracker(_document, _viewportRuler);\n _dragDropRegistry.registerDragItem(this);\n }\n /** Whether starting to drag this element is disabled. */\n get disabled() {\n return this._disabled || !!(this._dropContainer && this._dropContainer.disabled);\n }\n set disabled(value) {\n const newValue = coerceBooleanProperty(value);\n if (newValue !== this._disabled) {\n this._disabled = newValue;\n this._toggleNativeDragInteractions();\n this._handles.forEach(handle => toggleNativeDragInteractions(handle, newValue));\n }\n }\n /**\n * Returns the element that is being used as a placeholder\n * while the current element is being dragged.\n */\n getPlaceholderElement() {\n return this._placeholder;\n }\n /** Returns the root draggable element. */\n getRootElement() {\n return this._rootElement;\n }\n /**\n * Gets the currently-visible element that represents the drag item.\n * While dragging this is the placeholder, otherwise it's the root element.\n */\n getVisibleElement() {\n return this.isDragging() ? this.getPlaceholderElement() : this.getRootElement();\n }\n /** Registers the handles that can be used to drag the element. */\n withHandles(handles) {\n this._handles = handles.map(handle => coerceElement(handle));\n this._handles.forEach(handle => toggleNativeDragInteractions(handle, this.disabled));\n this._toggleNativeDragInteractions();\n // Delete any lingering disabled handles that may have been destroyed. Note that we re-create\n // the set, rather than iterate over it and filter out the destroyed handles, because while\n // the ES spec allows for sets to be modified while they're being iterated over, some polyfills\n // use an array internally which may throw an error.\n const disabledHandles = new Set();\n this._disabledHandles.forEach(handle => {\n if (this._handles.indexOf(handle) > -1) {\n disabledHandles.add(handle);\n }\n });\n this._disabledHandles = disabledHandles;\n return this;\n }\n /**\n * Registers the template that should be used for the drag preview.\n * @param template Template that from which to stamp out the preview.\n */\n withPreviewTemplate(template) {\n this._previewTemplate = template;\n return this;\n }\n /**\n * Registers the template that should be used for the drag placeholder.\n * @param template Template that from which to stamp out the placeholder.\n */\n withPlaceholderTemplate(template) {\n this._placeholderTemplate = template;\n return this;\n }\n /**\n * Sets an alternate drag root element. The root element is the element that will be moved as\n * the user is dragging. Passing an alternate root element is useful when trying to enable\n * dragging on an element that you might not have access to.\n */\n withRootElement(rootElement) {\n const element = coerceElement(rootElement);\n if (element !== this._rootElement) {\n if (this._rootElement) {\n this._removeRootElementListeners(this._rootElement);\n }\n this._ngZone.runOutsideAngular(() => {\n element.addEventListener('mousedown', this._pointerDown, activeEventListenerOptions);\n element.addEventListener('touchstart', this._pointerDown, passiveEventListenerOptions);\n });\n this._initialTransform = undefined;\n this._rootElement = element;\n }\n if (typeof SVGElement !== 'undefined' && this._rootElement instanceof SVGElement) {\n this._ownerSVGElement = this._rootElement.ownerSVGElement;\n }\n return this;\n }\n /**\n * Element to which the draggable's position will be constrained.\n */\n withBoundaryElement(boundaryElement) {\n this._boundaryElement = boundaryElement ? coerceElement(boundaryElement) : null;\n this._resizeSubscription.unsubscribe();\n if (boundaryElement) {\n this._resizeSubscription = this._viewportRuler\n .change(10)\n .subscribe(() => this._containInsideBoundaryOnResize());\n }\n return this;\n }\n /** Sets the parent ref that the ref is nested in. */\n withParent(parent) {\n this._parentDragRef = parent;\n return this;\n }\n /** Removes the dragging functionality from the DOM element. */\n dispose() {\n this._removeRootElementListeners(this._rootElement);\n // Do this check before removing from the registry since it'll\n // stop being considered as dragged once it is removed.\n if (this.isDragging()) {\n // Since we move out the element to the end of the body while it's being\n // dragged, we have to make sure that it's removed if it gets destroyed.\n removeNode(this._rootElement);\n }\n removeNode(this._anchor);\n this._destroyPreview();\n this._destroyPlaceholder();\n this._dragDropRegistry.removeDragItem(this);\n this._removeSubscriptions();\n this.beforeStarted.complete();\n this.started.complete();\n this.released.complete();\n this.ended.complete();\n this.entered.complete();\n this.exited.complete();\n this.dropped.complete();\n this._moveEvents.complete();\n this._handles = [];\n this._disabledHandles.clear();\n this._dropContainer = undefined;\n this._resizeSubscription.unsubscribe();\n this._parentPositions.clear();\n this._boundaryElement = this._rootElement = this._ownerSVGElement = this._placeholderTemplate =\n this._previewTemplate = this._anchor = this._parentDragRef = null;\n }\n /** Checks whether the element is currently being dragged. */\n isDragging() {\n return this._hasStartedDragging && this._dragDropRegistry.isDragging(this);\n }\n /** Resets a standalone drag item to its initial position. */\n reset() {\n this._rootElement.style.transform = this._initialTransform || '';\n this._activeTransform = { x: 0, y: 0 };\n this._passiveTransform = { x: 0, y: 0 };\n }\n /**\n * Sets a handle as disabled. While a handle is disabled, it'll capture and interrupt dragging.\n * @param handle Handle element that should be disabled.\n */\n disableHandle(handle) {\n if (!this._disabledHandles.has(handle) && this._handles.indexOf(handle) > -1) {\n this._disabledHandles.add(handle);\n toggleNativeDragInteractions(handle, true);\n }\n }\n /**\n * Enables a handle, if it has been disabled.\n * @param handle Handle element to be enabled.\n */\n enableHandle(handle) {\n if (this._disabledHandles.has(handle)) {\n this._disabledHandles.delete(handle);\n toggleNativeDragInteractions(handle, this.disabled);\n }\n }\n /** Sets the layout direction of the draggable item. */\n withDirection(direction) {\n this._direction = direction;\n return this;\n }\n /** Sets the container that the item is part of. */\n _withDropContainer(container) {\n this._dropContainer = container;\n }\n /**\n * Gets the current position in pixels the draggable outside of a drop container.\n */\n getFreeDragPosition() {\n const position = this.isDragging() ? this._activeTransform : this._passiveTransform;\n return { x: position.x, y: position.y };\n }\n /**\n * Sets the current position in pixels the draggable outside of a drop container.\n * @param value New position to be set.\n */\n setFreeDragPosition(value) {\n this._activeTransform = { x: 0, y: 0 };\n this._passiveTransform.x = value.x;\n this._passiveTransform.y = value.y;\n if (!this._dropContainer) {\n this._applyRootElementTransform(value.x, value.y);\n }\n return this;\n }\n /**\n * Sets the container into which to insert the preview element.\n * @param value Container into which to insert the preview.\n */\n withPreviewContainer(value) {\n this._previewContainer = value;\n return this;\n }\n /** Updates the item's sort order based on the last-known pointer position. */\n _sortFromLastPointerPosition() {\n const position = this._lastKnownPointerPosition;\n if (position && this._dropContainer) {\n this._updateActiveDropContainer(this._getConstrainedPointerPosition(position), position);\n }\n }\n /** Unsubscribes from the global subscriptions. */\n _removeSubscriptions() {\n this._pointerMoveSubscription.unsubscribe();\n this._pointerUpSubscription.unsubscribe();\n this._scrollSubscription.unsubscribe();\n }\n /** Destroys the preview element and its ViewRef. */\n _destroyPreview() {\n if (this._preview) {\n removeNode(this._preview);\n }\n if (this._previewRef) {\n this._previewRef.destroy();\n }\n this._preview = this._previewRef = null;\n }\n /** Destroys the placeholder element and its ViewRef. */\n _destroyPlaceholder() {\n if (this._placeholder) {\n removeNode(this._placeholder);\n }\n if (this._placeholderRef) {\n this._placeholderRef.destroy();\n }\n this._placeholder = this._placeholderRef = null;\n }\n /**\n * Clears subscriptions and stops the dragging sequence.\n * @param event Browser event object that ended the sequence.\n */\n _endDragSequence(event) {\n // Note that here we use `isDragging` from the service, rather than from `this`.\n // The difference is that the one from the service reflects whether a dragging sequence\n // has been initiated, whereas the one on `this` includes whether the user has passed\n // the minimum dragging threshold.\n if (!this._dragDropRegistry.isDragging(this)) {\n return;\n }\n this._removeSubscriptions();\n this._dragDropRegistry.stopDragging(this);\n this._toggleNativeDragInteractions();\n if (this._handles) {\n this._rootElement.style.webkitTapHighlightColor = this._rootElementTapHighlight;\n }\n if (!this._hasStartedDragging) {\n return;\n }\n this.released.next({ source: this });\n if (this._dropContainer) {\n // Stop scrolling immediately, instead of waiting for the animation to finish.\n this._dropContainer._stopScrolling();\n this._animatePreviewToPlaceholder().then(() => {\n this._cleanupDragArtifacts(event);\n this._cleanupCachedDimensions();\n this._dragDropRegistry.stopDragging(this);\n });\n }\n else {\n // Convert the active transform into a passive one. This means that next time\n // the user starts dragging the item, its position will be calculated relatively\n // to the new passive transform.\n this._passiveTransform.x = this._activeTransform.x;\n const pointerPosition = this._getPointerPositionOnPage(event);\n this._passiveTransform.y = this._activeTransform.y;\n this._ngZone.run(() => {\n this.ended.next({\n source: this,\n distance: this._getDragDistance(pointerPosition),\n dropPoint: pointerPosition\n });\n });\n this._cleanupCachedDimensions();\n this._dragDropRegistry.stopDragging(this);\n }\n }\n /** Starts the dragging sequence. */\n _startDragSequence(event) {\n if (isTouchEvent(event)) {\n this._lastTouchEventTime = Date.now();\n }\n this._toggleNativeDragInteractions();\n const dropContainer = this._dropContainer;\n if (dropContainer) {\n const element = this._rootElement;\n const parent = element.parentNode;\n const placeholder = this._placeholder = this._createPlaceholderElement();\n const anchor = this._anchor = this._anchor || this._document.createComment('');\n // Needs to happen before the root element is moved.\n const shadowRoot = this._getShadowRoot();\n // Insert an anchor node so that we can restore the element's position in the DOM.\n parent.insertBefore(anchor, element);\n // There's no risk of transforms stacking when inside a drop container so\n // we can keep the initial transform up to date any time dragging starts.\n this._initialTransform = element.style.transform || '';\n // Create the preview after the initial transform has\n // been cached, because it can be affected by the transform.\n this._preview = this._createPreviewElement();\n // We move the element out at the end of the body and we make it hidden, because keeping it in\n // place will throw off the consumer's `:last-child` selectors. We can't remove the element\n // from the DOM completely, because iOS will stop firing all subsequent events in the chain.\n toggleVisibility(element, false);\n this._document.body.appendChild(parent.replaceChild(placeholder, element));\n this._getPreviewInsertionPoint(parent, shadowRoot).appendChild(this._preview);\n this.started.next({ source: this }); // Emit before notifying the container.\n dropContainer.start();\n this._initialContainer = dropContainer;\n this._initialIndex = dropContainer.getItemIndex(this);\n }\n else {\n this.started.next({ source: this });\n this._initialContainer = this._initialIndex = undefined;\n }\n // Important to run after we've called `start` on the parent container\n // so that it has had time to resolve its scrollable parents.\n this._parentPositions.cache(dropContainer ? dropContainer.getScrollableParents() : []);\n }\n /**\n * Sets up the different variables and subscriptions\n * that will be necessary for the dragging sequence.\n * @param referenceElement Element that started the drag sequence.\n * @param event Browser event object that started the sequence.\n */\n _initializeDragSequence(referenceElement, event) {\n // Stop propagation if the item is inside another\n // draggable so we don't start multiple drag sequences.\n if (this._parentDragRef) {\n event.stopPropagation();\n }\n const isDragging = this.isDragging();\n const isTouchSequence = isTouchEvent(event);\n const isAuxiliaryMouseButton = !isTouchSequence && event.button !== 0;\n const rootElement = this._rootElement;\n const target = getEventTarget(event);\n const isSyntheticEvent = !isTouchSequence && this._lastTouchEventTime &&\n this._lastTouchEventTime + MOUSE_EVENT_IGNORE_TIME > Date.now();\n // If the event started from an element with the native HTML drag&drop, it'll interfere\n // with our own dragging (e.g. `img` tags do it by default). Prevent the default action\n // to stop it from happening. Note that preventing on `dragstart` also seems to work, but\n // it's flaky and it fails if the user drags it away quickly. Also note that we only want\n // to do this for `mousedown` since doing the same for `touchstart` will stop any `click`\n // events from firing on touch devices.\n if (target && target.draggable && event.type === 'mousedown') {\n event.preventDefault();\n }\n // Abort if the user is already dragging or is using a mouse button other than the primary one.\n if (isDragging || isAuxiliaryMouseButton || isSyntheticEvent) {\n return;\n }\n // If we've got handles, we need to disable the tap highlight on the entire root element,\n // otherwise iOS will still add it, even though all the drag interactions on the handle\n // are disabled.\n if (this._handles.length) {\n this._rootElementTapHighlight = rootElement.style.webkitTapHighlightColor || '';\n rootElement.style.webkitTapHighlightColor = 'transparent';\n }\n this._hasStartedDragging = this._hasMoved = false;\n // Avoid multiple subscriptions and memory leaks when multi touch\n // (isDragging check above isn't enough because of possible temporal and/or dimensional delays)\n this._removeSubscriptions();\n this._pointerMoveSubscription = this._dragDropRegistry.pointerMove.subscribe(this._pointerMove);\n this._pointerUpSubscription = this._dragDropRegistry.pointerUp.subscribe(this._pointerUp);\n this._scrollSubscription = this._dragDropRegistry\n .scrolled(this._getShadowRoot())\n .subscribe(scrollEvent => this._updateOnScroll(scrollEvent));\n if (this._boundaryElement) {\n this._boundaryRect = getMutableClientRect(this._boundaryElement);\n }\n // If we have a custom preview we can't know ahead of time how large it'll be so we position\n // it next to the cursor. The exception is when the consumer has opted into making the preview\n // the same size as the root element, in which case we do know the size.\n const previewTemplate = this._previewTemplate;\n this._pickupPositionInElement = previewTemplate && previewTemplate.template &&\n !previewTemplate.matchSize ? { x: 0, y: 0 } :\n this._getPointerPositionInElement(referenceElement, event);\n const pointerPosition = this._pickupPositionOnPage = this._lastKnownPointerPosition =\n this._getPointerPositionOnPage(event);\n this._pointerDirectionDelta = { x: 0, y: 0 };\n this._pointerPositionAtLastDirectionChange = { x: pointerPosition.x, y: pointerPosition.y };\n this._dragStartTime = Date.now();\n this._dragDropRegistry.startDragging(this, event);\n }\n /** Cleans up the DOM artifacts that were added to facilitate the element being dragged. */\n _cleanupDragArtifacts(event) {\n // Restore the element's visibility and insert it at its old position in the DOM.\n // It's important that we maintain the position, because moving the element around in the DOM\n // can throw off `NgFor` which does smart diffing and re-creates elements only when necessary,\n // while moving the existing elements in all other cases.\n toggleVisibility(this._rootElement, true);\n this._anchor.parentNode.replaceChild(this._rootElement, this._anchor);\n this._destroyPreview();\n this._destroyPlaceholder();\n this._boundaryRect = this._previewRect = this._initialTransform = undefined;\n // Re-enter the NgZone since we bound `document` events on the outside.\n this._ngZone.run(() => {\n const container = this._dropContainer;\n const currentIndex = container.getItemIndex(this);\n const pointerPosition = this._getPointerPositionOnPage(event);\n const distance = this._getDragDistance(pointerPosition);\n const isPointerOverContainer = container._isOverContainer(pointerPosition.x, pointerPosition.y);\n this.ended.next({ source: this, distance, dropPoint: pointerPosition });\n this.dropped.next({\n item: this,\n currentIndex,\n previousIndex: this._initialIndex,\n container: container,\n previousContainer: this._initialContainer,\n isPointerOverContainer,\n distance,\n dropPoint: pointerPosition\n });\n container.drop(this, currentIndex, this._initialIndex, this._initialContainer, isPointerOverContainer, distance, pointerPosition);\n this._dropContainer = this._initialContainer;\n });\n }\n /**\n * Updates the item's position in its drop container, or moves it\n * into a new one, depending on its current drag position.\n */\n _updateActiveDropContainer({ x, y }, { x: rawX, y: rawY }) {\n // Drop container that draggable has been moved into.\n let newContainer = this._initialContainer._getSiblingContainerFromPosition(this, x, y);\n // If we couldn't find a new container to move the item into, and the item has left its\n // initial container, check whether the it's over the initial container. This handles the\n // case where two containers are connected one way and the user tries to undo dragging an\n // item into a new container.\n if (!newContainer && this._dropContainer !== this._initialContainer &&\n this._initialContainer._isOverContainer(x, y)) {\n newContainer = this._initialContainer;\n }\n if (newContainer && newContainer !== this._dropContainer) {\n this._ngZone.run(() => {\n // Notify the old container that the item has left.\n this.exited.next({ item: this, container: this._dropContainer });\n this._dropContainer.exit(this);\n // Notify the new container that the item has entered.\n this._dropContainer = newContainer;\n this._dropContainer.enter(this, x, y, newContainer === this._initialContainer &&\n // If we're re-entering the initial container and sorting is disabled,\n // put item the into its starting index to begin with.\n newContainer.sortingDisabled ? this._initialIndex : undefined);\n this.entered.next({\n item: this,\n container: newContainer,\n currentIndex: newContainer.getItemIndex(this)\n });\n });\n }\n // Dragging may have been interrupted as a result of the events above.\n if (this.isDragging()) {\n this._dropContainer._startScrollingIfNecessary(rawX, rawY);\n this._dropContainer._sortItem(this, x, y, this._pointerDirectionDelta);\n this._applyPreviewTransform(x - this._pickupPositionInElement.x, y - this._pickupPositionInElement.y);\n }\n }\n /**\n * Creates the element that will be rendered next to the user's pointer\n * and will be used as a preview of the element that is being dragged.\n */\n _createPreviewElement() {\n const previewConfig = this._previewTemplate;\n const previewClass = this.previewClass;\n const previewTemplate = previewConfig ? previewConfig.template : null;\n let preview;\n if (previewTemplate && previewConfig) {\n // Measure the element before we've inserted the preview\n // since the insertion could throw off the measurement.\n const rootRect = previewConfig.matchSize ? this._rootElement.getBoundingClientRect() : null;\n const viewRef = previewConfig.viewContainer.createEmbeddedView(previewTemplate, previewConfig.context);\n viewRef.detectChanges();\n preview = getRootNode(viewRef, this._document);\n this._previewRef = viewRef;\n if (previewConfig.matchSize) {\n matchElementSize(preview, rootRect);\n }\n else {\n preview.style.transform =\n getTransform(this._pickupPositionOnPage.x, this._pickupPositionOnPage.y);\n }\n }\n else {\n const element = this._rootElement;\n preview = deepCloneNode(element);\n matchElementSize(preview, element.getBoundingClientRect());\n if (this._initialTransform) {\n preview.style.transform = this._initialTransform;\n }\n }\n extendStyles(preview.style, {\n // It's important that we disable the pointer events on the preview, because\n // it can throw off the `document.elementFromPoint` calls in the `CdkDropList`.\n pointerEvents: 'none',\n // We have to reset the margin, because it can throw off positioning relative to the viewport.\n margin: '0',\n position: 'fixed',\n top: '0',\n left: '0',\n zIndex: `${this._config.zIndex || 1000}`\n });\n toggleNativeDragInteractions(preview, false);\n preview.classList.add('cdk-drag-preview');\n preview.setAttribute('dir', this._direction);\n if (previewClass) {\n if (Array.isArray(previewClass)) {\n previewClass.forEach(className => preview.classList.add(className));\n }\n else {\n preview.classList.add(previewClass);\n }\n }\n return preview;\n }\n /**\n * Animates the preview element from its current position to the location of the drop placeholder.\n * @returns Promise that resolves when the animation completes.\n */\n _animatePreviewToPlaceholder() {\n // If the user hasn't moved yet, the transitionend event won't fire.\n if (!this._hasMoved) {\n return Promise.resolve();\n }\n const placeholderRect = this._placeholder.getBoundingClientRect();\n // Apply the class that adds a transition to the preview.\n this._preview.classList.add('cdk-drag-animating');\n // Move the preview to the placeholder position.\n this._applyPreviewTransform(placeholderRect.left, placeholderRect.top);\n // If the element doesn't have a `transition`, the `transitionend` event won't fire. Since\n // we need to trigger a style recalculation in order for the `cdk-drag-animating` class to\n // apply its style, we take advantage of the available info to figure out whether we need to\n // bind the event in the first place.\n const duration = getTransformTransitionDurationInMs(this._preview);\n if (duration === 0) {\n return Promise.resolve();\n }\n return this._ngZone.runOutsideAngular(() => {\n return new Promise(resolve => {\n const handler = ((event) => {\n if (!event || (getEventTarget(event) === this._preview &&\n event.propertyName === 'transform')) {\n this._preview.removeEventListener('transitionend', handler);\n resolve();\n clearTimeout(timeout);\n }\n });\n // If a transition is short enough, the browser might not fire the `transitionend` event.\n // Since we know how long it's supposed to take, add a timeout with a 50% buffer that'll\n // fire if the transition hasn't completed when it was supposed to.\n const timeout = setTimeout(handler, duration * 1.5);\n this._preview.addEventListener('transitionend', handler);\n });\n });\n }\n /** Creates an element that will be shown instead of the current element while dragging. */\n _createPlaceholderElement() {\n const placeholderConfig = this._placeholderTemplate;\n const placeholderTemplate = placeholderConfig ? placeholderConfig.template : null;\n let placeholder;\n if (placeholderTemplate) {\n this._placeholderRef = placeholderConfig.viewContainer.createEmbeddedView(placeholderTemplate, placeholderConfig.context);\n this._placeholderRef.detectChanges();\n placeholder = getRootNode(this._placeholderRef, this._document);\n }\n else {\n placeholder = deepCloneNode(this._rootElement);\n }\n placeholder.classList.add('cdk-drag-placeholder');\n return placeholder;\n }\n /**\n * Figures out the coordinates at which an element was picked up.\n * @param referenceElement Element that initiated the dragging.\n * @param event Event that initiated the dragging.\n */\n _getPointerPositionInElement(referenceElement, event) {\n const elementRect = this._rootElement.getBoundingClientRect();\n const handleElement = referenceElement === this._rootElement ? null : referenceElement;\n const referenceRect = handleElement ? handleElement.getBoundingClientRect() : elementRect;\n const point = isTouchEvent(event) ? event.targetTouches[0] : event;\n const scrollPosition = this._getViewportScrollPosition();\n const x = point.pageX - referenceRect.left - scrollPosition.left;\n const y = point.pageY - referenceRect.top - scrollPosition.top;\n return {\n x: referenceRect.left - elementRect.left + x,\n y: referenceRect.top - elementRect.top + y\n };\n }\n /** Determines the point of the page that was touched by the user. */\n _getPointerPositionOnPage(event) {\n const scrollPosition = this._getViewportScrollPosition();\n const point = isTouchEvent(event) ?\n // `touches` will be empty for start/end events so we have to fall back to `changedTouches`.\n // Also note that on real devices we're guaranteed for either `touches` or `changedTouches`\n // to have a value, but Firefox in device emulation mode has a bug where both can be empty\n // for `touchstart` and `touchend` so we fall back to a dummy object in order to avoid\n // throwing an error. The value returned here will be incorrect, but since this only\n // breaks inside a developer tool and the value is only used for secondary information,\n // we can get away with it. See https://bugzilla.mozilla.org/show_bug.cgi?id=1615824.\n (event.touches[0] || event.changedTouches[0] || { pageX: 0, pageY: 0 }) : event;\n const x = point.pageX - scrollPosition.left;\n const y = point.pageY - scrollPosition.top;\n // if dragging SVG element, try to convert from the screen coordinate system to the SVG\n // coordinate system\n if (this._ownerSVGElement) {\n const svgMatrix = this._ownerSVGElement.getScreenCTM();\n if (svgMatrix) {\n const svgPoint = this._ownerSVGElement.createSVGPoint();\n svgPoint.x = x;\n svgPoint.y = y;\n return svgPoint.matrixTransform(svgMatrix.inverse());\n }\n }\n return { x, y };\n }\n /** Gets the pointer position on the page, accounting for any position constraints. */\n _getConstrainedPointerPosition(point) {\n const dropContainerLock = this._dropContainer ? this._dropContainer.lockAxis : null;\n let { x, y } = this.constrainPosition ? this.constrainPosition(point, this) : point;\n if (this.lockAxis === 'x' || dropContainerLock === 'x') {\n y = this._pickupPositionOnPage.y;\n }\n else if (this.lockAxis === 'y' || dropContainerLock === 'y') {\n x = this._pickupPositionOnPage.x;\n }\n if (this._boundaryRect) {\n const { x: pickupX, y: pickupY } = this._pickupPositionInElement;\n const boundaryRect = this._boundaryRect;\n const previewRect = this._previewRect;\n const minY = boundaryRect.top + pickupY;\n const maxY = boundaryRect.bottom - (previewRect.height - pickupY);\n const minX = boundaryRect.left + pickupX;\n const maxX = boundaryRect.right - (previewRect.width - pickupX);\n x = clamp$1(x, minX, maxX);\n y = clamp$1(y, minY, maxY);\n }\n return { x, y };\n }\n /** Updates the current drag delta, based on the user's current pointer position on the page. */\n _updatePointerDirectionDelta(pointerPositionOnPage) {\n const { x, y } = pointerPositionOnPage;\n const delta = this._pointerDirectionDelta;\n const positionSinceLastChange = this._pointerPositionAtLastDirectionChange;\n // Amount of pixels the user has dragged since the last time the direction changed.\n const changeX = Math.abs(x - positionSinceLastChange.x);\n const changeY = Math.abs(y - positionSinceLastChange.y);\n // Because we handle pointer events on a per-pixel basis, we don't want the delta\n // to change for every pixel, otherwise anything that depends on it can look erratic.\n // To make the delta more consistent, we track how much the user has moved since the last\n // delta change and we only update it after it has reached a certain threshold.\n if (changeX > this._config.pointerDirectionChangeThreshold) {\n delta.x = x > positionSinceLastChange.x ? 1 : -1;\n positionSinceLastChange.x = x;\n }\n if (changeY > this._config.pointerDirectionChangeThreshold) {\n delta.y = y > positionSinceLastChange.y ? 1 : -1;\n positionSinceLastChange.y = y;\n }\n return delta;\n }\n /** Toggles the native drag interactions, based on how many handles are registered. */\n _toggleNativeDragInteractions() {\n if (!this._rootElement || !this._handles) {\n return;\n }\n const shouldEnable = this._handles.length > 0 || !this.isDragging();\n if (shouldEnable !== this._nativeInteractionsEnabled) {\n this._nativeInteractionsEnabled = shouldEnable;\n toggleNativeDragInteractions(this._rootElement, shouldEnable);\n }\n }\n /** Removes the manually-added event listeners from the root element. */\n _removeRootElementListeners(element) {\n element.removeEventListener('mousedown', this._pointerDown, activeEventListenerOptions);\n element.removeEventListener('touchstart', this._pointerDown, passiveEventListenerOptions);\n }\n /**\n * Applies a `transform` to the root element, taking into account any existing transforms on it.\n * @param x New transform value along the X axis.\n * @param y New transform value along the Y axis.\n */\n _applyRootElementTransform(x, y) {\n const transform = getTransform(x, y);\n // Cache the previous transform amount only after the first drag sequence, because\n // we don't want our own transforms to stack on top of each other.\n if (this._initialTransform == null) {\n this._initialTransform = this._rootElement.style.transform || '';\n }\n // Preserve the previous `transform` value, if there was one. Note that we apply our own\n // transform before the user's, because things like rotation can affect which direction\n // the element will be translated towards.\n this._rootElement.style.transform = combineTransforms(transform, this._initialTransform);\n }\n /**\n * Applies a `transform` to the preview, taking into account any existing transforms on it.\n * @param x New transform value along the X axis.\n * @param y New transform value along the Y axis.\n */\n _applyPreviewTransform(x, y) {\n var _a;\n // Only apply the initial transform if the preview is a clone of the original element, otherwise\n // it could be completely different and the transform might not make sense anymore.\n const initialTransform = ((_a = this._previewTemplate) === null || _a === void 0 ? void 0 : _a.template) ? undefined : this._initialTransform;\n const transform = getTransform(x, y);\n this._preview.style.transform = combineTransforms(transform, initialTransform);\n }\n /**\n * Gets the distance that the user has dragged during the current drag sequence.\n * @param currentPosition Current position of the user's pointer.\n */\n _getDragDistance(currentPosition) {\n const pickupPosition = this._pickupPositionOnPage;\n if (pickupPosition) {\n return { x: currentPosition.x - pickupPosition.x, y: currentPosition.y - pickupPosition.y };\n }\n return { x: 0, y: 0 };\n }\n /** Cleans up any cached element dimensions that we don't need after dragging has stopped. */\n _cleanupCachedDimensions() {\n this._boundaryRect = this._previewRect = undefined;\n this._parentPositions.clear();\n }\n /**\n * Checks whether the element is still inside its boundary after the viewport has been resized.\n * If not, the position is adjusted so that the element fits again.\n */\n _containInsideBoundaryOnResize() {\n let { x, y } = this._passiveTransform;\n if ((x === 0 && y === 0) || this.isDragging() || !this._boundaryElement) {\n return;\n }\n const boundaryRect = this._boundaryElement.getBoundingClientRect();\n const elementRect = this._rootElement.getBoundingClientRect();\n // It's possible that the element got hidden away after dragging (e.g. by switching to a\n // different tab). Don't do anything in this case so we don't clear the user's position.\n if ((boundaryRect.width === 0 && boundaryRect.height === 0) ||\n (elementRect.width === 0 && elementRect.height === 0)) {\n return;\n }\n const leftOverflow = boundaryRect.left - elementRect.left;\n const rightOverflow = elementRect.right - boundaryRect.right;\n const topOverflow = boundaryRect.top - elementRect.top;\n const bottomOverflow = elementRect.bottom - boundaryRect.bottom;\n // If the element has become wider than the boundary, we can't\n // do much to make it fit so we just anchor it to the left.\n if (boundaryRect.width > elementRect.width) {\n if (leftOverflow > 0) {\n x += leftOverflow;\n }\n if (rightOverflow > 0) {\n x -= rightOverflow;\n }\n }\n else {\n x = 0;\n }\n // If the element has become taller than the boundary, we can't\n // do much to make it fit so we just anchor it to the top.\n if (boundaryRect.height > elementRect.height) {\n if (topOverflow > 0) {\n y += topOverflow;\n }\n if (bottomOverflow > 0) {\n y -= bottomOverflow;\n }\n }\n else {\n y = 0;\n }\n if (x !== this._passiveTransform.x || y !== this._passiveTransform.y) {\n this.setFreeDragPosition({ y, x });\n }\n }\n /** Gets the drag start delay, based on the event type. */\n _getDragStartDelay(event) {\n const value = this.dragStartDelay;\n if (typeof value === 'number') {\n return value;\n }\n else if (isTouchEvent(event)) {\n return value.touch;\n }\n return value ? value.mouse : 0;\n }\n /** Updates the internal state of the draggable element when scrolling has occurred. */\n _updateOnScroll(event) {\n const scrollDifference = this._parentPositions.handleScroll(event);\n if (scrollDifference) {\n const target = getEventTarget(event);\n // ClientRect dimensions are based on the scroll position of the page and its parent node so\n // we have to update the cached boundary ClientRect if the user has scrolled. Check for\n // the `document` specifically since IE doesn't support `contains` on it.\n if (this._boundaryRect && (target === this._document ||\n (target !== this._boundaryElement && target.contains(this._boundaryElement)))) {\n adjustClientRect(this._boundaryRect, scrollDifference.top, scrollDifference.left);\n }\n this._pickupPositionOnPage.x += scrollDifference.left;\n this._pickupPositionOnPage.y += scrollDifference.top;\n // If we're in free drag mode, we have to update the active transform, because\n // it isn't relative to the viewport like the preview inside a drop list.\n if (!this._dropContainer) {\n this._activeTransform.x -= scrollDifference.left;\n this._activeTransform.y -= scrollDifference.top;\n this._applyRootElementTransform(this._activeTransform.x, this._activeTransform.y);\n }\n }\n }\n /** Gets the scroll position of the viewport. */\n _getViewportScrollPosition() {\n const cachedPosition = this._parentPositions.positions.get(this._document);\n return cachedPosition ? cachedPosition.scrollPosition :\n this._viewportRuler.getViewportScrollPosition();\n }\n /**\n * Lazily resolves and returns the shadow root of the element. We do this in a function, rather\n * than saving it in property directly on init, because we want to resolve it as late as possible\n * in order to ensure that the element has been moved into the shadow DOM. Doing it inside the\n * constructor might be too early if the element is inside of something like `ngFor` or `ngIf`.\n */\n _getShadowRoot() {\n if (this._cachedShadowRoot === undefined) {\n this._cachedShadowRoot = _getShadowRoot(this._rootElement);\n }\n return this._cachedShadowRoot;\n }\n /** Gets the element into which the drag preview should be inserted. */\n _getPreviewInsertionPoint(initialParent, shadowRoot) {\n const previewContainer = this._previewContainer || 'global';\n if (previewContainer === 'parent') {\n return initialParent;\n }\n if (previewContainer === 'global') {\n const documentRef = this._document;\n // We can't use the body if the user is in fullscreen mode,\n // because the preview will render under the fullscreen element.\n // TODO(crisbeto): dedupe this with the `FullscreenOverlayContainer` eventually.\n return shadowRoot ||\n documentRef.fullscreenElement ||\n documentRef.webkitFullscreenElement ||\n documentRef.mozFullScreenElement ||\n documentRef.msFullscreenElement ||\n documentRef.body;\n }\n return coerceElement(previewContainer);\n }\n}\n/**\n * Gets a 3d `transform` that can be applied to an element.\n * @param x Desired position of the element along the X axis.\n * @param y Desired position of the element along the Y axis.\n */\nfunction getTransform(x, y) {\n // Round the transforms since some browsers will\n // blur the elements for sub-pixel transforms.\n return `translate3d(${Math.round(x)}px, ${Math.round(y)}px, 0)`;\n}\n/** Clamps a value between a minimum and a maximum. */\nfunction clamp$1(value, min, max) {\n return Math.max(min, Math.min(max, value));\n}\n/**\n * Helper to remove a node from the DOM and to do all the necessary null checks.\n * @param node Node to be removed.\n */\nfunction removeNode(node) {\n if (node && node.parentNode) {\n node.parentNode.removeChild(node);\n }\n}\n/** Determines whether an event is a touch event. */\nfunction isTouchEvent(event) {\n // This function is called for every pixel that the user has dragged so we need it to be\n // as fast as possible. Since we only bind mouse events and touch events, we can assume\n // that if the event's name starts with `t`, it's a touch event.\n return event.type[0] === 't';\n}\n/**\n * Gets the root HTML element of an embedded view.\n * If the root is not an HTML element it gets wrapped in one.\n */\nfunction getRootNode(viewRef, _document) {\n const rootNodes = viewRef.rootNodes;\n if (rootNodes.length === 1 && rootNodes[0].nodeType === _document.ELEMENT_NODE) {\n return rootNodes[0];\n }\n const wrapper = _document.createElement('div');\n rootNodes.forEach(node => wrapper.appendChild(node));\n return wrapper;\n}\n/**\n * Matches the target element's size to the source's size.\n * @param target Element that needs to be resized.\n * @param sourceRect Dimensions of the source element.\n */\nfunction matchElementSize(target, sourceRect) {\n target.style.width = `${sourceRect.width}px`;\n target.style.height = `${sourceRect.height}px`;\n target.style.transform = getTransform(sourceRect.left, sourceRect.top);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Moves an item one index in an array to another.\n * @param array Array in which to move the item.\n * @param fromIndex Starting index of the item.\n * @param toIndex Index to which the item should be moved.\n */\nfunction moveItemInArray(array, fromIndex, toIndex) {\n const from = clamp(fromIndex, array.length - 1);\n const to = clamp(toIndex, array.length - 1);\n if (from === to) {\n return;\n }\n const target = array[from];\n const delta = to < from ? -1 : 1;\n for (let i = from; i !== to; i += delta) {\n array[i] = array[i + delta];\n }\n array[to] = target;\n}\n/**\n * Moves an item from one array to another.\n * @param currentArray Array from which to transfer the item.\n * @param targetArray Array into which to put the item.\n * @param currentIndex Index of the item in its current array.\n * @param targetIndex Index at which to insert the item.\n */\nfunction transferArrayItem(currentArray, targetArray, currentIndex, targetIndex) {\n const from = clamp(currentIndex, currentArray.length - 1);\n const to = clamp(targetIndex, targetArray.length);\n if (currentArray.length) {\n targetArray.splice(to, 0, currentArray.splice(from, 1)[0]);\n }\n}\n/**\n * Copies an item from one array to another, leaving it in its\n * original position in current array.\n * @param currentArray Array from which to copy the item.\n * @param targetArray Array into which is copy the item.\n * @param currentIndex Index of the item in its current array.\n * @param targetIndex Index at which to insert the item.\n *\n */\nfunction copyArrayItem(currentArray, targetArray, currentIndex, targetIndex) {\n const to = clamp(targetIndex, targetArray.length);\n if (currentArray.length) {\n targetArray.splice(to, 0, currentArray[currentIndex]);\n }\n}\n/** Clamps a number between zero and a maximum. */\nfunction clamp(value, max) {\n return Math.max(0, Math.min(max, value));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Proximity, as a ratio to width/height, at which a\n * dragged item will affect the drop container.\n */\nconst DROP_PROXIMITY_THRESHOLD = 0.05;\n/**\n * Proximity, as a ratio to width/height at which to start auto-scrolling the drop list or the\n * viewport. The value comes from trying it out manually until it feels right.\n */\nconst SCROLL_PROXIMITY_THRESHOLD = 0.05;\n/**\n * Reference to a drop list. Used to manipulate or dispose of the container.\n */\nclass DropListRef {\n constructor(element, _dragDropRegistry, _document, _ngZone, _viewportRuler) {\n this._dragDropRegistry = _dragDropRegistry;\n this._ngZone = _ngZone;\n this._viewportRuler = _viewportRuler;\n /** Whether starting a dragging sequence from this container is disabled. */\n this.disabled = false;\n /** Whether sorting items within the list is disabled. */\n this.sortingDisabled = false;\n /**\n * Whether auto-scrolling the view when the user\n * moves their pointer close to the edges is disabled.\n */\n this.autoScrollDisabled = false;\n /** Number of pixels to scroll for each frame when auto-scrolling an element. */\n this.autoScrollStep = 2;\n /**\n * Function that is used to determine whether an item\n * is allowed to be moved into a drop container.\n */\n this.enterPredicate = () => true;\n /** Functions that is used to determine whether an item can be sorted into a particular index. */\n this.sortPredicate = () => true;\n /** Emits right before dragging has started. */\n this.beforeStarted = new Subject();\n /**\n * Emits when the user has moved a new drag item into this container.\n */\n this.entered = new Subject();\n /**\n * Emits when the user removes an item from the container\n * by dragging it into another container.\n */\n this.exited = new Subject();\n /** Emits when the user drops an item inside the container. */\n this.dropped = new Subject();\n /** Emits as the user is swapping items while actively dragging. */\n this.sorted = new Subject();\n /** Whether an item in the list is being dragged. */\n this._isDragging = false;\n /** Cache of the dimensions of all the items inside the container. */\n this._itemPositions = [];\n /**\n * Keeps track of the item that was last swapped with the dragged item, as well as what direction\n * the pointer was moving in when the swap occured and whether the user's pointer continued to\n * overlap with the swapped item after the swapping occurred.\n */\n this._previousSwap = { drag: null, delta: 0, overlaps: false };\n /** Draggable items in the container. */\n this._draggables = [];\n /** Drop lists that are connected to the current one. */\n this._siblings = [];\n /** Direction in which the list is oriented. */\n this._orientation = 'vertical';\n /** Connected siblings that currently have a dragged item. */\n this._activeSiblings = new Set();\n /** Layout direction of the drop list. */\n this._direction = 'ltr';\n /** Subscription to the window being scrolled. */\n this._viewportScrollSubscription = Subscription.EMPTY;\n /** Vertical direction in which the list is currently scrolling. */\n this._verticalScrollDirection = 0 /* NONE */;\n /** Horizontal direction in which the list is currently scrolling. */\n this._horizontalScrollDirection = 0 /* NONE */;\n /** Used to signal to the current auto-scroll sequence when to stop. */\n this._stopScrollTimers = new Subject();\n /** Shadow root of the current element. Necessary for `elementFromPoint` to resolve correctly. */\n this._cachedShadowRoot = null;\n /** Starts the interval that'll auto-scroll the element. */\n this._startScrollInterval = () => {\n this._stopScrolling();\n interval(0, animationFrameScheduler)\n .pipe(takeUntil(this._stopScrollTimers))\n .subscribe(() => {\n const node = this._scrollNode;\n const scrollStep = this.autoScrollStep;\n if (this._verticalScrollDirection === 1 /* UP */) {\n incrementVerticalScroll(node, -scrollStep);\n }\n else if (this._verticalScrollDirection === 2 /* DOWN */) {\n incrementVerticalScroll(node, scrollStep);\n }\n if (this._horizontalScrollDirection === 1 /* LEFT */) {\n incrementHorizontalScroll(node, -scrollStep);\n }\n else if (this._horizontalScrollDirection === 2 /* RIGHT */) {\n incrementHorizontalScroll(node, scrollStep);\n }\n });\n };\n this.element = coerceElement(element);\n this._document = _document;\n this.withScrollableParents([this.element]);\n _dragDropRegistry.registerDropContainer(this);\n this._parentPositions = new ParentPositionTracker(_document, _viewportRuler);\n }\n /** Removes the drop list functionality from the DOM element. */\n dispose() {\n this._stopScrolling();\n this._stopScrollTimers.complete();\n this._viewportScrollSubscription.unsubscribe();\n this.beforeStarted.complete();\n this.entered.complete();\n this.exited.complete();\n this.dropped.complete();\n this.sorted.complete();\n this._activeSiblings.clear();\n this._scrollNode = null;\n this._parentPositions.clear();\n this._dragDropRegistry.removeDropContainer(this);\n }\n /** Whether an item from this list is currently being dragged. */\n isDragging() {\n return this._isDragging;\n }\n /** Starts dragging an item. */\n start() {\n this._draggingStarted();\n this._notifyReceivingSiblings();\n }\n /**\n * Emits an event to indicate that the user moved an item into the container.\n * @param item Item that was moved into the container.\n * @param pointerX Position of the item along the X axis.\n * @param pointerY Position of the item along the Y axis.\n * @param index Index at which the item entered. If omitted, the container will try to figure it\n * out automatically.\n */\n enter(item, pointerX, pointerY, index) {\n this._draggingStarted();\n // If sorting is disabled, we want the item to return to its starting\n // position if the user is returning it to its initial container.\n let newIndex;\n if (index == null) {\n newIndex = this.sortingDisabled ? this._draggables.indexOf(item) : -1;\n if (newIndex === -1) {\n // We use the coordinates of where the item entered the drop\n // zone to figure out at which index it should be inserted.\n newIndex = this._getItemIndexFromPointerPosition(item, pointerX, pointerY);\n }\n }\n else {\n newIndex = index;\n }\n const activeDraggables = this._activeDraggables;\n const currentIndex = activeDraggables.indexOf(item);\n const placeholder = item.getPlaceholderElement();\n let newPositionReference = activeDraggables[newIndex];\n // If the item at the new position is the same as the item that is being dragged,\n // it means that we're trying to restore the item to its initial position. In this\n // case we should use the next item from the list as the reference.\n if (newPositionReference === item) {\n newPositionReference = activeDraggables[newIndex + 1];\n }\n // Since the item may be in the `activeDraggables` already (e.g. if the user dragged it\n // into another container and back again), we have to ensure that it isn't duplicated.\n if (currentIndex > -1) {\n activeDraggables.splice(currentIndex, 1);\n }\n // Don't use items that are being dragged as a reference, because\n // their element has been moved down to the bottom of the body.\n if (newPositionReference && !this._dragDropRegistry.isDragging(newPositionReference)) {\n const element = newPositionReference.getRootElement();\n element.parentElement.insertBefore(placeholder, element);\n activeDraggables.splice(newIndex, 0, item);\n }\n else if (this._shouldEnterAsFirstChild(pointerX, pointerY)) {\n const reference = activeDraggables[0].getRootElement();\n reference.parentNode.insertBefore(placeholder, reference);\n activeDraggables.unshift(item);\n }\n else {\n coerceElement(this.element).appendChild(placeholder);\n activeDraggables.push(item);\n }\n // The transform needs to be cleared so it doesn't throw off the measurements.\n placeholder.style.transform = '';\n // Note that the positions were already cached when we called `start` above,\n // but we need to refresh them since the amount of items has changed and also parent rects.\n this._cacheItemPositions();\n this._cacheParentPositions();\n // Notify siblings at the end so that the item has been inserted into the `activeDraggables`.\n this._notifyReceivingSiblings();\n this.entered.next({ item, container: this, currentIndex: this.getItemIndex(item) });\n }\n /**\n * Removes an item from the container after it was dragged into another container by the user.\n * @param item Item that was dragged out.\n */\n exit(item) {\n this._reset();\n this.exited.next({ item, container: this });\n }\n /**\n * Drops an item into this container.\n * @param item Item being dropped into the container.\n * @param currentIndex Index at which the item should be inserted.\n * @param previousIndex Index of the item when dragging started.\n * @param previousContainer Container from which the item got dragged in.\n * @param isPointerOverContainer Whether the user's pointer was over the\n * container when the item was dropped.\n * @param distance Distance the user has dragged since the start of the dragging sequence.\n */\n drop(item, currentIndex, previousIndex, previousContainer, isPointerOverContainer, distance, dropPoint) {\n this._reset();\n this.dropped.next({\n item,\n currentIndex,\n previousIndex,\n container: this,\n previousContainer,\n isPointerOverContainer,\n distance,\n dropPoint\n });\n }\n /**\n * Sets the draggable items that are a part of this list.\n * @param items Items that are a part of this list.\n */\n withItems(items) {\n const previousItems = this._draggables;\n this._draggables = items;\n items.forEach(item => item._withDropContainer(this));\n if (this.isDragging()) {\n const draggedItems = previousItems.filter(item => item.isDragging());\n // If all of the items being dragged were removed\n // from the list, abort the current drag sequence.\n if (draggedItems.every(item => items.indexOf(item) === -1)) {\n this._reset();\n }\n else {\n this._cacheItems();\n }\n }\n return this;\n }\n /** Sets the layout direction of the drop list. */\n withDirection(direction) {\n this._direction = direction;\n return this;\n }\n /**\n * Sets the containers that are connected to this one. When two or more containers are\n * connected, the user will be allowed to transfer items between them.\n * @param connectedTo Other containers that the current containers should be connected to.\n */\n connectedTo(connectedTo) {\n this._siblings = connectedTo.slice();\n return this;\n }\n /**\n * Sets the orientation of the container.\n * @param orientation New orientation for the container.\n */\n withOrientation(orientation) {\n this._orientation = orientation;\n return this;\n }\n /**\n * Sets which parent elements are can be scrolled while the user is dragging.\n * @param elements Elements that can be scrolled.\n */\n withScrollableParents(elements) {\n const element = coerceElement(this.element);\n // We always allow the current element to be scrollable\n // so we need to ensure that it's in the array.\n this._scrollableElements =\n elements.indexOf(element) === -1 ? [element, ...elements] : elements.slice();\n return this;\n }\n /** Gets the scrollable parents that are registered with this drop container. */\n getScrollableParents() {\n return this._scrollableElements;\n }\n /**\n * Figures out the index of an item in the container.\n * @param item Item whose index should be determined.\n */\n getItemIndex(item) {\n if (!this._isDragging) {\n return this._draggables.indexOf(item);\n }\n // Items are sorted always by top/left in the cache, however they flow differently in RTL.\n // The rest of the logic still stands no matter what orientation we're in, however\n // we need to invert the array when determining the index.\n const items = this._orientation === 'horizontal' && this._direction === 'rtl' ?\n this._itemPositions.slice().reverse() : this._itemPositions;\n return findIndex(items, currentItem => currentItem.drag === item);\n }\n /**\n * Whether the list is able to receive the item that\n * is currently being dragged inside a connected drop list.\n */\n isReceiving() {\n return this._activeSiblings.size > 0;\n }\n /**\n * Sorts an item inside the container based on its position.\n * @param item Item to be sorted.\n * @param pointerX Position of the item along the X axis.\n * @param pointerY Position of the item along the Y axis.\n * @param pointerDelta Direction in which the pointer is moving along each axis.\n */\n _sortItem(item, pointerX, pointerY, pointerDelta) {\n // Don't sort the item if sorting is disabled or it's out of range.\n if (this.sortingDisabled || !this._clientRect ||\n !isPointerNearClientRect(this._clientRect, DROP_PROXIMITY_THRESHOLD, pointerX, pointerY)) {\n return;\n }\n const siblings = this._itemPositions;\n const newIndex = this._getItemIndexFromPointerPosition(item, pointerX, pointerY, pointerDelta);\n if (newIndex === -1 && siblings.length > 0) {\n return;\n }\n const isHorizontal = this._orientation === 'horizontal';\n const currentIndex = findIndex(siblings, currentItem => currentItem.drag === item);\n const siblingAtNewPosition = siblings[newIndex];\n const currentPosition = siblings[currentIndex].clientRect;\n const newPosition = siblingAtNewPosition.clientRect;\n const delta = currentIndex > newIndex ? 1 : -1;\n // How many pixels the item's placeholder should be offset.\n const itemOffset = this._getItemOffsetPx(currentPosition, newPosition, delta);\n // How many pixels all the other items should be offset.\n const siblingOffset = this._getSiblingOffsetPx(currentIndex, siblings, delta);\n // Save the previous order of the items before moving the item to its new index.\n // We use this to check whether an item has been moved as a result of the sorting.\n const oldOrder = siblings.slice();\n // Shuffle the array in place.\n moveItemInArray(siblings, currentIndex, newIndex);\n this.sorted.next({\n previousIndex: currentIndex,\n currentIndex: newIndex,\n container: this,\n item\n });\n siblings.forEach((sibling, index) => {\n // Don't do anything if the position hasn't changed.\n if (oldOrder[index] === sibling) {\n return;\n }\n const isDraggedItem = sibling.drag === item;\n const offset = isDraggedItem ? itemOffset : siblingOffset;\n const elementToOffset = isDraggedItem ? item.getPlaceholderElement() :\n sibling.drag.getRootElement();\n // Update the offset to reflect the new position.\n sibling.offset += offset;\n // Since we're moving the items with a `transform`, we need to adjust their cached\n // client rects to reflect their new position, as well as swap their positions in the cache.\n // Note that we shouldn't use `getBoundingClientRect` here to update the cache, because the\n // elements may be mid-animation which will give us a wrong result.\n if (isHorizontal) {\n // Round the transforms since some browsers will\n // blur the elements, for sub-pixel transforms.\n elementToOffset.style.transform = combineTransforms(`translate3d(${Math.round(sibling.offset)}px, 0, 0)`, sibling.initialTransform);\n adjustClientRect(sibling.clientRect, 0, offset);\n }\n else {\n elementToOffset.style.transform = combineTransforms(`translate3d(0, ${Math.round(sibling.offset)}px, 0)`, sibling.initialTransform);\n adjustClientRect(sibling.clientRect, offset, 0);\n }\n });\n // Note that it's important that we do this after the client rects have been adjusted.\n this._previousSwap.overlaps = isInsideClientRect(newPosition, pointerX, pointerY);\n this._previousSwap.drag = siblingAtNewPosition.drag;\n this._previousSwap.delta = isHorizontal ? pointerDelta.x : pointerDelta.y;\n }\n /**\n * Checks whether the user's pointer is close to the edges of either the\n * viewport or the drop list and starts the auto-scroll sequence.\n * @param pointerX User's pointer position along the x axis.\n * @param pointerY User's pointer position along the y axis.\n */\n _startScrollingIfNecessary(pointerX, pointerY) {\n if (this.autoScrollDisabled) {\n return;\n }\n let scrollNode;\n let verticalScrollDirection = 0 /* NONE */;\n let horizontalScrollDirection = 0 /* NONE */;\n // Check whether we should start scrolling any of the parent containers.\n this._parentPositions.positions.forEach((position, element) => {\n // We have special handling for the `document` below. Also this would be\n // nicer with a for...of loop, but it requires changing a compiler flag.\n if (element === this._document || !position.clientRect || scrollNode) {\n return;\n }\n if (isPointerNearClientRect(position.clientRect, DROP_PROXIMITY_THRESHOLD, pointerX, pointerY)) {\n [verticalScrollDirection, horizontalScrollDirection] = getElementScrollDirections(element, position.clientRect, pointerX, pointerY);\n if (verticalScrollDirection || horizontalScrollDirection) {\n scrollNode = element;\n }\n }\n });\n // Otherwise check if we can start scrolling the viewport.\n if (!verticalScrollDirection && !horizontalScrollDirection) {\n const { width, height } = this._viewportRuler.getViewportSize();\n const clientRect = { width, height, top: 0, right: width, bottom: height, left: 0 };\n verticalScrollDirection = getVerticalScrollDirection(clientRect, pointerY);\n horizontalScrollDirection = getHorizontalScrollDirection(clientRect, pointerX);\n scrollNode = window;\n }\n if (scrollNode && (verticalScrollDirection !== this._verticalScrollDirection ||\n horizontalScrollDirection !== this._horizontalScrollDirection ||\n scrollNode !== this._scrollNode)) {\n this._verticalScrollDirection = verticalScrollDirection;\n this._horizontalScrollDirection = horizontalScrollDirection;\n this._scrollNode = scrollNode;\n if ((verticalScrollDirection || horizontalScrollDirection) && scrollNode) {\n this._ngZone.runOutsideAngular(this._startScrollInterval);\n }\n else {\n this._stopScrolling();\n }\n }\n }\n /** Stops any currently-running auto-scroll sequences. */\n _stopScrolling() {\n this._stopScrollTimers.next();\n }\n /** Starts the dragging sequence within the list. */\n _draggingStarted() {\n const styles = coerceElement(this.element).style;\n this.beforeStarted.next();\n this._isDragging = true;\n // We need to disable scroll snapping while the user is dragging, because it breaks automatic\n // scrolling. The browser seems to round the value based on the snapping points which means\n // that we can't increment/decrement the scroll position.\n this._initialScrollSnap = styles.msScrollSnapType || styles.scrollSnapType || '';\n styles.scrollSnapType = styles.msScrollSnapType = 'none';\n this._cacheItems();\n this._viewportScrollSubscription.unsubscribe();\n this._listenToScrollEvents();\n }\n /** Caches the positions of the configured scrollable parents. */\n _cacheParentPositions() {\n const element = coerceElement(this.element);\n this._parentPositions.cache(this._scrollableElements);\n // The list element is always in the `scrollableElements`\n // so we can take advantage of the cached `ClientRect`.\n this._clientRect = this._parentPositions.positions.get(element).clientRect;\n }\n /** Refreshes the position cache of the items and sibling containers. */\n _cacheItemPositions() {\n const isHorizontal = this._orientation === 'horizontal';\n this._itemPositions = this._activeDraggables.map(drag => {\n const elementToMeasure = drag.getVisibleElement();\n return {\n drag,\n offset: 0,\n initialTransform: elementToMeasure.style.transform || '',\n clientRect: getMutableClientRect(elementToMeasure),\n };\n }).sort((a, b) => {\n return isHorizontal ? a.clientRect.left - b.clientRect.left :\n a.clientRect.top - b.clientRect.top;\n });\n }\n /** Resets the container to its initial state. */\n _reset() {\n this._isDragging = false;\n const styles = coerceElement(this.element).style;\n styles.scrollSnapType = styles.msScrollSnapType = this._initialScrollSnap;\n // TODO(crisbeto): may have to wait for the animations to finish.\n this._activeDraggables.forEach(item => {\n var _a;\n const rootElement = item.getRootElement();\n if (rootElement) {\n const initialTransform = (_a = this._itemPositions\n .find(current => current.drag === item)) === null || _a === void 0 ? void 0 : _a.initialTransform;\n rootElement.style.transform = initialTransform || '';\n }\n });\n this._siblings.forEach(sibling => sibling._stopReceiving(this));\n this._activeDraggables = [];\n this._itemPositions = [];\n this._previousSwap.drag = null;\n this._previousSwap.delta = 0;\n this._previousSwap.overlaps = false;\n this._stopScrolling();\n this._viewportScrollSubscription.unsubscribe();\n this._parentPositions.clear();\n }\n /**\n * Gets the offset in pixels by which the items that aren't being dragged should be moved.\n * @param currentIndex Index of the item currently being dragged.\n * @param siblings All of the items in the list.\n * @param delta Direction in which the user is moving.\n */\n _getSiblingOffsetPx(currentIndex, siblings, delta) {\n const isHorizontal = this._orientation === 'horizontal';\n const currentPosition = siblings[currentIndex].clientRect;\n const immediateSibling = siblings[currentIndex + delta * -1];\n let siblingOffset = currentPosition[isHorizontal ? 'width' : 'height'] * delta;\n if (immediateSibling) {\n const start = isHorizontal ? 'left' : 'top';\n const end = isHorizontal ? 'right' : 'bottom';\n // Get the spacing between the start of the current item and the end of the one immediately\n // after it in the direction in which the user is dragging, or vice versa. We add it to the\n // offset in order to push the element to where it will be when it's inline and is influenced\n // by the `margin` of its siblings.\n if (delta === -1) {\n siblingOffset -= immediateSibling.clientRect[start] - currentPosition[end];\n }\n else {\n siblingOffset += currentPosition[start] - immediateSibling.clientRect[end];\n }\n }\n return siblingOffset;\n }\n /**\n * Gets the offset in pixels by which the item that is being dragged should be moved.\n * @param currentPosition Current position of the item.\n * @param newPosition Position of the item where the current item should be moved.\n * @param delta Direction in which the user is moving.\n */\n _getItemOffsetPx(currentPosition, newPosition, delta) {\n const isHorizontal = this._orientation === 'horizontal';\n let itemOffset = isHorizontal ? newPosition.left - currentPosition.left :\n newPosition.top - currentPosition.top;\n // Account for differences in the item width/height.\n if (delta === -1) {\n itemOffset += isHorizontal ? newPosition.width - currentPosition.width :\n newPosition.height - currentPosition.height;\n }\n return itemOffset;\n }\n /**\n * Checks if pointer is entering in the first position\n * @param pointerX Position of the user's pointer along the X axis.\n * @param pointerY Position of the user's pointer along the Y axis.\n */\n _shouldEnterAsFirstChild(pointerX, pointerY) {\n if (!this._activeDraggables.length) {\n return false;\n }\n const itemPositions = this._itemPositions;\n const isHorizontal = this._orientation === 'horizontal';\n // `itemPositions` are sorted by position while `activeDraggables` are sorted by child index\n // check if container is using some sort of \"reverse\" ordering (eg: flex-direction: row-reverse)\n const reversed = itemPositions[0].drag !== this._activeDraggables[0];\n if (reversed) {\n const lastItemRect = itemPositions[itemPositions.length - 1].clientRect;\n return isHorizontal ? pointerX >= lastItemRect.right : pointerY >= lastItemRect.bottom;\n }\n else {\n const firstItemRect = itemPositions[0].clientRect;\n return isHorizontal ? pointerX <= firstItemRect.left : pointerY <= firstItemRect.top;\n }\n }\n /**\n * Gets the index of an item in the drop container, based on the position of the user's pointer.\n * @param item Item that is being sorted.\n * @param pointerX Position of the user's pointer along the X axis.\n * @param pointerY Position of the user's pointer along the Y axis.\n * @param delta Direction in which the user is moving their pointer.\n */\n _getItemIndexFromPointerPosition(item, pointerX, pointerY, delta) {\n const isHorizontal = this._orientation === 'horizontal';\n const index = findIndex(this._itemPositions, ({ drag, clientRect }, _, array) => {\n if (drag === item) {\n // If there's only one item left in the container, it must be\n // the dragged item itself so we use it as a reference.\n return array.length < 2;\n }\n if (delta) {\n const direction = isHorizontal ? delta.x : delta.y;\n // If the user is still hovering over the same item as last time, their cursor hasn't left\n // the item after we made the swap, and they didn't change the direction in which they're\n // dragging, we don't consider it a direction swap.\n if (drag === this._previousSwap.drag && this._previousSwap.overlaps &&\n direction === this._previousSwap.delta) {\n return false;\n }\n }\n return isHorizontal ?\n // Round these down since most browsers report client rects with\n // sub-pixel precision, whereas the pointer coordinates are rounded to pixels.\n pointerX >= Math.floor(clientRect.left) && pointerX < Math.floor(clientRect.right) :\n pointerY >= Math.floor(clientRect.top) && pointerY < Math.floor(clientRect.bottom);\n });\n return (index === -1 || !this.sortPredicate(index, item, this)) ? -1 : index;\n }\n /** Caches the current items in the list and their positions. */\n _cacheItems() {\n this._activeDraggables = this._draggables.slice();\n this._cacheItemPositions();\n this._cacheParentPositions();\n }\n /**\n * Checks whether the user's pointer is positioned over the container.\n * @param x Pointer position along the X axis.\n * @param y Pointer position along the Y axis.\n */\n _isOverContainer(x, y) {\n return this._clientRect != null && isInsideClientRect(this._clientRect, x, y);\n }\n /**\n * Figures out whether an item should be moved into a sibling\n * drop container, based on its current position.\n * @param item Drag item that is being moved.\n * @param x Position of the item along the X axis.\n * @param y Position of the item along the Y axis.\n */\n _getSiblingContainerFromPosition(item, x, y) {\n return this._siblings.find(sibling => sibling._canReceive(item, x, y));\n }\n /**\n * Checks whether the drop list can receive the passed-in item.\n * @param item Item that is being dragged into the list.\n * @param x Position of the item along the X axis.\n * @param y Position of the item along the Y axis.\n */\n _canReceive(item, x, y) {\n if (!this._clientRect || !isInsideClientRect(this._clientRect, x, y) ||\n !this.enterPredicate(item, this)) {\n return false;\n }\n const elementFromPoint = this._getShadowRoot().elementFromPoint(x, y);\n // If there's no element at the pointer position, then\n // the client rect is probably scrolled out of the view.\n if (!elementFromPoint) {\n return false;\n }\n const nativeElement = coerceElement(this.element);\n // The `ClientRect`, that we're using to find the container over which the user is\n // hovering, doesn't give us any information on whether the element has been scrolled\n // out of the view or whether it's overlapping with other containers. This means that\n // we could end up transferring the item into a container that's invisible or is positioned\n // below another one. We use the result from `elementFromPoint` to get the top-most element\n // at the pointer position and to find whether it's one of the intersecting drop containers.\n return elementFromPoint === nativeElement || nativeElement.contains(elementFromPoint);\n }\n /**\n * Called by one of the connected drop lists when a dragging sequence has started.\n * @param sibling Sibling in which dragging has started.\n */\n _startReceiving(sibling, items) {\n const activeSiblings = this._activeSiblings;\n if (!activeSiblings.has(sibling) && items.every(item => {\n // Note that we have to add an exception to the `enterPredicate` for items that started off\n // in this drop list. The drag ref has logic that allows an item to return to its initial\n // container, if it has left the initial container and none of the connected containers\n // allow it to enter. See `DragRef._updateActiveDropContainer` for more context.\n return this.enterPredicate(item, this) || this._draggables.indexOf(item) > -1;\n })) {\n activeSiblings.add(sibling);\n this._cacheParentPositions();\n this._listenToScrollEvents();\n }\n }\n /**\n * Called by a connected drop list when dragging has stopped.\n * @param sibling Sibling whose dragging has stopped.\n */\n _stopReceiving(sibling) {\n this._activeSiblings.delete(sibling);\n this._viewportScrollSubscription.unsubscribe();\n }\n /**\n * Starts listening to scroll events on the viewport.\n * Used for updating the internal state of the list.\n */\n _listenToScrollEvents() {\n this._viewportScrollSubscription = this._dragDropRegistry\n .scrolled(this._getShadowRoot())\n .subscribe(event => {\n if (this.isDragging()) {\n const scrollDifference = this._parentPositions.handleScroll(event);\n if (scrollDifference) {\n // Since we know the amount that the user has scrolled we can shift all of the\n // client rectangles ourselves. This is cheaper than re-measuring everything and\n // we can avoid inconsistent behavior where we might be measuring the element before\n // its position has changed.\n this._itemPositions.forEach(({ clientRect }) => {\n adjustClientRect(clientRect, scrollDifference.top, scrollDifference.left);\n });\n // We need two loops for this, because we want all of the cached\n // positions to be up-to-date before we re-sort the item.\n this._itemPositions.forEach(({ drag }) => {\n if (this._dragDropRegistry.isDragging(drag)) {\n // We need to re-sort the item manually, because the pointer move\n // events won't be dispatched while the user is scrolling.\n drag._sortFromLastPointerPosition();\n }\n });\n }\n }\n else if (this.isReceiving()) {\n this._cacheParentPositions();\n }\n });\n }\n /**\n * Lazily resolves and returns the shadow root of the element. We do this in a function, rather\n * than saving it in property directly on init, because we want to resolve it as late as possible\n * in order to ensure that the element has been moved into the shadow DOM. Doing it inside the\n * constructor might be too early if the element is inside of something like `ngFor` or `ngIf`.\n */\n _getShadowRoot() {\n if (!this._cachedShadowRoot) {\n const shadowRoot = _getShadowRoot(coerceElement(this.element));\n this._cachedShadowRoot = shadowRoot || this._document;\n }\n return this._cachedShadowRoot;\n }\n /** Notifies any siblings that may potentially receive the item. */\n _notifyReceivingSiblings() {\n const draggedItems = this._activeDraggables.filter(item => item.isDragging());\n this._siblings.forEach(sibling => sibling._startReceiving(this, draggedItems));\n }\n}\n/**\n * Finds the index of an item that matches a predicate function. Used as an equivalent\n * of `Array.prototype.findIndex` which isn't part of the standard Google typings.\n * @param array Array in which to look for matches.\n * @param predicate Function used to determine whether an item is a match.\n */\nfunction findIndex(array, predicate) {\n for (let i = 0; i < array.length; i++) {\n if (predicate(array[i], i, array)) {\n return i;\n }\n }\n return -1;\n}\n/**\n * Increments the vertical scroll position of a node.\n * @param node Node whose scroll position should change.\n * @param amount Amount of pixels that the `node` should be scrolled.\n */\nfunction incrementVerticalScroll(node, amount) {\n if (node === window) {\n node.scrollBy(0, amount);\n }\n else {\n // Ideally we could use `Element.scrollBy` here as well, but IE and Edge don't support it.\n node.scrollTop += amount;\n }\n}\n/**\n * Increments the horizontal scroll position of a node.\n * @param node Node whose scroll position should change.\n * @param amount Amount of pixels that the `node` should be scrolled.\n */\nfunction incrementHorizontalScroll(node, amount) {\n if (node === window) {\n node.scrollBy(amount, 0);\n }\n else {\n // Ideally we could use `Element.scrollBy` here as well, but IE and Edge don't support it.\n node.scrollLeft += amount;\n }\n}\n/**\n * Gets whether the vertical auto-scroll direction of a node.\n * @param clientRect Dimensions of the node.\n * @param pointerY Position of the user's pointer along the y axis.\n */\nfunction getVerticalScrollDirection(clientRect, pointerY) {\n const { top, bottom, height } = clientRect;\n const yThreshold = height * SCROLL_PROXIMITY_THRESHOLD;\n if (pointerY >= top - yThreshold && pointerY <= top + yThreshold) {\n return 1 /* UP */;\n }\n else if (pointerY >= bottom - yThreshold && pointerY <= bottom + yThreshold) {\n return 2 /* DOWN */;\n }\n return 0 /* NONE */;\n}\n/**\n * Gets whether the horizontal auto-scroll direction of a node.\n * @param clientRect Dimensions of the node.\n * @param pointerX Position of the user's pointer along the x axis.\n */\nfunction getHorizontalScrollDirection(clientRect, pointerX) {\n const { left, right, width } = clientRect;\n const xThreshold = width * SCROLL_PROXIMITY_THRESHOLD;\n if (pointerX >= left - xThreshold && pointerX <= left + xThreshold) {\n return 1 /* LEFT */;\n }\n else if (pointerX >= right - xThreshold && pointerX <= right + xThreshold) {\n return 2 /* RIGHT */;\n }\n return 0 /* NONE */;\n}\n/**\n * Gets the directions in which an element node should be scrolled,\n * assuming that the user's pointer is already within it scrollable region.\n * @param element Element for which we should calculate the scroll direction.\n * @param clientRect Bounding client rectangle of the element.\n * @param pointerX Position of the user's pointer along the x axis.\n * @param pointerY Position of the user's pointer along the y axis.\n */\nfunction getElementScrollDirections(element, clientRect, pointerX, pointerY) {\n const computedVertical = getVerticalScrollDirection(clientRect, pointerY);\n const computedHorizontal = getHorizontalScrollDirection(clientRect, pointerX);\n let verticalScrollDirection = 0 /* NONE */;\n let horizontalScrollDirection = 0 /* NONE */;\n // Note that we here we do some extra checks for whether the element is actually scrollable in\n // a certain direction and we only assign the scroll direction if it is. We do this so that we\n // can allow other elements to be scrolled, if the current element can't be scrolled anymore.\n // This allows us to handle cases where the scroll regions of two scrollable elements overlap.\n if (computedVertical) {\n const scrollTop = element.scrollTop;\n if (computedVertical === 1 /* UP */) {\n if (scrollTop > 0) {\n verticalScrollDirection = 1 /* UP */;\n }\n }\n else if (element.scrollHeight - scrollTop > element.clientHeight) {\n verticalScrollDirection = 2 /* DOWN */;\n }\n }\n if (computedHorizontal) {\n const scrollLeft = element.scrollLeft;\n if (computedHorizontal === 1 /* LEFT */) {\n if (scrollLeft > 0) {\n horizontalScrollDirection = 1 /* LEFT */;\n }\n }\n else if (element.scrollWidth - scrollLeft > element.clientWidth) {\n horizontalScrollDirection = 2 /* RIGHT */;\n }\n }\n return [verticalScrollDirection, horizontalScrollDirection];\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Event options that can be used to bind an active, capturing event. */\nconst activeCapturingEventOptions = normalizePassiveListenerOptions({\n passive: false,\n capture: true\n});\n/**\n * Service that keeps track of all the drag item and drop container\n * instances, and manages global event listeners on the `document`.\n * @docs-private\n */\n// Note: this class is generic, rather than referencing CdkDrag and CdkDropList directly, in order\n// to avoid circular imports. If we were to reference them here, importing the registry into the\n// classes that are registering themselves will introduce a circular import.\nclass DragDropRegistry {\n constructor(_ngZone, _document) {\n this._ngZone = _ngZone;\n /** Registered drop container instances. */\n this._dropInstances = new Set();\n /** Registered drag item instances. */\n this._dragInstances = new Set();\n /** Drag item instances that are currently being dragged. */\n this._activeDragInstances = [];\n /** Keeps track of the event listeners that we've bound to the `document`. */\n this._globalListeners = new Map();\n /**\n * Predicate function to check if an item is being dragged. Moved out into a property,\n * because it'll be called a lot and we don't want to create a new function every time.\n */\n this._draggingPredicate = (item) => item.isDragging();\n /**\n * Emits the `touchmove` or `mousemove` events that are dispatched\n * while the user is dragging a drag item instance.\n */\n this.pointerMove = new Subject();\n /**\n * Emits the `touchend` or `mouseup` events that are dispatched\n * while the user is dragging a drag item instance.\n */\n this.pointerUp = new Subject();\n /**\n * Emits when the viewport has been scrolled while the user is dragging an item.\n * @deprecated To be turned into a private member. Use the `scrolled` method instead.\n * @breaking-change 13.0.0\n */\n this.scroll = new Subject();\n /**\n * Event listener that will prevent the default browser action while the user is dragging.\n * @param event Event whose default action should be prevented.\n */\n this._preventDefaultWhileDragging = (event) => {\n if (this._activeDragInstances.length > 0) {\n event.preventDefault();\n }\n };\n /** Event listener for `touchmove` that is bound even if no dragging is happening. */\n this._persistentTouchmoveListener = (event) => {\n if (this._activeDragInstances.length > 0) {\n // Note that we only want to prevent the default action after dragging has actually started.\n // Usually this is the same time at which the item is added to the `_activeDragInstances`,\n // but it could be pushed back if the user has set up a drag delay or threshold.\n if (this._activeDragInstances.some(this._draggingPredicate)) {\n event.preventDefault();\n }\n this.pointerMove.next(event);\n }\n };\n this._document = _document;\n }\n /** Adds a drop container to the registry. */\n registerDropContainer(drop) {\n if (!this._dropInstances.has(drop)) {\n this._dropInstances.add(drop);\n }\n }\n /** Adds a drag item instance to the registry. */\n registerDragItem(drag) {\n this._dragInstances.add(drag);\n // The `touchmove` event gets bound once, ahead of time, because WebKit\n // won't preventDefault on a dynamically-added `touchmove` listener.\n // See https://bugs.webkit.org/show_bug.cgi?id=184250.\n if (this._dragInstances.size === 1) {\n this._ngZone.runOutsideAngular(() => {\n // The event handler has to be explicitly active,\n // because newer browsers make it passive by default.\n this._document.addEventListener('touchmove', this._persistentTouchmoveListener, activeCapturingEventOptions);\n });\n }\n }\n /** Removes a drop container from the registry. */\n removeDropContainer(drop) {\n this._dropInstances.delete(drop);\n }\n /** Removes a drag item instance from the registry. */\n removeDragItem(drag) {\n this._dragInstances.delete(drag);\n this.stopDragging(drag);\n if (this._dragInstances.size === 0) {\n this._document.removeEventListener('touchmove', this._persistentTouchmoveListener, activeCapturingEventOptions);\n }\n }\n /**\n * Starts the dragging sequence for a drag instance.\n * @param drag Drag instance which is being dragged.\n * @param event Event that initiated the dragging.\n */\n startDragging(drag, event) {\n // Do not process the same drag twice to avoid memory leaks and redundant listeners\n if (this._activeDragInstances.indexOf(drag) > -1) {\n return;\n }\n this._activeDragInstances.push(drag);\n if (this._activeDragInstances.length === 1) {\n const isTouchEvent = event.type.startsWith('touch');\n // We explicitly bind __active__ listeners here, because newer browsers will default to\n // passive ones for `mousemove` and `touchmove`. The events need to be active, because we\n // use `preventDefault` to prevent the page from scrolling while the user is dragging.\n this._globalListeners\n .set(isTouchEvent ? 'touchend' : 'mouseup', {\n handler: (e) => this.pointerUp.next(e),\n options: true\n })\n .set('scroll', {\n handler: (e) => this.scroll.next(e),\n // Use capturing so that we pick up scroll changes in any scrollable nodes that aren't\n // the document. See https://github.com/angular/components/issues/17144.\n options: true\n })\n // Preventing the default action on `mousemove` isn't enough to disable text selection\n // on Safari so we need to prevent the selection event as well. Alternatively this can\n // be done by setting `user-select: none` on the `body`, however it has causes a style\n // recalculation which can be expensive on pages with a lot of elements.\n .set('selectstart', {\n handler: this._preventDefaultWhileDragging,\n options: activeCapturingEventOptions\n });\n // We don't have to bind a move event for touch drag sequences, because\n // we already have a persistent global one bound from `registerDragItem`.\n if (!isTouchEvent) {\n this._globalListeners.set('mousemove', {\n handler: (e) => this.pointerMove.next(e),\n options: activeCapturingEventOptions\n });\n }\n this._ngZone.runOutsideAngular(() => {\n this._globalListeners.forEach((config, name) => {\n this._document.addEventListener(name, config.handler, config.options);\n });\n });\n }\n }\n /** Stops dragging a drag item instance. */\n stopDragging(drag) {\n const index = this._activeDragInstances.indexOf(drag);\n if (index > -1) {\n this._activeDragInstances.splice(index, 1);\n if (this._activeDragInstances.length === 0) {\n this._clearGlobalListeners();\n }\n }\n }\n /** Gets whether a drag item instance is currently being dragged. */\n isDragging(drag) {\n return this._activeDragInstances.indexOf(drag) > -1;\n }\n /**\n * Gets a stream that will emit when any element on the page is scrolled while an item is being\n * dragged.\n * @param shadowRoot Optional shadow root that the current dragging sequence started from.\n * Top-level listeners won't pick up events coming from the shadow DOM so this parameter can\n * be used to include an additional top-level listener at the shadow root level.\n */\n scrolled(shadowRoot) {\n const streams = [this.scroll];\n if (shadowRoot && shadowRoot !== this._document) {\n // Note that this is basically the same as `fromEvent` from rjxs, but we do it ourselves,\n // because we want to guarantee that the event is bound outside of the `NgZone`. With\n // `fromEvent` it'll only happen if the subscription is outside the `NgZone`.\n streams.push(new Observable((observer) => {\n return this._ngZone.runOutsideAngular(() => {\n const eventOptions = true;\n const callback = (event) => {\n if (this._activeDragInstances.length) {\n observer.next(event);\n }\n };\n shadowRoot.addEventListener('scroll', callback, eventOptions);\n return () => {\n shadowRoot.removeEventListener('scroll', callback, eventOptions);\n };\n });\n }));\n }\n return merge(...streams);\n }\n ngOnDestroy() {\n this._dragInstances.forEach(instance => this.removeDragItem(instance));\n this._dropInstances.forEach(instance => this.removeDropContainer(instance));\n this._clearGlobalListeners();\n this.pointerMove.complete();\n this.pointerUp.complete();\n }\n /** Clears out the global event listeners from the `document`. */\n _clearGlobalListeners() {\n this._globalListeners.forEach((config, name) => {\n this._document.removeEventListener(name, config.handler, config.options);\n });\n this._globalListeners.clear();\n }\n}\nDragDropRegistry.ɵfac = function DragDropRegistry_Factory(t) { return new (t || DragDropRegistry)(ɵngcc0.ɵɵinject(ɵngcc0.NgZone), ɵngcc0.ɵɵinject(DOCUMENT)); };\nDragDropRegistry.ɵprov = i0.ɵɵdefineInjectable({ factory: function DragDropRegistry_Factory() { return new DragDropRegistry(i0.ɵɵinject(i0.NgZone), i0.ɵɵinject(i1.DOCUMENT)); }, token: DragDropRegistry, providedIn: \"root\" });\nDragDropRegistry.ctorParameters = () => [\n { type: NgZone },\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(DragDropRegistry, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: ɵngcc0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Default configuration to be used when creating a `DragRef`. */\nconst DEFAULT_CONFIG = {\n dragStartThreshold: 5,\n pointerDirectionChangeThreshold: 5\n};\n/**\n * Service that allows for drag-and-drop functionality to be attached to DOM elements.\n */\nclass DragDrop {\n constructor(_document, _ngZone, _viewportRuler, _dragDropRegistry) {\n this._document = _document;\n this._ngZone = _ngZone;\n this._viewportRuler = _viewportRuler;\n this._dragDropRegistry = _dragDropRegistry;\n }\n /**\n * Turns an element into a draggable item.\n * @param element Element to which to attach the dragging functionality.\n * @param config Object used to configure the dragging behavior.\n */\n createDrag(element, config = DEFAULT_CONFIG) {\n return new DragRef(element, config, this._document, this._ngZone, this._viewportRuler, this._dragDropRegistry);\n }\n /**\n * Turns an element into a drop list.\n * @param element Element to which to attach the drop list functionality.\n */\n createDropList(element) {\n return new DropListRef(element, this._dragDropRegistry, this._document, this._ngZone, this._viewportRuler);\n }\n}\nDragDrop.ɵfac = function DragDrop_Factory(t) { return new (t || DragDrop)(ɵngcc0.ɵɵinject(DOCUMENT), ɵngcc0.ɵɵinject(ɵngcc0.NgZone), ɵngcc0.ɵɵinject(ɵngcc1.ViewportRuler), ɵngcc0.ɵɵinject(DragDropRegistry)); };\nDragDrop.ɵprov = i0.ɵɵdefineInjectable({ factory: function DragDrop_Factory() { return new DragDrop(i0.ɵɵinject(i1.DOCUMENT), i0.ɵɵinject(i0.NgZone), i0.ɵɵinject(i2.ViewportRuler), i0.ɵɵinject(DragDropRegistry)); }, token: DragDrop, providedIn: \"root\" });\nDragDrop.ctorParameters = () => [\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] },\n { type: NgZone },\n { type: ViewportRuler },\n { type: DragDropRegistry }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(DragDrop, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: ɵngcc0.NgZone }, { type: ɵngcc1.ViewportRuler }, { type: DragDropRegistry }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injection token that can be used for a `CdkDrag` to provide itself as a parent to the\n * drag-specific child directive (`CdkDragHandle`, `CdkDragPreview` etc.). Used primarily\n * to avoid circular imports.\n * @docs-private\n */\nconst CDK_DRAG_PARENT = new InjectionToken('CDK_DRAG_PARENT');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injection token that can be used to reference instances of `CdkDropListGroup`. It serves as\n * alternative token to the actual `CdkDropListGroup` class which could cause unnecessary\n * retention of the class and its directive metadata.\n */\nconst CDK_DROP_LIST_GROUP = new InjectionToken('CdkDropListGroup');\n/**\n * Declaratively connects sibling `cdkDropList` instances together. All of the `cdkDropList`\n * elements that are placed inside a `cdkDropListGroup` will be connected to each other\n * automatically. Can be used as an alternative to the `cdkDropListConnectedTo` input\n * from `cdkDropList`.\n */\nclass CdkDropListGroup {\n constructor() {\n /** Drop lists registered inside the group. */\n this._items = new Set();\n this._disabled = false;\n }\n /** Whether starting a dragging sequence from inside this group is disabled. */\n get disabled() { return this._disabled; }\n set disabled(value) {\n this._disabled = coerceBooleanProperty(value);\n }\n ngOnDestroy() {\n this._items.clear();\n }\n}\nCdkDropListGroup.ɵfac = function CdkDropListGroup_Factory(t) { return new (t || CdkDropListGroup)(); };\nCdkDropListGroup.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkDropListGroup, selectors: [[\"\", \"cdkDropListGroup\", \"\"]], inputs: { disabled: [\"cdkDropListGroupDisabled\", \"disabled\"] }, exportAs: [\"cdkDropListGroup\"], features: [ɵngcc0.ɵɵProvidersFeature([{ provide: CDK_DROP_LIST_GROUP, useExisting: CdkDropListGroup }])] });\nCdkDropListGroup.propDecorators = {\n disabled: [{ type: Input, args: ['cdkDropListGroupDisabled',] }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkDropListGroup, [{\n type: Directive,\n args: [{\n selector: '[cdkDropListGroup]',\n exportAs: 'cdkDropListGroup',\n providers: [{ provide: CDK_DROP_LIST_GROUP, useExisting: CdkDropListGroup }]\n }]\n }], function () { return []; }, { disabled: [{\n type: Input,\n args: ['cdkDropListGroupDisabled']\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injection token that can be used to configure the\n * behavior of the drag&drop-related components.\n */\nconst CDK_DRAG_CONFIG = new InjectionToken('CDK_DRAG_CONFIG');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Asserts that a particular node is an element.\n * @param node Node to be checked.\n * @param name Name to attach to the error message.\n */\nfunction assertElementNode(node, name) {\n if (node.nodeType !== 1) {\n throw Error(`${name} must be attached to an element node. ` +\n `Currently attached to \"${node.nodeName}\".`);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Counter used to generate unique ids for drop zones. */\nlet _uniqueIdCounter = 0;\n/**\n * Injection token that can be used to reference instances of `CdkDropList`. It serves as\n * alternative token to the actual `CdkDropList` class which could cause unnecessary\n * retention of the class and its directive metadata.\n */\nconst CDK_DROP_LIST = new InjectionToken('CdkDropList');\nconst ɵ0 = undefined;\n/** Container that wraps a set of draggable items. */\nclass CdkDropList {\n constructor(\n /** Element that the drop list is attached to. */\n element, dragDrop, _changeDetectorRef, _scrollDispatcher, _dir, _group, config) {\n this.element = element;\n this._changeDetectorRef = _changeDetectorRef;\n this._scrollDispatcher = _scrollDispatcher;\n this._dir = _dir;\n this._group = _group;\n /** Emits when the list has been destroyed. */\n this._destroyed = new Subject();\n /**\n * Other draggable containers that this container is connected to and into which the\n * container's items can be transferred. Can either be references to other drop containers,\n * or their unique IDs.\n */\n this.connectedTo = [];\n /**\n * Unique ID for the drop zone. Can be used as a reference\n * in the `connectedTo` of another `CdkDropList`.\n */\n this.id = `cdk-drop-list-${_uniqueIdCounter++}`;\n /**\n * Function that is used to determine whether an item\n * is allowed to be moved into a drop container.\n */\n this.enterPredicate = () => true;\n /** Functions that is used to determine whether an item can be sorted into a particular index. */\n this.sortPredicate = () => true;\n /** Emits when the user drops an item inside the container. */\n this.dropped = new EventEmitter();\n /**\n * Emits when the user has moved a new drag item into this container.\n */\n this.entered = new EventEmitter();\n /**\n * Emits when the user removes an item from the container\n * by dragging it into another container.\n */\n this.exited = new EventEmitter();\n /** Emits as the user is swapping items while actively dragging. */\n this.sorted = new EventEmitter();\n /**\n * Keeps track of the items that are registered with this container. Historically we used to\n * do this with a `ContentChildren` query, however queries don't handle transplanted views very\n * well which means that we can't handle cases like dragging the headers of a `mat-table`\n * correctly. What we do instead is to have the items register themselves with the container\n * and then we sort them based on their position in the DOM.\n */\n this._unsortedItems = new Set();\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n assertElementNode(element.nativeElement, 'cdkDropList');\n }\n this._dropListRef = dragDrop.createDropList(element);\n this._dropListRef.data = this;\n if (config) {\n this._assignDefaults(config);\n }\n this._dropListRef.enterPredicate = (drag, drop) => {\n return this.enterPredicate(drag.data, drop.data);\n };\n this._dropListRef.sortPredicate =\n (index, drag, drop) => {\n return this.sortPredicate(index, drag.data, drop.data);\n };\n this._setupInputSyncSubscription(this._dropListRef);\n this._handleEvents(this._dropListRef);\n CdkDropList._dropLists.push(this);\n if (_group) {\n _group._items.add(this);\n }\n }\n /** Whether starting a dragging sequence from this container is disabled. */\n get disabled() {\n return this._disabled || (!!this._group && this._group.disabled);\n }\n set disabled(value) {\n // Usually we sync the directive and ref state right before dragging starts, in order to have\n // a single point of failure and to avoid having to use setters for everything. `disabled` is\n // a special case, because it can prevent the `beforeStarted` event from firing, which can lock\n // the user in a disabled state, so we also need to sync it as it's being set.\n this._dropListRef.disabled = this._disabled = coerceBooleanProperty(value);\n }\n /** Registers an items with the drop list. */\n addItem(item) {\n this._unsortedItems.add(item);\n if (this._dropListRef.isDragging()) {\n this._syncItemsWithRef();\n }\n }\n /** Removes an item from the drop list. */\n removeItem(item) {\n this._unsortedItems.delete(item);\n if (this._dropListRef.isDragging()) {\n this._syncItemsWithRef();\n }\n }\n /** Gets the registered items in the list, sorted by their position in the DOM. */\n getSortedItems() {\n return Array.from(this._unsortedItems).sort((a, b) => {\n const documentPosition = a._dragRef.getVisibleElement().compareDocumentPosition(b._dragRef.getVisibleElement());\n // `compareDocumentPosition` returns a bitmask so we have to use a bitwise operator.\n // https://developer.mozilla.org/en-US/docs/Web/API/Node/compareDocumentPosition\n // tslint:disable-next-line:no-bitwise\n return documentPosition & Node.DOCUMENT_POSITION_FOLLOWING ? -1 : 1;\n });\n }\n ngOnDestroy() {\n const index = CdkDropList._dropLists.indexOf(this);\n if (index > -1) {\n CdkDropList._dropLists.splice(index, 1);\n }\n if (this._group) {\n this._group._items.delete(this);\n }\n this._unsortedItems.clear();\n this._dropListRef.dispose();\n this._destroyed.next();\n this._destroyed.complete();\n }\n /** Syncs the inputs of the CdkDropList with the options of the underlying DropListRef. */\n _setupInputSyncSubscription(ref) {\n if (this._dir) {\n this._dir.change\n .pipe(startWith(this._dir.value), takeUntil(this._destroyed))\n .subscribe(value => ref.withDirection(value));\n }\n ref.beforeStarted.subscribe(() => {\n const siblings = coerceArray(this.connectedTo).map(drop => {\n if (typeof drop === 'string') {\n const correspondingDropList = CdkDropList._dropLists.find(list => list.id === drop);\n if (!correspondingDropList && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n console.warn(`CdkDropList could not find connected drop list with id \"${drop}\"`);\n }\n return correspondingDropList;\n }\n return drop;\n });\n if (this._group) {\n this._group._items.forEach(drop => {\n if (siblings.indexOf(drop) === -1) {\n siblings.push(drop);\n }\n });\n }\n // Note that we resolve the scrollable parents here so that we delay the resolution\n // as long as possible, ensuring that the element is in its final place in the DOM.\n if (!this._scrollableParentsResolved) {\n const scrollableParents = this._scrollDispatcher\n .getAncestorScrollContainers(this.element)\n .map(scrollable => scrollable.getElementRef().nativeElement);\n this._dropListRef.withScrollableParents(scrollableParents);\n // Only do this once since it involves traversing the DOM and the parents\n // shouldn't be able to change without the drop list being destroyed.\n this._scrollableParentsResolved = true;\n }\n ref.disabled = this.disabled;\n ref.lockAxis = this.lockAxis;\n ref.sortingDisabled = coerceBooleanProperty(this.sortingDisabled);\n ref.autoScrollDisabled = coerceBooleanProperty(this.autoScrollDisabled);\n ref.autoScrollStep = coerceNumberProperty(this.autoScrollStep, 2);\n ref\n .connectedTo(siblings.filter(drop => drop && drop !== this).map(list => list._dropListRef))\n .withOrientation(this.orientation);\n });\n }\n /** Handles events from the underlying DropListRef. */\n _handleEvents(ref) {\n ref.beforeStarted.subscribe(() => {\n this._syncItemsWithRef();\n this._changeDetectorRef.markForCheck();\n });\n ref.entered.subscribe(event => {\n this.entered.emit({\n container: this,\n item: event.item.data,\n currentIndex: event.currentIndex\n });\n });\n ref.exited.subscribe(event => {\n this.exited.emit({\n container: this,\n item: event.item.data\n });\n this._changeDetectorRef.markForCheck();\n });\n ref.sorted.subscribe(event => {\n this.sorted.emit({\n previousIndex: event.previousIndex,\n currentIndex: event.currentIndex,\n container: this,\n item: event.item.data\n });\n });\n ref.dropped.subscribe(event => {\n this.dropped.emit({\n previousIndex: event.previousIndex,\n currentIndex: event.currentIndex,\n previousContainer: event.previousContainer.data,\n container: event.container.data,\n item: event.item.data,\n isPointerOverContainer: event.isPointerOverContainer,\n distance: event.distance,\n dropPoint: event.dropPoint\n });\n // Mark for check since all of these events run outside of change\n // detection and we're not guaranteed for something else to have triggered it.\n this._changeDetectorRef.markForCheck();\n });\n }\n /** Assigns the default input values based on a provided config object. */\n _assignDefaults(config) {\n const { lockAxis, draggingDisabled, sortingDisabled, listAutoScrollDisabled, listOrientation } = config;\n this.disabled = draggingDisabled == null ? false : draggingDisabled;\n this.sortingDisabled = sortingDisabled == null ? false : sortingDisabled;\n this.autoScrollDisabled = listAutoScrollDisabled == null ? false : listAutoScrollDisabled;\n this.orientation = listOrientation || 'vertical';\n if (lockAxis) {\n this.lockAxis = lockAxis;\n }\n }\n /** Syncs up the registered drag items with underlying drop list ref. */\n _syncItemsWithRef() {\n this._dropListRef.withItems(this.getSortedItems().map(item => item._dragRef));\n }\n}\nCdkDropList.ɵfac = function CdkDropList_Factory(t) { return new (t || CdkDropList)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(DragDrop), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ChangeDetectorRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc1.ScrollDispatcher), ɵngcc0.ɵɵdirectiveInject(ɵngcc2.Directionality, 8), ɵngcc0.ɵɵdirectiveInject(CDK_DROP_LIST_GROUP, 12), ɵngcc0.ɵɵdirectiveInject(CDK_DRAG_CONFIG, 8)); };\nCdkDropList.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkDropList, selectors: [[\"\", \"cdkDropList\", \"\"], [\"cdk-drop-list\"]], hostAttrs: [1, \"cdk-drop-list\"], hostVars: 7, hostBindings: function CdkDropList_HostBindings(rf, ctx) { if (rf & 2) {\n ɵngcc0.ɵɵattribute(\"id\", ctx.id);\n ɵngcc0.ɵɵclassProp(\"cdk-drop-list-disabled\", ctx.disabled)(\"cdk-drop-list-dragging\", ctx._dropListRef.isDragging())(\"cdk-drop-list-receiving\", ctx._dropListRef.isReceiving());\n } }, inputs: { connectedTo: [\"cdkDropListConnectedTo\", \"connectedTo\"], id: \"id\", enterPredicate: [\"cdkDropListEnterPredicate\", \"enterPredicate\"], sortPredicate: [\"cdkDropListSortPredicate\", \"sortPredicate\"], disabled: [\"cdkDropListDisabled\", \"disabled\"], sortingDisabled: [\"cdkDropListSortingDisabled\", \"sortingDisabled\"], autoScrollDisabled: [\"cdkDropListAutoScrollDisabled\", \"autoScrollDisabled\"], orientation: [\"cdkDropListOrientation\", \"orientation\"], lockAxis: [\"cdkDropListLockAxis\", \"lockAxis\"], data: [\"cdkDropListData\", \"data\"], autoScrollStep: [\"cdkDropListAutoScrollStep\", \"autoScrollStep\"] }, outputs: { dropped: \"cdkDropListDropped\", entered: \"cdkDropListEntered\", exited: \"cdkDropListExited\", sorted: \"cdkDropListSorted\" }, exportAs: [\"cdkDropList\"], features: [ɵngcc0.ɵɵProvidersFeature([\n // Prevent child drop lists from picking up the same group as their parent.\n { provide: CDK_DROP_LIST_GROUP, useValue: ɵ0 },\n { provide: CDK_DROP_LIST, useExisting: CdkDropList },\n ])] });\n/** Keeps track of the drop lists that are currently on the page. */\nCdkDropList._dropLists = [];\nCdkDropList.ctorParameters = () => [\n { type: ElementRef },\n { type: DragDrop },\n { type: ChangeDetectorRef },\n { type: ScrollDispatcher },\n { type: Directionality, decorators: [{ type: Optional }] },\n { type: CdkDropListGroup, decorators: [{ type: Optional }, { type: Inject, args: [CDK_DROP_LIST_GROUP,] }, { type: SkipSelf }] },\n { type: undefined, decorators: [{ type: Optional }, { type: Inject, args: [CDK_DRAG_CONFIG,] }] }\n];\nCdkDropList.propDecorators = {\n connectedTo: [{ type: Input, args: ['cdkDropListConnectedTo',] }],\n data: [{ type: Input, args: ['cdkDropListData',] }],\n orientation: [{ type: Input, args: ['cdkDropListOrientation',] }],\n id: [{ type: Input }],\n lockAxis: [{ type: Input, args: ['cdkDropListLockAxis',] }],\n disabled: [{ type: Input, args: ['cdkDropListDisabled',] }],\n sortingDisabled: [{ type: Input, args: ['cdkDropListSortingDisabled',] }],\n enterPredicate: [{ type: Input, args: ['cdkDropListEnterPredicate',] }],\n sortPredicate: [{ type: Input, args: ['cdkDropListSortPredicate',] }],\n autoScrollDisabled: [{ type: Input, args: ['cdkDropListAutoScrollDisabled',] }],\n autoScrollStep: [{ type: Input, args: ['cdkDropListAutoScrollStep',] }],\n dropped: [{ type: Output, args: ['cdkDropListDropped',] }],\n entered: [{ type: Output, args: ['cdkDropListEntered',] }],\n exited: [{ type: Output, args: ['cdkDropListExited',] }],\n sorted: [{ type: Output, args: ['cdkDropListSorted',] }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkDropList, [{\n type: Directive,\n args: [{\n selector: '[cdkDropList], cdk-drop-list',\n exportAs: 'cdkDropList',\n providers: [\n // Prevent child drop lists from picking up the same group as their parent.\n { provide: CDK_DROP_LIST_GROUP, useValue: ɵ0 },\n { provide: CDK_DROP_LIST, useExisting: CdkDropList },\n ],\n host: {\n 'class': 'cdk-drop-list',\n '[attr.id]': 'id',\n '[class.cdk-drop-list-disabled]': 'disabled',\n '[class.cdk-drop-list-dragging]': '_dropListRef.isDragging()',\n '[class.cdk-drop-list-receiving]': '_dropListRef.isReceiving()'\n }\n }]\n }], function () { return [{ type: ɵngcc0.ElementRef }, { type: DragDrop }, { type: ɵngcc0.ChangeDetectorRef }, { type: ɵngcc1.ScrollDispatcher }, { type: ɵngcc2.Directionality, decorators: [{\n type: Optional\n }] }, { type: CdkDropListGroup, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [CDK_DROP_LIST_GROUP]\n }, {\n type: SkipSelf\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [CDK_DRAG_CONFIG]\n }] }]; }, { connectedTo: [{\n type: Input,\n args: ['cdkDropListConnectedTo']\n }], id: [{\n type: Input\n }], enterPredicate: [{\n type: Input,\n args: ['cdkDropListEnterPredicate']\n }], sortPredicate: [{\n type: Input,\n args: ['cdkDropListSortPredicate']\n }], dropped: [{\n type: Output,\n args: ['cdkDropListDropped']\n }], entered: [{\n type: Output,\n args: ['cdkDropListEntered']\n }], exited: [{\n type: Output,\n args: ['cdkDropListExited']\n }], sorted: [{\n type: Output,\n args: ['cdkDropListSorted']\n }], disabled: [{\n type: Input,\n args: ['cdkDropListDisabled']\n }], sortingDisabled: [{\n type: Input,\n args: ['cdkDropListSortingDisabled']\n }], autoScrollDisabled: [{\n type: Input,\n args: ['cdkDropListAutoScrollDisabled']\n }], orientation: [{\n type: Input,\n args: ['cdkDropListOrientation']\n }], lockAxis: [{\n type: Input,\n args: ['cdkDropListLockAxis']\n }], data: [{\n type: Input,\n args: ['cdkDropListData']\n }], autoScrollStep: [{\n type: Input,\n args: ['cdkDropListAutoScrollStep']\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injection token that can be used to reference instances of `CdkDragHandle`. It serves as\n * alternative token to the actual `CdkDragHandle` class which could cause unnecessary\n * retention of the class and its directive metadata.\n */\nconst CDK_DRAG_HANDLE = new InjectionToken('CdkDragHandle');\n/** Handle that can be used to drag a CdkDrag instance. */\nclass CdkDragHandle {\n constructor(element, parentDrag) {\n this.element = element;\n /** Emits when the state of the handle has changed. */\n this._stateChanges = new Subject();\n this._disabled = false;\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n assertElementNode(element.nativeElement, 'cdkDragHandle');\n }\n this._parentDrag = parentDrag;\n }\n /** Whether starting to drag through this handle is disabled. */\n get disabled() { return this._disabled; }\n set disabled(value) {\n this._disabled = coerceBooleanProperty(value);\n this._stateChanges.next(this);\n }\n ngOnDestroy() {\n this._stateChanges.complete();\n }\n}\nCdkDragHandle.ɵfac = function CdkDragHandle_Factory(t) { return new (t || CdkDragHandle)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(CDK_DRAG_PARENT, 12)); };\nCdkDragHandle.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkDragHandle, selectors: [[\"\", \"cdkDragHandle\", \"\"]], hostAttrs: [1, \"cdk-drag-handle\"], inputs: { disabled: [\"cdkDragHandleDisabled\", \"disabled\"] }, features: [ɵngcc0.ɵɵProvidersFeature([{ provide: CDK_DRAG_HANDLE, useExisting: CdkDragHandle }])] });\nCdkDragHandle.ctorParameters = () => [\n { type: ElementRef },\n { type: undefined, decorators: [{ type: Inject, args: [CDK_DRAG_PARENT,] }, { type: Optional }, { type: SkipSelf }] }\n];\nCdkDragHandle.propDecorators = {\n disabled: [{ type: Input, args: ['cdkDragHandleDisabled',] }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkDragHandle, [{\n type: Directive,\n args: [{\n selector: '[cdkDragHandle]',\n host: {\n 'class': 'cdk-drag-handle'\n },\n providers: [{ provide: CDK_DRAG_HANDLE, useExisting: CdkDragHandle }]\n }]\n }], function () { return [{ type: ɵngcc0.ElementRef }, { type: undefined, decorators: [{\n type: Inject,\n args: [CDK_DRAG_PARENT]\n }, {\n type: Optional\n }, {\n type: SkipSelf\n }] }]; }, { disabled: [{\n type: Input,\n args: ['cdkDragHandleDisabled']\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injection token that can be used to reference instances of `CdkDragPlaceholder`. It serves as\n * alternative token to the actual `CdkDragPlaceholder` class which could cause unnecessary\n * retention of the class and its directive metadata.\n */\nconst CDK_DRAG_PLACEHOLDER = new InjectionToken('CdkDragPlaceholder');\n/**\n * Element that will be used as a template for the placeholder of a CdkDrag when\n * it is being dragged. The placeholder is displayed in place of the element being dragged.\n */\nclass CdkDragPlaceholder {\n constructor(templateRef) {\n this.templateRef = templateRef;\n }\n}\nCdkDragPlaceholder.ɵfac = function CdkDragPlaceholder_Factory(t) { return new (t || CdkDragPlaceholder)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef)); };\nCdkDragPlaceholder.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkDragPlaceholder, selectors: [[\"ng-template\", \"cdkDragPlaceholder\", \"\"]], inputs: { data: \"data\" }, features: [ɵngcc0.ɵɵProvidersFeature([{ provide: CDK_DRAG_PLACEHOLDER, useExisting: CdkDragPlaceholder }])] });\nCdkDragPlaceholder.ctorParameters = () => [\n { type: TemplateRef }\n];\nCdkDragPlaceholder.propDecorators = {\n data: [{ type: Input }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkDragPlaceholder, [{\n type: Directive,\n args: [{\n selector: 'ng-template[cdkDragPlaceholder]',\n providers: [{ provide: CDK_DRAG_PLACEHOLDER, useExisting: CdkDragPlaceholder }]\n }]\n }], function () { return [{ type: ɵngcc0.TemplateRef }]; }, { data: [{\n type: Input\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injection token that can be used to reference instances of `CdkDragPreview`. It serves as\n * alternative token to the actual `CdkDragPreview` class which could cause unnecessary\n * retention of the class and its directive metadata.\n */\nconst CDK_DRAG_PREVIEW = new InjectionToken('CdkDragPreview');\n/**\n * Element that will be used as a template for the preview\n * of a CdkDrag when it is being dragged.\n */\nclass CdkDragPreview {\n constructor(templateRef) {\n this.templateRef = templateRef;\n this._matchSize = false;\n }\n /** Whether the preview should preserve the same size as the item that is being dragged. */\n get matchSize() { return this._matchSize; }\n set matchSize(value) { this._matchSize = coerceBooleanProperty(value); }\n}\nCdkDragPreview.ɵfac = function CdkDragPreview_Factory(t) { return new (t || CdkDragPreview)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef)); };\nCdkDragPreview.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkDragPreview, selectors: [[\"ng-template\", \"cdkDragPreview\", \"\"]], inputs: { matchSize: \"matchSize\", data: \"data\" }, features: [ɵngcc0.ɵɵProvidersFeature([{ provide: CDK_DRAG_PREVIEW, useExisting: CdkDragPreview }])] });\nCdkDragPreview.ctorParameters = () => [\n { type: TemplateRef }\n];\nCdkDragPreview.propDecorators = {\n data: [{ type: Input }],\n matchSize: [{ type: Input }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkDragPreview, [{\n type: Directive,\n args: [{\n selector: 'ng-template[cdkDragPreview]',\n providers: [{ provide: CDK_DRAG_PREVIEW, useExisting: CdkDragPreview }]\n }]\n }], function () { return [{ type: ɵngcc0.TemplateRef }]; }, { matchSize: [{\n type: Input\n }], data: [{\n type: Input\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst DRAG_HOST_CLASS = 'cdk-drag';\n/** Element that can be moved inside a CdkDropList container. */\nclass CdkDrag {\n constructor(\n /** Element that the draggable is attached to. */\n element, \n /** Droppable container that the draggable is a part of. */\n dropContainer, \n /**\n * @deprecated `_document` parameter no longer being used and will be removed.\n * @breaking-change 12.0.0\n */\n _document, _ngZone, _viewContainerRef, config, _dir, dragDrop, _changeDetectorRef, _selfHandle, _parentDrag) {\n this.element = element;\n this.dropContainer = dropContainer;\n this._ngZone = _ngZone;\n this._viewContainerRef = _viewContainerRef;\n this._dir = _dir;\n this._changeDetectorRef = _changeDetectorRef;\n this._selfHandle = _selfHandle;\n this._parentDrag = _parentDrag;\n this._destroyed = new Subject();\n /** Emits when the user starts dragging the item. */\n this.started = new EventEmitter();\n /** Emits when the user has released a drag item, before any animations have started. */\n this.released = new EventEmitter();\n /** Emits when the user stops dragging an item in the container. */\n this.ended = new EventEmitter();\n /** Emits when the user has moved the item into a new container. */\n this.entered = new EventEmitter();\n /** Emits when the user removes the item its container by dragging it into another container. */\n this.exited = new EventEmitter();\n /** Emits when the user drops the item inside a container. */\n this.dropped = new EventEmitter();\n /**\n * Emits as the user is dragging the item. Use with caution,\n * because this event will fire for every pixel that the user has dragged.\n */\n this.moved = new Observable((observer) => {\n const subscription = this._dragRef.moved.pipe(map(movedEvent => ({\n source: this,\n pointerPosition: movedEvent.pointerPosition,\n event: movedEvent.event,\n delta: movedEvent.delta,\n distance: movedEvent.distance\n }))).subscribe(observer);\n return () => {\n subscription.unsubscribe();\n };\n });\n this._dragRef = dragDrop.createDrag(element, {\n dragStartThreshold: config && config.dragStartThreshold != null ?\n config.dragStartThreshold : 5,\n pointerDirectionChangeThreshold: config && config.pointerDirectionChangeThreshold != null ?\n config.pointerDirectionChangeThreshold : 5,\n zIndex: config === null || config === void 0 ? void 0 : config.zIndex,\n });\n this._dragRef.data = this;\n // We have to keep track of the drag instances in order to be able to match an element to\n // a drag instance. We can't go through the global registry of `DragRef`, because the root\n // element could be different.\n CdkDrag._dragInstances.push(this);\n if (config) {\n this._assignDefaults(config);\n }\n // Note that usually the container is assigned when the drop list is picks up the item, but in\n // some cases (mainly transplanted views with OnPush, see #18341) we may end up in a situation\n // where there are no items on the first change detection pass, but the items get picked up as\n // soon as the user triggers another pass by dragging. This is a problem, because the item would\n // have to switch from standalone mode to drag mode in the middle of the dragging sequence which\n // is too late since the two modes save different kinds of information. We work around it by\n // assigning the drop container both from here and the list.\n if (dropContainer) {\n this._dragRef._withDropContainer(dropContainer._dropListRef);\n dropContainer.addItem(this);\n }\n this._syncInputs(this._dragRef);\n this._handleEvents(this._dragRef);\n }\n /** Whether starting to drag this element is disabled. */\n get disabled() {\n return this._disabled || (this.dropContainer && this.dropContainer.disabled);\n }\n set disabled(value) {\n this._disabled = coerceBooleanProperty(value);\n this._dragRef.disabled = this._disabled;\n }\n /**\n * Returns the element that is being used as a placeholder\n * while the current element is being dragged.\n */\n getPlaceholderElement() {\n return this._dragRef.getPlaceholderElement();\n }\n /** Returns the root draggable element. */\n getRootElement() {\n return this._dragRef.getRootElement();\n }\n /** Resets a standalone drag item to its initial position. */\n reset() {\n this._dragRef.reset();\n }\n /**\n * Gets the pixel coordinates of the draggable outside of a drop container.\n */\n getFreeDragPosition() {\n return this._dragRef.getFreeDragPosition();\n }\n ngAfterViewInit() {\n // We need to wait for the zone to stabilize, in order for the reference\n // element to be in the proper place in the DOM. This is mostly relevant\n // for draggable elements inside portals since they get stamped out in\n // their original DOM position and then they get transferred to the portal.\n this._ngZone.onStable\n .pipe(take(1), takeUntil(this._destroyed))\n .subscribe(() => {\n this._updateRootElement();\n // Listen for any newly-added handles.\n this._handles.changes.pipe(startWith(this._handles), \n // Sync the new handles with the DragRef.\n tap((handles) => {\n const childHandleElements = handles\n .filter(handle => handle._parentDrag === this)\n .map(handle => handle.element);\n // Usually handles are only allowed to be a descendant of the drag element, but if\n // the consumer defined a different drag root, we should allow the drag element\n // itself to be a handle too.\n if (this._selfHandle && this.rootElementSelector) {\n childHandleElements.push(this.element);\n }\n this._dragRef.withHandles(childHandleElements);\n }), \n // Listen if the state of any of the handles changes.\n switchMap((handles) => {\n return merge(...handles.map(item => {\n return item._stateChanges.pipe(startWith(item));\n }));\n }), takeUntil(this._destroyed)).subscribe(handleInstance => {\n // Enabled/disable the handle that changed in the DragRef.\n const dragRef = this._dragRef;\n const handle = handleInstance.element.nativeElement;\n handleInstance.disabled ? dragRef.disableHandle(handle) : dragRef.enableHandle(handle);\n });\n if (this.freeDragPosition) {\n this._dragRef.setFreeDragPosition(this.freeDragPosition);\n }\n });\n }\n ngOnChanges(changes) {\n const rootSelectorChange = changes['rootElementSelector'];\n const positionChange = changes['freeDragPosition'];\n // We don't have to react to the first change since it's being\n // handled in `ngAfterViewInit` where it needs to be deferred.\n if (rootSelectorChange && !rootSelectorChange.firstChange) {\n this._updateRootElement();\n }\n // Skip the first change since it's being handled in `ngAfterViewInit`.\n if (positionChange && !positionChange.firstChange && this.freeDragPosition) {\n this._dragRef.setFreeDragPosition(this.freeDragPosition);\n }\n }\n ngOnDestroy() {\n if (this.dropContainer) {\n this.dropContainer.removeItem(this);\n }\n const index = CdkDrag._dragInstances.indexOf(this);\n if (index > -1) {\n CdkDrag._dragInstances.splice(index, 1);\n }\n this._destroyed.next();\n this._destroyed.complete();\n this._dragRef.dispose();\n }\n /** Syncs the root element with the `DragRef`. */\n _updateRootElement() {\n const element = this.element.nativeElement;\n const rootElement = this.rootElementSelector ?\n getClosestMatchingAncestor(element, this.rootElementSelector) : element;\n if (rootElement && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n assertElementNode(rootElement, 'cdkDrag');\n }\n this._dragRef.withRootElement(rootElement || element);\n }\n /** Gets the boundary element, based on the `boundaryElement` value. */\n _getBoundaryElement() {\n const boundary = this.boundaryElement;\n if (!boundary) {\n return null;\n }\n if (typeof boundary === 'string') {\n return getClosestMatchingAncestor(this.element.nativeElement, boundary);\n }\n const element = coerceElement(boundary);\n if ((typeof ngDevMode === 'undefined' || ngDevMode) &&\n !element.contains(this.element.nativeElement)) {\n throw Error('Draggable element is not inside of the node passed into cdkDragBoundary.');\n }\n return element;\n }\n /** Syncs the inputs of the CdkDrag with the options of the underlying DragRef. */\n _syncInputs(ref) {\n ref.beforeStarted.subscribe(() => {\n if (!ref.isDragging()) {\n const dir = this._dir;\n const dragStartDelay = this.dragStartDelay;\n const placeholder = this._placeholderTemplate ? {\n template: this._placeholderTemplate.templateRef,\n context: this._placeholderTemplate.data,\n viewContainer: this._viewContainerRef\n } : null;\n const preview = this._previewTemplate ? {\n template: this._previewTemplate.templateRef,\n context: this._previewTemplate.data,\n matchSize: this._previewTemplate.matchSize,\n viewContainer: this._viewContainerRef\n } : null;\n ref.disabled = this.disabled;\n ref.lockAxis = this.lockAxis;\n ref.dragStartDelay = (typeof dragStartDelay === 'object' && dragStartDelay) ?\n dragStartDelay : coerceNumberProperty(dragStartDelay);\n ref.constrainPosition = this.constrainPosition;\n ref.previewClass = this.previewClass;\n ref\n .withBoundaryElement(this._getBoundaryElement())\n .withPlaceholderTemplate(placeholder)\n .withPreviewTemplate(preview)\n .withPreviewContainer(this.previewContainer || 'global');\n if (dir) {\n ref.withDirection(dir.value);\n }\n }\n });\n // This only needs to be resolved once.\n ref.beforeStarted.pipe(take(1)).subscribe(() => {\n var _a, _b;\n // If we managed to resolve a parent through DI, use it.\n if (this._parentDrag) {\n ref.withParent(this._parentDrag._dragRef);\n return;\n }\n // Otherwise fall back to resolving the parent by looking up the DOM. This can happen if\n // the item was projected into another item by something like `ngTemplateOutlet`.\n let parent = this.element.nativeElement.parentElement;\n while (parent) {\n // `classList` needs to be null checked, because IE doesn't have it on some elements.\n if ((_a = parent.classList) === null || _a === void 0 ? void 0 : _a.contains(DRAG_HOST_CLASS)) {\n ref.withParent(((_b = CdkDrag._dragInstances.find(drag => {\n return drag.element.nativeElement === parent;\n })) === null || _b === void 0 ? void 0 : _b._dragRef) || null);\n break;\n }\n parent = parent.parentElement;\n }\n });\n }\n /** Handles the events from the underlying `DragRef`. */\n _handleEvents(ref) {\n ref.started.subscribe(() => {\n this.started.emit({ source: this });\n // Since all of these events run outside of change detection,\n // we need to ensure that everything is marked correctly.\n this._changeDetectorRef.markForCheck();\n });\n ref.released.subscribe(() => {\n this.released.emit({ source: this });\n });\n ref.ended.subscribe(event => {\n this.ended.emit({\n source: this,\n distance: event.distance,\n dropPoint: event.dropPoint\n });\n // Since all of these events run outside of change detection,\n // we need to ensure that everything is marked correctly.\n this._changeDetectorRef.markForCheck();\n });\n ref.entered.subscribe(event => {\n this.entered.emit({\n container: event.container.data,\n item: this,\n currentIndex: event.currentIndex\n });\n });\n ref.exited.subscribe(event => {\n this.exited.emit({\n container: event.container.data,\n item: this\n });\n });\n ref.dropped.subscribe(event => {\n this.dropped.emit({\n previousIndex: event.previousIndex,\n currentIndex: event.currentIndex,\n previousContainer: event.previousContainer.data,\n container: event.container.data,\n isPointerOverContainer: event.isPointerOverContainer,\n item: this,\n distance: event.distance,\n dropPoint: event.dropPoint\n });\n });\n }\n /** Assigns the default input values based on a provided config object. */\n _assignDefaults(config) {\n const { lockAxis, dragStartDelay, constrainPosition, previewClass, boundaryElement, draggingDisabled, rootElementSelector, previewContainer } = config;\n this.disabled = draggingDisabled == null ? false : draggingDisabled;\n this.dragStartDelay = dragStartDelay || 0;\n if (lockAxis) {\n this.lockAxis = lockAxis;\n }\n if (constrainPosition) {\n this.constrainPosition = constrainPosition;\n }\n if (previewClass) {\n this.previewClass = previewClass;\n }\n if (boundaryElement) {\n this.boundaryElement = boundaryElement;\n }\n if (rootElementSelector) {\n this.rootElementSelector = rootElementSelector;\n }\n if (previewContainer) {\n this.previewContainer = previewContainer;\n }\n }\n}\nCdkDrag.ɵfac = function CdkDrag_Factory(t) { return new (t || CdkDrag)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(CDK_DROP_LIST, 12), ɵngcc0.ɵɵdirectiveInject(DOCUMENT), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.NgZone), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef), ɵngcc0.ɵɵdirectiveInject(CDK_DRAG_CONFIG, 8), ɵngcc0.ɵɵdirectiveInject(ɵngcc2.Directionality, 8), ɵngcc0.ɵɵdirectiveInject(DragDrop), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ChangeDetectorRef), ɵngcc0.ɵɵdirectiveInject(CDK_DRAG_HANDLE, 10), ɵngcc0.ɵɵdirectiveInject(CDK_DRAG_PARENT, 12)); };\nCdkDrag.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkDrag, selectors: [[\"\", \"cdkDrag\", \"\"]], contentQueries: function CdkDrag_ContentQueries(rf, ctx, dirIndex) { if (rf & 1) {\n ɵngcc0.ɵɵcontentQuery(dirIndex, CDK_DRAG_PREVIEW, 5);\n ɵngcc0.ɵɵcontentQuery(dirIndex, CDK_DRAG_PLACEHOLDER, 5);\n ɵngcc0.ɵɵcontentQuery(dirIndex, CDK_DRAG_HANDLE, 5);\n } if (rf & 2) {\n let _t;\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._previewTemplate = _t.first);\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._placeholderTemplate = _t.first);\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._handles = _t);\n } }, hostAttrs: [1, \"cdk-drag\"], hostVars: 4, hostBindings: function CdkDrag_HostBindings(rf, ctx) { if (rf & 2) {\n ɵngcc0.ɵɵclassProp(\"cdk-drag-disabled\", ctx.disabled)(\"cdk-drag-dragging\", ctx._dragRef.isDragging());\n } }, inputs: { disabled: [\"cdkDragDisabled\", \"disabled\"], dragStartDelay: [\"cdkDragStartDelay\", \"dragStartDelay\"], lockAxis: [\"cdkDragLockAxis\", \"lockAxis\"], constrainPosition: [\"cdkDragConstrainPosition\", \"constrainPosition\"], previewClass: [\"cdkDragPreviewClass\", \"previewClass\"], boundaryElement: [\"cdkDragBoundary\", \"boundaryElement\"], rootElementSelector: [\"cdkDragRootElement\", \"rootElementSelector\"], previewContainer: [\"cdkDragPreviewContainer\", \"previewContainer\"], data: [\"cdkDragData\", \"data\"], freeDragPosition: [\"cdkDragFreeDragPosition\", \"freeDragPosition\"] }, outputs: { started: \"cdkDragStarted\", released: \"cdkDragReleased\", ended: \"cdkDragEnded\", entered: \"cdkDragEntered\", exited: \"cdkDragExited\", dropped: \"cdkDragDropped\", moved: \"cdkDragMoved\" }, exportAs: [\"cdkDrag\"], features: [ɵngcc0.ɵɵProvidersFeature([{ provide: CDK_DRAG_PARENT, useExisting: CdkDrag }]), ɵngcc0.ɵɵNgOnChangesFeature] });\nCdkDrag._dragInstances = [];\nCdkDrag.ctorParameters = () => [\n { type: ElementRef },\n { type: undefined, decorators: [{ type: Inject, args: [CDK_DROP_LIST,] }, { type: Optional }, { type: SkipSelf }] },\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] },\n { type: NgZone },\n { type: ViewContainerRef },\n { type: undefined, decorators: [{ type: Optional }, { type: Inject, args: [CDK_DRAG_CONFIG,] }] },\n { type: Directionality, decorators: [{ type: Optional }] },\n { type: DragDrop },\n { type: ChangeDetectorRef },\n { type: CdkDragHandle, decorators: [{ type: Optional }, { type: Self }, { type: Inject, args: [CDK_DRAG_HANDLE,] }] },\n { type: CdkDrag, decorators: [{ type: Optional }, { type: SkipSelf }, { type: Inject, args: [CDK_DRAG_PARENT,] }] }\n];\nCdkDrag.propDecorators = {\n _handles: [{ type: ContentChildren, args: [CDK_DRAG_HANDLE, { descendants: true },] }],\n _previewTemplate: [{ type: ContentChild, args: [CDK_DRAG_PREVIEW,] }],\n _placeholderTemplate: [{ type: ContentChild, args: [CDK_DRAG_PLACEHOLDER,] }],\n data: [{ type: Input, args: ['cdkDragData',] }],\n lockAxis: [{ type: Input, args: ['cdkDragLockAxis',] }],\n rootElementSelector: [{ type: Input, args: ['cdkDragRootElement',] }],\n boundaryElement: [{ type: Input, args: ['cdkDragBoundary',] }],\n dragStartDelay: [{ type: Input, args: ['cdkDragStartDelay',] }],\n freeDragPosition: [{ type: Input, args: ['cdkDragFreeDragPosition',] }],\n disabled: [{ type: Input, args: ['cdkDragDisabled',] }],\n constrainPosition: [{ type: Input, args: ['cdkDragConstrainPosition',] }],\n previewClass: [{ type: Input, args: ['cdkDragPreviewClass',] }],\n previewContainer: [{ type: Input, args: ['cdkDragPreviewContainer',] }],\n started: [{ type: Output, args: ['cdkDragStarted',] }],\n released: [{ type: Output, args: ['cdkDragReleased',] }],\n ended: [{ type: Output, args: ['cdkDragEnded',] }],\n entered: [{ type: Output, args: ['cdkDragEntered',] }],\n exited: [{ type: Output, args: ['cdkDragExited',] }],\n dropped: [{ type: Output, args: ['cdkDragDropped',] }],\n moved: [{ type: Output, args: ['cdkDragMoved',] }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkDrag, [{\n type: Directive,\n args: [{\n selector: '[cdkDrag]',\n exportAs: 'cdkDrag',\n host: {\n 'class': DRAG_HOST_CLASS,\n '[class.cdk-drag-disabled]': 'disabled',\n '[class.cdk-drag-dragging]': '_dragRef.isDragging()'\n },\n providers: [{ provide: CDK_DRAG_PARENT, useExisting: CdkDrag }]\n }]\n }], function () { return [{ type: ɵngcc0.ElementRef }, { type: undefined, decorators: [{\n type: Inject,\n args: [CDK_DROP_LIST]\n }, {\n type: Optional\n }, {\n type: SkipSelf\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: ɵngcc0.NgZone }, { type: ɵngcc0.ViewContainerRef }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [CDK_DRAG_CONFIG]\n }] }, { type: ɵngcc2.Directionality, decorators: [{\n type: Optional\n }] }, { type: DragDrop }, { type: ɵngcc0.ChangeDetectorRef }, { type: CdkDragHandle, decorators: [{\n type: Optional\n }, {\n type: Self\n }, {\n type: Inject,\n args: [CDK_DRAG_HANDLE]\n }] }, { type: CdkDrag, decorators: [{\n type: Optional\n }, {\n type: SkipSelf\n }, {\n type: Inject,\n args: [CDK_DRAG_PARENT]\n }] }]; }, { started: [{\n type: Output,\n args: ['cdkDragStarted']\n }], released: [{\n type: Output,\n args: ['cdkDragReleased']\n }], ended: [{\n type: Output,\n args: ['cdkDragEnded']\n }], entered: [{\n type: Output,\n args: ['cdkDragEntered']\n }], exited: [{\n type: Output,\n args: ['cdkDragExited']\n }], dropped: [{\n type: Output,\n args: ['cdkDragDropped']\n }], moved: [{\n type: Output,\n args: ['cdkDragMoved']\n }], disabled: [{\n type: Input,\n args: ['cdkDragDisabled']\n }], dragStartDelay: [{\n type: Input,\n args: ['cdkDragStartDelay']\n }], lockAxis: [{\n type: Input,\n args: ['cdkDragLockAxis']\n }], constrainPosition: [{\n type: Input,\n args: ['cdkDragConstrainPosition']\n }], previewClass: [{\n type: Input,\n args: ['cdkDragPreviewClass']\n }], boundaryElement: [{\n type: Input,\n args: ['cdkDragBoundary']\n }], rootElementSelector: [{\n type: Input,\n args: ['cdkDragRootElement']\n }], previewContainer: [{\n type: Input,\n args: ['cdkDragPreviewContainer']\n }], _handles: [{\n type: ContentChildren,\n args: [CDK_DRAG_HANDLE, { descendants: true }]\n }], _previewTemplate: [{\n type: ContentChild,\n args: [CDK_DRAG_PREVIEW]\n }], _placeholderTemplate: [{\n type: ContentChild,\n args: [CDK_DRAG_PLACEHOLDER]\n }], data: [{\n type: Input,\n args: ['cdkDragData']\n }], freeDragPosition: [{\n type: Input,\n args: ['cdkDragFreeDragPosition']\n }] }); })();\n/** Gets the closest ancestor of an element that matches a selector. */\nfunction getClosestMatchingAncestor(element, selector) {\n let currentElement = element.parentElement;\n while (currentElement) {\n // IE doesn't support `matches` so we have to fall back to `msMatchesSelector`.\n if (currentElement.matches ? currentElement.matches(selector) :\n currentElement.msMatchesSelector(selector)) {\n return currentElement;\n }\n currentElement = currentElement.parentElement;\n }\n return null;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass DragDropModule {\n}\nDragDropModule.ɵfac = function DragDropModule_Factory(t) { return new (t || DragDropModule)(); };\nDragDropModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: DragDropModule });\nDragDropModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({ providers: [\n DragDrop,\n ], imports: [CdkScrollableModule] });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(DragDropModule, [{\n type: NgModule,\n args: [{\n declarations: [\n CdkDropList,\n CdkDropListGroup,\n CdkDrag,\n CdkDragHandle,\n CdkDragPreview,\n CdkDragPlaceholder,\n ],\n exports: [\n CdkScrollableModule,\n CdkDropList,\n CdkDropListGroup,\n CdkDrag,\n CdkDragHandle,\n CdkDragPreview,\n CdkDragPlaceholder,\n ],\n providers: [\n DragDrop,\n ]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(DragDropModule, { declarations: function () { return [CdkDropList, CdkDropListGroup, CdkDrag, CdkDragHandle, CdkDragPreview, CdkDragPlaceholder]; }, exports: function () { return [CdkScrollableModule, CdkDropList, CdkDropListGroup, CdkDrag, CdkDragHandle, CdkDragPreview, CdkDragPlaceholder]; } }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { CDK_DRAG_CONFIG, CDK_DRAG_HANDLE, CDK_DRAG_PARENT, CDK_DRAG_PLACEHOLDER, CDK_DRAG_PREVIEW, CDK_DROP_LIST, CDK_DROP_LIST_GROUP, CdkDrag, CdkDragHandle, CdkDragPlaceholder, CdkDragPreview, CdkDropList, CdkDropListGroup, DragDrop, DragDropModule, DragDropRegistry, DragRef, DropListRef, copyArrayItem, moveItemInArray, transferArrayItem };\n\n//# sourceMappingURL=drag-drop.js.map","/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst MAC_ENTER = 3;\nconst BACKSPACE = 8;\nconst TAB = 9;\nconst NUM_CENTER = 12;\nconst ENTER = 13;\nconst SHIFT = 16;\nconst CONTROL = 17;\nconst ALT = 18;\nconst PAUSE = 19;\nconst CAPS_LOCK = 20;\nconst ESCAPE = 27;\nconst SPACE = 32;\nconst PAGE_UP = 33;\nconst PAGE_DOWN = 34;\nconst END = 35;\nconst HOME = 36;\nconst LEFT_ARROW = 37;\nconst UP_ARROW = 38;\nconst RIGHT_ARROW = 39;\nconst DOWN_ARROW = 40;\nconst PLUS_SIGN = 43;\nconst PRINT_SCREEN = 44;\nconst INSERT = 45;\nconst DELETE = 46;\nconst ZERO = 48;\nconst ONE = 49;\nconst TWO = 50;\nconst THREE = 51;\nconst FOUR = 52;\nconst FIVE = 53;\nconst SIX = 54;\nconst SEVEN = 55;\nconst EIGHT = 56;\nconst NINE = 57;\nconst FF_SEMICOLON = 59; // Firefox (Gecko) fires this for semicolon instead of 186\nconst FF_EQUALS = 61; // Firefox (Gecko) fires this for equals instead of 187\nconst QUESTION_MARK = 63;\nconst AT_SIGN = 64;\nconst A = 65;\nconst B = 66;\nconst C = 67;\nconst D = 68;\nconst E = 69;\nconst F = 70;\nconst G = 71;\nconst H = 72;\nconst I = 73;\nconst J = 74;\nconst K = 75;\nconst L = 76;\nconst M = 77;\nconst N = 78;\nconst O = 79;\nconst P = 80;\nconst Q = 81;\nconst R = 82;\nconst S = 83;\nconst T = 84;\nconst U = 85;\nconst V = 86;\nconst W = 87;\nconst X = 88;\nconst Y = 89;\nconst Z = 90;\nconst META = 91; // WIN_KEY_LEFT\nconst MAC_WK_CMD_LEFT = 91;\nconst MAC_WK_CMD_RIGHT = 93;\nconst CONTEXT_MENU = 93;\nconst NUMPAD_ZERO = 96;\nconst NUMPAD_ONE = 97;\nconst NUMPAD_TWO = 98;\nconst NUMPAD_THREE = 99;\nconst NUMPAD_FOUR = 100;\nconst NUMPAD_FIVE = 101;\nconst NUMPAD_SIX = 102;\nconst NUMPAD_SEVEN = 103;\nconst NUMPAD_EIGHT = 104;\nconst NUMPAD_NINE = 105;\nconst NUMPAD_MULTIPLY = 106;\nconst NUMPAD_PLUS = 107;\nconst NUMPAD_MINUS = 109;\nconst NUMPAD_PERIOD = 110;\nconst NUMPAD_DIVIDE = 111;\nconst F1 = 112;\nconst F2 = 113;\nconst F3 = 114;\nconst F4 = 115;\nconst F5 = 116;\nconst F6 = 117;\nconst F7 = 118;\nconst F8 = 119;\nconst F9 = 120;\nconst F10 = 121;\nconst F11 = 122;\nconst F12 = 123;\nconst NUM_LOCK = 144;\nconst SCROLL_LOCK = 145;\nconst FIRST_MEDIA = 166;\nconst FF_MINUS = 173;\nconst MUTE = 173; // Firefox (Gecko) fires 181 for MUTE\nconst VOLUME_DOWN = 174; // Firefox (Gecko) fires 182 for VOLUME_DOWN\nconst VOLUME_UP = 175; // Firefox (Gecko) fires 183 for VOLUME_UP\nconst FF_MUTE = 181;\nconst FF_VOLUME_DOWN = 182;\nconst LAST_MEDIA = 183;\nconst FF_VOLUME_UP = 183;\nconst SEMICOLON = 186; // Firefox (Gecko) fires 59 for SEMICOLON\nconst EQUALS = 187; // Firefox (Gecko) fires 61 for EQUALS\nconst COMMA = 188;\nconst DASH = 189; // Firefox (Gecko) fires 173 for DASH/MINUS\nconst PERIOD = 190;\nconst SLASH = 191;\nconst APOSTROPHE = 192;\nconst TILDE = 192;\nconst OPEN_SQUARE_BRACKET = 219;\nconst BACKSLASH = 220;\nconst CLOSE_SQUARE_BRACKET = 221;\nconst SINGLE_QUOTE = 222;\nconst MAC_META = 224;\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Checks whether a modifier key is pressed.\n * @param event Event to be checked.\n */\nfunction hasModifierKey(event, ...modifiers) {\n if (modifiers.length) {\n return modifiers.some(modifier => event[modifier]);\n }\n return event.altKey || event.shiftKey || event.ctrlKey || event.metaKey;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { A, ALT, APOSTROPHE, AT_SIGN, B, BACKSLASH, BACKSPACE, C, CAPS_LOCK, CLOSE_SQUARE_BRACKET, COMMA, CONTEXT_MENU, CONTROL, D, DASH, DELETE, DOWN_ARROW, E, EIGHT, END, ENTER, EQUALS, ESCAPE, F, F1, F10, F11, F12, F2, F3, F4, F5, F6, F7, F8, F9, FF_EQUALS, FF_MINUS, FF_MUTE, FF_SEMICOLON, FF_VOLUME_DOWN, FF_VOLUME_UP, FIRST_MEDIA, FIVE, FOUR, G, H, HOME, I, INSERT, J, K, L, LAST_MEDIA, LEFT_ARROW, M, MAC_ENTER, MAC_META, MAC_WK_CMD_LEFT, MAC_WK_CMD_RIGHT, META, MUTE, N, NINE, NUMPAD_DIVIDE, NUMPAD_EIGHT, NUMPAD_FIVE, NUMPAD_FOUR, NUMPAD_MINUS, NUMPAD_MULTIPLY, NUMPAD_NINE, NUMPAD_ONE, NUMPAD_PERIOD, NUMPAD_PLUS, NUMPAD_SEVEN, NUMPAD_SIX, NUMPAD_THREE, NUMPAD_TWO, NUMPAD_ZERO, NUM_CENTER, NUM_LOCK, O, ONE, OPEN_SQUARE_BRACKET, P, PAGE_DOWN, PAGE_UP, PAUSE, PERIOD, PLUS_SIGN, PRINT_SCREEN, Q, QUESTION_MARK, R, RIGHT_ARROW, S, SCROLL_LOCK, SEMICOLON, SEVEN, SHIFT, SINGLE_QUOTE, SIX, SLASH, SPACE, T, TAB, THREE, TILDE, TWO, U, UP_ARROW, V, VOLUME_DOWN, VOLUME_UP, W, X, Y, Z, ZERO, hasModifierKey };\n\n//# sourceMappingURL=keycodes.js.map","import { coerceElement, coerceBooleanProperty, coerceNumberProperty } from '@angular/cdk/coercion';\nimport * as i0 from '@angular/core';\nimport { Injectable, EventEmitter, Directive, ElementRef, NgZone, Output, Input, NgModule } from '@angular/core';\nimport { Observable, Subject } from 'rxjs';\nimport { debounceTime } from 'rxjs/operators';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Factory that creates a new MutationObserver and allows us to stub it out in unit tests.\n * @docs-private\n */\nimport * as ɵngcc0 from '@angular/core';\nclass MutationObserverFactory {\n create(callback) {\n return typeof MutationObserver === 'undefined' ? null : new MutationObserver(callback);\n }\n}\nMutationObserverFactory.ɵfac = function MutationObserverFactory_Factory(t) { return new (t || MutationObserverFactory)(); };\nMutationObserverFactory.ɵprov = i0.ɵɵdefineInjectable({ factory: function MutationObserverFactory_Factory() { return new MutationObserverFactory(); }, token: MutationObserverFactory, providedIn: \"root\" });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(MutationObserverFactory, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], null, null); })();\n/** An injectable service that allows watching elements for changes to their content. */\nclass ContentObserver {\n constructor(_mutationObserverFactory) {\n this._mutationObserverFactory = _mutationObserverFactory;\n /** Keeps track of the existing MutationObservers so they can be reused. */\n this._observedElements = new Map();\n }\n ngOnDestroy() {\n this._observedElements.forEach((_, element) => this._cleanupObserver(element));\n }\n observe(elementOrRef) {\n const element = coerceElement(elementOrRef);\n return new Observable((observer) => {\n const stream = this._observeElement(element);\n const subscription = stream.subscribe(observer);\n return () => {\n subscription.unsubscribe();\n this._unobserveElement(element);\n };\n });\n }\n /**\n * Observes the given element by using the existing MutationObserver if available, or creating a\n * new one if not.\n */\n _observeElement(element) {\n if (!this._observedElements.has(element)) {\n const stream = new Subject();\n const observer = this._mutationObserverFactory.create(mutations => stream.next(mutations));\n if (observer) {\n observer.observe(element, {\n characterData: true,\n childList: true,\n subtree: true\n });\n }\n this._observedElements.set(element, { observer, stream, count: 1 });\n }\n else {\n this._observedElements.get(element).count++;\n }\n return this._observedElements.get(element).stream;\n }\n /**\n * Un-observes the given element and cleans up the underlying MutationObserver if nobody else is\n * observing this element.\n */\n _unobserveElement(element) {\n if (this._observedElements.has(element)) {\n this._observedElements.get(element).count--;\n if (!this._observedElements.get(element).count) {\n this._cleanupObserver(element);\n }\n }\n }\n /** Clean up the underlying MutationObserver for the specified element. */\n _cleanupObserver(element) {\n if (this._observedElements.has(element)) {\n const { observer, stream } = this._observedElements.get(element);\n if (observer) {\n observer.disconnect();\n }\n stream.complete();\n this._observedElements.delete(element);\n }\n }\n}\nContentObserver.ɵfac = function ContentObserver_Factory(t) { return new (t || ContentObserver)(ɵngcc0.ɵɵinject(MutationObserverFactory)); };\nContentObserver.ɵprov = i0.ɵɵdefineInjectable({ factory: function ContentObserver_Factory() { return new ContentObserver(i0.ɵɵinject(MutationObserverFactory)); }, token: ContentObserver, providedIn: \"root\" });\nContentObserver.ctorParameters = () => [\n { type: MutationObserverFactory }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(ContentObserver, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: MutationObserverFactory }]; }, null); })();\n/**\n * Directive that triggers a callback whenever the content of\n * its associated element has changed.\n */\nclass CdkObserveContent {\n constructor(_contentObserver, _elementRef, _ngZone) {\n this._contentObserver = _contentObserver;\n this._elementRef = _elementRef;\n this._ngZone = _ngZone;\n /** Event emitted for each change in the element's content. */\n this.event = new EventEmitter();\n this._disabled = false;\n this._currentSubscription = null;\n }\n /**\n * Whether observing content is disabled. This option can be used\n * to disconnect the underlying MutationObserver until it is needed.\n */\n get disabled() { return this._disabled; }\n set disabled(value) {\n this._disabled = coerceBooleanProperty(value);\n this._disabled ? this._unsubscribe() : this._subscribe();\n }\n /** Debounce interval for emitting the changes. */\n get debounce() { return this._debounce; }\n set debounce(value) {\n this._debounce = coerceNumberProperty(value);\n this._subscribe();\n }\n ngAfterContentInit() {\n if (!this._currentSubscription && !this.disabled) {\n this._subscribe();\n }\n }\n ngOnDestroy() {\n this._unsubscribe();\n }\n _subscribe() {\n this._unsubscribe();\n const stream = this._contentObserver.observe(this._elementRef);\n // TODO(mmalerba): We shouldn't be emitting on this @Output() outside the zone.\n // Consider brining it back inside the zone next time we're making breaking changes.\n // Bringing it back inside can cause things like infinite change detection loops and changed\n // after checked errors if people's code isn't handling it properly.\n this._ngZone.runOutsideAngular(() => {\n this._currentSubscription =\n (this.debounce ? stream.pipe(debounceTime(this.debounce)) : stream).subscribe(this.event);\n });\n }\n _unsubscribe() {\n var _a;\n (_a = this._currentSubscription) === null || _a === void 0 ? void 0 : _a.unsubscribe();\n }\n}\nCdkObserveContent.ɵfac = function CdkObserveContent_Factory(t) { return new (t || CdkObserveContent)(ɵngcc0.ɵɵdirectiveInject(ContentObserver), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.NgZone)); };\nCdkObserveContent.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkObserveContent, selectors: [[\"\", \"cdkObserveContent\", \"\"]], inputs: { disabled: [\"cdkObserveContentDisabled\", \"disabled\"], debounce: \"debounce\" }, outputs: { event: \"cdkObserveContent\" }, exportAs: [\"cdkObserveContent\"] });\nCdkObserveContent.ctorParameters = () => [\n { type: ContentObserver },\n { type: ElementRef },\n { type: NgZone }\n];\nCdkObserveContent.propDecorators = {\n event: [{ type: Output, args: ['cdkObserveContent',] }],\n disabled: [{ type: Input, args: ['cdkObserveContentDisabled',] }],\n debounce: [{ type: Input }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkObserveContent, [{\n type: Directive,\n args: [{\n selector: '[cdkObserveContent]',\n exportAs: 'cdkObserveContent'\n }]\n }], function () { return [{ type: ContentObserver }, { type: ɵngcc0.ElementRef }, { type: ɵngcc0.NgZone }]; }, { event: [{\n type: Output,\n args: ['cdkObserveContent']\n }], disabled: [{\n type: Input,\n args: ['cdkObserveContentDisabled']\n }], debounce: [{\n type: Input\n }] }); })();\nclass ObserversModule {\n}\nObserversModule.ɵfac = function ObserversModule_Factory(t) { return new (t || ObserversModule)(); };\nObserversModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: ObserversModule });\nObserversModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({ providers: [MutationObserverFactory] });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(ObserversModule, [{\n type: NgModule,\n args: [{\n exports: [CdkObserveContent],\n declarations: [CdkObserveContent],\n providers: [MutationObserverFactory]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(ObserversModule, { declarations: [CdkObserveContent], exports: [CdkObserveContent] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { CdkObserveContent, ContentObserver, MutationObserverFactory, ObserversModule };\n\n//# sourceMappingURL=observers.js.map","import * as i1 from '@angular/cdk/scrolling';\nimport { ScrollDispatcher, ViewportRuler, ScrollingModule } from '@angular/cdk/scrolling';\nimport * as ɵngcc0 from '@angular/core';\nimport * as ɵngcc1 from '@angular/cdk/scrolling';\nimport * as ɵngcc2 from '@angular/cdk/platform';\nimport * as ɵngcc3 from '@angular/cdk/bidi';\nimport * as ɵngcc4 from '@angular/common';\nexport { CdkScrollable, ScrollDispatcher, ViewportRuler } from '@angular/cdk/scrolling';\nimport * as i1$1 from '@angular/common';\nimport { DOCUMENT, Location } from '@angular/common';\nimport * as i0 from '@angular/core';\nimport { Injectable, NgZone, Inject, Optional, ElementRef, ApplicationRef, ComponentFactoryResolver, Injector, InjectionToken, Directive, EventEmitter, TemplateRef, ViewContainerRef, Input, Output, NgModule } from '@angular/core';\nimport { coerceCssPixelValue, coerceArray, coerceBooleanProperty } from '@angular/cdk/coercion';\nimport * as i2 from '@angular/cdk/platform';\nimport { supportsScrollBehavior, Platform } from '@angular/cdk/platform';\nimport { Directionality, BidiModule } from '@angular/cdk/bidi';\nimport { DomPortalOutlet, TemplatePortal, PortalModule } from '@angular/cdk/portal';\nimport { Subject, Subscription, merge } from 'rxjs';\nimport { take, takeUntil, takeWhile } from 'rxjs/operators';\nimport { ESCAPE, hasModifierKey } from '@angular/cdk/keycodes';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst scrollBehaviorSupported = supportsScrollBehavior();\n/**\n * Strategy that will prevent the user from scrolling while the overlay is visible.\n */\nclass BlockScrollStrategy {\n constructor(_viewportRuler, document) {\n this._viewportRuler = _viewportRuler;\n this._previousHTMLStyles = { top: '', left: '' };\n this._isEnabled = false;\n this._document = document;\n }\n /** Attaches this scroll strategy to an overlay. */\n attach() { }\n /** Blocks page-level scroll while the attached overlay is open. */\n enable() {\n if (this._canBeEnabled()) {\n const root = this._document.documentElement;\n this._previousScrollPosition = this._viewportRuler.getViewportScrollPosition();\n // Cache the previous inline styles in case the user had set them.\n this._previousHTMLStyles.left = root.style.left || '';\n this._previousHTMLStyles.top = root.style.top || '';\n // Note: we're using the `html` node, instead of the `body`, because the `body` may\n // have the user agent margin, whereas the `html` is guaranteed not to have one.\n root.style.left = coerceCssPixelValue(-this._previousScrollPosition.left);\n root.style.top = coerceCssPixelValue(-this._previousScrollPosition.top);\n root.classList.add('cdk-global-scrollblock');\n this._isEnabled = true;\n }\n }\n /** Unblocks page-level scroll while the attached overlay is open. */\n disable() {\n if (this._isEnabled) {\n const html = this._document.documentElement;\n const body = this._document.body;\n const htmlStyle = html.style;\n const bodyStyle = body.style;\n const previousHtmlScrollBehavior = htmlStyle.scrollBehavior || '';\n const previousBodyScrollBehavior = bodyStyle.scrollBehavior || '';\n this._isEnabled = false;\n htmlStyle.left = this._previousHTMLStyles.left;\n htmlStyle.top = this._previousHTMLStyles.top;\n html.classList.remove('cdk-global-scrollblock');\n // Disable user-defined smooth scrolling temporarily while we restore the scroll position.\n // See https://developer.mozilla.org/en-US/docs/Web/CSS/scroll-behavior\n // Note that we don't mutate the property if the browser doesn't support `scroll-behavior`,\n // because it can throw off feature detections in `supportsScrollBehavior` which\n // checks for `'scrollBehavior' in documentElement.style`.\n if (scrollBehaviorSupported) {\n htmlStyle.scrollBehavior = bodyStyle.scrollBehavior = 'auto';\n }\n window.scroll(this._previousScrollPosition.left, this._previousScrollPosition.top);\n if (scrollBehaviorSupported) {\n htmlStyle.scrollBehavior = previousHtmlScrollBehavior;\n bodyStyle.scrollBehavior = previousBodyScrollBehavior;\n }\n }\n }\n _canBeEnabled() {\n // Since the scroll strategies can't be singletons, we have to use a global CSS class\n // (`cdk-global-scrollblock`) to make sure that we don't try to disable global\n // scrolling multiple times.\n const html = this._document.documentElement;\n if (html.classList.contains('cdk-global-scrollblock') || this._isEnabled) {\n return false;\n }\n const body = this._document.body;\n const viewport = this._viewportRuler.getViewportSize();\n return body.scrollHeight > viewport.height || body.scrollWidth > viewport.width;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Returns an error to be thrown when attempting to attach an already-attached scroll strategy.\n */\nfunction getMatScrollStrategyAlreadyAttachedError() {\n return Error(`Scroll strategy has already been attached.`);\n}\n\n/**\n * Strategy that will close the overlay as soon as the user starts scrolling.\n */\nclass CloseScrollStrategy {\n constructor(_scrollDispatcher, _ngZone, _viewportRuler, _config) {\n this._scrollDispatcher = _scrollDispatcher;\n this._ngZone = _ngZone;\n this._viewportRuler = _viewportRuler;\n this._config = _config;\n this._scrollSubscription = null;\n /** Detaches the overlay ref and disables the scroll strategy. */\n this._detach = () => {\n this.disable();\n if (this._overlayRef.hasAttached()) {\n this._ngZone.run(() => this._overlayRef.detach());\n }\n };\n }\n /** Attaches this scroll strategy to an overlay. */\n attach(overlayRef) {\n if (this._overlayRef && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getMatScrollStrategyAlreadyAttachedError();\n }\n this._overlayRef = overlayRef;\n }\n /** Enables the closing of the attached overlay on scroll. */\n enable() {\n if (this._scrollSubscription) {\n return;\n }\n const stream = this._scrollDispatcher.scrolled(0);\n if (this._config && this._config.threshold && this._config.threshold > 1) {\n this._initialScrollPosition = this._viewportRuler.getViewportScrollPosition().top;\n this._scrollSubscription = stream.subscribe(() => {\n const scrollPosition = this._viewportRuler.getViewportScrollPosition().top;\n if (Math.abs(scrollPosition - this._initialScrollPosition) > this._config.threshold) {\n this._detach();\n }\n else {\n this._overlayRef.updatePosition();\n }\n });\n }\n else {\n this._scrollSubscription = stream.subscribe(this._detach);\n }\n }\n /** Disables the closing the attached overlay on scroll. */\n disable() {\n if (this._scrollSubscription) {\n this._scrollSubscription.unsubscribe();\n this._scrollSubscription = null;\n }\n }\n detach() {\n this.disable();\n this._overlayRef = null;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Scroll strategy that doesn't do anything. */\nclass NoopScrollStrategy {\n /** Does nothing, as this scroll strategy is a no-op. */\n enable() { }\n /** Does nothing, as this scroll strategy is a no-op. */\n disable() { }\n /** Does nothing, as this scroll strategy is a no-op. */\n attach() { }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// TODO(jelbourn): move this to live with the rest of the scrolling code\n// TODO(jelbourn): someday replace this with IntersectionObservers\n/**\n * Gets whether an element is scrolled outside of view by any of its parent scrolling containers.\n * @param element Dimensions of the element (from getBoundingClientRect)\n * @param scrollContainers Dimensions of element's scrolling containers (from getBoundingClientRect)\n * @returns Whether the element is scrolled out of view\n * @docs-private\n */\nfunction isElementScrolledOutsideView(element, scrollContainers) {\n return scrollContainers.some(containerBounds => {\n const outsideAbove = element.bottom < containerBounds.top;\n const outsideBelow = element.top > containerBounds.bottom;\n const outsideLeft = element.right < containerBounds.left;\n const outsideRight = element.left > containerBounds.right;\n return outsideAbove || outsideBelow || outsideLeft || outsideRight;\n });\n}\n/**\n * Gets whether an element is clipped by any of its scrolling containers.\n * @param element Dimensions of the element (from getBoundingClientRect)\n * @param scrollContainers Dimensions of element's scrolling containers (from getBoundingClientRect)\n * @returns Whether the element is clipped\n * @docs-private\n */\nfunction isElementClippedByScrolling(element, scrollContainers) {\n return scrollContainers.some(scrollContainerRect => {\n const clippedAbove = element.top < scrollContainerRect.top;\n const clippedBelow = element.bottom > scrollContainerRect.bottom;\n const clippedLeft = element.left < scrollContainerRect.left;\n const clippedRight = element.right > scrollContainerRect.right;\n return clippedAbove || clippedBelow || clippedLeft || clippedRight;\n });\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Strategy that will update the element position as the user is scrolling.\n */\nclass RepositionScrollStrategy {\n constructor(_scrollDispatcher, _viewportRuler, _ngZone, _config) {\n this._scrollDispatcher = _scrollDispatcher;\n this._viewportRuler = _viewportRuler;\n this._ngZone = _ngZone;\n this._config = _config;\n this._scrollSubscription = null;\n }\n /** Attaches this scroll strategy to an overlay. */\n attach(overlayRef) {\n if (this._overlayRef && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getMatScrollStrategyAlreadyAttachedError();\n }\n this._overlayRef = overlayRef;\n }\n /** Enables repositioning of the attached overlay on scroll. */\n enable() {\n if (!this._scrollSubscription) {\n const throttle = this._config ? this._config.scrollThrottle : 0;\n this._scrollSubscription = this._scrollDispatcher.scrolled(throttle).subscribe(() => {\n this._overlayRef.updatePosition();\n // TODO(crisbeto): make `close` on by default once all components can handle it.\n if (this._config && this._config.autoClose) {\n const overlayRect = this._overlayRef.overlayElement.getBoundingClientRect();\n const { width, height } = this._viewportRuler.getViewportSize();\n // TODO(crisbeto): include all ancestor scroll containers here once\n // we have a way of exposing the trigger element to the scroll strategy.\n const parentRects = [{ width, height, bottom: height, right: width, top: 0, left: 0 }];\n if (isElementScrolledOutsideView(overlayRect, parentRects)) {\n this.disable();\n this._ngZone.run(() => this._overlayRef.detach());\n }\n }\n });\n }\n }\n /** Disables repositioning of the attached overlay on scroll. */\n disable() {\n if (this._scrollSubscription) {\n this._scrollSubscription.unsubscribe();\n this._scrollSubscription = null;\n }\n }\n detach() {\n this.disable();\n this._overlayRef = null;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Options for how an overlay will handle scrolling.\n *\n * Users can provide a custom value for `ScrollStrategyOptions` to replace the default\n * behaviors. This class primarily acts as a factory for ScrollStrategy instances.\n */\nclass ScrollStrategyOptions {\n constructor(_scrollDispatcher, _viewportRuler, _ngZone, document) {\n this._scrollDispatcher = _scrollDispatcher;\n this._viewportRuler = _viewportRuler;\n this._ngZone = _ngZone;\n /** Do nothing on scroll. */\n this.noop = () => new NoopScrollStrategy();\n /**\n * Close the overlay as soon as the user scrolls.\n * @param config Configuration to be used inside the scroll strategy.\n */\n this.close = (config) => new CloseScrollStrategy(this._scrollDispatcher, this._ngZone, this._viewportRuler, config);\n /** Block scrolling. */\n this.block = () => new BlockScrollStrategy(this._viewportRuler, this._document);\n /**\n * Update the overlay's position on scroll.\n * @param config Configuration to be used inside the scroll strategy.\n * Allows debouncing the reposition calls.\n */\n this.reposition = (config) => new RepositionScrollStrategy(this._scrollDispatcher, this._viewportRuler, this._ngZone, config);\n this._document = document;\n }\n}\nScrollStrategyOptions.ɵfac = function ScrollStrategyOptions_Factory(t) { return new (t || ScrollStrategyOptions)(ɵngcc0.ɵɵinject(ɵngcc1.ScrollDispatcher), ɵngcc0.ɵɵinject(ɵngcc1.ViewportRuler), ɵngcc0.ɵɵinject(ɵngcc0.NgZone), ɵngcc0.ɵɵinject(DOCUMENT)); };\nScrollStrategyOptions.ɵprov = i0.ɵɵdefineInjectable({ factory: function ScrollStrategyOptions_Factory() { return new ScrollStrategyOptions(i0.ɵɵinject(i1.ScrollDispatcher), i0.ɵɵinject(i1.ViewportRuler), i0.ɵɵinject(i0.NgZone), i0.ɵɵinject(i1$1.DOCUMENT)); }, token: ScrollStrategyOptions, providedIn: \"root\" });\nScrollStrategyOptions.ctorParameters = () => [\n { type: ScrollDispatcher },\n { type: ViewportRuler },\n { type: NgZone },\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(ScrollStrategyOptions, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: ɵngcc1.ScrollDispatcher }, { type: ɵngcc1.ViewportRuler }, { type: ɵngcc0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Initial configuration used when creating an overlay. */\nclass OverlayConfig {\n constructor(config) {\n /** Strategy to be used when handling scroll events while the overlay is open. */\n this.scrollStrategy = new NoopScrollStrategy();\n /** Custom class to add to the overlay pane. */\n this.panelClass = '';\n /** Whether the overlay has a backdrop. */\n this.hasBackdrop = false;\n /** Custom class to add to the backdrop */\n this.backdropClass = 'cdk-overlay-dark-backdrop';\n /**\n * Whether the overlay should be disposed of when the user goes backwards/forwards in history.\n * Note that this usually doesn't include clicking on links (unless the user is using\n * the `HashLocationStrategy`).\n */\n this.disposeOnNavigation = false;\n if (config) {\n // Use `Iterable` instead of `Array` because TypeScript, as of 3.6.3,\n // loses the array generic type in the `for of`. But we *also* have to use `Array` because\n // typescript won't iterate over an `Iterable` unless you compile with `--downlevelIteration`\n const configKeys = Object.keys(config);\n for (const key of configKeys) {\n if (config[key] !== undefined) {\n // TypeScript, as of version 3.5, sees the left-hand-side of this expression\n // as \"I don't know *which* key this is, so the only valid value is the intersection\n // of all the posible values.\" In this case, that happens to be `undefined`. TypeScript\n // is not smart enough to see that the right-hand-side is actually an access of the same\n // exact type with the same exact key, meaning that the value type must be identical.\n // So we use `any` to work around this.\n this[key] = config[key];\n }\n }\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** The points of the origin element and the overlay element to connect. */\nclass ConnectionPositionPair {\n constructor(origin, overlay, \n /** Offset along the X axis. */\n offsetX, \n /** Offset along the Y axis. */\n offsetY, \n /** Class(es) to be applied to the panel while this position is active. */\n panelClass) {\n this.offsetX = offsetX;\n this.offsetY = offsetY;\n this.panelClass = panelClass;\n this.originX = origin.originX;\n this.originY = origin.originY;\n this.overlayX = overlay.overlayX;\n this.overlayY = overlay.overlayY;\n }\n}\n/**\n * Set of properties regarding the position of the origin and overlay relative to the viewport\n * with respect to the containing Scrollable elements.\n *\n * The overlay and origin are clipped if any part of their bounding client rectangle exceeds the\n * bounds of any one of the strategy's Scrollable's bounding client rectangle.\n *\n * The overlay and origin are outside view if there is no overlap between their bounding client\n * rectangle and any one of the strategy's Scrollable's bounding client rectangle.\n *\n * ----------- -----------\n * | outside | | clipped |\n * | view | --------------------------\n * | | | | | |\n * ---------- | ----------- |\n * -------------------------- | |\n * | | | Scrollable |\n * | | | |\n * | | --------------------------\n * | Scrollable |\n * | |\n * --------------------------\n *\n * @docs-private\n */\nclass ScrollingVisibility {\n}\n/** The change event emitted by the strategy when a fallback position is used. */\nclass ConnectedOverlayPositionChange {\n constructor(\n /** The position used as a result of this change. */\n connectionPair, \n /** @docs-private */\n scrollableViewProperties) {\n this.connectionPair = connectionPair;\n this.scrollableViewProperties = scrollableViewProperties;\n }\n}\nConnectedOverlayPositionChange.ctorParameters = () => [\n { type: ConnectionPositionPair },\n { type: ScrollingVisibility, decorators: [{ type: Optional }] }\n];\n/**\n * Validates whether a vertical position property matches the expected values.\n * @param property Name of the property being validated.\n * @param value Value of the property being validated.\n * @docs-private\n */\nfunction validateVerticalPosition(property, value) {\n if (value !== 'top' && value !== 'bottom' && value !== 'center') {\n throw Error(`ConnectedPosition: Invalid ${property} \"${value}\". ` +\n `Expected \"top\", \"bottom\" or \"center\".`);\n }\n}\n/**\n * Validates whether a horizontal position property matches the expected values.\n * @param property Name of the property being validated.\n * @param value Value of the property being validated.\n * @docs-private\n */\nfunction validateHorizontalPosition(property, value) {\n if (value !== 'start' && value !== 'end' && value !== 'center') {\n throw Error(`ConnectedPosition: Invalid ${property} \"${value}\". ` +\n `Expected \"start\", \"end\" or \"center\".`);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Service for dispatching events that land on the body to appropriate overlay ref,\n * if any. It maintains a list of attached overlays to determine best suited overlay based\n * on event target and order of overlay opens.\n */\nclass BaseOverlayDispatcher {\n constructor(document) {\n /** Currently attached overlays in the order they were attached. */\n this._attachedOverlays = [];\n this._document = document;\n }\n ngOnDestroy() {\n this.detach();\n }\n /** Add a new overlay to the list of attached overlay refs. */\n add(overlayRef) {\n // Ensure that we don't get the same overlay multiple times.\n this.remove(overlayRef);\n this._attachedOverlays.push(overlayRef);\n }\n /** Remove an overlay from the list of attached overlay refs. */\n remove(overlayRef) {\n const index = this._attachedOverlays.indexOf(overlayRef);\n if (index > -1) {\n this._attachedOverlays.splice(index, 1);\n }\n // Remove the global listener once there are no more overlays.\n if (this._attachedOverlays.length === 0) {\n this.detach();\n }\n }\n}\nBaseOverlayDispatcher.ɵfac = function BaseOverlayDispatcher_Factory(t) { return new (t || BaseOverlayDispatcher)(ɵngcc0.ɵɵinject(DOCUMENT)); };\nBaseOverlayDispatcher.ɵprov = i0.ɵɵdefineInjectable({ factory: function BaseOverlayDispatcher_Factory() { return new BaseOverlayDispatcher(i0.ɵɵinject(i1$1.DOCUMENT)); }, token: BaseOverlayDispatcher, providedIn: \"root\" });\nBaseOverlayDispatcher.ctorParameters = () => [\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(BaseOverlayDispatcher, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Service for dispatching keyboard events that land on the body to appropriate overlay ref,\n * if any. It maintains a list of attached overlays to determine best suited overlay based\n * on event target and order of overlay opens.\n */\nclass OverlayKeyboardDispatcher extends BaseOverlayDispatcher {\n constructor(document) {\n super(document);\n /** Keyboard event listener that will be attached to the body. */\n this._keydownListener = (event) => {\n const overlays = this._attachedOverlays;\n for (let i = overlays.length - 1; i > -1; i--) {\n // Dispatch the keydown event to the top overlay which has subscribers to its keydown events.\n // We want to target the most recent overlay, rather than trying to match where the event came\n // from, because some components might open an overlay, but keep focus on a trigger element\n // (e.g. for select and autocomplete). We skip overlays without keydown event subscriptions,\n // because we don't want overlays that don't handle keyboard events to block the ones below\n // them that do.\n if (overlays[i]._keydownEvents.observers.length > 0) {\n overlays[i]._keydownEvents.next(event);\n break;\n }\n }\n };\n }\n /** Add a new overlay to the list of attached overlay refs. */\n add(overlayRef) {\n super.add(overlayRef);\n // Lazily start dispatcher once first overlay is added\n if (!this._isAttached) {\n this._document.body.addEventListener('keydown', this._keydownListener);\n this._isAttached = true;\n }\n }\n /** Detaches the global keyboard event listener. */\n detach() {\n if (this._isAttached) {\n this._document.body.removeEventListener('keydown', this._keydownListener);\n this._isAttached = false;\n }\n }\n}\nOverlayKeyboardDispatcher.ɵfac = function OverlayKeyboardDispatcher_Factory(t) { return new (t || OverlayKeyboardDispatcher)(ɵngcc0.ɵɵinject(DOCUMENT)); };\nOverlayKeyboardDispatcher.ɵprov = i0.ɵɵdefineInjectable({ factory: function OverlayKeyboardDispatcher_Factory() { return new OverlayKeyboardDispatcher(i0.ɵɵinject(i1$1.DOCUMENT)); }, token: OverlayKeyboardDispatcher, providedIn: \"root\" });\nOverlayKeyboardDispatcher.ctorParameters = () => [\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(OverlayKeyboardDispatcher, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Service for dispatching mouse click events that land on the body to appropriate overlay ref,\n * if any. It maintains a list of attached overlays to determine best suited overlay based\n * on event target and order of overlay opens.\n */\nclass OverlayOutsideClickDispatcher extends BaseOverlayDispatcher {\n constructor(document, _platform) {\n super(document);\n this._platform = _platform;\n this._cursorStyleIsSet = false;\n /** Click event listener that will be attached to the body propagate phase. */\n this._clickListener = (event) => {\n // Get the target through the `composedPath` if possible to account for shadow DOM.\n const target = event.composedPath ? event.composedPath()[0] : event.target;\n // We copy the array because the original may be modified asynchronously if the\n // outsidePointerEvents listener decides to detach overlays resulting in index errors inside\n // the for loop.\n const overlays = this._attachedOverlays.slice();\n // Dispatch the mouse event to the top overlay which has subscribers to its mouse events.\n // We want to target all overlays for which the click could be considered as outside click.\n // As soon as we reach an overlay for which the click is not outside click we break off\n // the loop.\n for (let i = overlays.length - 1; i > -1; i--) {\n const overlayRef = overlays[i];\n if (overlayRef._outsidePointerEvents.observers.length < 1 || !overlayRef.hasAttached()) {\n continue;\n }\n // If it's a click inside the overlay, just break - we should do nothing\n // If it's an outside click dispatch the mouse event, and proceed with the next overlay\n if (overlayRef.overlayElement.contains(target)) {\n break;\n }\n overlayRef._outsidePointerEvents.next(event);\n }\n };\n }\n /** Add a new overlay to the list of attached overlay refs. */\n add(overlayRef) {\n super.add(overlayRef);\n // Safari on iOS does not generate click events for non-interactive\n // elements. However, we want to receive a click for any element outside\n // the overlay. We can force a \"clickable\" state by setting\n // `cursor: pointer` on the document body. See:\n // https://developer.mozilla.org/en-US/docs/Web/API/Element/click_event#Safari_Mobile\n // https://developer.apple.com/library/archive/documentation/AppleApplications/Reference/SafariWebContent/HandlingEvents/HandlingEvents.html\n if (!this._isAttached) {\n const body = this._document.body;\n body.addEventListener('click', this._clickListener, true);\n body.addEventListener('auxclick', this._clickListener, true);\n body.addEventListener('contextmenu', this._clickListener, true);\n // click event is not fired on iOS. To make element \"clickable\" we are\n // setting the cursor to pointer\n if (this._platform.IOS && !this._cursorStyleIsSet) {\n this._cursorOriginalValue = body.style.cursor;\n body.style.cursor = 'pointer';\n this._cursorStyleIsSet = true;\n }\n this._isAttached = true;\n }\n }\n /** Detaches the global keyboard event listener. */\n detach() {\n if (this._isAttached) {\n const body = this._document.body;\n body.removeEventListener('click', this._clickListener, true);\n body.removeEventListener('auxclick', this._clickListener, true);\n body.removeEventListener('contextmenu', this._clickListener, true);\n if (this._platform.IOS && this._cursorStyleIsSet) {\n body.style.cursor = this._cursorOriginalValue;\n this._cursorStyleIsSet = false;\n }\n this._isAttached = false;\n }\n }\n}\nOverlayOutsideClickDispatcher.ɵfac = function OverlayOutsideClickDispatcher_Factory(t) { return new (t || OverlayOutsideClickDispatcher)(ɵngcc0.ɵɵinject(DOCUMENT), ɵngcc0.ɵɵinject(ɵngcc2.Platform)); };\nOverlayOutsideClickDispatcher.ɵprov = i0.ɵɵdefineInjectable({ factory: function OverlayOutsideClickDispatcher_Factory() { return new OverlayOutsideClickDispatcher(i0.ɵɵinject(i1$1.DOCUMENT), i0.ɵɵinject(i2.Platform)); }, token: OverlayOutsideClickDispatcher, providedIn: \"root\" });\nOverlayOutsideClickDispatcher.ctorParameters = () => [\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] },\n { type: Platform }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(OverlayOutsideClickDispatcher, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: ɵngcc2.Platform }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Whether we're in a testing environment.\n * TODO(crisbeto): remove this once we have an overlay testing module or Angular starts tearing\n * down the testing `NgModule` (see https://github.com/angular/angular/issues/18831).\n */\nconst isTestEnvironment = (typeof __karma__ !== 'undefined' && !!__karma__) ||\n (typeof jasmine !== 'undefined' && !!jasmine) ||\n (typeof jest !== 'undefined' && !!jest) ||\n (typeof Mocha !== 'undefined' && !!Mocha);\n/** Container inside which all overlays will render. */\nclass OverlayContainer {\n constructor(document, _platform) {\n this._platform = _platform;\n this._document = document;\n }\n ngOnDestroy() {\n const container = this._containerElement;\n if (container && container.parentNode) {\n container.parentNode.removeChild(container);\n }\n }\n /**\n * This method returns the overlay container element. It will lazily\n * create the element the first time it is called to facilitate using\n * the container in non-browser environments.\n * @returns the container element\n */\n getContainerElement() {\n if (!this._containerElement) {\n this._createContainer();\n }\n return this._containerElement;\n }\n /**\n * Create the overlay container element, which is simply a div\n * with the 'cdk-overlay-container' class on the document body.\n */\n _createContainer() {\n const containerClass = 'cdk-overlay-container';\n if (this._platform.isBrowser || isTestEnvironment) {\n const oppositePlatformContainers = this._document.querySelectorAll(`.${containerClass}[platform=\"server\"], ` +\n `.${containerClass}[platform=\"test\"]`);\n // Remove any old containers from the opposite platform.\n // This can happen when transitioning from the server to the client.\n for (let i = 0; i < oppositePlatformContainers.length; i++) {\n oppositePlatformContainers[i].parentNode.removeChild(oppositePlatformContainers[i]);\n }\n }\n const container = this._document.createElement('div');\n container.classList.add(containerClass);\n // A long time ago we kept adding new overlay containers whenever a new app was instantiated,\n // but at some point we added logic which clears the duplicate ones in order to avoid leaks.\n // The new logic was a little too aggressive since it was breaking some legitimate use cases.\n // To mitigate the problem we made it so that only containers from a different platform are\n // cleared, but the side-effect was that people started depending on the overly-aggressive\n // logic to clean up their tests for them. Until we can introduce an overlay-specific testing\n // module which does the cleanup, we try to detect that we're in a test environment and we\n // always clear the container. See #17006.\n // TODO(crisbeto): remove the test environment check once we have an overlay testing module.\n if (isTestEnvironment) {\n container.setAttribute('platform', 'test');\n }\n else if (!this._platform.isBrowser) {\n container.setAttribute('platform', 'server');\n }\n this._document.body.appendChild(container);\n this._containerElement = container;\n }\n}\nOverlayContainer.ɵfac = function OverlayContainer_Factory(t) { return new (t || OverlayContainer)(ɵngcc0.ɵɵinject(DOCUMENT), ɵngcc0.ɵɵinject(ɵngcc2.Platform)); };\nOverlayContainer.ɵprov = i0.ɵɵdefineInjectable({ factory: function OverlayContainer_Factory() { return new OverlayContainer(i0.ɵɵinject(i1$1.DOCUMENT), i0.ɵɵinject(i2.Platform)); }, token: OverlayContainer, providedIn: \"root\" });\nOverlayContainer.ctorParameters = () => [\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] },\n { type: Platform }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(OverlayContainer, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: ɵngcc2.Platform }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Reference to an overlay that has been created with the Overlay service.\n * Used to manipulate or dispose of said overlay.\n */\nclass OverlayRef {\n constructor(_portalOutlet, _host, _pane, _config, _ngZone, _keyboardDispatcher, _document, _location, _outsideClickDispatcher) {\n this._portalOutlet = _portalOutlet;\n this._host = _host;\n this._pane = _pane;\n this._config = _config;\n this._ngZone = _ngZone;\n this._keyboardDispatcher = _keyboardDispatcher;\n this._document = _document;\n this._location = _location;\n this._outsideClickDispatcher = _outsideClickDispatcher;\n this._backdropElement = null;\n this._backdropClick = new Subject();\n this._attachments = new Subject();\n this._detachments = new Subject();\n this._locationChanges = Subscription.EMPTY;\n this._backdropClickHandler = (event) => this._backdropClick.next(event);\n /** Stream of keydown events dispatched to this overlay. */\n this._keydownEvents = new Subject();\n /** Stream of mouse outside events dispatched to this overlay. */\n this._outsidePointerEvents = new Subject();\n if (_config.scrollStrategy) {\n this._scrollStrategy = _config.scrollStrategy;\n this._scrollStrategy.attach(this);\n }\n this._positionStrategy = _config.positionStrategy;\n }\n /** The overlay's HTML element */\n get overlayElement() {\n return this._pane;\n }\n /** The overlay's backdrop HTML element. */\n get backdropElement() {\n return this._backdropElement;\n }\n /**\n * Wrapper around the panel element. Can be used for advanced\n * positioning where a wrapper with specific styling is\n * required around the overlay pane.\n */\n get hostElement() {\n return this._host;\n }\n /**\n * Attaches content, given via a Portal, to the overlay.\n * If the overlay is configured to have a backdrop, it will be created.\n *\n * @param portal Portal instance to which to attach the overlay.\n * @returns The portal attachment result.\n */\n attach(portal) {\n let attachResult = this._portalOutlet.attach(portal);\n // Update the pane element with the given configuration.\n if (!this._host.parentElement && this._previousHostParent) {\n this._previousHostParent.appendChild(this._host);\n }\n if (this._positionStrategy) {\n this._positionStrategy.attach(this);\n }\n this._updateStackingOrder();\n this._updateElementSize();\n this._updateElementDirection();\n if (this._scrollStrategy) {\n this._scrollStrategy.enable();\n }\n // Update the position once the zone is stable so that the overlay will be fully rendered\n // before attempting to position it, as the position may depend on the size of the rendered\n // content.\n this._ngZone.onStable\n .pipe(take(1))\n .subscribe(() => {\n // The overlay could've been detached before the zone has stabilized.\n if (this.hasAttached()) {\n this.updatePosition();\n }\n });\n // Enable pointer events for the overlay pane element.\n this._togglePointerEvents(true);\n if (this._config.hasBackdrop) {\n this._attachBackdrop();\n }\n if (this._config.panelClass) {\n this._toggleClasses(this._pane, this._config.panelClass, true);\n }\n // Only emit the `attachments` event once all other setup is done.\n this._attachments.next();\n // Track this overlay by the keyboard dispatcher\n this._keyboardDispatcher.add(this);\n if (this._config.disposeOnNavigation) {\n this._locationChanges = this._location.subscribe(() => this.dispose());\n }\n this._outsideClickDispatcher.add(this);\n return attachResult;\n }\n /**\n * Detaches an overlay from a portal.\n * @returns The portal detachment result.\n */\n detach() {\n if (!this.hasAttached()) {\n return;\n }\n this.detachBackdrop();\n // When the overlay is detached, the pane element should disable pointer events.\n // This is necessary because otherwise the pane element will cover the page and disable\n // pointer events therefore. Depends on the position strategy and the applied pane boundaries.\n this._togglePointerEvents(false);\n if (this._positionStrategy && this._positionStrategy.detach) {\n this._positionStrategy.detach();\n }\n if (this._scrollStrategy) {\n this._scrollStrategy.disable();\n }\n const detachmentResult = this._portalOutlet.detach();\n // Only emit after everything is detached.\n this._detachments.next();\n // Remove this overlay from keyboard dispatcher tracking.\n this._keyboardDispatcher.remove(this);\n // Keeping the host element in the DOM can cause scroll jank, because it still gets\n // rendered, even though it's transparent and unclickable which is why we remove it.\n this._detachContentWhenStable();\n this._locationChanges.unsubscribe();\n this._outsideClickDispatcher.remove(this);\n return detachmentResult;\n }\n /** Cleans up the overlay from the DOM. */\n dispose() {\n const isAttached = this.hasAttached();\n if (this._positionStrategy) {\n this._positionStrategy.dispose();\n }\n this._disposeScrollStrategy();\n this.detachBackdrop();\n this._locationChanges.unsubscribe();\n this._keyboardDispatcher.remove(this);\n this._portalOutlet.dispose();\n this._attachments.complete();\n this._backdropClick.complete();\n this._keydownEvents.complete();\n this._outsidePointerEvents.complete();\n this._outsideClickDispatcher.remove(this);\n if (this._host && this._host.parentNode) {\n this._host.parentNode.removeChild(this._host);\n this._host = null;\n }\n this._previousHostParent = this._pane = null;\n if (isAttached) {\n this._detachments.next();\n }\n this._detachments.complete();\n }\n /** Whether the overlay has attached content. */\n hasAttached() {\n return this._portalOutlet.hasAttached();\n }\n /** Gets an observable that emits when the backdrop has been clicked. */\n backdropClick() {\n return this._backdropClick;\n }\n /** Gets an observable that emits when the overlay has been attached. */\n attachments() {\n return this._attachments;\n }\n /** Gets an observable that emits when the overlay has been detached. */\n detachments() {\n return this._detachments;\n }\n /** Gets an observable of keydown events targeted to this overlay. */\n keydownEvents() {\n return this._keydownEvents;\n }\n /** Gets an observable of pointer events targeted outside this overlay. */\n outsidePointerEvents() {\n return this._outsidePointerEvents;\n }\n /** Gets the current overlay configuration, which is immutable. */\n getConfig() {\n return this._config;\n }\n /** Updates the position of the overlay based on the position strategy. */\n updatePosition() {\n if (this._positionStrategy) {\n this._positionStrategy.apply();\n }\n }\n /** Switches to a new position strategy and updates the overlay position. */\n updatePositionStrategy(strategy) {\n if (strategy === this._positionStrategy) {\n return;\n }\n if (this._positionStrategy) {\n this._positionStrategy.dispose();\n }\n this._positionStrategy = strategy;\n if (this.hasAttached()) {\n strategy.attach(this);\n this.updatePosition();\n }\n }\n /** Update the size properties of the overlay. */\n updateSize(sizeConfig) {\n this._config = Object.assign(Object.assign({}, this._config), sizeConfig);\n this._updateElementSize();\n }\n /** Sets the LTR/RTL direction for the overlay. */\n setDirection(dir) {\n this._config = Object.assign(Object.assign({}, this._config), { direction: dir });\n this._updateElementDirection();\n }\n /** Add a CSS class or an array of classes to the overlay pane. */\n addPanelClass(classes) {\n if (this._pane) {\n this._toggleClasses(this._pane, classes, true);\n }\n }\n /** Remove a CSS class or an array of classes from the overlay pane. */\n removePanelClass(classes) {\n if (this._pane) {\n this._toggleClasses(this._pane, classes, false);\n }\n }\n /**\n * Returns the layout direction of the overlay panel.\n */\n getDirection() {\n const direction = this._config.direction;\n if (!direction) {\n return 'ltr';\n }\n return typeof direction === 'string' ? direction : direction.value;\n }\n /** Switches to a new scroll strategy. */\n updateScrollStrategy(strategy) {\n if (strategy === this._scrollStrategy) {\n return;\n }\n this._disposeScrollStrategy();\n this._scrollStrategy = strategy;\n if (this.hasAttached()) {\n strategy.attach(this);\n strategy.enable();\n }\n }\n /** Updates the text direction of the overlay panel. */\n _updateElementDirection() {\n this._host.setAttribute('dir', this.getDirection());\n }\n /** Updates the size of the overlay element based on the overlay config. */\n _updateElementSize() {\n if (!this._pane) {\n return;\n }\n const style = this._pane.style;\n style.width = coerceCssPixelValue(this._config.width);\n style.height = coerceCssPixelValue(this._config.height);\n style.minWidth = coerceCssPixelValue(this._config.minWidth);\n style.minHeight = coerceCssPixelValue(this._config.minHeight);\n style.maxWidth = coerceCssPixelValue(this._config.maxWidth);\n style.maxHeight = coerceCssPixelValue(this._config.maxHeight);\n }\n /** Toggles the pointer events for the overlay pane element. */\n _togglePointerEvents(enablePointer) {\n this._pane.style.pointerEvents = enablePointer ? '' : 'none';\n }\n /** Attaches a backdrop for this overlay. */\n _attachBackdrop() {\n const showingClass = 'cdk-overlay-backdrop-showing';\n this._backdropElement = this._document.createElement('div');\n this._backdropElement.classList.add('cdk-overlay-backdrop');\n if (this._config.backdropClass) {\n this._toggleClasses(this._backdropElement, this._config.backdropClass, true);\n }\n // Insert the backdrop before the pane in the DOM order,\n // in order to handle stacked overlays properly.\n this._host.parentElement.insertBefore(this._backdropElement, this._host);\n // Forward backdrop clicks such that the consumer of the overlay can perform whatever\n // action desired when such a click occurs (usually closing the overlay).\n this._backdropElement.addEventListener('click', this._backdropClickHandler);\n // Add class to fade-in the backdrop after one frame.\n if (typeof requestAnimationFrame !== 'undefined') {\n this._ngZone.runOutsideAngular(() => {\n requestAnimationFrame(() => {\n if (this._backdropElement) {\n this._backdropElement.classList.add(showingClass);\n }\n });\n });\n }\n else {\n this._backdropElement.classList.add(showingClass);\n }\n }\n /**\n * Updates the stacking order of the element, moving it to the top if necessary.\n * This is required in cases where one overlay was detached, while another one,\n * that should be behind it, was destroyed. The next time both of them are opened,\n * the stacking will be wrong, because the detached element's pane will still be\n * in its original DOM position.\n */\n _updateStackingOrder() {\n if (this._host.nextSibling) {\n this._host.parentNode.appendChild(this._host);\n }\n }\n /** Detaches the backdrop (if any) associated with the overlay. */\n detachBackdrop() {\n let backdropToDetach = this._backdropElement;\n if (!backdropToDetach) {\n return;\n }\n let timeoutId;\n let finishDetach = () => {\n // It may not be attached to anything in certain cases (e.g. unit tests).\n if (backdropToDetach) {\n backdropToDetach.removeEventListener('click', this._backdropClickHandler);\n backdropToDetach.removeEventListener('transitionend', finishDetach);\n if (backdropToDetach.parentNode) {\n backdropToDetach.parentNode.removeChild(backdropToDetach);\n }\n }\n // It is possible that a new portal has been attached to this overlay since we started\n // removing the backdrop. If that is the case, only clear the backdrop reference if it\n // is still the same instance that we started to remove.\n if (this._backdropElement == backdropToDetach) {\n this._backdropElement = null;\n }\n if (this._config.backdropClass) {\n this._toggleClasses(backdropToDetach, this._config.backdropClass, false);\n }\n clearTimeout(timeoutId);\n };\n backdropToDetach.classList.remove('cdk-overlay-backdrop-showing');\n this._ngZone.runOutsideAngular(() => {\n backdropToDetach.addEventListener('transitionend', finishDetach);\n });\n // If the backdrop doesn't have a transition, the `transitionend` event won't fire.\n // In this case we make it unclickable and we try to remove it after a delay.\n backdropToDetach.style.pointerEvents = 'none';\n // Run this outside the Angular zone because there's nothing that Angular cares about.\n // If it were to run inside the Angular zone, every test that used Overlay would have to be\n // either async or fakeAsync.\n timeoutId = this._ngZone.runOutsideAngular(() => setTimeout(finishDetach, 500));\n }\n /** Toggles a single CSS class or an array of classes on an element. */\n _toggleClasses(element, cssClasses, isAdd) {\n const classList = element.classList;\n coerceArray(cssClasses).forEach(cssClass => {\n // We can't do a spread here, because IE doesn't support setting multiple classes.\n // Also trying to add an empty string to a DOMTokenList will throw.\n if (cssClass) {\n isAdd ? classList.add(cssClass) : classList.remove(cssClass);\n }\n });\n }\n /** Detaches the overlay content next time the zone stabilizes. */\n _detachContentWhenStable() {\n // Normally we wouldn't have to explicitly run this outside the `NgZone`, however\n // if the consumer is using `zone-patch-rxjs`, the `Subscription.unsubscribe` call will\n // be patched to run inside the zone, which will throw us into an infinite loop.\n this._ngZone.runOutsideAngular(() => {\n // We can't remove the host here immediately, because the overlay pane's content\n // might still be animating. This stream helps us avoid interrupting the animation\n // by waiting for the pane to become empty.\n const subscription = this._ngZone.onStable\n .pipe(takeUntil(merge(this._attachments, this._detachments)))\n .subscribe(() => {\n // Needs a couple of checks for the pane and host, because\n // they may have been removed by the time the zone stabilizes.\n if (!this._pane || !this._host || this._pane.children.length === 0) {\n if (this._pane && this._config.panelClass) {\n this._toggleClasses(this._pane, this._config.panelClass, false);\n }\n if (this._host && this._host.parentElement) {\n this._previousHostParent = this._host.parentElement;\n this._previousHostParent.removeChild(this._host);\n }\n subscription.unsubscribe();\n }\n });\n });\n }\n /** Disposes of a scroll strategy. */\n _disposeScrollStrategy() {\n const scrollStrategy = this._scrollStrategy;\n if (scrollStrategy) {\n scrollStrategy.disable();\n if (scrollStrategy.detach) {\n scrollStrategy.detach();\n }\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// TODO: refactor clipping detection into a separate thing (part of scrolling module)\n// TODO: doesn't handle both flexible width and height when it has to scroll along both axis.\n/** Class to be added to the overlay bounding box. */\nconst boundingBoxClass = 'cdk-overlay-connected-position-bounding-box';\n/** Regex used to split a string on its CSS units. */\nconst cssUnitPattern = /([A-Za-z%]+)$/;\n/**\n * A strategy for positioning overlays. Using this strategy, an overlay is given an\n * implicit position relative some origin element. The relative position is defined in terms of\n * a point on the origin element that is connected to a point on the overlay element. For example,\n * a basic dropdown is connecting the bottom-left corner of the origin to the top-left corner\n * of the overlay.\n */\nclass FlexibleConnectedPositionStrategy {\n constructor(connectedTo, _viewportRuler, _document, _platform, _overlayContainer) {\n this._viewportRuler = _viewportRuler;\n this._document = _document;\n this._platform = _platform;\n this._overlayContainer = _overlayContainer;\n /** Last size used for the bounding box. Used to avoid resizing the overlay after open. */\n this._lastBoundingBoxSize = { width: 0, height: 0 };\n /** Whether the overlay was pushed in a previous positioning. */\n this._isPushed = false;\n /** Whether the overlay can be pushed on-screen on the initial open. */\n this._canPush = true;\n /** Whether the overlay can grow via flexible width/height after the initial open. */\n this._growAfterOpen = false;\n /** Whether the overlay's width and height can be constrained to fit within the viewport. */\n this._hasFlexibleDimensions = true;\n /** Whether the overlay position is locked. */\n this._positionLocked = false;\n /** Amount of space that must be maintained between the overlay and the edge of the viewport. */\n this._viewportMargin = 0;\n /** The Scrollable containers used to check scrollable view properties on position change. */\n this._scrollables = [];\n /** Ordered list of preferred positions, from most to least desirable. */\n this._preferredPositions = [];\n /** Subject that emits whenever the position changes. */\n this._positionChanges = new Subject();\n /** Subscription to viewport size changes. */\n this._resizeSubscription = Subscription.EMPTY;\n /** Default offset for the overlay along the x axis. */\n this._offsetX = 0;\n /** Default offset for the overlay along the y axis. */\n this._offsetY = 0;\n /** Keeps track of the CSS classes that the position strategy has applied on the overlay panel. */\n this._appliedPanelClasses = [];\n /** Observable sequence of position changes. */\n this.positionChanges = this._positionChanges;\n this.setOrigin(connectedTo);\n }\n /** Ordered list of preferred positions, from most to least desirable. */\n get positions() {\n return this._preferredPositions;\n }\n /** Attaches this position strategy to an overlay. */\n attach(overlayRef) {\n if (this._overlayRef && overlayRef !== this._overlayRef &&\n (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('This position strategy is already attached to an overlay');\n }\n this._validatePositions();\n overlayRef.hostElement.classList.add(boundingBoxClass);\n this._overlayRef = overlayRef;\n this._boundingBox = overlayRef.hostElement;\n this._pane = overlayRef.overlayElement;\n this._isDisposed = false;\n this._isInitialRender = true;\n this._lastPosition = null;\n this._resizeSubscription.unsubscribe();\n this._resizeSubscription = this._viewportRuler.change().subscribe(() => {\n // When the window is resized, we want to trigger the next reposition as if it\n // was an initial render, in order for the strategy to pick a new optimal position,\n // otherwise position locking will cause it to stay at the old one.\n this._isInitialRender = true;\n this.apply();\n });\n }\n /**\n * Updates the position of the overlay element, using whichever preferred position relative\n * to the origin best fits on-screen.\n *\n * The selection of a position goes as follows:\n * - If any positions fit completely within the viewport as-is,\n * choose the first position that does so.\n * - If flexible dimensions are enabled and at least one satifies the given minimum width/height,\n * choose the position with the greatest available size modified by the positions' weight.\n * - If pushing is enabled, take the position that went off-screen the least and push it\n * on-screen.\n * - If none of the previous criteria were met, use the position that goes off-screen the least.\n * @docs-private\n */\n apply() {\n // We shouldn't do anything if the strategy was disposed or we're on the server.\n if (this._isDisposed || !this._platform.isBrowser) {\n return;\n }\n // If the position has been applied already (e.g. when the overlay was opened) and the\n // consumer opted into locking in the position, re-use the old position, in order to\n // prevent the overlay from jumping around.\n if (!this._isInitialRender && this._positionLocked && this._lastPosition) {\n this.reapplyLastPosition();\n return;\n }\n this._clearPanelClasses();\n this._resetOverlayElementStyles();\n this._resetBoundingBoxStyles();\n // We need the bounding rects for the origin and the overlay to determine how to position\n // the overlay relative to the origin.\n // We use the viewport rect to determine whether a position would go off-screen.\n this._viewportRect = this._getNarrowedViewportRect();\n this._originRect = this._getOriginRect();\n this._overlayRect = this._pane.getBoundingClientRect();\n const originRect = this._originRect;\n const overlayRect = this._overlayRect;\n const viewportRect = this._viewportRect;\n // Positions where the overlay will fit with flexible dimensions.\n const flexibleFits = [];\n // Fallback if none of the preferred positions fit within the viewport.\n let fallback;\n // Go through each of the preferred positions looking for a good fit.\n // If a good fit is found, it will be applied immediately.\n for (let pos of this._preferredPositions) {\n // Get the exact (x, y) coordinate for the point-of-origin on the origin element.\n let originPoint = this._getOriginPoint(originRect, pos);\n // From that point-of-origin, get the exact (x, y) coordinate for the top-left corner of the\n // overlay in this position. We use the top-left corner for calculations and later translate\n // this into an appropriate (top, left, bottom, right) style.\n let overlayPoint = this._getOverlayPoint(originPoint, overlayRect, pos);\n // Calculate how well the overlay would fit into the viewport with this point.\n let overlayFit = this._getOverlayFit(overlayPoint, overlayRect, viewportRect, pos);\n // If the overlay, without any further work, fits into the viewport, use this position.\n if (overlayFit.isCompletelyWithinViewport) {\n this._isPushed = false;\n this._applyPosition(pos, originPoint);\n return;\n }\n // If the overlay has flexible dimensions, we can use this position\n // so long as there's enough space for the minimum dimensions.\n if (this._canFitWithFlexibleDimensions(overlayFit, overlayPoint, viewportRect)) {\n // Save positions where the overlay will fit with flexible dimensions. We will use these\n // if none of the positions fit *without* flexible dimensions.\n flexibleFits.push({\n position: pos,\n origin: originPoint,\n overlayRect,\n boundingBoxRect: this._calculateBoundingBoxRect(originPoint, pos)\n });\n continue;\n }\n // If the current preferred position does not fit on the screen, remember the position\n // if it has more visible area on-screen than we've seen and move onto the next preferred\n // position.\n if (!fallback || fallback.overlayFit.visibleArea < overlayFit.visibleArea) {\n fallback = { overlayFit, overlayPoint, originPoint, position: pos, overlayRect };\n }\n }\n // If there are any positions where the overlay would fit with flexible dimensions, choose the\n // one that has the greatest area available modified by the position's weight\n if (flexibleFits.length) {\n let bestFit = null;\n let bestScore = -1;\n for (const fit of flexibleFits) {\n const score = fit.boundingBoxRect.width * fit.boundingBoxRect.height * (fit.position.weight || 1);\n if (score > bestScore) {\n bestScore = score;\n bestFit = fit;\n }\n }\n this._isPushed = false;\n this._applyPosition(bestFit.position, bestFit.origin);\n return;\n }\n // When none of the preferred positions fit within the viewport, take the position\n // that went off-screen the least and attempt to push it on-screen.\n if (this._canPush) {\n // TODO(jelbourn): after pushing, the opening \"direction\" of the overlay might not make sense.\n this._isPushed = true;\n this._applyPosition(fallback.position, fallback.originPoint);\n return;\n }\n // All options for getting the overlay within the viewport have been exhausted, so go with the\n // position that went off-screen the least.\n this._applyPosition(fallback.position, fallback.originPoint);\n }\n detach() {\n this._clearPanelClasses();\n this._lastPosition = null;\n this._previousPushAmount = null;\n this._resizeSubscription.unsubscribe();\n }\n /** Cleanup after the element gets destroyed. */\n dispose() {\n if (this._isDisposed) {\n return;\n }\n // We can't use `_resetBoundingBoxStyles` here, because it resets\n // some properties to zero, rather than removing them.\n if (this._boundingBox) {\n extendStyles(this._boundingBox.style, {\n top: '',\n left: '',\n right: '',\n bottom: '',\n height: '',\n width: '',\n alignItems: '',\n justifyContent: '',\n });\n }\n if (this._pane) {\n this._resetOverlayElementStyles();\n }\n if (this._overlayRef) {\n this._overlayRef.hostElement.classList.remove(boundingBoxClass);\n }\n this.detach();\n this._positionChanges.complete();\n this._overlayRef = this._boundingBox = null;\n this._isDisposed = true;\n }\n /**\n * This re-aligns the overlay element with the trigger in its last calculated position,\n * even if a position higher in the \"preferred positions\" list would now fit. This\n * allows one to re-align the panel without changing the orientation of the panel.\n */\n reapplyLastPosition() {\n if (!this._isDisposed && (!this._platform || this._platform.isBrowser)) {\n this._originRect = this._getOriginRect();\n this._overlayRect = this._pane.getBoundingClientRect();\n this._viewportRect = this._getNarrowedViewportRect();\n const lastPosition = this._lastPosition || this._preferredPositions[0];\n const originPoint = this._getOriginPoint(this._originRect, lastPosition);\n this._applyPosition(lastPosition, originPoint);\n }\n }\n /**\n * Sets the list of Scrollable containers that host the origin element so that\n * on reposition we can evaluate if it or the overlay has been clipped or outside view. Every\n * Scrollable must be an ancestor element of the strategy's origin element.\n */\n withScrollableContainers(scrollables) {\n this._scrollables = scrollables;\n return this;\n }\n /**\n * Adds new preferred positions.\n * @param positions List of positions options for this overlay.\n */\n withPositions(positions) {\n this._preferredPositions = positions;\n // If the last calculated position object isn't part of the positions anymore, clear\n // it in order to avoid it being picked up if the consumer tries to re-apply.\n if (positions.indexOf(this._lastPosition) === -1) {\n this._lastPosition = null;\n }\n this._validatePositions();\n return this;\n }\n /**\n * Sets a minimum distance the overlay may be positioned to the edge of the viewport.\n * @param margin Required margin between the overlay and the viewport edge in pixels.\n */\n withViewportMargin(margin) {\n this._viewportMargin = margin;\n return this;\n }\n /** Sets whether the overlay's width and height can be constrained to fit within the viewport. */\n withFlexibleDimensions(flexibleDimensions = true) {\n this._hasFlexibleDimensions = flexibleDimensions;\n return this;\n }\n /** Sets whether the overlay can grow after the initial open via flexible width/height. */\n withGrowAfterOpen(growAfterOpen = true) {\n this._growAfterOpen = growAfterOpen;\n return this;\n }\n /** Sets whether the overlay can be pushed on-screen if none of the provided positions fit. */\n withPush(canPush = true) {\n this._canPush = canPush;\n return this;\n }\n /**\n * Sets whether the overlay's position should be locked in after it is positioned\n * initially. When an overlay is locked in, it won't attempt to reposition itself\n * when the position is re-applied (e.g. when the user scrolls away).\n * @param isLocked Whether the overlay should locked in.\n */\n withLockedPosition(isLocked = true) {\n this._positionLocked = isLocked;\n return this;\n }\n /**\n * Sets the origin, relative to which to position the overlay.\n * Using an element origin is useful for building components that need to be positioned\n * relatively to a trigger (e.g. dropdown menus or tooltips), whereas using a point can be\n * used for cases like contextual menus which open relative to the user's pointer.\n * @param origin Reference to the new origin.\n */\n setOrigin(origin) {\n this._origin = origin;\n return this;\n }\n /**\n * Sets the default offset for the overlay's connection point on the x-axis.\n * @param offset New offset in the X axis.\n */\n withDefaultOffsetX(offset) {\n this._offsetX = offset;\n return this;\n }\n /**\n * Sets the default offset for the overlay's connection point on the y-axis.\n * @param offset New offset in the Y axis.\n */\n withDefaultOffsetY(offset) {\n this._offsetY = offset;\n return this;\n }\n /**\n * Configures that the position strategy should set a `transform-origin` on some elements\n * inside the overlay, depending on the current position that is being applied. This is\n * useful for the cases where the origin of an animation can change depending on the\n * alignment of the overlay.\n * @param selector CSS selector that will be used to find the target\n * elements onto which to set the transform origin.\n */\n withTransformOriginOn(selector) {\n this._transformOriginSelector = selector;\n return this;\n }\n /**\n * Gets the (x, y) coordinate of a connection point on the origin based on a relative position.\n */\n _getOriginPoint(originRect, pos) {\n let x;\n if (pos.originX == 'center') {\n // Note: when centering we should always use the `left`\n // offset, otherwise the position will be wrong in RTL.\n x = originRect.left + (originRect.width / 2);\n }\n else {\n const startX = this._isRtl() ? originRect.right : originRect.left;\n const endX = this._isRtl() ? originRect.left : originRect.right;\n x = pos.originX == 'start' ? startX : endX;\n }\n let y;\n if (pos.originY == 'center') {\n y = originRect.top + (originRect.height / 2);\n }\n else {\n y = pos.originY == 'top' ? originRect.top : originRect.bottom;\n }\n return { x, y };\n }\n /**\n * Gets the (x, y) coordinate of the top-left corner of the overlay given a given position and\n * origin point to which the overlay should be connected.\n */\n _getOverlayPoint(originPoint, overlayRect, pos) {\n // Calculate the (overlayStartX, overlayStartY), the start of the\n // potential overlay position relative to the origin point.\n let overlayStartX;\n if (pos.overlayX == 'center') {\n overlayStartX = -overlayRect.width / 2;\n }\n else if (pos.overlayX === 'start') {\n overlayStartX = this._isRtl() ? -overlayRect.width : 0;\n }\n else {\n overlayStartX = this._isRtl() ? 0 : -overlayRect.width;\n }\n let overlayStartY;\n if (pos.overlayY == 'center') {\n overlayStartY = -overlayRect.height / 2;\n }\n else {\n overlayStartY = pos.overlayY == 'top' ? 0 : -overlayRect.height;\n }\n // The (x, y) coordinates of the overlay.\n return {\n x: originPoint.x + overlayStartX,\n y: originPoint.y + overlayStartY,\n };\n }\n /** Gets how well an overlay at the given point will fit within the viewport. */\n _getOverlayFit(point, rawOverlayRect, viewport, position) {\n // Round the overlay rect when comparing against the\n // viewport, because the viewport is always rounded.\n const overlay = getRoundedBoundingClientRect(rawOverlayRect);\n let { x, y } = point;\n let offsetX = this._getOffset(position, 'x');\n let offsetY = this._getOffset(position, 'y');\n // Account for the offsets since they could push the overlay out of the viewport.\n if (offsetX) {\n x += offsetX;\n }\n if (offsetY) {\n y += offsetY;\n }\n // How much the overlay would overflow at this position, on each side.\n let leftOverflow = 0 - x;\n let rightOverflow = (x + overlay.width) - viewport.width;\n let topOverflow = 0 - y;\n let bottomOverflow = (y + overlay.height) - viewport.height;\n // Visible parts of the element on each axis.\n let visibleWidth = this._subtractOverflows(overlay.width, leftOverflow, rightOverflow);\n let visibleHeight = this._subtractOverflows(overlay.height, topOverflow, bottomOverflow);\n let visibleArea = visibleWidth * visibleHeight;\n return {\n visibleArea,\n isCompletelyWithinViewport: (overlay.width * overlay.height) === visibleArea,\n fitsInViewportVertically: visibleHeight === overlay.height,\n fitsInViewportHorizontally: visibleWidth == overlay.width,\n };\n }\n /**\n * Whether the overlay can fit within the viewport when it may resize either its width or height.\n * @param fit How well the overlay fits in the viewport at some position.\n * @param point The (x, y) coordinates of the overlat at some position.\n * @param viewport The geometry of the viewport.\n */\n _canFitWithFlexibleDimensions(fit, point, viewport) {\n if (this._hasFlexibleDimensions) {\n const availableHeight = viewport.bottom - point.y;\n const availableWidth = viewport.right - point.x;\n const minHeight = getPixelValue(this._overlayRef.getConfig().minHeight);\n const minWidth = getPixelValue(this._overlayRef.getConfig().minWidth);\n const verticalFit = fit.fitsInViewportVertically ||\n (minHeight != null && minHeight <= availableHeight);\n const horizontalFit = fit.fitsInViewportHorizontally ||\n (minWidth != null && minWidth <= availableWidth);\n return verticalFit && horizontalFit;\n }\n return false;\n }\n /**\n * Gets the point at which the overlay can be \"pushed\" on-screen. If the overlay is larger than\n * the viewport, the top-left corner will be pushed on-screen (with overflow occuring on the\n * right and bottom).\n *\n * @param start Starting point from which the overlay is pushed.\n * @param overlay Dimensions of the overlay.\n * @param scrollPosition Current viewport scroll position.\n * @returns The point at which to position the overlay after pushing. This is effectively a new\n * originPoint.\n */\n _pushOverlayOnScreen(start, rawOverlayRect, scrollPosition) {\n // If the position is locked and we've pushed the overlay already, reuse the previous push\n // amount, rather than pushing it again. If we were to continue pushing, the element would\n // remain in the viewport, which goes against the expectations when position locking is enabled.\n if (this._previousPushAmount && this._positionLocked) {\n return {\n x: start.x + this._previousPushAmount.x,\n y: start.y + this._previousPushAmount.y\n };\n }\n // Round the overlay rect when comparing against the\n // viewport, because the viewport is always rounded.\n const overlay = getRoundedBoundingClientRect(rawOverlayRect);\n const viewport = this._viewportRect;\n // Determine how much the overlay goes outside the viewport on each\n // side, which we'll use to decide which direction to push it.\n const overflowRight = Math.max(start.x + overlay.width - viewport.width, 0);\n const overflowBottom = Math.max(start.y + overlay.height - viewport.height, 0);\n const overflowTop = Math.max(viewport.top - scrollPosition.top - start.y, 0);\n const overflowLeft = Math.max(viewport.left - scrollPosition.left - start.x, 0);\n // Amount by which to push the overlay in each axis such that it remains on-screen.\n let pushX = 0;\n let pushY = 0;\n // If the overlay fits completely within the bounds of the viewport, push it from whichever\n // direction is goes off-screen. Otherwise, push the top-left corner such that its in the\n // viewport and allow for the trailing end of the overlay to go out of bounds.\n if (overlay.width <= viewport.width) {\n pushX = overflowLeft || -overflowRight;\n }\n else {\n pushX = start.x < this._viewportMargin ? (viewport.left - scrollPosition.left) - start.x : 0;\n }\n if (overlay.height <= viewport.height) {\n pushY = overflowTop || -overflowBottom;\n }\n else {\n pushY = start.y < this._viewportMargin ? (viewport.top - scrollPosition.top) - start.y : 0;\n }\n this._previousPushAmount = { x: pushX, y: pushY };\n return {\n x: start.x + pushX,\n y: start.y + pushY,\n };\n }\n /**\n * Applies a computed position to the overlay and emits a position change.\n * @param position The position preference\n * @param originPoint The point on the origin element where the overlay is connected.\n */\n _applyPosition(position, originPoint) {\n this._setTransformOrigin(position);\n this._setOverlayElementStyles(originPoint, position);\n this._setBoundingBoxStyles(originPoint, position);\n if (position.panelClass) {\n this._addPanelClasses(position.panelClass);\n }\n // Save the last connected position in case the position needs to be re-calculated.\n this._lastPosition = position;\n // Notify that the position has been changed along with its change properties.\n // We only emit if we've got any subscriptions, because the scroll visibility\n // calculcations can be somewhat expensive.\n if (this._positionChanges.observers.length) {\n const scrollableViewProperties = this._getScrollVisibility();\n const changeEvent = new ConnectedOverlayPositionChange(position, scrollableViewProperties);\n this._positionChanges.next(changeEvent);\n }\n this._isInitialRender = false;\n }\n /** Sets the transform origin based on the configured selector and the passed-in position. */\n _setTransformOrigin(position) {\n if (!this._transformOriginSelector) {\n return;\n }\n const elements = this._boundingBox.querySelectorAll(this._transformOriginSelector);\n let xOrigin;\n let yOrigin = position.overlayY;\n if (position.overlayX === 'center') {\n xOrigin = 'center';\n }\n else if (this._isRtl()) {\n xOrigin = position.overlayX === 'start' ? 'right' : 'left';\n }\n else {\n xOrigin = position.overlayX === 'start' ? 'left' : 'right';\n }\n for (let i = 0; i < elements.length; i++) {\n elements[i].style.transformOrigin = `${xOrigin} ${yOrigin}`;\n }\n }\n /**\n * Gets the position and size of the overlay's sizing container.\n *\n * This method does no measuring and applies no styles so that we can cheaply compute the\n * bounds for all positions and choose the best fit based on these results.\n */\n _calculateBoundingBoxRect(origin, position) {\n const viewport = this._viewportRect;\n const isRtl = this._isRtl();\n let height, top, bottom;\n if (position.overlayY === 'top') {\n // Overlay is opening \"downward\" and thus is bound by the bottom viewport edge.\n top = origin.y;\n height = viewport.height - top + this._viewportMargin;\n }\n else if (position.overlayY === 'bottom') {\n // Overlay is opening \"upward\" and thus is bound by the top viewport edge. We need to add\n // the viewport margin back in, because the viewport rect is narrowed down to remove the\n // margin, whereas the `origin` position is calculated based on its `ClientRect`.\n bottom = viewport.height - origin.y + this._viewportMargin * 2;\n height = viewport.height - bottom + this._viewportMargin;\n }\n else {\n // If neither top nor bottom, it means that the overlay is vertically centered on the\n // origin point. Note that we want the position relative to the viewport, rather than\n // the page, which is why we don't use something like `viewport.bottom - origin.y` and\n // `origin.y - viewport.top`.\n const smallestDistanceToViewportEdge = Math.min(viewport.bottom - origin.y + viewport.top, origin.y);\n const previousHeight = this._lastBoundingBoxSize.height;\n height = smallestDistanceToViewportEdge * 2;\n top = origin.y - smallestDistanceToViewportEdge;\n if (height > previousHeight && !this._isInitialRender && !this._growAfterOpen) {\n top = origin.y - (previousHeight / 2);\n }\n }\n // The overlay is opening 'right-ward' (the content flows to the right).\n const isBoundedByRightViewportEdge = (position.overlayX === 'start' && !isRtl) ||\n (position.overlayX === 'end' && isRtl);\n // The overlay is opening 'left-ward' (the content flows to the left).\n const isBoundedByLeftViewportEdge = (position.overlayX === 'end' && !isRtl) ||\n (position.overlayX === 'start' && isRtl);\n let width, left, right;\n if (isBoundedByLeftViewportEdge) {\n right = viewport.width - origin.x + this._viewportMargin;\n width = origin.x - this._viewportMargin;\n }\n else if (isBoundedByRightViewportEdge) {\n left = origin.x;\n width = viewport.right - origin.x;\n }\n else {\n // If neither start nor end, it means that the overlay is horizontally centered on the\n // origin point. Note that we want the position relative to the viewport, rather than\n // the page, which is why we don't use something like `viewport.right - origin.x` and\n // `origin.x - viewport.left`.\n const smallestDistanceToViewportEdge = Math.min(viewport.right - origin.x + viewport.left, origin.x);\n const previousWidth = this._lastBoundingBoxSize.width;\n width = smallestDistanceToViewportEdge * 2;\n left = origin.x - smallestDistanceToViewportEdge;\n if (width > previousWidth && !this._isInitialRender && !this._growAfterOpen) {\n left = origin.x - (previousWidth / 2);\n }\n }\n return { top: top, left: left, bottom: bottom, right: right, width, height };\n }\n /**\n * Sets the position and size of the overlay's sizing wrapper. The wrapper is positioned on the\n * origin's connection point and stetches to the bounds of the viewport.\n *\n * @param origin The point on the origin element where the overlay is connected.\n * @param position The position preference\n */\n _setBoundingBoxStyles(origin, position) {\n const boundingBoxRect = this._calculateBoundingBoxRect(origin, position);\n // It's weird if the overlay *grows* while scrolling, so we take the last size into account\n // when applying a new size.\n if (!this._isInitialRender && !this._growAfterOpen) {\n boundingBoxRect.height = Math.min(boundingBoxRect.height, this._lastBoundingBoxSize.height);\n boundingBoxRect.width = Math.min(boundingBoxRect.width, this._lastBoundingBoxSize.width);\n }\n const styles = {};\n if (this._hasExactPosition()) {\n styles.top = styles.left = '0';\n styles.bottom = styles.right = styles.maxHeight = styles.maxWidth = '';\n styles.width = styles.height = '100%';\n }\n else {\n const maxHeight = this._overlayRef.getConfig().maxHeight;\n const maxWidth = this._overlayRef.getConfig().maxWidth;\n styles.height = coerceCssPixelValue(boundingBoxRect.height);\n styles.top = coerceCssPixelValue(boundingBoxRect.top);\n styles.bottom = coerceCssPixelValue(boundingBoxRect.bottom);\n styles.width = coerceCssPixelValue(boundingBoxRect.width);\n styles.left = coerceCssPixelValue(boundingBoxRect.left);\n styles.right = coerceCssPixelValue(boundingBoxRect.right);\n // Push the pane content towards the proper direction.\n if (position.overlayX === 'center') {\n styles.alignItems = 'center';\n }\n else {\n styles.alignItems = position.overlayX === 'end' ? 'flex-end' : 'flex-start';\n }\n if (position.overlayY === 'center') {\n styles.justifyContent = 'center';\n }\n else {\n styles.justifyContent = position.overlayY === 'bottom' ? 'flex-end' : 'flex-start';\n }\n if (maxHeight) {\n styles.maxHeight = coerceCssPixelValue(maxHeight);\n }\n if (maxWidth) {\n styles.maxWidth = coerceCssPixelValue(maxWidth);\n }\n }\n this._lastBoundingBoxSize = boundingBoxRect;\n extendStyles(this._boundingBox.style, styles);\n }\n /** Resets the styles for the bounding box so that a new positioning can be computed. */\n _resetBoundingBoxStyles() {\n extendStyles(this._boundingBox.style, {\n top: '0',\n left: '0',\n right: '0',\n bottom: '0',\n height: '',\n width: '',\n alignItems: '',\n justifyContent: '',\n });\n }\n /** Resets the styles for the overlay pane so that a new positioning can be computed. */\n _resetOverlayElementStyles() {\n extendStyles(this._pane.style, {\n top: '',\n left: '',\n bottom: '',\n right: '',\n position: '',\n transform: '',\n });\n }\n /** Sets positioning styles to the overlay element. */\n _setOverlayElementStyles(originPoint, position) {\n const styles = {};\n const hasExactPosition = this._hasExactPosition();\n const hasFlexibleDimensions = this._hasFlexibleDimensions;\n const config = this._overlayRef.getConfig();\n if (hasExactPosition) {\n const scrollPosition = this._viewportRuler.getViewportScrollPosition();\n extendStyles(styles, this._getExactOverlayY(position, originPoint, scrollPosition));\n extendStyles(styles, this._getExactOverlayX(position, originPoint, scrollPosition));\n }\n else {\n styles.position = 'static';\n }\n // Use a transform to apply the offsets. We do this because the `center` positions rely on\n // being in the normal flex flow and setting a `top` / `left` at all will completely throw\n // off the position. We also can't use margins, because they won't have an effect in some\n // cases where the element doesn't have anything to \"push off of\". Finally, this works\n // better both with flexible and non-flexible positioning.\n let transformString = '';\n let offsetX = this._getOffset(position, 'x');\n let offsetY = this._getOffset(position, 'y');\n if (offsetX) {\n transformString += `translateX(${offsetX}px) `;\n }\n if (offsetY) {\n transformString += `translateY(${offsetY}px)`;\n }\n styles.transform = transformString.trim();\n // If a maxWidth or maxHeight is specified on the overlay, we remove them. We do this because\n // we need these values to both be set to \"100%\" for the automatic flexible sizing to work.\n // The maxHeight and maxWidth are set on the boundingBox in order to enforce the constraint.\n // Note that this doesn't apply when we have an exact position, in which case we do want to\n // apply them because they'll be cleared from the bounding box.\n if (config.maxHeight) {\n if (hasExactPosition) {\n styles.maxHeight = coerceCssPixelValue(config.maxHeight);\n }\n else if (hasFlexibleDimensions) {\n styles.maxHeight = '';\n }\n }\n if (config.maxWidth) {\n if (hasExactPosition) {\n styles.maxWidth = coerceCssPixelValue(config.maxWidth);\n }\n else if (hasFlexibleDimensions) {\n styles.maxWidth = '';\n }\n }\n extendStyles(this._pane.style, styles);\n }\n /** Gets the exact top/bottom for the overlay when not using flexible sizing or when pushing. */\n _getExactOverlayY(position, originPoint, scrollPosition) {\n // Reset any existing styles. This is necessary in case the\n // preferred position has changed since the last `apply`.\n let styles = { top: '', bottom: '' };\n let overlayPoint = this._getOverlayPoint(originPoint, this._overlayRect, position);\n if (this._isPushed) {\n overlayPoint = this._pushOverlayOnScreen(overlayPoint, this._overlayRect, scrollPosition);\n }\n let virtualKeyboardOffset = this._overlayContainer.getContainerElement().getBoundingClientRect().top;\n // Normally this would be zero, however when the overlay is attached to an input (e.g. in an\n // autocomplete), mobile browsers will shift everything in order to put the input in the middle\n // of the screen and to make space for the virtual keyboard. We need to account for this offset,\n // otherwise our positioning will be thrown off.\n overlayPoint.y -= virtualKeyboardOffset;\n // We want to set either `top` or `bottom` based on whether the overlay wants to appear\n // above or below the origin and the direction in which the element will expand.\n if (position.overlayY === 'bottom') {\n // When using `bottom`, we adjust the y position such that it is the distance\n // from the bottom of the viewport rather than the top.\n const documentHeight = this._document.documentElement.clientHeight;\n styles.bottom = `${documentHeight - (overlayPoint.y + this._overlayRect.height)}px`;\n }\n else {\n styles.top = coerceCssPixelValue(overlayPoint.y);\n }\n return styles;\n }\n /** Gets the exact left/right for the overlay when not using flexible sizing or when pushing. */\n _getExactOverlayX(position, originPoint, scrollPosition) {\n // Reset any existing styles. This is necessary in case the preferred position has\n // changed since the last `apply`.\n let styles = { left: '', right: '' };\n let overlayPoint = this._getOverlayPoint(originPoint, this._overlayRect, position);\n if (this._isPushed) {\n overlayPoint = this._pushOverlayOnScreen(overlayPoint, this._overlayRect, scrollPosition);\n }\n // We want to set either `left` or `right` based on whether the overlay wants to appear \"before\"\n // or \"after\" the origin, which determines the direction in which the element will expand.\n // For the horizontal axis, the meaning of \"before\" and \"after\" change based on whether the\n // page is in RTL or LTR.\n let horizontalStyleProperty;\n if (this._isRtl()) {\n horizontalStyleProperty = position.overlayX === 'end' ? 'left' : 'right';\n }\n else {\n horizontalStyleProperty = position.overlayX === 'end' ? 'right' : 'left';\n }\n // When we're setting `right`, we adjust the x position such that it is the distance\n // from the right edge of the viewport rather than the left edge.\n if (horizontalStyleProperty === 'right') {\n const documentWidth = this._document.documentElement.clientWidth;\n styles.right = `${documentWidth - (overlayPoint.x + this._overlayRect.width)}px`;\n }\n else {\n styles.left = coerceCssPixelValue(overlayPoint.x);\n }\n return styles;\n }\n /**\n * Gets the view properties of the trigger and overlay, including whether they are clipped\n * or completely outside the view of any of the strategy's scrollables.\n */\n _getScrollVisibility() {\n // Note: needs fresh rects since the position could've changed.\n const originBounds = this._getOriginRect();\n const overlayBounds = this._pane.getBoundingClientRect();\n // TODO(jelbourn): instead of needing all of the client rects for these scrolling containers\n // every time, we should be able to use the scrollTop of the containers if the size of those\n // containers hasn't changed.\n const scrollContainerBounds = this._scrollables.map(scrollable => {\n return scrollable.getElementRef().nativeElement.getBoundingClientRect();\n });\n return {\n isOriginClipped: isElementClippedByScrolling(originBounds, scrollContainerBounds),\n isOriginOutsideView: isElementScrolledOutsideView(originBounds, scrollContainerBounds),\n isOverlayClipped: isElementClippedByScrolling(overlayBounds, scrollContainerBounds),\n isOverlayOutsideView: isElementScrolledOutsideView(overlayBounds, scrollContainerBounds),\n };\n }\n /** Subtracts the amount that an element is overflowing on an axis from its length. */\n _subtractOverflows(length, ...overflows) {\n return overflows.reduce((currentValue, currentOverflow) => {\n return currentValue - Math.max(currentOverflow, 0);\n }, length);\n }\n /** Narrows the given viewport rect by the current _viewportMargin. */\n _getNarrowedViewportRect() {\n // We recalculate the viewport rect here ourselves, rather than using the ViewportRuler,\n // because we want to use the `clientWidth` and `clientHeight` as the base. The difference\n // being that the client properties don't include the scrollbar, as opposed to `innerWidth`\n // and `innerHeight` that do. This is necessary, because the overlay container uses\n // 100% `width` and `height` which don't include the scrollbar either.\n const width = this._document.documentElement.clientWidth;\n const height = this._document.documentElement.clientHeight;\n const scrollPosition = this._viewportRuler.getViewportScrollPosition();\n return {\n top: scrollPosition.top + this._viewportMargin,\n left: scrollPosition.left + this._viewportMargin,\n right: scrollPosition.left + width - this._viewportMargin,\n bottom: scrollPosition.top + height - this._viewportMargin,\n width: width - (2 * this._viewportMargin),\n height: height - (2 * this._viewportMargin),\n };\n }\n /** Whether the we're dealing with an RTL context */\n _isRtl() {\n return this._overlayRef.getDirection() === 'rtl';\n }\n /** Determines whether the overlay uses exact or flexible positioning. */\n _hasExactPosition() {\n return !this._hasFlexibleDimensions || this._isPushed;\n }\n /** Retrieves the offset of a position along the x or y axis. */\n _getOffset(position, axis) {\n if (axis === 'x') {\n // We don't do something like `position['offset' + axis]` in\n // order to avoid breking minifiers that rename properties.\n return position.offsetX == null ? this._offsetX : position.offsetX;\n }\n return position.offsetY == null ? this._offsetY : position.offsetY;\n }\n /** Validates that the current position match the expected values. */\n _validatePositions() {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (!this._preferredPositions.length) {\n throw Error('FlexibleConnectedPositionStrategy: At least one position is required.');\n }\n // TODO(crisbeto): remove these once Angular's template type\n // checking is advanced enough to catch these cases.\n this._preferredPositions.forEach(pair => {\n validateHorizontalPosition('originX', pair.originX);\n validateVerticalPosition('originY', pair.originY);\n validateHorizontalPosition('overlayX', pair.overlayX);\n validateVerticalPosition('overlayY', pair.overlayY);\n });\n }\n }\n /** Adds a single CSS class or an array of classes on the overlay panel. */\n _addPanelClasses(cssClasses) {\n if (this._pane) {\n coerceArray(cssClasses).forEach(cssClass => {\n if (cssClass !== '' && this._appliedPanelClasses.indexOf(cssClass) === -1) {\n this._appliedPanelClasses.push(cssClass);\n this._pane.classList.add(cssClass);\n }\n });\n }\n }\n /** Clears the classes that the position strategy has applied from the overlay panel. */\n _clearPanelClasses() {\n if (this._pane) {\n this._appliedPanelClasses.forEach(cssClass => {\n this._pane.classList.remove(cssClass);\n });\n this._appliedPanelClasses = [];\n }\n }\n /** Returns the ClientRect of the current origin. */\n _getOriginRect() {\n const origin = this._origin;\n if (origin instanceof ElementRef) {\n return origin.nativeElement.getBoundingClientRect();\n }\n // Check for Element so SVG elements are also supported.\n if (origin instanceof Element) {\n return origin.getBoundingClientRect();\n }\n const width = origin.width || 0;\n const height = origin.height || 0;\n // If the origin is a point, return a client rect as if it was a 0x0 element at the point.\n return {\n top: origin.y,\n bottom: origin.y + height,\n left: origin.x,\n right: origin.x + width,\n height,\n width\n };\n }\n}\n/** Shallow-extends a stylesheet object with another stylesheet object. */\nfunction extendStyles(destination, source) {\n for (let key in source) {\n if (source.hasOwnProperty(key)) {\n destination[key] = source[key];\n }\n }\n return destination;\n}\n/**\n * Extracts the pixel value as a number from a value, if it's a number\n * or a CSS pixel string (e.g. `1337px`). Otherwise returns null.\n */\nfunction getPixelValue(input) {\n if (typeof input !== 'number' && input != null) {\n const [value, units] = input.split(cssUnitPattern);\n return (!units || units === 'px') ? parseFloat(value) : null;\n }\n return input || null;\n}\n/**\n * Gets a version of an element's bounding `ClientRect` where all the values are rounded down to\n * the nearest pixel. This allows us to account for the cases where there may be sub-pixel\n * deviations in the `ClientRect` returned by the browser (e.g. when zoomed in with a percentage\n * size, see #21350).\n */\nfunction getRoundedBoundingClientRect(clientRect) {\n return {\n top: Math.floor(clientRect.top),\n right: Math.floor(clientRect.right),\n bottom: Math.floor(clientRect.bottom),\n left: Math.floor(clientRect.left),\n width: Math.floor(clientRect.width),\n height: Math.floor(clientRect.height)\n };\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A strategy for positioning overlays. Using this strategy, an overlay is given an\n * implicit position relative to some origin element. The relative position is defined in terms of\n * a point on the origin element that is connected to a point on the overlay element. For example,\n * a basic dropdown is connecting the bottom-left corner of the origin to the top-left corner\n * of the overlay.\n * @deprecated Use `FlexibleConnectedPositionStrategy` instead.\n * @breaking-change 8.0.0\n */\nclass ConnectedPositionStrategy {\n constructor(originPos, overlayPos, connectedTo, viewportRuler, document, platform, overlayContainer) {\n /** Ordered list of preferred positions, from most to least desirable. */\n this._preferredPositions = [];\n // Since the `ConnectedPositionStrategy` is deprecated and we don't want to maintain\n // the extra logic, we create an instance of the positioning strategy that has some\n // defaults that make it behave as the old position strategy and to which we'll\n // proxy all of the API calls.\n this._positionStrategy = new FlexibleConnectedPositionStrategy(connectedTo, viewportRuler, document, platform, overlayContainer)\n .withFlexibleDimensions(false)\n .withPush(false)\n .withViewportMargin(0);\n this.withFallbackPosition(originPos, overlayPos);\n this.onPositionChange = this._positionStrategy.positionChanges;\n }\n /** Ordered list of preferred positions, from most to least desirable. */\n get positions() {\n return this._preferredPositions;\n }\n /** Attach this position strategy to an overlay. */\n attach(overlayRef) {\n this._overlayRef = overlayRef;\n this._positionStrategy.attach(overlayRef);\n if (this._direction) {\n overlayRef.setDirection(this._direction);\n this._direction = null;\n }\n }\n /** Disposes all resources used by the position strategy. */\n dispose() {\n this._positionStrategy.dispose();\n }\n /** @docs-private */\n detach() {\n this._positionStrategy.detach();\n }\n /**\n * Updates the position of the overlay element, using whichever preferred position relative\n * to the origin fits on-screen.\n * @docs-private\n */\n apply() {\n this._positionStrategy.apply();\n }\n /**\n * Re-positions the overlay element with the trigger in its last calculated position,\n * even if a position higher in the \"preferred positions\" list would now fit. This\n * allows one to re-align the panel without changing the orientation of the panel.\n */\n recalculateLastPosition() {\n this._positionStrategy.reapplyLastPosition();\n }\n /**\n * Sets the list of Scrollable containers that host the origin element so that\n * on reposition we can evaluate if it or the overlay has been clipped or outside view. Every\n * Scrollable must be an ancestor element of the strategy's origin element.\n */\n withScrollableContainers(scrollables) {\n this._positionStrategy.withScrollableContainers(scrollables);\n }\n /**\n * Adds a new preferred fallback position.\n * @param originPos\n * @param overlayPos\n */\n withFallbackPosition(originPos, overlayPos, offsetX, offsetY) {\n const position = new ConnectionPositionPair(originPos, overlayPos, offsetX, offsetY);\n this._preferredPositions.push(position);\n this._positionStrategy.withPositions(this._preferredPositions);\n return this;\n }\n /**\n * Sets the layout direction so the overlay's position can be adjusted to match.\n * @param dir New layout direction.\n */\n withDirection(dir) {\n // Since the direction might be declared before the strategy is attached,\n // we save the value in a temporary property and we'll transfer it to the\n // overlay ref on attachment.\n if (this._overlayRef) {\n this._overlayRef.setDirection(dir);\n }\n else {\n this._direction = dir;\n }\n return this;\n }\n /**\n * Sets an offset for the overlay's connection point on the x-axis\n * @param offset New offset in the X axis.\n */\n withOffsetX(offset) {\n this._positionStrategy.withDefaultOffsetX(offset);\n return this;\n }\n /**\n * Sets an offset for the overlay's connection point on the y-axis\n * @param offset New offset in the Y axis.\n */\n withOffsetY(offset) {\n this._positionStrategy.withDefaultOffsetY(offset);\n return this;\n }\n /**\n * Sets whether the overlay's position should be locked in after it is positioned\n * initially. When an overlay is locked in, it won't attempt to reposition itself\n * when the position is re-applied (e.g. when the user scrolls away).\n * @param isLocked Whether the overlay should locked in.\n */\n withLockedPosition(isLocked) {\n this._positionStrategy.withLockedPosition(isLocked);\n return this;\n }\n /**\n * Overwrites the current set of positions with an array of new ones.\n * @param positions Position pairs to be set on the strategy.\n */\n withPositions(positions) {\n this._preferredPositions = positions.slice();\n this._positionStrategy.withPositions(this._preferredPositions);\n return this;\n }\n /**\n * Sets the origin element, relative to which to position the overlay.\n * @param origin Reference to the new origin element.\n */\n setOrigin(origin) {\n this._positionStrategy.setOrigin(origin);\n return this;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Class to be added to the overlay pane wrapper. */\nconst wrapperClass = 'cdk-global-overlay-wrapper';\n/**\n * A strategy for positioning overlays. Using this strategy, an overlay is given an\n * explicit position relative to the browser's viewport. We use flexbox, instead of\n * transforms, in order to avoid issues with subpixel rendering which can cause the\n * element to become blurry.\n */\nclass GlobalPositionStrategy {\n constructor() {\n this._cssPosition = 'static';\n this._topOffset = '';\n this._bottomOffset = '';\n this._leftOffset = '';\n this._rightOffset = '';\n this._alignItems = '';\n this._justifyContent = '';\n this._width = '';\n this._height = '';\n }\n attach(overlayRef) {\n const config = overlayRef.getConfig();\n this._overlayRef = overlayRef;\n if (this._width && !config.width) {\n overlayRef.updateSize({ width: this._width });\n }\n if (this._height && !config.height) {\n overlayRef.updateSize({ height: this._height });\n }\n overlayRef.hostElement.classList.add(wrapperClass);\n this._isDisposed = false;\n }\n /**\n * Sets the top position of the overlay. Clears any previously set vertical position.\n * @param value New top offset.\n */\n top(value = '') {\n this._bottomOffset = '';\n this._topOffset = value;\n this._alignItems = 'flex-start';\n return this;\n }\n /**\n * Sets the left position of the overlay. Clears any previously set horizontal position.\n * @param value New left offset.\n */\n left(value = '') {\n this._rightOffset = '';\n this._leftOffset = value;\n this._justifyContent = 'flex-start';\n return this;\n }\n /**\n * Sets the bottom position of the overlay. Clears any previously set vertical position.\n * @param value New bottom offset.\n */\n bottom(value = '') {\n this._topOffset = '';\n this._bottomOffset = value;\n this._alignItems = 'flex-end';\n return this;\n }\n /**\n * Sets the right position of the overlay. Clears any previously set horizontal position.\n * @param value New right offset.\n */\n right(value = '') {\n this._leftOffset = '';\n this._rightOffset = value;\n this._justifyContent = 'flex-end';\n return this;\n }\n /**\n * Sets the overlay width and clears any previously set width.\n * @param value New width for the overlay\n * @deprecated Pass the `width` through the `OverlayConfig`.\n * @breaking-change 8.0.0\n */\n width(value = '') {\n if (this._overlayRef) {\n this._overlayRef.updateSize({ width: value });\n }\n else {\n this._width = value;\n }\n return this;\n }\n /**\n * Sets the overlay height and clears any previously set height.\n * @param value New height for the overlay\n * @deprecated Pass the `height` through the `OverlayConfig`.\n * @breaking-change 8.0.0\n */\n height(value = '') {\n if (this._overlayRef) {\n this._overlayRef.updateSize({ height: value });\n }\n else {\n this._height = value;\n }\n return this;\n }\n /**\n * Centers the overlay horizontally with an optional offset.\n * Clears any previously set horizontal position.\n *\n * @param offset Overlay offset from the horizontal center.\n */\n centerHorizontally(offset = '') {\n this.left(offset);\n this._justifyContent = 'center';\n return this;\n }\n /**\n * Centers the overlay vertically with an optional offset.\n * Clears any previously set vertical position.\n *\n * @param offset Overlay offset from the vertical center.\n */\n centerVertically(offset = '') {\n this.top(offset);\n this._alignItems = 'center';\n return this;\n }\n /**\n * Apply the position to the element.\n * @docs-private\n */\n apply() {\n // Since the overlay ref applies the strategy asynchronously, it could\n // have been disposed before it ends up being applied. If that is the\n // case, we shouldn't do anything.\n if (!this._overlayRef || !this._overlayRef.hasAttached()) {\n return;\n }\n const styles = this._overlayRef.overlayElement.style;\n const parentStyles = this._overlayRef.hostElement.style;\n const config = this._overlayRef.getConfig();\n const { width, height, maxWidth, maxHeight } = config;\n const shouldBeFlushHorizontally = (width === '100%' || width === '100vw') &&\n (!maxWidth || maxWidth === '100%' || maxWidth === '100vw');\n const shouldBeFlushVertically = (height === '100%' || height === '100vh') &&\n (!maxHeight || maxHeight === '100%' || maxHeight === '100vh');\n styles.position = this._cssPosition;\n styles.marginLeft = shouldBeFlushHorizontally ? '0' : this._leftOffset;\n styles.marginTop = shouldBeFlushVertically ? '0' : this._topOffset;\n styles.marginBottom = this._bottomOffset;\n styles.marginRight = this._rightOffset;\n if (shouldBeFlushHorizontally) {\n parentStyles.justifyContent = 'flex-start';\n }\n else if (this._justifyContent === 'center') {\n parentStyles.justifyContent = 'center';\n }\n else if (this._overlayRef.getConfig().direction === 'rtl') {\n // In RTL the browser will invert `flex-start` and `flex-end` automatically, but we\n // don't want that because our positioning is explicitly `left` and `right`, hence\n // why we do another inversion to ensure that the overlay stays in the same position.\n // TODO: reconsider this if we add `start` and `end` methods.\n if (this._justifyContent === 'flex-start') {\n parentStyles.justifyContent = 'flex-end';\n }\n else if (this._justifyContent === 'flex-end') {\n parentStyles.justifyContent = 'flex-start';\n }\n }\n else {\n parentStyles.justifyContent = this._justifyContent;\n }\n parentStyles.alignItems = shouldBeFlushVertically ? 'flex-start' : this._alignItems;\n }\n /**\n * Cleans up the DOM changes from the position strategy.\n * @docs-private\n */\n dispose() {\n if (this._isDisposed || !this._overlayRef) {\n return;\n }\n const styles = this._overlayRef.overlayElement.style;\n const parent = this._overlayRef.hostElement;\n const parentStyles = parent.style;\n parent.classList.remove(wrapperClass);\n parentStyles.justifyContent = parentStyles.alignItems = styles.marginTop =\n styles.marginBottom = styles.marginLeft = styles.marginRight = styles.position = '';\n this._overlayRef = null;\n this._isDisposed = true;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Builder for overlay position strategy. */\nclass OverlayPositionBuilder {\n constructor(_viewportRuler, _document, _platform, _overlayContainer) {\n this._viewportRuler = _viewportRuler;\n this._document = _document;\n this._platform = _platform;\n this._overlayContainer = _overlayContainer;\n }\n /**\n * Creates a global position strategy.\n */\n global() {\n return new GlobalPositionStrategy();\n }\n /**\n * Creates a relative position strategy.\n * @param elementRef\n * @param originPos\n * @param overlayPos\n * @deprecated Use `flexibleConnectedTo` instead.\n * @breaking-change 8.0.0\n */\n connectedTo(elementRef, originPos, overlayPos) {\n return new ConnectedPositionStrategy(originPos, overlayPos, elementRef, this._viewportRuler, this._document, this._platform, this._overlayContainer);\n }\n /**\n * Creates a flexible position strategy.\n * @param origin Origin relative to which to position the overlay.\n */\n flexibleConnectedTo(origin) {\n return new FlexibleConnectedPositionStrategy(origin, this._viewportRuler, this._document, this._platform, this._overlayContainer);\n }\n}\nOverlayPositionBuilder.ɵfac = function OverlayPositionBuilder_Factory(t) { return new (t || OverlayPositionBuilder)(ɵngcc0.ɵɵinject(ɵngcc1.ViewportRuler), ɵngcc0.ɵɵinject(DOCUMENT), ɵngcc0.ɵɵinject(ɵngcc2.Platform), ɵngcc0.ɵɵinject(OverlayContainer)); };\nOverlayPositionBuilder.ɵprov = i0.ɵɵdefineInjectable({ factory: function OverlayPositionBuilder_Factory() { return new OverlayPositionBuilder(i0.ɵɵinject(i1.ViewportRuler), i0.ɵɵinject(i1$1.DOCUMENT), i0.ɵɵinject(i2.Platform), i0.ɵɵinject(OverlayContainer)); }, token: OverlayPositionBuilder, providedIn: \"root\" });\nOverlayPositionBuilder.ctorParameters = () => [\n { type: ViewportRuler },\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] },\n { type: Platform },\n { type: OverlayContainer }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(OverlayPositionBuilder, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: ɵngcc1.ViewportRuler }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: ɵngcc2.Platform }, { type: OverlayContainer }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Next overlay unique ID. */\nlet nextUniqueId = 0;\n// Note that Overlay is *not* scoped to the app root because of the ComponentFactoryResolver\n// which needs to be different depending on where OverlayModule is imported.\n/**\n * Service to create Overlays. Overlays are dynamically added pieces of floating UI, meant to be\n * used as a low-level building block for other components. Dialogs, tooltips, menus,\n * selects, etc. can all be built using overlays. The service should primarily be used by authors\n * of re-usable components rather than developers building end-user applications.\n *\n * An overlay *is* a PortalOutlet, so any kind of Portal can be loaded into one.\n */\nclass Overlay {\n constructor(\n /** Scrolling strategies that can be used when creating an overlay. */\n scrollStrategies, _overlayContainer, _componentFactoryResolver, _positionBuilder, _keyboardDispatcher, _injector, _ngZone, _document, _directionality, _location, _outsideClickDispatcher) {\n this.scrollStrategies = scrollStrategies;\n this._overlayContainer = _overlayContainer;\n this._componentFactoryResolver = _componentFactoryResolver;\n this._positionBuilder = _positionBuilder;\n this._keyboardDispatcher = _keyboardDispatcher;\n this._injector = _injector;\n this._ngZone = _ngZone;\n this._document = _document;\n this._directionality = _directionality;\n this._location = _location;\n this._outsideClickDispatcher = _outsideClickDispatcher;\n }\n /**\n * Creates an overlay.\n * @param config Configuration applied to the overlay.\n * @returns Reference to the created overlay.\n */\n create(config) {\n const host = this._createHostElement();\n const pane = this._createPaneElement(host);\n const portalOutlet = this._createPortalOutlet(pane);\n const overlayConfig = new OverlayConfig(config);\n overlayConfig.direction = overlayConfig.direction || this._directionality.value;\n return new OverlayRef(portalOutlet, host, pane, overlayConfig, this._ngZone, this._keyboardDispatcher, this._document, this._location, this._outsideClickDispatcher);\n }\n /**\n * Gets a position builder that can be used, via fluent API,\n * to construct and configure a position strategy.\n * @returns An overlay position builder.\n */\n position() {\n return this._positionBuilder;\n }\n /**\n * Creates the DOM element for an overlay and appends it to the overlay container.\n * @returns Newly-created pane element\n */\n _createPaneElement(host) {\n const pane = this._document.createElement('div');\n pane.id = `cdk-overlay-${nextUniqueId++}`;\n pane.classList.add('cdk-overlay-pane');\n host.appendChild(pane);\n return pane;\n }\n /**\n * Creates the host element that wraps around an overlay\n * and can be used for advanced positioning.\n * @returns Newly-create host element.\n */\n _createHostElement() {\n const host = this._document.createElement('div');\n this._overlayContainer.getContainerElement().appendChild(host);\n return host;\n }\n /**\n * Create a DomPortalOutlet into which the overlay content can be loaded.\n * @param pane The DOM element to turn into a portal outlet.\n * @returns A portal outlet for the given DOM element.\n */\n _createPortalOutlet(pane) {\n // We have to resolve the ApplicationRef later in order to allow people\n // to use overlay-based providers during app initialization.\n if (!this._appRef) {\n this._appRef = this._injector.get(ApplicationRef);\n }\n return new DomPortalOutlet(pane, this._componentFactoryResolver, this._appRef, this._injector, this._document);\n }\n}\nOverlay.ɵfac = function Overlay_Factory(t) { return new (t || Overlay)(ɵngcc0.ɵɵinject(ScrollStrategyOptions), ɵngcc0.ɵɵinject(OverlayContainer), ɵngcc0.ɵɵinject(ɵngcc0.ComponentFactoryResolver), ɵngcc0.ɵɵinject(OverlayPositionBuilder), ɵngcc0.ɵɵinject(OverlayKeyboardDispatcher), ɵngcc0.ɵɵinject(ɵngcc0.Injector), ɵngcc0.ɵɵinject(ɵngcc0.NgZone), ɵngcc0.ɵɵinject(DOCUMENT), ɵngcc0.ɵɵinject(ɵngcc3.Directionality), ɵngcc0.ɵɵinject(ɵngcc4.Location), ɵngcc0.ɵɵinject(OverlayOutsideClickDispatcher)); };\nOverlay.ɵprov = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjectable({ token: Overlay, factory: Overlay.ɵfac });\nOverlay.ctorParameters = () => [\n { type: ScrollStrategyOptions },\n { type: OverlayContainer },\n { type: ComponentFactoryResolver },\n { type: OverlayPositionBuilder },\n { type: OverlayKeyboardDispatcher },\n { type: Injector },\n { type: NgZone },\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] },\n { type: Directionality },\n { type: Location },\n { type: OverlayOutsideClickDispatcher }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(Overlay, [{\n type: Injectable\n }], function () { return [{ type: ScrollStrategyOptions }, { type: OverlayContainer }, { type: ɵngcc0.ComponentFactoryResolver }, { type: OverlayPositionBuilder }, { type: OverlayKeyboardDispatcher }, { type: ɵngcc0.Injector }, { type: ɵngcc0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: ɵngcc3.Directionality }, { type: ɵngcc4.Location }, { type: OverlayOutsideClickDispatcher }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Default set of positions for the overlay. Follows the behavior of a dropdown. */\nconst defaultPositionList = [\n {\n originX: 'start',\n originY: 'bottom',\n overlayX: 'start',\n overlayY: 'top'\n },\n {\n originX: 'start',\n originY: 'top',\n overlayX: 'start',\n overlayY: 'bottom'\n },\n {\n originX: 'end',\n originY: 'top',\n overlayX: 'end',\n overlayY: 'bottom'\n },\n {\n originX: 'end',\n originY: 'bottom',\n overlayX: 'end',\n overlayY: 'top'\n }\n];\n/** Injection token that determines the scroll handling while the connected overlay is open. */\nconst CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY = new InjectionToken('cdk-connected-overlay-scroll-strategy');\n/**\n * Directive applied to an element to make it usable as an origin for an Overlay using a\n * ConnectedPositionStrategy.\n */\nclass CdkOverlayOrigin {\n constructor(\n /** Reference to the element on which the directive is applied. */\n elementRef) {\n this.elementRef = elementRef;\n }\n}\nCdkOverlayOrigin.ɵfac = function CdkOverlayOrigin_Factory(t) { return new (t || CdkOverlayOrigin)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef)); };\nCdkOverlayOrigin.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkOverlayOrigin, selectors: [[\"\", \"cdk-overlay-origin\", \"\"], [\"\", \"overlay-origin\", \"\"], [\"\", \"cdkOverlayOrigin\", \"\"]], exportAs: [\"cdkOverlayOrigin\"] });\nCdkOverlayOrigin.ctorParameters = () => [\n { type: ElementRef }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkOverlayOrigin, [{\n type: Directive,\n args: [{\n selector: '[cdk-overlay-origin], [overlay-origin], [cdkOverlayOrigin]',\n exportAs: 'cdkOverlayOrigin'\n }]\n }], function () { return [{ type: ɵngcc0.ElementRef }]; }, null); })();\n/**\n * Directive to facilitate declarative creation of an\n * Overlay using a FlexibleConnectedPositionStrategy.\n */\nclass CdkConnectedOverlay {\n // TODO(jelbourn): inputs for size, scroll behavior, animation, etc.\n constructor(_overlay, templateRef, viewContainerRef, scrollStrategyFactory, _dir) {\n this._overlay = _overlay;\n this._dir = _dir;\n this._hasBackdrop = false;\n this._lockPosition = false;\n this._growAfterOpen = false;\n this._flexibleDimensions = false;\n this._push = false;\n this._backdropSubscription = Subscription.EMPTY;\n this._attachSubscription = Subscription.EMPTY;\n this._detachSubscription = Subscription.EMPTY;\n this._positionSubscription = Subscription.EMPTY;\n /** Margin between the overlay and the viewport edges. */\n this.viewportMargin = 0;\n /** Whether the overlay is open. */\n this.open = false;\n /** Whether the overlay can be closed by user interaction. */\n this.disableClose = false;\n /** Event emitted when the backdrop is clicked. */\n this.backdropClick = new EventEmitter();\n /** Event emitted when the position has changed. */\n this.positionChange = new EventEmitter();\n /** Event emitted when the overlay has been attached. */\n this.attach = new EventEmitter();\n /** Event emitted when the overlay has been detached. */\n this.detach = new EventEmitter();\n /** Emits when there are keyboard events that are targeted at the overlay. */\n this.overlayKeydown = new EventEmitter();\n /** Emits when there are mouse outside click events that are targeted at the overlay. */\n this.overlayOutsideClick = new EventEmitter();\n this._templatePortal = new TemplatePortal(templateRef, viewContainerRef);\n this._scrollStrategyFactory = scrollStrategyFactory;\n this.scrollStrategy = this._scrollStrategyFactory();\n }\n /** The offset in pixels for the overlay connection point on the x-axis */\n get offsetX() { return this._offsetX; }\n set offsetX(offsetX) {\n this._offsetX = offsetX;\n if (this._position) {\n this._updatePositionStrategy(this._position);\n }\n }\n /** The offset in pixels for the overlay connection point on the y-axis */\n get offsetY() { return this._offsetY; }\n set offsetY(offsetY) {\n this._offsetY = offsetY;\n if (this._position) {\n this._updatePositionStrategy(this._position);\n }\n }\n /** Whether or not the overlay should attach a backdrop. */\n get hasBackdrop() { return this._hasBackdrop; }\n set hasBackdrop(value) { this._hasBackdrop = coerceBooleanProperty(value); }\n /** Whether or not the overlay should be locked when scrolling. */\n get lockPosition() { return this._lockPosition; }\n set lockPosition(value) { this._lockPosition = coerceBooleanProperty(value); }\n /** Whether the overlay's width and height can be constrained to fit within the viewport. */\n get flexibleDimensions() { return this._flexibleDimensions; }\n set flexibleDimensions(value) {\n this._flexibleDimensions = coerceBooleanProperty(value);\n }\n /** Whether the overlay can grow after the initial open when flexible positioning is turned on. */\n get growAfterOpen() { return this._growAfterOpen; }\n set growAfterOpen(value) { this._growAfterOpen = coerceBooleanProperty(value); }\n /** Whether the overlay can be pushed on-screen if none of the provided positions fit. */\n get push() { return this._push; }\n set push(value) { this._push = coerceBooleanProperty(value); }\n /** The associated overlay reference. */\n get overlayRef() {\n return this._overlayRef;\n }\n /** The element's layout direction. */\n get dir() {\n return this._dir ? this._dir.value : 'ltr';\n }\n ngOnDestroy() {\n this._attachSubscription.unsubscribe();\n this._detachSubscription.unsubscribe();\n this._backdropSubscription.unsubscribe();\n this._positionSubscription.unsubscribe();\n if (this._overlayRef) {\n this._overlayRef.dispose();\n }\n }\n ngOnChanges(changes) {\n if (this._position) {\n this._updatePositionStrategy(this._position);\n this._overlayRef.updateSize({\n width: this.width,\n minWidth: this.minWidth,\n height: this.height,\n minHeight: this.minHeight,\n });\n if (changes['origin'] && this.open) {\n this._position.apply();\n }\n }\n if (changes['open']) {\n this.open ? this._attachOverlay() : this._detachOverlay();\n }\n }\n /** Creates an overlay */\n _createOverlay() {\n if (!this.positions || !this.positions.length) {\n this.positions = defaultPositionList;\n }\n const overlayRef = this._overlayRef = this._overlay.create(this._buildConfig());\n this._attachSubscription = overlayRef.attachments().subscribe(() => this.attach.emit());\n this._detachSubscription = overlayRef.detachments().subscribe(() => this.detach.emit());\n overlayRef.keydownEvents().subscribe((event) => {\n this.overlayKeydown.next(event);\n if (event.keyCode === ESCAPE && !this.disableClose && !hasModifierKey(event)) {\n event.preventDefault();\n this._detachOverlay();\n }\n });\n this._overlayRef.outsidePointerEvents().subscribe((event) => {\n this.overlayOutsideClick.next(event);\n });\n }\n /** Builds the overlay config based on the directive's inputs */\n _buildConfig() {\n const positionStrategy = this._position =\n this.positionStrategy || this._createPositionStrategy();\n const overlayConfig = new OverlayConfig({\n direction: this._dir,\n positionStrategy,\n scrollStrategy: this.scrollStrategy,\n hasBackdrop: this.hasBackdrop\n });\n if (this.width || this.width === 0) {\n overlayConfig.width = this.width;\n }\n if (this.height || this.height === 0) {\n overlayConfig.height = this.height;\n }\n if (this.minWidth || this.minWidth === 0) {\n overlayConfig.minWidth = this.minWidth;\n }\n if (this.minHeight || this.minHeight === 0) {\n overlayConfig.minHeight = this.minHeight;\n }\n if (this.backdropClass) {\n overlayConfig.backdropClass = this.backdropClass;\n }\n if (this.panelClass) {\n overlayConfig.panelClass = this.panelClass;\n }\n return overlayConfig;\n }\n /** Updates the state of a position strategy, based on the values of the directive inputs. */\n _updatePositionStrategy(positionStrategy) {\n const positions = this.positions.map(currentPosition => ({\n originX: currentPosition.originX,\n originY: currentPosition.originY,\n overlayX: currentPosition.overlayX,\n overlayY: currentPosition.overlayY,\n offsetX: currentPosition.offsetX || this.offsetX,\n offsetY: currentPosition.offsetY || this.offsetY,\n panelClass: currentPosition.panelClass || undefined,\n }));\n return positionStrategy\n .setOrigin(this.origin.elementRef)\n .withPositions(positions)\n .withFlexibleDimensions(this.flexibleDimensions)\n .withPush(this.push)\n .withGrowAfterOpen(this.growAfterOpen)\n .withViewportMargin(this.viewportMargin)\n .withLockedPosition(this.lockPosition)\n .withTransformOriginOn(this.transformOriginSelector);\n }\n /** Returns the position strategy of the overlay to be set on the overlay config */\n _createPositionStrategy() {\n const strategy = this._overlay.position().flexibleConnectedTo(this.origin.elementRef);\n this._updatePositionStrategy(strategy);\n return strategy;\n }\n /** Attaches the overlay and subscribes to backdrop clicks if backdrop exists */\n _attachOverlay() {\n if (!this._overlayRef) {\n this._createOverlay();\n }\n else {\n // Update the overlay size, in case the directive's inputs have changed\n this._overlayRef.getConfig().hasBackdrop = this.hasBackdrop;\n }\n if (!this._overlayRef.hasAttached()) {\n this._overlayRef.attach(this._templatePortal);\n }\n if (this.hasBackdrop) {\n this._backdropSubscription = this._overlayRef.backdropClick().subscribe(event => {\n this.backdropClick.emit(event);\n });\n }\n else {\n this._backdropSubscription.unsubscribe();\n }\n this._positionSubscription.unsubscribe();\n // Only subscribe to `positionChanges` if requested, because putting\n // together all the information for it can be expensive.\n if (this.positionChange.observers.length > 0) {\n this._positionSubscription = this._position.positionChanges\n .pipe(takeWhile(() => this.positionChange.observers.length > 0))\n .subscribe(position => {\n this.positionChange.emit(position);\n if (this.positionChange.observers.length === 0) {\n this._positionSubscription.unsubscribe();\n }\n });\n }\n }\n /** Detaches the overlay and unsubscribes to backdrop clicks if backdrop exists */\n _detachOverlay() {\n if (this._overlayRef) {\n this._overlayRef.detach();\n }\n this._backdropSubscription.unsubscribe();\n this._positionSubscription.unsubscribe();\n }\n}\nCdkConnectedOverlay.ɵfac = function CdkConnectedOverlay_Factory(t) { return new (t || CdkConnectedOverlay)(ɵngcc0.ɵɵdirectiveInject(Overlay), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef), ɵngcc0.ɵɵdirectiveInject(CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY), ɵngcc0.ɵɵdirectiveInject(ɵngcc3.Directionality, 8)); };\nCdkConnectedOverlay.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkConnectedOverlay, selectors: [[\"\", \"cdk-connected-overlay\", \"\"], [\"\", \"connected-overlay\", \"\"], [\"\", \"cdkConnectedOverlay\", \"\"]], inputs: { viewportMargin: [\"cdkConnectedOverlayViewportMargin\", \"viewportMargin\"], open: [\"cdkConnectedOverlayOpen\", \"open\"], disableClose: [\"cdkConnectedOverlayDisableClose\", \"disableClose\"], scrollStrategy: [\"cdkConnectedOverlayScrollStrategy\", \"scrollStrategy\"], offsetX: [\"cdkConnectedOverlayOffsetX\", \"offsetX\"], offsetY: [\"cdkConnectedOverlayOffsetY\", \"offsetY\"], hasBackdrop: [\"cdkConnectedOverlayHasBackdrop\", \"hasBackdrop\"], lockPosition: [\"cdkConnectedOverlayLockPosition\", \"lockPosition\"], flexibleDimensions: [\"cdkConnectedOverlayFlexibleDimensions\", \"flexibleDimensions\"], growAfterOpen: [\"cdkConnectedOverlayGrowAfterOpen\", \"growAfterOpen\"], push: [\"cdkConnectedOverlayPush\", \"push\"], positions: [\"cdkConnectedOverlayPositions\", \"positions\"], origin: [\"cdkConnectedOverlayOrigin\", \"origin\"], positionStrategy: [\"cdkConnectedOverlayPositionStrategy\", \"positionStrategy\"], width: [\"cdkConnectedOverlayWidth\", \"width\"], height: [\"cdkConnectedOverlayHeight\", \"height\"], minWidth: [\"cdkConnectedOverlayMinWidth\", \"minWidth\"], minHeight: [\"cdkConnectedOverlayMinHeight\", \"minHeight\"], backdropClass: [\"cdkConnectedOverlayBackdropClass\", \"backdropClass\"], panelClass: [\"cdkConnectedOverlayPanelClass\", \"panelClass\"], transformOriginSelector: [\"cdkConnectedOverlayTransformOriginOn\", \"transformOriginSelector\"] }, outputs: { backdropClick: \"backdropClick\", positionChange: \"positionChange\", attach: \"attach\", detach: \"detach\", overlayKeydown: \"overlayKeydown\", overlayOutsideClick: \"overlayOutsideClick\" }, exportAs: [\"cdkConnectedOverlay\"], features: [ɵngcc0.ɵɵNgOnChangesFeature] });\nCdkConnectedOverlay.ctorParameters = () => [\n { type: Overlay },\n { type: TemplateRef },\n { type: ViewContainerRef },\n { type: undefined, decorators: [{ type: Inject, args: [CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY,] }] },\n { type: Directionality, decorators: [{ type: Optional }] }\n];\nCdkConnectedOverlay.propDecorators = {\n origin: [{ type: Input, args: ['cdkConnectedOverlayOrigin',] }],\n positions: [{ type: Input, args: ['cdkConnectedOverlayPositions',] }],\n positionStrategy: [{ type: Input, args: ['cdkConnectedOverlayPositionStrategy',] }],\n offsetX: [{ type: Input, args: ['cdkConnectedOverlayOffsetX',] }],\n offsetY: [{ type: Input, args: ['cdkConnectedOverlayOffsetY',] }],\n width: [{ type: Input, args: ['cdkConnectedOverlayWidth',] }],\n height: [{ type: Input, args: ['cdkConnectedOverlayHeight',] }],\n minWidth: [{ type: Input, args: ['cdkConnectedOverlayMinWidth',] }],\n minHeight: [{ type: Input, args: ['cdkConnectedOverlayMinHeight',] }],\n backdropClass: [{ type: Input, args: ['cdkConnectedOverlayBackdropClass',] }],\n panelClass: [{ type: Input, args: ['cdkConnectedOverlayPanelClass',] }],\n viewportMargin: [{ type: Input, args: ['cdkConnectedOverlayViewportMargin',] }],\n scrollStrategy: [{ type: Input, args: ['cdkConnectedOverlayScrollStrategy',] }],\n open: [{ type: Input, args: ['cdkConnectedOverlayOpen',] }],\n disableClose: [{ type: Input, args: ['cdkConnectedOverlayDisableClose',] }],\n transformOriginSelector: [{ type: Input, args: ['cdkConnectedOverlayTransformOriginOn',] }],\n hasBackdrop: [{ type: Input, args: ['cdkConnectedOverlayHasBackdrop',] }],\n lockPosition: [{ type: Input, args: ['cdkConnectedOverlayLockPosition',] }],\n flexibleDimensions: [{ type: Input, args: ['cdkConnectedOverlayFlexibleDimensions',] }],\n growAfterOpen: [{ type: Input, args: ['cdkConnectedOverlayGrowAfterOpen',] }],\n push: [{ type: Input, args: ['cdkConnectedOverlayPush',] }],\n backdropClick: [{ type: Output }],\n positionChange: [{ type: Output }],\n attach: [{ type: Output }],\n detach: [{ type: Output }],\n overlayKeydown: [{ type: Output }],\n overlayOutsideClick: [{ type: Output }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkConnectedOverlay, [{\n type: Directive,\n args: [{\n selector: '[cdk-connected-overlay], [connected-overlay], [cdkConnectedOverlay]',\n exportAs: 'cdkConnectedOverlay'\n }]\n }], function () { return [{ type: Overlay }, { type: ɵngcc0.TemplateRef }, { type: ɵngcc0.ViewContainerRef }, { type: undefined, decorators: [{\n type: Inject,\n args: [CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY]\n }] }, { type: ɵngcc3.Directionality, decorators: [{\n type: Optional\n }] }]; }, { viewportMargin: [{\n type: Input,\n args: ['cdkConnectedOverlayViewportMargin']\n }], open: [{\n type: Input,\n args: ['cdkConnectedOverlayOpen']\n }], disableClose: [{\n type: Input,\n args: ['cdkConnectedOverlayDisableClose']\n }], backdropClick: [{\n type: Output\n }], positionChange: [{\n type: Output\n }], attach: [{\n type: Output\n }], detach: [{\n type: Output\n }], overlayKeydown: [{\n type: Output\n }], overlayOutsideClick: [{\n type: Output\n }], scrollStrategy: [{\n type: Input,\n args: ['cdkConnectedOverlayScrollStrategy']\n }], offsetX: [{\n type: Input,\n args: ['cdkConnectedOverlayOffsetX']\n }], offsetY: [{\n type: Input,\n args: ['cdkConnectedOverlayOffsetY']\n }], hasBackdrop: [{\n type: Input,\n args: ['cdkConnectedOverlayHasBackdrop']\n }], lockPosition: [{\n type: Input,\n args: ['cdkConnectedOverlayLockPosition']\n }], flexibleDimensions: [{\n type: Input,\n args: ['cdkConnectedOverlayFlexibleDimensions']\n }], growAfterOpen: [{\n type: Input,\n args: ['cdkConnectedOverlayGrowAfterOpen']\n }], push: [{\n type: Input,\n args: ['cdkConnectedOverlayPush']\n }], positions: [{\n type: Input,\n args: ['cdkConnectedOverlayPositions']\n }], origin: [{\n type: Input,\n args: ['cdkConnectedOverlayOrigin']\n }], positionStrategy: [{\n type: Input,\n args: ['cdkConnectedOverlayPositionStrategy']\n }], width: [{\n type: Input,\n args: ['cdkConnectedOverlayWidth']\n }], height: [{\n type: Input,\n args: ['cdkConnectedOverlayHeight']\n }], minWidth: [{\n type: Input,\n args: ['cdkConnectedOverlayMinWidth']\n }], minHeight: [{\n type: Input,\n args: ['cdkConnectedOverlayMinHeight']\n }], backdropClass: [{\n type: Input,\n args: ['cdkConnectedOverlayBackdropClass']\n }], panelClass: [{\n type: Input,\n args: ['cdkConnectedOverlayPanelClass']\n }], transformOriginSelector: [{\n type: Input,\n args: ['cdkConnectedOverlayTransformOriginOn']\n }] }); })();\n/** @docs-private */\nfunction CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER_FACTORY(overlay) {\n return () => overlay.scrollStrategies.reposition();\n}\n/** @docs-private */\nconst CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER = {\n provide: CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY,\n deps: [Overlay],\n useFactory: CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER_FACTORY,\n};\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass OverlayModule {\n}\nOverlayModule.ɵfac = function OverlayModule_Factory(t) { return new (t || OverlayModule)(); };\nOverlayModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: OverlayModule });\nOverlayModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({ providers: [\n Overlay,\n CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER,\n ], imports: [[BidiModule, PortalModule, ScrollingModule], ScrollingModule] });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(OverlayModule, [{\n type: NgModule,\n args: [{\n imports: [BidiModule, PortalModule, ScrollingModule],\n exports: [CdkConnectedOverlay, CdkOverlayOrigin, ScrollingModule],\n declarations: [CdkConnectedOverlay, CdkOverlayOrigin],\n providers: [\n Overlay,\n CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER,\n ]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(OverlayModule, { declarations: function () { return [CdkConnectedOverlay, CdkOverlayOrigin]; }, imports: function () { return [BidiModule, PortalModule, ScrollingModule]; }, exports: function () { return [CdkConnectedOverlay, CdkOverlayOrigin, ScrollingModule]; } }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Alternative to OverlayContainer that supports correct displaying of overlay elements in\n * Fullscreen mode\n * https://developer.mozilla.org/en-US/docs/Web/API/Element/requestFullScreen\n *\n * Should be provided in the root component.\n */\nclass FullscreenOverlayContainer extends OverlayContainer {\n constructor(_document, platform) {\n super(_document, platform);\n }\n ngOnDestroy() {\n super.ngOnDestroy();\n if (this._fullScreenEventName && this._fullScreenListener) {\n this._document.removeEventListener(this._fullScreenEventName, this._fullScreenListener);\n }\n }\n _createContainer() {\n super._createContainer();\n this._adjustParentForFullscreenChange();\n this._addFullscreenChangeListener(() => this._adjustParentForFullscreenChange());\n }\n _adjustParentForFullscreenChange() {\n if (!this._containerElement) {\n return;\n }\n const fullscreenElement = this.getFullscreenElement();\n const parent = fullscreenElement || this._document.body;\n parent.appendChild(this._containerElement);\n }\n _addFullscreenChangeListener(fn) {\n const eventName = this._getEventName();\n if (eventName) {\n if (this._fullScreenListener) {\n this._document.removeEventListener(eventName, this._fullScreenListener);\n }\n this._document.addEventListener(eventName, fn);\n this._fullScreenListener = fn;\n }\n }\n _getEventName() {\n if (!this._fullScreenEventName) {\n const _document = this._document;\n if (_document.fullscreenEnabled) {\n this._fullScreenEventName = 'fullscreenchange';\n }\n else if (_document.webkitFullscreenEnabled) {\n this._fullScreenEventName = 'webkitfullscreenchange';\n }\n else if (_document.mozFullScreenEnabled) {\n this._fullScreenEventName = 'mozfullscreenchange';\n }\n else if (_document.msFullscreenEnabled) {\n this._fullScreenEventName = 'MSFullscreenChange';\n }\n }\n return this._fullScreenEventName;\n }\n /**\n * When the page is put into fullscreen mode, a specific element is specified.\n * Only that element and its children are visible when in fullscreen mode.\n */\n getFullscreenElement() {\n const _document = this._document;\n return _document.fullscreenElement ||\n _document.webkitFullscreenElement ||\n _document.mozFullScreenElement ||\n _document.msFullscreenElement ||\n null;\n }\n}\nFullscreenOverlayContainer.ɵfac = function FullscreenOverlayContainer_Factory(t) { return new (t || FullscreenOverlayContainer)(ɵngcc0.ɵɵinject(DOCUMENT), ɵngcc0.ɵɵinject(ɵngcc2.Platform)); };\nFullscreenOverlayContainer.ɵprov = i0.ɵɵdefineInjectable({ factory: function FullscreenOverlayContainer_Factory() { return new FullscreenOverlayContainer(i0.ɵɵinject(i1$1.DOCUMENT), i0.ɵɵinject(i2.Platform)); }, token: FullscreenOverlayContainer, providedIn: \"root\" });\nFullscreenOverlayContainer.ctorParameters = () => [\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] },\n { type: Platform }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(FullscreenOverlayContainer, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: ɵngcc2.Platform }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BlockScrollStrategy, CdkConnectedOverlay, CdkOverlayOrigin, CloseScrollStrategy, ConnectedOverlayPositionChange, ConnectedPositionStrategy, ConnectionPositionPair, FlexibleConnectedPositionStrategy, FullscreenOverlayContainer, GlobalPositionStrategy, NoopScrollStrategy, Overlay, OverlayConfig, OverlayContainer, OverlayKeyboardDispatcher, OverlayModule, OverlayOutsideClickDispatcher, OverlayPositionBuilder, OverlayRef, RepositionScrollStrategy, ScrollStrategyOptions, ScrollingVisibility, validateHorizontalPosition, validateVerticalPosition, CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY as ɵangular_material_src_cdk_overlay_overlay_a, CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER_FACTORY as ɵangular_material_src_cdk_overlay_overlay_b, CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER as ɵangular_material_src_cdk_overlay_overlay_c, BaseOverlayDispatcher as ɵangular_material_src_cdk_overlay_overlay_d };\n\n//# sourceMappingURL=overlay.js.map","import * as i0 from '@angular/core';\nimport { Injectable, Inject, PLATFORM_ID, NgModule } from '@angular/core';\nimport { isPlatformBrowser } from '@angular/common';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Whether the current platform supports the V8 Break Iterator. The V8 check\n// is necessary to detect all Blink based browsers.\nimport * as ɵngcc0 from '@angular/core';\nlet hasV8BreakIterator;\n// We need a try/catch around the reference to `Intl`, because accessing it in some cases can\n// cause IE to throw. These cases are tied to particular versions of Windows and can happen if\n// the consumer is providing a polyfilled `Map`. See:\n// https://github.com/Microsoft/ChakraCore/issues/3189\n// https://github.com/angular/components/issues/15687\ntry {\n hasV8BreakIterator = (typeof Intl !== 'undefined' && Intl.v8BreakIterator);\n}\ncatch (_a) {\n hasV8BreakIterator = false;\n}\n/**\n * Service to detect the current platform by comparing the userAgent strings and\n * checking browser-specific global properties.\n */\nclass Platform {\n constructor(_platformId) {\n this._platformId = _platformId;\n // We want to use the Angular platform check because if the Document is shimmed\n // without the navigator, the following checks will fail. This is preferred because\n // sometimes the Document may be shimmed without the user's knowledge or intention\n /** Whether the Angular application is being rendered in the browser. */\n this.isBrowser = this._platformId ?\n isPlatformBrowser(this._platformId) : typeof document === 'object' && !!document;\n /** Whether the current browser is Microsoft Edge. */\n this.EDGE = this.isBrowser && /(edge)/i.test(navigator.userAgent);\n /** Whether the current rendering engine is Microsoft Trident. */\n this.TRIDENT = this.isBrowser && /(msie|trident)/i.test(navigator.userAgent);\n // EdgeHTML and Trident mock Blink specific things and need to be excluded from this check.\n /** Whether the current rendering engine is Blink. */\n this.BLINK = this.isBrowser && (!!(window.chrome || hasV8BreakIterator) &&\n typeof CSS !== 'undefined' && !this.EDGE && !this.TRIDENT);\n // Webkit is part of the userAgent in EdgeHTML, Blink and Trident. Therefore we need to\n // ensure that Webkit runs standalone and is not used as another engine's base.\n /** Whether the current rendering engine is WebKit. */\n this.WEBKIT = this.isBrowser &&\n /AppleWebKit/i.test(navigator.userAgent) && !this.BLINK && !this.EDGE && !this.TRIDENT;\n /** Whether the current platform is Apple iOS. */\n this.IOS = this.isBrowser && /iPad|iPhone|iPod/.test(navigator.userAgent) &&\n !('MSStream' in window);\n // It's difficult to detect the plain Gecko engine, because most of the browsers identify\n // them self as Gecko-like browsers and modify the userAgent's according to that.\n // Since we only cover one explicit Firefox case, we can simply check for Firefox\n // instead of having an unstable check for Gecko.\n /** Whether the current browser is Firefox. */\n this.FIREFOX = this.isBrowser && /(firefox|minefield)/i.test(navigator.userAgent);\n /** Whether the current platform is Android. */\n // Trident on mobile adds the android platform to the userAgent to trick detections.\n this.ANDROID = this.isBrowser && /android/i.test(navigator.userAgent) && !this.TRIDENT;\n // Safari browsers will include the Safari keyword in their userAgent. Some browsers may fake\n // this and just place the Safari keyword in the userAgent. To be more safe about Safari every\n // Safari browser should also use Webkit as its layout engine.\n /** Whether the current browser is Safari. */\n this.SAFARI = this.isBrowser && /safari/i.test(navigator.userAgent) && this.WEBKIT;\n }\n}\nPlatform.ɵfac = function Platform_Factory(t) { return new (t || Platform)(ɵngcc0.ɵɵinject(PLATFORM_ID)); };\nPlatform.ɵprov = i0.ɵɵdefineInjectable({ factory: function Platform_Factory() { return new Platform(i0.ɵɵinject(i0.PLATFORM_ID)); }, token: Platform, providedIn: \"root\" });\nPlatform.ctorParameters = () => [\n { type: Object, decorators: [{ type: Inject, args: [PLATFORM_ID,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(Platform, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: Object, decorators: [{\n type: Inject,\n args: [PLATFORM_ID]\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass PlatformModule {\n}\nPlatformModule.ɵfac = function PlatformModule_Factory(t) { return new (t || PlatformModule)(); };\nPlatformModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: PlatformModule });\nPlatformModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({});\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(PlatformModule, [{\n type: NgModule,\n args: [{}]\n }], null, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Cached result Set of input types support by the current browser. */\nlet supportedInputTypes;\n/** Types of `` that *might* be supported. */\nconst candidateInputTypes = [\n // `color` must come first. Chrome 56 shows a warning if we change the type to `color` after\n // first changing it to something else:\n // The specified value \"\" does not conform to the required format.\n // The format is \"#rrggbb\" where rr, gg, bb are two-digit hexadecimal numbers.\n 'color',\n 'button',\n 'checkbox',\n 'date',\n 'datetime-local',\n 'email',\n 'file',\n 'hidden',\n 'image',\n 'month',\n 'number',\n 'password',\n 'radio',\n 'range',\n 'reset',\n 'search',\n 'submit',\n 'tel',\n 'text',\n 'time',\n 'url',\n 'week',\n];\n/** @returns The input types supported by this browser. */\nfunction getSupportedInputTypes() {\n // Result is cached.\n if (supportedInputTypes) {\n return supportedInputTypes;\n }\n // We can't check if an input type is not supported until we're on the browser, so say that\n // everything is supported when not on the browser. We don't use `Platform` here since it's\n // just a helper function and can't inject it.\n if (typeof document !== 'object' || !document) {\n supportedInputTypes = new Set(candidateInputTypes);\n return supportedInputTypes;\n }\n let featureTestInput = document.createElement('input');\n supportedInputTypes = new Set(candidateInputTypes.filter(value => {\n featureTestInput.setAttribute('type', value);\n return featureTestInput.type === value;\n }));\n return supportedInputTypes;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Cached result of whether the user's browser supports passive event listeners. */\nlet supportsPassiveEvents;\n/**\n * Checks whether the user's browser supports passive event listeners.\n * See: https://github.com/WICG/EventListenerOptions/blob/gh-pages/explainer.md\n */\nfunction supportsPassiveEventListeners() {\n if (supportsPassiveEvents == null && typeof window !== 'undefined') {\n try {\n window.addEventListener('test', null, Object.defineProperty({}, 'passive', {\n get: () => supportsPassiveEvents = true\n }));\n }\n finally {\n supportsPassiveEvents = supportsPassiveEvents || false;\n }\n }\n return supportsPassiveEvents;\n}\n/**\n * Normalizes an `AddEventListener` object to something that can be passed\n * to `addEventListener` on any browser, no matter whether it supports the\n * `options` parameter.\n * @param options Object to be normalized.\n */\nfunction normalizePassiveListenerOptions(options) {\n return supportsPassiveEventListeners() ? options : !!options.capture;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Cached result of the way the browser handles the horizontal scroll axis in RTL mode. */\nlet rtlScrollAxisType;\n/** Cached result of the check that indicates whether the browser supports scroll behaviors. */\nlet scrollBehaviorSupported;\n/** Check whether the browser supports scroll behaviors. */\nfunction supportsScrollBehavior() {\n if (scrollBehaviorSupported == null) {\n // If we're not in the browser, it can't be supported. Also check for `Element`, because\n // some projects stub out the global `document` during SSR which can throw us off.\n if (typeof document !== 'object' || !document || typeof Element !== 'function' || !Element) {\n scrollBehaviorSupported = false;\n return scrollBehaviorSupported;\n }\n // If the element can have a `scrollBehavior` style, we can be sure that it's supported.\n if ('scrollBehavior' in document.documentElement.style) {\n scrollBehaviorSupported = true;\n }\n else {\n // At this point we have 3 possibilities: `scrollTo` isn't supported at all, it's\n // supported but it doesn't handle scroll behavior, or it has been polyfilled.\n const scrollToFunction = Element.prototype.scrollTo;\n if (scrollToFunction) {\n // We can detect if the function has been polyfilled by calling `toString` on it. Native\n // functions are obfuscated using `[native code]`, whereas if it was overwritten we'd get\n // the actual function source. Via https://davidwalsh.name/detect-native-function. Consider\n // polyfilled functions as supporting scroll behavior.\n scrollBehaviorSupported = !/\\{\\s*\\[native code\\]\\s*\\}/.test(scrollToFunction.toString());\n }\n else {\n scrollBehaviorSupported = false;\n }\n }\n }\n return scrollBehaviorSupported;\n}\n/**\n * Checks the type of RTL scroll axis used by this browser. As of time of writing, Chrome is NORMAL,\n * Firefox & Safari are NEGATED, and IE & Edge are INVERTED.\n */\nfunction getRtlScrollAxisType() {\n // We can't check unless we're on the browser. Just assume 'normal' if we're not.\n if (typeof document !== 'object' || !document) {\n return 0 /* NORMAL */;\n }\n if (rtlScrollAxisType == null) {\n // Create a 1px wide scrolling container and a 2px wide content element.\n const scrollContainer = document.createElement('div');\n const containerStyle = scrollContainer.style;\n scrollContainer.dir = 'rtl';\n containerStyle.width = '1px';\n containerStyle.overflow = 'auto';\n containerStyle.visibility = 'hidden';\n containerStyle.pointerEvents = 'none';\n containerStyle.position = 'absolute';\n const content = document.createElement('div');\n const contentStyle = content.style;\n contentStyle.width = '2px';\n contentStyle.height = '1px';\n scrollContainer.appendChild(content);\n document.body.appendChild(scrollContainer);\n rtlScrollAxisType = 0 /* NORMAL */;\n // The viewport starts scrolled all the way to the right in RTL mode. If we are in a NORMAL\n // browser this would mean that the scrollLeft should be 1. If it's zero instead we know we're\n // dealing with one of the other two types of browsers.\n if (scrollContainer.scrollLeft === 0) {\n // In a NEGATED browser the scrollLeft is always somewhere in [-maxScrollAmount, 0]. For an\n // INVERTED browser it is always somewhere in [0, maxScrollAmount]. We can determine which by\n // setting to the scrollLeft to 1. This is past the max for a NEGATED browser, so it will\n // return 0 when we read it again.\n scrollContainer.scrollLeft = 1;\n rtlScrollAxisType =\n scrollContainer.scrollLeft === 0 ? 1 /* NEGATED */ : 2 /* INVERTED */;\n }\n scrollContainer.parentNode.removeChild(scrollContainer);\n }\n return rtlScrollAxisType;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nlet shadowDomIsSupported;\n/** Checks whether the user's browser support Shadow DOM. */\nfunction _supportsShadowDom() {\n if (shadowDomIsSupported == null) {\n const head = typeof document !== 'undefined' ? document.head : null;\n shadowDomIsSupported = !!(head && (head.createShadowRoot || head.attachShadow));\n }\n return shadowDomIsSupported;\n}\n/** Gets the shadow root of an element, if supported and the element is inside the Shadow DOM. */\nfunction _getShadowRoot(element) {\n if (_supportsShadowDom()) {\n const rootNode = element.getRootNode ? element.getRootNode() : null;\n // Note that this should be caught by `_supportsShadowDom`, but some\n // teams have been able to hit this code path on unsupported browsers.\n if (typeof ShadowRoot !== 'undefined' && ShadowRoot && rootNode instanceof ShadowRoot) {\n return rootNode;\n }\n }\n return null;\n}\n/**\n * Gets the currently-focused element on the page while\n * also piercing through Shadow DOM boundaries.\n */\nfunction _getFocusedElementPierceShadowDom() {\n let activeElement = typeof document !== 'undefined' && document ?\n document.activeElement : null;\n while (activeElement && activeElement.shadowRoot) {\n const newActiveElement = activeElement.shadowRoot.activeElement;\n if (newActiveElement === activeElement) {\n break;\n }\n else {\n activeElement = newActiveElement;\n }\n }\n return activeElement;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { Platform, PlatformModule, _getFocusedElementPierceShadowDom, _getShadowRoot, _supportsShadowDom, getRtlScrollAxisType, getSupportedInputTypes, normalizePassiveListenerOptions, supportsPassiveEventListeners, supportsScrollBehavior };\n\n//# sourceMappingURL=platform.js.map","import { ElementRef, Directive, TemplateRef, ViewContainerRef, EventEmitter, ComponentFactoryResolver, Inject, Output, NgModule } from '@angular/core';\nimport { DOCUMENT } from '@angular/common';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Throws an exception when attempting to attach a null portal to a host.\n * @docs-private\n */\nimport * as ɵngcc0 from '@angular/core';\nfunction throwNullPortalError() {\n throw Error('Must provide a portal to attach');\n}\n/**\n * Throws an exception when attempting to attach a portal to a host that is already attached.\n * @docs-private\n */\nfunction throwPortalAlreadyAttachedError() {\n throw Error('Host already has a portal attached');\n}\n/**\n * Throws an exception when attempting to attach a portal to an already-disposed host.\n * @docs-private\n */\nfunction throwPortalOutletAlreadyDisposedError() {\n throw Error('This PortalOutlet has already been disposed');\n}\n/**\n * Throws an exception when attempting to attach an unknown portal type.\n * @docs-private\n */\nfunction throwUnknownPortalTypeError() {\n throw Error('Attempting to attach an unknown Portal type. BasePortalOutlet accepts either ' +\n 'a ComponentPortal or a TemplatePortal.');\n}\n/**\n * Throws an exception when attempting to attach a portal to a null host.\n * @docs-private\n */\nfunction throwNullPortalOutletError() {\n throw Error('Attempting to attach a portal to a null PortalOutlet');\n}\n/**\n * Throws an exception when attempting to detach a portal that is not attached.\n * @docs-private\n */\nfunction throwNoPortalAttachedError() {\n throw Error('Attempting to detach a portal that is not attached to a host');\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A `Portal` is something that you want to render somewhere else.\n * It can be attach to / detached from a `PortalOutlet`.\n */\nclass Portal {\n /** Attach this portal to a host. */\n attach(host) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (host == null) {\n throwNullPortalOutletError();\n }\n if (host.hasAttached()) {\n throwPortalAlreadyAttachedError();\n }\n }\n this._attachedHost = host;\n return host.attach(this);\n }\n /** Detach this portal from its host */\n detach() {\n let host = this._attachedHost;\n if (host != null) {\n this._attachedHost = null;\n host.detach();\n }\n else if (typeof ngDevMode === 'undefined' || ngDevMode) {\n throwNoPortalAttachedError();\n }\n }\n /** Whether this portal is attached to a host. */\n get isAttached() {\n return this._attachedHost != null;\n }\n /**\n * Sets the PortalOutlet reference without performing `attach()`. This is used directly by\n * the PortalOutlet when it is performing an `attach()` or `detach()`.\n */\n setAttachedHost(host) {\n this._attachedHost = host;\n }\n}\n/**\n * A `ComponentPortal` is a portal that instantiates some Component upon attachment.\n */\nclass ComponentPortal extends Portal {\n constructor(component, viewContainerRef, injector, componentFactoryResolver) {\n super();\n this.component = component;\n this.viewContainerRef = viewContainerRef;\n this.injector = injector;\n this.componentFactoryResolver = componentFactoryResolver;\n }\n}\n/**\n * A `TemplatePortal` is a portal that represents some embedded template (TemplateRef).\n */\nclass TemplatePortal extends Portal {\n constructor(template, viewContainerRef, context) {\n super();\n this.templateRef = template;\n this.viewContainerRef = viewContainerRef;\n this.context = context;\n }\n get origin() {\n return this.templateRef.elementRef;\n }\n /**\n * Attach the portal to the provided `PortalOutlet`.\n * When a context is provided it will override the `context` property of the `TemplatePortal`\n * instance.\n */\n attach(host, context = this.context) {\n this.context = context;\n return super.attach(host);\n }\n detach() {\n this.context = undefined;\n return super.detach();\n }\n}\n/**\n * A `DomPortal` is a portal whose DOM element will be taken from its current position\n * in the DOM and moved into a portal outlet, when it is attached. On detach, the content\n * will be restored to its original position.\n */\nclass DomPortal extends Portal {\n constructor(element) {\n super();\n this.element = element instanceof ElementRef ? element.nativeElement : element;\n }\n}\n/**\n * Partial implementation of PortalOutlet that handles attaching\n * ComponentPortal and TemplatePortal.\n */\nclass BasePortalOutlet {\n constructor() {\n /** Whether this host has already been permanently disposed. */\n this._isDisposed = false;\n // @breaking-change 10.0.0 `attachDomPortal` to become a required abstract method.\n this.attachDomPortal = null;\n }\n /** Whether this host has an attached portal. */\n hasAttached() {\n return !!this._attachedPortal;\n }\n /** Attaches a portal. */\n attach(portal) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (!portal) {\n throwNullPortalError();\n }\n if (this.hasAttached()) {\n throwPortalAlreadyAttachedError();\n }\n if (this._isDisposed) {\n throwPortalOutletAlreadyDisposedError();\n }\n }\n if (portal instanceof ComponentPortal) {\n this._attachedPortal = portal;\n return this.attachComponentPortal(portal);\n }\n else if (portal instanceof TemplatePortal) {\n this._attachedPortal = portal;\n return this.attachTemplatePortal(portal);\n // @breaking-change 10.0.0 remove null check for `this.attachDomPortal`.\n }\n else if (this.attachDomPortal && portal instanceof DomPortal) {\n this._attachedPortal = portal;\n return this.attachDomPortal(portal);\n }\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n throwUnknownPortalTypeError();\n }\n }\n /** Detaches a previously attached portal. */\n detach() {\n if (this._attachedPortal) {\n this._attachedPortal.setAttachedHost(null);\n this._attachedPortal = null;\n }\n this._invokeDisposeFn();\n }\n /** Permanently dispose of this portal host. */\n dispose() {\n if (this.hasAttached()) {\n this.detach();\n }\n this._invokeDisposeFn();\n this._isDisposed = true;\n }\n /** @docs-private */\n setDisposeFn(fn) {\n this._disposeFn = fn;\n }\n _invokeDisposeFn() {\n if (this._disposeFn) {\n this._disposeFn();\n this._disposeFn = null;\n }\n }\n}\n/**\n * @deprecated Use `BasePortalOutlet` instead.\n * @breaking-change 9.0.0\n */\nclass BasePortalHost extends BasePortalOutlet {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A PortalOutlet for attaching portals to an arbitrary DOM element outside of the Angular\n * application context.\n */\nclass DomPortalOutlet extends BasePortalOutlet {\n constructor(\n /** Element into which the content is projected. */\n outletElement, _componentFactoryResolver, _appRef, _defaultInjector, \n /**\n * @deprecated `_document` Parameter to be made required.\n * @breaking-change 10.0.0\n */\n _document) {\n super();\n this.outletElement = outletElement;\n this._componentFactoryResolver = _componentFactoryResolver;\n this._appRef = _appRef;\n this._defaultInjector = _defaultInjector;\n /**\n * Attaches a DOM portal by transferring its content into the outlet.\n * @param portal Portal to be attached.\n * @deprecated To be turned into a method.\n * @breaking-change 10.0.0\n */\n this.attachDomPortal = (portal) => {\n // @breaking-change 10.0.0 Remove check and error once the\n // `_document` constructor parameter is required.\n if (!this._document && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('Cannot attach DOM portal without _document constructor parameter');\n }\n const element = portal.element;\n if (!element.parentNode && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('DOM portal content must be attached to a parent node.');\n }\n // Anchor used to save the element's previous position so\n // that we can restore it when the portal is detached.\n const anchorNode = this._document.createComment('dom-portal');\n element.parentNode.insertBefore(anchorNode, element);\n this.outletElement.appendChild(element);\n this._attachedPortal = portal;\n super.setDisposeFn(() => {\n // We can't use `replaceWith` here because IE doesn't support it.\n if (anchorNode.parentNode) {\n anchorNode.parentNode.replaceChild(element, anchorNode);\n }\n });\n };\n this._document = _document;\n }\n /**\n * Attach the given ComponentPortal to DOM element using the ComponentFactoryResolver.\n * @param portal Portal to be attached\n * @returns Reference to the created component.\n */\n attachComponentPortal(portal) {\n const resolver = portal.componentFactoryResolver || this._componentFactoryResolver;\n const componentFactory = resolver.resolveComponentFactory(portal.component);\n let componentRef;\n // If the portal specifies a ViewContainerRef, we will use that as the attachment point\n // for the component (in terms of Angular's component tree, not rendering).\n // When the ViewContainerRef is missing, we use the factory to create the component directly\n // and then manually attach the view to the application.\n if (portal.viewContainerRef) {\n componentRef = portal.viewContainerRef.createComponent(componentFactory, portal.viewContainerRef.length, portal.injector || portal.viewContainerRef.injector);\n this.setDisposeFn(() => componentRef.destroy());\n }\n else {\n componentRef = componentFactory.create(portal.injector || this._defaultInjector);\n this._appRef.attachView(componentRef.hostView);\n this.setDisposeFn(() => {\n this._appRef.detachView(componentRef.hostView);\n componentRef.destroy();\n });\n }\n // At this point the component has been instantiated, so we move it to the location in the DOM\n // where we want it to be rendered.\n this.outletElement.appendChild(this._getComponentRootNode(componentRef));\n this._attachedPortal = portal;\n return componentRef;\n }\n /**\n * Attaches a template portal to the DOM as an embedded view.\n * @param portal Portal to be attached.\n * @returns Reference to the created embedded view.\n */\n attachTemplatePortal(portal) {\n let viewContainer = portal.viewContainerRef;\n let viewRef = viewContainer.createEmbeddedView(portal.templateRef, portal.context);\n // The method `createEmbeddedView` will add the view as a child of the viewContainer.\n // But for the DomPortalOutlet the view can be added everywhere in the DOM\n // (e.g Overlay Container) To move the view to the specified host element. We just\n // re-append the existing root nodes.\n viewRef.rootNodes.forEach(rootNode => this.outletElement.appendChild(rootNode));\n // Note that we want to detect changes after the nodes have been moved so that\n // any directives inside the portal that are looking at the DOM inside a lifecycle\n // hook won't be invoked too early.\n viewRef.detectChanges();\n this.setDisposeFn((() => {\n let index = viewContainer.indexOf(viewRef);\n if (index !== -1) {\n viewContainer.remove(index);\n }\n }));\n this._attachedPortal = portal;\n // TODO(jelbourn): Return locals from view.\n return viewRef;\n }\n /**\n * Clears out a portal from the DOM.\n */\n dispose() {\n super.dispose();\n if (this.outletElement.parentNode != null) {\n this.outletElement.parentNode.removeChild(this.outletElement);\n }\n }\n /** Gets the root HTMLElement for an instantiated component. */\n _getComponentRootNode(componentRef) {\n return componentRef.hostView.rootNodes[0];\n }\n}\n/**\n * @deprecated Use `DomPortalOutlet` instead.\n * @breaking-change 9.0.0\n */\nclass DomPortalHost extends DomPortalOutlet {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Directive version of a `TemplatePortal`. Because the directive *is* a TemplatePortal,\n * the directive instance itself can be attached to a host, enabling declarative use of portals.\n */\nclass CdkPortal extends TemplatePortal {\n constructor(templateRef, viewContainerRef) {\n super(templateRef, viewContainerRef);\n }\n}\nCdkPortal.ɵfac = function CdkPortal_Factory(t) { return new (t || CdkPortal)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef)); };\nCdkPortal.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkPortal, selectors: [[\"\", \"cdkPortal\", \"\"]], exportAs: [\"cdkPortal\"], features: [ɵngcc0.ɵɵInheritDefinitionFeature] });\nCdkPortal.ctorParameters = () => [\n { type: TemplateRef },\n { type: ViewContainerRef }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkPortal, [{\n type: Directive,\n args: [{\n selector: '[cdkPortal]',\n exportAs: 'cdkPortal'\n }]\n }], function () { return [{ type: ɵngcc0.TemplateRef }, { type: ɵngcc0.ViewContainerRef }]; }, null); })();\n/**\n * @deprecated Use `CdkPortal` instead.\n * @breaking-change 9.0.0\n */\nclass TemplatePortalDirective extends CdkPortal {\n}\nTemplatePortalDirective.ɵfac = /*@__PURE__*/ function () { let ɵTemplatePortalDirective_BaseFactory; return function TemplatePortalDirective_Factory(t) { return (ɵTemplatePortalDirective_BaseFactory || (ɵTemplatePortalDirective_BaseFactory = ɵngcc0.ɵɵgetInheritedFactory(TemplatePortalDirective)))(t || TemplatePortalDirective); }; }();\nTemplatePortalDirective.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: TemplatePortalDirective, selectors: [[\"\", \"cdk-portal\", \"\"], [\"\", \"portal\", \"\"]], exportAs: [\"cdkPortal\"], features: [ɵngcc0.ɵɵProvidersFeature([{\n provide: CdkPortal,\n useExisting: TemplatePortalDirective\n }]), ɵngcc0.ɵɵInheritDefinitionFeature] });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(TemplatePortalDirective, [{\n type: Directive,\n args: [{\n selector: '[cdk-portal], [portal]',\n exportAs: 'cdkPortal',\n providers: [{\n provide: CdkPortal,\n useExisting: TemplatePortalDirective\n }]\n }]\n }], null, null); })();\n/**\n * Directive version of a PortalOutlet. Because the directive *is* a PortalOutlet, portals can be\n * directly attached to it, enabling declarative use.\n *\n * Usage:\n * ``\n */\nclass CdkPortalOutlet extends BasePortalOutlet {\n constructor(_componentFactoryResolver, _viewContainerRef, \n /**\n * @deprecated `_document` parameter to be made required.\n * @breaking-change 9.0.0\n */\n _document) {\n super();\n this._componentFactoryResolver = _componentFactoryResolver;\n this._viewContainerRef = _viewContainerRef;\n /** Whether the portal component is initialized. */\n this._isInitialized = false;\n /** Emits when a portal is attached to the outlet. */\n this.attached = new EventEmitter();\n /**\n * Attaches the given DomPortal to this PortalHost by moving all of the portal content into it.\n * @param portal Portal to be attached.\n * @deprecated To be turned into a method.\n * @breaking-change 10.0.0\n */\n this.attachDomPortal = (portal) => {\n // @breaking-change 9.0.0 Remove check and error once the\n // `_document` constructor parameter is required.\n if (!this._document && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('Cannot attach DOM portal without _document constructor parameter');\n }\n const element = portal.element;\n if (!element.parentNode && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('DOM portal content must be attached to a parent node.');\n }\n // Anchor used to save the element's previous position so\n // that we can restore it when the portal is detached.\n const anchorNode = this._document.createComment('dom-portal');\n portal.setAttachedHost(this);\n element.parentNode.insertBefore(anchorNode, element);\n this._getRootNode().appendChild(element);\n this._attachedPortal = portal;\n super.setDisposeFn(() => {\n if (anchorNode.parentNode) {\n anchorNode.parentNode.replaceChild(element, anchorNode);\n }\n });\n };\n this._document = _document;\n }\n /** Portal associated with the Portal outlet. */\n get portal() {\n return this._attachedPortal;\n }\n set portal(portal) {\n // Ignore the cases where the `portal` is set to a falsy value before the lifecycle hooks have\n // run. This handles the cases where the user might do something like `
`\n // and attach a portal programmatically in the parent component. When Angular does the first CD\n // round, it will fire the setter with empty string, causing the user's content to be cleared.\n if (this.hasAttached() && !portal && !this._isInitialized) {\n return;\n }\n if (this.hasAttached()) {\n super.detach();\n }\n if (portal) {\n super.attach(portal);\n }\n this._attachedPortal = portal;\n }\n /** Component or view reference that is attached to the portal. */\n get attachedRef() {\n return this._attachedRef;\n }\n ngOnInit() {\n this._isInitialized = true;\n }\n ngOnDestroy() {\n super.dispose();\n this._attachedPortal = null;\n this._attachedRef = null;\n }\n /**\n * Attach the given ComponentPortal to this PortalOutlet using the ComponentFactoryResolver.\n *\n * @param portal Portal to be attached to the portal outlet.\n * @returns Reference to the created component.\n */\n attachComponentPortal(portal) {\n portal.setAttachedHost(this);\n // If the portal specifies an origin, use that as the logical location of the component\n // in the application tree. Otherwise use the location of this PortalOutlet.\n const viewContainerRef = portal.viewContainerRef != null ?\n portal.viewContainerRef :\n this._viewContainerRef;\n const resolver = portal.componentFactoryResolver || this._componentFactoryResolver;\n const componentFactory = resolver.resolveComponentFactory(portal.component);\n const ref = viewContainerRef.createComponent(componentFactory, viewContainerRef.length, portal.injector || viewContainerRef.injector);\n // If we're using a view container that's different from the injected one (e.g. when the portal\n // specifies its own) we need to move the component into the outlet, otherwise it'll be rendered\n // inside of the alternate view container.\n if (viewContainerRef !== this._viewContainerRef) {\n this._getRootNode().appendChild(ref.hostView.rootNodes[0]);\n }\n super.setDisposeFn(() => ref.destroy());\n this._attachedPortal = portal;\n this._attachedRef = ref;\n this.attached.emit(ref);\n return ref;\n }\n /**\n * Attach the given TemplatePortal to this PortalHost as an embedded View.\n * @param portal Portal to be attached.\n * @returns Reference to the created embedded view.\n */\n attachTemplatePortal(portal) {\n portal.setAttachedHost(this);\n const viewRef = this._viewContainerRef.createEmbeddedView(portal.templateRef, portal.context);\n super.setDisposeFn(() => this._viewContainerRef.clear());\n this._attachedPortal = portal;\n this._attachedRef = viewRef;\n this.attached.emit(viewRef);\n return viewRef;\n }\n /** Gets the root node of the portal outlet. */\n _getRootNode() {\n const nativeElement = this._viewContainerRef.element.nativeElement;\n // The directive could be set on a template which will result in a comment\n // node being the root. Use the comment's parent node if that is the case.\n return (nativeElement.nodeType === nativeElement.ELEMENT_NODE ?\n nativeElement : nativeElement.parentNode);\n }\n}\nCdkPortalOutlet.ɵfac = function CdkPortalOutlet_Factory(t) { return new (t || CdkPortalOutlet)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ComponentFactoryResolver), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef), ɵngcc0.ɵɵdirectiveInject(DOCUMENT)); };\nCdkPortalOutlet.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkPortalOutlet, selectors: [[\"\", \"cdkPortalOutlet\", \"\"]], inputs: { portal: [\"cdkPortalOutlet\", \"portal\"] }, outputs: { attached: \"attached\" }, exportAs: [\"cdkPortalOutlet\"], features: [ɵngcc0.ɵɵInheritDefinitionFeature] });\nCdkPortalOutlet.ctorParameters = () => [\n { type: ComponentFactoryResolver },\n { type: ViewContainerRef },\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] }\n];\nCdkPortalOutlet.propDecorators = {\n attached: [{ type: Output }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkPortalOutlet, [{\n type: Directive,\n args: [{\n selector: '[cdkPortalOutlet]',\n exportAs: 'cdkPortalOutlet',\n inputs: ['portal: cdkPortalOutlet']\n }]\n }], function () { return [{ type: ɵngcc0.ComponentFactoryResolver }, { type: ɵngcc0.ViewContainerRef }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, { attached: [{\n type: Output\n }] }); })();\n/**\n * @deprecated Use `CdkPortalOutlet` instead.\n * @breaking-change 9.0.0\n */\nclass PortalHostDirective extends CdkPortalOutlet {\n}\nPortalHostDirective.ɵfac = /*@__PURE__*/ function () { let ɵPortalHostDirective_BaseFactory; return function PortalHostDirective_Factory(t) { return (ɵPortalHostDirective_BaseFactory || (ɵPortalHostDirective_BaseFactory = ɵngcc0.ɵɵgetInheritedFactory(PortalHostDirective)))(t || PortalHostDirective); }; }();\nPortalHostDirective.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: PortalHostDirective, selectors: [[\"\", \"cdkPortalHost\", \"\"], [\"\", \"portalHost\", \"\"]], inputs: { portal: [\"cdkPortalHost\", \"portal\"] }, exportAs: [\"cdkPortalHost\"], features: [ɵngcc0.ɵɵProvidersFeature([{\n provide: CdkPortalOutlet,\n useExisting: PortalHostDirective\n }]), ɵngcc0.ɵɵInheritDefinitionFeature] });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(PortalHostDirective, [{\n type: Directive,\n args: [{\n selector: '[cdkPortalHost], [portalHost]',\n exportAs: 'cdkPortalHost',\n inputs: ['portal: cdkPortalHost'],\n providers: [{\n provide: CdkPortalOutlet,\n useExisting: PortalHostDirective\n }]\n }]\n }], null, null); })();\nclass PortalModule {\n}\nPortalModule.ɵfac = function PortalModule_Factory(t) { return new (t || PortalModule)(); };\nPortalModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: PortalModule });\nPortalModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({});\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(PortalModule, [{\n type: NgModule,\n args: [{\n exports: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective],\n declarations: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(PortalModule, { declarations: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective], exports: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Custom injector to be used when providing custom\n * injection tokens to components inside a portal.\n * @docs-private\n * @deprecated Use `Injector.create` instead.\n * @breaking-change 11.0.0\n */\nclass PortalInjector {\n constructor(_parentInjector, _customTokens) {\n this._parentInjector = _parentInjector;\n this._customTokens = _customTokens;\n }\n get(token, notFoundValue) {\n const value = this._customTokens.get(token);\n if (typeof value !== 'undefined') {\n return value;\n }\n return this._parentInjector.get(token, notFoundValue);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BasePortalHost, BasePortalOutlet, CdkPortal, CdkPortalOutlet, ComponentPortal, DomPortal, DomPortalHost, DomPortalOutlet, Portal, PortalHostDirective, PortalInjector, PortalModule, TemplatePortal, TemplatePortalDirective };\n\n//# sourceMappingURL=portal.js.map","import { coerceNumberProperty, coerceElement } from '@angular/cdk/coercion';\nimport * as i0 from '@angular/core';\nimport { InjectionToken, Directive, forwardRef, Input, Injectable, NgZone, Optional, Inject, ElementRef, Component, ViewEncapsulation, ChangeDetectionStrategy, ChangeDetectorRef, Output, ViewChild, ViewContainerRef, TemplateRef, IterableDiffers, SkipSelf, NgModule } from '@angular/core';\nimport { Subject, of, Observable, fromEvent, animationFrameScheduler, asapScheduler, Subscription, isObservable } from 'rxjs';\nimport { distinctUntilChanged, auditTime, filter, takeUntil, startWith, pairwise, switchMap, shareReplay } from 'rxjs/operators';\nimport * as i1 from '@angular/cdk/platform';\nimport { Platform, getRtlScrollAxisType, supportsScrollBehavior, PlatformModule } from '@angular/cdk/platform';\nimport * as i2 from '@angular/common';\nimport { DOCUMENT } from '@angular/common';\nimport { Directionality, BidiModule } from '@angular/cdk/bidi';\nimport { isDataSource, ArrayDataSource, _VIEW_REPEATER_STRATEGY, _RecycleViewRepeaterStrategy } from '@angular/cdk/collections';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** The injection token used to specify the virtual scrolling strategy. */\nimport * as ɵngcc0 from '@angular/core';\nimport * as ɵngcc1 from '@angular/cdk/platform';\nimport * as ɵngcc2 from '@angular/cdk/bidi';\nimport * as ɵngcc3 from '@angular/cdk/collections';\n\nconst _c0 = [\"contentWrapper\"];\nconst _c1 = [\"*\"];\nconst VIRTUAL_SCROLL_STRATEGY = new InjectionToken('VIRTUAL_SCROLL_STRATEGY');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Virtual scrolling strategy for lists with items of known fixed size. */\nclass FixedSizeVirtualScrollStrategy {\n /**\n * @param itemSize The size of the items in the virtually scrolling list.\n * @param minBufferPx The minimum amount of buffer (in pixels) before needing to render more\n * @param maxBufferPx The amount of buffer (in pixels) to render when rendering more.\n */\n constructor(itemSize, minBufferPx, maxBufferPx) {\n this._scrolledIndexChange = new Subject();\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n this.scrolledIndexChange = this._scrolledIndexChange.pipe(distinctUntilChanged());\n /** The attached viewport. */\n this._viewport = null;\n this._itemSize = itemSize;\n this._minBufferPx = minBufferPx;\n this._maxBufferPx = maxBufferPx;\n }\n /**\n * Attaches this scroll strategy to a viewport.\n * @param viewport The viewport to attach this strategy to.\n */\n attach(viewport) {\n this._viewport = viewport;\n this._updateTotalContentSize();\n this._updateRenderedRange();\n }\n /** Detaches this scroll strategy from the currently attached viewport. */\n detach() {\n this._scrolledIndexChange.complete();\n this._viewport = null;\n }\n /**\n * Update the item size and buffer size.\n * @param itemSize The size of the items in the virtually scrolling list.\n * @param minBufferPx The minimum amount of buffer (in pixels) before needing to render more\n * @param maxBufferPx The amount of buffer (in pixels) to render when rendering more.\n */\n updateItemAndBufferSize(itemSize, minBufferPx, maxBufferPx) {\n if (maxBufferPx < minBufferPx && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('CDK virtual scroll: maxBufferPx must be greater than or equal to minBufferPx');\n }\n this._itemSize = itemSize;\n this._minBufferPx = minBufferPx;\n this._maxBufferPx = maxBufferPx;\n this._updateTotalContentSize();\n this._updateRenderedRange();\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onContentScrolled() {\n this._updateRenderedRange();\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onDataLengthChanged() {\n this._updateTotalContentSize();\n this._updateRenderedRange();\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onContentRendered() { }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onRenderedOffsetChanged() { }\n /**\n * Scroll to the offset for the given index.\n * @param index The index of the element to scroll to.\n * @param behavior The ScrollBehavior to use when scrolling.\n */\n scrollToIndex(index, behavior) {\n if (this._viewport) {\n this._viewport.scrollToOffset(index * this._itemSize, behavior);\n }\n }\n /** Update the viewport's total content size. */\n _updateTotalContentSize() {\n if (!this._viewport) {\n return;\n }\n this._viewport.setTotalContentSize(this._viewport.getDataLength() * this._itemSize);\n }\n /** Update the viewport's rendered range. */\n _updateRenderedRange() {\n if (!this._viewport) {\n return;\n }\n const renderedRange = this._viewport.getRenderedRange();\n const newRange = { start: renderedRange.start, end: renderedRange.end };\n const viewportSize = this._viewport.getViewportSize();\n const dataLength = this._viewport.getDataLength();\n let scrollOffset = this._viewport.measureScrollOffset();\n // Prevent NaN as result when dividing by zero.\n let firstVisibleIndex = (this._itemSize > 0) ? scrollOffset / this._itemSize : 0;\n // If user scrolls to the bottom of the list and data changes to a smaller list\n if (newRange.end > dataLength) {\n // We have to recalculate the first visible index based on new data length and viewport size.\n const maxVisibleItems = Math.ceil(viewportSize / this._itemSize);\n const newVisibleIndex = Math.max(0, Math.min(firstVisibleIndex, dataLength - maxVisibleItems));\n // If first visible index changed we must update scroll offset to handle start/end buffers\n // Current range must also be adjusted to cover the new position (bottom of new list).\n if (firstVisibleIndex != newVisibleIndex) {\n firstVisibleIndex = newVisibleIndex;\n scrollOffset = newVisibleIndex * this._itemSize;\n newRange.start = Math.floor(firstVisibleIndex);\n }\n newRange.end = Math.max(0, Math.min(dataLength, newRange.start + maxVisibleItems));\n }\n const startBuffer = scrollOffset - newRange.start * this._itemSize;\n if (startBuffer < this._minBufferPx && newRange.start != 0) {\n const expandStart = Math.ceil((this._maxBufferPx - startBuffer) / this._itemSize);\n newRange.start = Math.max(0, newRange.start - expandStart);\n newRange.end = Math.min(dataLength, Math.ceil(firstVisibleIndex + (viewportSize + this._minBufferPx) / this._itemSize));\n }\n else {\n const endBuffer = newRange.end * this._itemSize - (scrollOffset + viewportSize);\n if (endBuffer < this._minBufferPx && newRange.end != dataLength) {\n const expandEnd = Math.ceil((this._maxBufferPx - endBuffer) / this._itemSize);\n if (expandEnd > 0) {\n newRange.end = Math.min(dataLength, newRange.end + expandEnd);\n newRange.start = Math.max(0, Math.floor(firstVisibleIndex - this._minBufferPx / this._itemSize));\n }\n }\n }\n this._viewport.setRenderedRange(newRange);\n this._viewport.setRenderedContentOffset(this._itemSize * newRange.start);\n this._scrolledIndexChange.next(Math.floor(firstVisibleIndex));\n }\n}\n/**\n * Provider factory for `FixedSizeVirtualScrollStrategy` that simply extracts the already created\n * `FixedSizeVirtualScrollStrategy` from the given directive.\n * @param fixedSizeDir The instance of `CdkFixedSizeVirtualScroll` to extract the\n * `FixedSizeVirtualScrollStrategy` from.\n */\nfunction _fixedSizeVirtualScrollStrategyFactory(fixedSizeDir) {\n return fixedSizeDir._scrollStrategy;\n}\n/** A virtual scroll strategy that supports fixed-size items. */\nclass CdkFixedSizeVirtualScroll {\n constructor() {\n this._itemSize = 20;\n this._minBufferPx = 100;\n this._maxBufferPx = 200;\n /** The scroll strategy used by this directive. */\n this._scrollStrategy = new FixedSizeVirtualScrollStrategy(this.itemSize, this.minBufferPx, this.maxBufferPx);\n }\n /** The size of the items in the list (in pixels). */\n get itemSize() { return this._itemSize; }\n set itemSize(value) { this._itemSize = coerceNumberProperty(value); }\n /**\n * The minimum amount of buffer rendered beyond the viewport (in pixels).\n * If the amount of buffer dips below this number, more items will be rendered. Defaults to 100px.\n */\n get minBufferPx() { return this._minBufferPx; }\n set minBufferPx(value) { this._minBufferPx = coerceNumberProperty(value); }\n /**\n * The number of pixels worth of buffer to render for when rendering new items. Defaults to 200px.\n */\n get maxBufferPx() { return this._maxBufferPx; }\n set maxBufferPx(value) { this._maxBufferPx = coerceNumberProperty(value); }\n ngOnChanges() {\n this._scrollStrategy.updateItemAndBufferSize(this.itemSize, this.minBufferPx, this.maxBufferPx);\n }\n}\nCdkFixedSizeVirtualScroll.ɵfac = function CdkFixedSizeVirtualScroll_Factory(t) { return new (t || CdkFixedSizeVirtualScroll)(); };\nCdkFixedSizeVirtualScroll.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkFixedSizeVirtualScroll, selectors: [[\"cdk-virtual-scroll-viewport\", \"itemSize\", \"\"]], inputs: { itemSize: \"itemSize\", minBufferPx: \"minBufferPx\", maxBufferPx: \"maxBufferPx\" }, features: [ɵngcc0.ɵɵProvidersFeature([{\n provide: VIRTUAL_SCROLL_STRATEGY,\n useFactory: _fixedSizeVirtualScrollStrategyFactory,\n deps: [forwardRef(() => CdkFixedSizeVirtualScroll)]\n }]), ɵngcc0.ɵɵNgOnChangesFeature] });\nCdkFixedSizeVirtualScroll.propDecorators = {\n itemSize: [{ type: Input }],\n minBufferPx: [{ type: Input }],\n maxBufferPx: [{ type: Input }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkFixedSizeVirtualScroll, [{\n type: Directive,\n args: [{\n selector: 'cdk-virtual-scroll-viewport[itemSize]',\n providers: [{\n provide: VIRTUAL_SCROLL_STRATEGY,\n useFactory: _fixedSizeVirtualScrollStrategyFactory,\n deps: [forwardRef(() => CdkFixedSizeVirtualScroll)]\n }]\n }]\n }], function () { return []; }, { itemSize: [{\n type: Input\n }], minBufferPx: [{\n type: Input\n }], maxBufferPx: [{\n type: Input\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Time in ms to throttle the scrolling events by default. */\nconst DEFAULT_SCROLL_TIME = 20;\n/**\n * Service contained all registered Scrollable references and emits an event when any one of the\n * Scrollable references emit a scrolled event.\n */\nclass ScrollDispatcher {\n constructor(_ngZone, _platform, document) {\n this._ngZone = _ngZone;\n this._platform = _platform;\n /** Subject for notifying that a registered scrollable reference element has been scrolled. */\n this._scrolled = new Subject();\n /** Keeps track of the global `scroll` and `resize` subscriptions. */\n this._globalSubscription = null;\n /** Keeps track of the amount of subscriptions to `scrolled`. Used for cleaning up afterwards. */\n this._scrolledCount = 0;\n /**\n * Map of all the scrollable references that are registered with the service and their\n * scroll event subscriptions.\n */\n this.scrollContainers = new Map();\n this._document = document;\n }\n /**\n * Registers a scrollable instance with the service and listens for its scrolled events. When the\n * scrollable is scrolled, the service emits the event to its scrolled observable.\n * @param scrollable Scrollable instance to be registered.\n */\n register(scrollable) {\n if (!this.scrollContainers.has(scrollable)) {\n this.scrollContainers.set(scrollable, scrollable.elementScrolled()\n .subscribe(() => this._scrolled.next(scrollable)));\n }\n }\n /**\n * Deregisters a Scrollable reference and unsubscribes from its scroll event observable.\n * @param scrollable Scrollable instance to be deregistered.\n */\n deregister(scrollable) {\n const scrollableReference = this.scrollContainers.get(scrollable);\n if (scrollableReference) {\n scrollableReference.unsubscribe();\n this.scrollContainers.delete(scrollable);\n }\n }\n /**\n * Returns an observable that emits an event whenever any of the registered Scrollable\n * references (or window, document, or body) fire a scrolled event. Can provide a time in ms\n * to override the default \"throttle\" time.\n *\n * **Note:** in order to avoid hitting change detection for every scroll event,\n * all of the events emitted from this stream will be run outside the Angular zone.\n * If you need to update any data bindings as a result of a scroll event, you have\n * to run the callback using `NgZone.run`.\n */\n scrolled(auditTimeInMs = DEFAULT_SCROLL_TIME) {\n if (!this._platform.isBrowser) {\n return of();\n }\n return new Observable((observer) => {\n if (!this._globalSubscription) {\n this._addGlobalListener();\n }\n // In the case of a 0ms delay, use an observable without auditTime\n // since it does add a perceptible delay in processing overhead.\n const subscription = auditTimeInMs > 0 ?\n this._scrolled.pipe(auditTime(auditTimeInMs)).subscribe(observer) :\n this._scrolled.subscribe(observer);\n this._scrolledCount++;\n return () => {\n subscription.unsubscribe();\n this._scrolledCount--;\n if (!this._scrolledCount) {\n this._removeGlobalListener();\n }\n };\n });\n }\n ngOnDestroy() {\n this._removeGlobalListener();\n this.scrollContainers.forEach((_, container) => this.deregister(container));\n this._scrolled.complete();\n }\n /**\n * Returns an observable that emits whenever any of the\n * scrollable ancestors of an element are scrolled.\n * @param elementOrElementRef Element whose ancestors to listen for.\n * @param auditTimeInMs Time to throttle the scroll events.\n */\n ancestorScrolled(elementOrElementRef, auditTimeInMs) {\n const ancestors = this.getAncestorScrollContainers(elementOrElementRef);\n return this.scrolled(auditTimeInMs).pipe(filter(target => {\n return !target || ancestors.indexOf(target) > -1;\n }));\n }\n /** Returns all registered Scrollables that contain the provided element. */\n getAncestorScrollContainers(elementOrElementRef) {\n const scrollingContainers = [];\n this.scrollContainers.forEach((_subscription, scrollable) => {\n if (this._scrollableContainsElement(scrollable, elementOrElementRef)) {\n scrollingContainers.push(scrollable);\n }\n });\n return scrollingContainers;\n }\n /** Use defaultView of injected document if available or fallback to global window reference */\n _getWindow() {\n return this._document.defaultView || window;\n }\n /** Returns true if the element is contained within the provided Scrollable. */\n _scrollableContainsElement(scrollable, elementOrElementRef) {\n let element = coerceElement(elementOrElementRef);\n let scrollableElement = scrollable.getElementRef().nativeElement;\n // Traverse through the element parents until we reach null, checking if any of the elements\n // are the scrollable's element.\n do {\n if (element == scrollableElement) {\n return true;\n }\n } while (element = element.parentElement);\n return false;\n }\n /** Sets up the global scroll listeners. */\n _addGlobalListener() {\n this._globalSubscription = this._ngZone.runOutsideAngular(() => {\n const window = this._getWindow();\n return fromEvent(window.document, 'scroll').subscribe(() => this._scrolled.next());\n });\n }\n /** Cleans up the global scroll listener. */\n _removeGlobalListener() {\n if (this._globalSubscription) {\n this._globalSubscription.unsubscribe();\n this._globalSubscription = null;\n }\n }\n}\nScrollDispatcher.ɵfac = function ScrollDispatcher_Factory(t) { return new (t || ScrollDispatcher)(ɵngcc0.ɵɵinject(ɵngcc0.NgZone), ɵngcc0.ɵɵinject(ɵngcc1.Platform), ɵngcc0.ɵɵinject(DOCUMENT, 8)); };\nScrollDispatcher.ɵprov = i0.ɵɵdefineInjectable({ factory: function ScrollDispatcher_Factory() { return new ScrollDispatcher(i0.ɵɵinject(i0.NgZone), i0.ɵɵinject(i1.Platform), i0.ɵɵinject(i2.DOCUMENT, 8)); }, token: ScrollDispatcher, providedIn: \"root\" });\nScrollDispatcher.ctorParameters = () => [\n { type: NgZone },\n { type: Platform },\n { type: undefined, decorators: [{ type: Optional }, { type: Inject, args: [DOCUMENT,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(ScrollDispatcher, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: ɵngcc0.NgZone }, { type: ɵngcc1.Platform }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Sends an event when the directive's element is scrolled. Registers itself with the\n * ScrollDispatcher service to include itself as part of its collection of scrolling events that it\n * can be listened to through the service.\n */\nclass CdkScrollable {\n constructor(elementRef, scrollDispatcher, ngZone, dir) {\n this.elementRef = elementRef;\n this.scrollDispatcher = scrollDispatcher;\n this.ngZone = ngZone;\n this.dir = dir;\n this._destroyed = new Subject();\n this._elementScrolled = new Observable((observer) => this.ngZone.runOutsideAngular(() => fromEvent(this.elementRef.nativeElement, 'scroll').pipe(takeUntil(this._destroyed))\n .subscribe(observer)));\n }\n ngOnInit() {\n this.scrollDispatcher.register(this);\n }\n ngOnDestroy() {\n this.scrollDispatcher.deregister(this);\n this._destroyed.next();\n this._destroyed.complete();\n }\n /** Returns observable that emits when a scroll event is fired on the host element. */\n elementScrolled() {\n return this._elementScrolled;\n }\n /** Gets the ElementRef for the viewport. */\n getElementRef() {\n return this.elementRef;\n }\n /**\n * Scrolls to the specified offsets. This is a normalized version of the browser's native scrollTo\n * method, since browsers are not consistent about what scrollLeft means in RTL. For this method\n * left and right always refer to the left and right side of the scrolling container irrespective\n * of the layout direction. start and end refer to left and right in an LTR context and vice-versa\n * in an RTL context.\n * @param options specified the offsets to scroll to.\n */\n scrollTo(options) {\n const el = this.elementRef.nativeElement;\n const isRtl = this.dir && this.dir.value == 'rtl';\n // Rewrite start & end offsets as right or left offsets.\n if (options.left == null) {\n options.left = isRtl ? options.end : options.start;\n }\n if (options.right == null) {\n options.right = isRtl ? options.start : options.end;\n }\n // Rewrite the bottom offset as a top offset.\n if (options.bottom != null) {\n options.top =\n el.scrollHeight - el.clientHeight - options.bottom;\n }\n // Rewrite the right offset as a left offset.\n if (isRtl && getRtlScrollAxisType() != 0 /* NORMAL */) {\n if (options.left != null) {\n options.right =\n el.scrollWidth - el.clientWidth - options.left;\n }\n if (getRtlScrollAxisType() == 2 /* INVERTED */) {\n options.left = options.right;\n }\n else if (getRtlScrollAxisType() == 1 /* NEGATED */) {\n options.left = options.right ? -options.right : options.right;\n }\n }\n else {\n if (options.right != null) {\n options.left =\n el.scrollWidth - el.clientWidth - options.right;\n }\n }\n this._applyScrollToOptions(options);\n }\n _applyScrollToOptions(options) {\n const el = this.elementRef.nativeElement;\n if (supportsScrollBehavior()) {\n el.scrollTo(options);\n }\n else {\n if (options.top != null) {\n el.scrollTop = options.top;\n }\n if (options.left != null) {\n el.scrollLeft = options.left;\n }\n }\n }\n /**\n * Measures the scroll offset relative to the specified edge of the viewport. This method can be\n * used instead of directly checking scrollLeft or scrollTop, since browsers are not consistent\n * about what scrollLeft means in RTL. The values returned by this method are normalized such that\n * left and right always refer to the left and right side of the scrolling container irrespective\n * of the layout direction. start and end refer to left and right in an LTR context and vice-versa\n * in an RTL context.\n * @param from The edge to measure from.\n */\n measureScrollOffset(from) {\n const LEFT = 'left';\n const RIGHT = 'right';\n const el = this.elementRef.nativeElement;\n if (from == 'top') {\n return el.scrollTop;\n }\n if (from == 'bottom') {\n return el.scrollHeight - el.clientHeight - el.scrollTop;\n }\n // Rewrite start & end as left or right offsets.\n const isRtl = this.dir && this.dir.value == 'rtl';\n if (from == 'start') {\n from = isRtl ? RIGHT : LEFT;\n }\n else if (from == 'end') {\n from = isRtl ? LEFT : RIGHT;\n }\n if (isRtl && getRtlScrollAxisType() == 2 /* INVERTED */) {\n // For INVERTED, scrollLeft is (scrollWidth - clientWidth) when scrolled all the way left and\n // 0 when scrolled all the way right.\n if (from == LEFT) {\n return el.scrollWidth - el.clientWidth - el.scrollLeft;\n }\n else {\n return el.scrollLeft;\n }\n }\n else if (isRtl && getRtlScrollAxisType() == 1 /* NEGATED */) {\n // For NEGATED, scrollLeft is -(scrollWidth - clientWidth) when scrolled all the way left and\n // 0 when scrolled all the way right.\n if (from == LEFT) {\n return el.scrollLeft + el.scrollWidth - el.clientWidth;\n }\n else {\n return -el.scrollLeft;\n }\n }\n else {\n // For NORMAL, as well as non-RTL contexts, scrollLeft is 0 when scrolled all the way left and\n // (scrollWidth - clientWidth) when scrolled all the way right.\n if (from == LEFT) {\n return el.scrollLeft;\n }\n else {\n return el.scrollWidth - el.clientWidth - el.scrollLeft;\n }\n }\n }\n}\nCdkScrollable.ɵfac = function CdkScrollable_Factory(t) { return new (t || CdkScrollable)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(ScrollDispatcher), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.NgZone), ɵngcc0.ɵɵdirectiveInject(ɵngcc2.Directionality, 8)); };\nCdkScrollable.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkScrollable, selectors: [[\"\", \"cdk-scrollable\", \"\"], [\"\", \"cdkScrollable\", \"\"]] });\nCdkScrollable.ctorParameters = () => [\n { type: ElementRef },\n { type: ScrollDispatcher },\n { type: NgZone },\n { type: Directionality, decorators: [{ type: Optional }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkScrollable, [{\n type: Directive,\n args: [{\n selector: '[cdk-scrollable], [cdkScrollable]'\n }]\n }], function () { return [{ type: ɵngcc0.ElementRef }, { type: ScrollDispatcher }, { type: ɵngcc0.NgZone }, { type: ɵngcc2.Directionality, decorators: [{\n type: Optional\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Time in ms to throttle the resize events by default. */\nconst DEFAULT_RESIZE_TIME = 20;\n/**\n * Simple utility for getting the bounds of the browser viewport.\n * @docs-private\n */\nclass ViewportRuler {\n constructor(_platform, ngZone, document) {\n this._platform = _platform;\n /** Stream of viewport change events. */\n this._change = new Subject();\n /** Event listener that will be used to handle the viewport change events. */\n this._changeListener = (event) => {\n this._change.next(event);\n };\n this._document = document;\n ngZone.runOutsideAngular(() => {\n if (_platform.isBrowser) {\n const window = this._getWindow();\n // Note that bind the events ourselves, rather than going through something like RxJS's\n // `fromEvent` so that we can ensure that they're bound outside of the NgZone.\n window.addEventListener('resize', this._changeListener);\n window.addEventListener('orientationchange', this._changeListener);\n }\n // We don't need to keep track of the subscription,\n // because we complete the `change` stream on destroy.\n this.change().subscribe(() => this._updateViewportSize());\n });\n }\n ngOnDestroy() {\n if (this._platform.isBrowser) {\n const window = this._getWindow();\n window.removeEventListener('resize', this._changeListener);\n window.removeEventListener('orientationchange', this._changeListener);\n }\n this._change.complete();\n }\n /** Returns the viewport's width and height. */\n getViewportSize() {\n if (!this._viewportSize) {\n this._updateViewportSize();\n }\n const output = { width: this._viewportSize.width, height: this._viewportSize.height };\n // If we're not on a browser, don't cache the size since it'll be mocked out anyway.\n if (!this._platform.isBrowser) {\n this._viewportSize = null;\n }\n return output;\n }\n /** Gets a ClientRect for the viewport's bounds. */\n getViewportRect() {\n // Use the document element's bounding rect rather than the window scroll properties\n // (e.g. pageYOffset, scrollY) due to in issue in Chrome and IE where window scroll\n // properties and client coordinates (boundingClientRect, clientX/Y, etc.) are in different\n // conceptual viewports. Under most circumstances these viewports are equivalent, but they\n // can disagree when the page is pinch-zoomed (on devices that support touch).\n // See https://bugs.chromium.org/p/chromium/issues/detail?id=489206#c4\n // We use the documentElement instead of the body because, by default (without a css reset)\n // browsers typically give the document body an 8px margin, which is not included in\n // getBoundingClientRect().\n const scrollPosition = this.getViewportScrollPosition();\n const { width, height } = this.getViewportSize();\n return {\n top: scrollPosition.top,\n left: scrollPosition.left,\n bottom: scrollPosition.top + height,\n right: scrollPosition.left + width,\n height,\n width,\n };\n }\n /** Gets the (top, left) scroll position of the viewport. */\n getViewportScrollPosition() {\n // While we can get a reference to the fake document\n // during SSR, it doesn't have getBoundingClientRect.\n if (!this._platform.isBrowser) {\n return { top: 0, left: 0 };\n }\n // The top-left-corner of the viewport is determined by the scroll position of the document\n // body, normally just (scrollLeft, scrollTop). However, Chrome and Firefox disagree about\n // whether `document.body` or `document.documentElement` is the scrolled element, so reading\n // `scrollTop` and `scrollLeft` is inconsistent. However, using the bounding rect of\n // `document.documentElement` works consistently, where the `top` and `left` values will\n // equal negative the scroll position.\n const document = this._document;\n const window = this._getWindow();\n const documentElement = document.documentElement;\n const documentRect = documentElement.getBoundingClientRect();\n const top = -documentRect.top || document.body.scrollTop || window.scrollY ||\n documentElement.scrollTop || 0;\n const left = -documentRect.left || document.body.scrollLeft || window.scrollX ||\n documentElement.scrollLeft || 0;\n return { top, left };\n }\n /**\n * Returns a stream that emits whenever the size of the viewport changes.\n * This stream emits outside of the Angular zone.\n * @param throttleTime Time in milliseconds to throttle the stream.\n */\n change(throttleTime = DEFAULT_RESIZE_TIME) {\n return throttleTime > 0 ? this._change.pipe(auditTime(throttleTime)) : this._change;\n }\n /** Use defaultView of injected document if available or fallback to global window reference */\n _getWindow() {\n return this._document.defaultView || window;\n }\n /** Updates the cached viewport size. */\n _updateViewportSize() {\n const window = this._getWindow();\n this._viewportSize = this._platform.isBrowser ?\n { width: window.innerWidth, height: window.innerHeight } :\n { width: 0, height: 0 };\n }\n}\nViewportRuler.ɵfac = function ViewportRuler_Factory(t) { return new (t || ViewportRuler)(ɵngcc0.ɵɵinject(ɵngcc1.Platform), ɵngcc0.ɵɵinject(ɵngcc0.NgZone), ɵngcc0.ɵɵinject(DOCUMENT, 8)); };\nViewportRuler.ɵprov = i0.ɵɵdefineInjectable({ factory: function ViewportRuler_Factory() { return new ViewportRuler(i0.ɵɵinject(i1.Platform), i0.ɵɵinject(i0.NgZone), i0.ɵɵinject(i2.DOCUMENT, 8)); }, token: ViewportRuler, providedIn: \"root\" });\nViewportRuler.ctorParameters = () => [\n { type: Platform },\n { type: NgZone },\n { type: undefined, decorators: [{ type: Optional }, { type: Inject, args: [DOCUMENT,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(ViewportRuler, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: ɵngcc1.Platform }, { type: ɵngcc0.NgZone }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Checks if the given ranges are equal. */\nfunction rangesEqual(r1, r2) {\n return r1.start == r2.start && r1.end == r2.end;\n}\n/**\n * Scheduler to be used for scroll events. Needs to fall back to\n * something that doesn't rely on requestAnimationFrame on environments\n * that don't support it (e.g. server-side rendering).\n */\nconst SCROLL_SCHEDULER = typeof requestAnimationFrame !== 'undefined' ? animationFrameScheduler : asapScheduler;\n/** A viewport that virtualizes its scrolling with the help of `CdkVirtualForOf`. */\nclass CdkVirtualScrollViewport extends CdkScrollable {\n constructor(elementRef, _changeDetectorRef, ngZone, _scrollStrategy, dir, scrollDispatcher, viewportRuler) {\n super(elementRef, scrollDispatcher, ngZone, dir);\n this.elementRef = elementRef;\n this._changeDetectorRef = _changeDetectorRef;\n this._scrollStrategy = _scrollStrategy;\n /** Emits when the viewport is detached from a CdkVirtualForOf. */\n this._detachedSubject = new Subject();\n /** Emits when the rendered range changes. */\n this._renderedRangeSubject = new Subject();\n this._orientation = 'vertical';\n // Note: we don't use the typical EventEmitter here because we need to subscribe to the scroll\n // strategy lazily (i.e. only if the user is actually listening to the events). We do this because\n // depending on how the strategy calculates the scrolled index, it may come at a cost to\n // performance.\n /** Emits when the index of the first element visible in the viewport changes. */\n this.scrolledIndexChange = new Observable((observer) => this._scrollStrategy.scrolledIndexChange.subscribe(index => Promise.resolve().then(() => this.ngZone.run(() => observer.next(index)))));\n /** A stream that emits whenever the rendered range changes. */\n this.renderedRangeStream = this._renderedRangeSubject;\n /**\n * The total size of all content (in pixels), including content that is not currently rendered.\n */\n this._totalContentSize = 0;\n /** A string representing the `style.width` property value to be used for the spacer element. */\n this._totalContentWidth = '';\n /** A string representing the `style.height` property value to be used for the spacer element. */\n this._totalContentHeight = '';\n /** The currently rendered range of indices. */\n this._renderedRange = { start: 0, end: 0 };\n /** The length of the data bound to this viewport (in number of items). */\n this._dataLength = 0;\n /** The size of the viewport (in pixels). */\n this._viewportSize = 0;\n /** The last rendered content offset that was set. */\n this._renderedContentOffset = 0;\n /**\n * Whether the last rendered content offset was to the end of the content (and therefore needs to\n * be rewritten as an offset to the start of the content).\n */\n this._renderedContentOffsetNeedsRewrite = false;\n /** Whether there is a pending change detection cycle. */\n this._isChangeDetectionPending = false;\n /** A list of functions to run after the next change detection cycle. */\n this._runAfterChangeDetection = [];\n /** Subscription to changes in the viewport size. */\n this._viewportChanges = Subscription.EMPTY;\n if (!_scrollStrategy && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('Error: cdk-virtual-scroll-viewport requires the \"itemSize\" property to be set.');\n }\n this._viewportChanges = viewportRuler.change().subscribe(() => {\n this.checkViewportSize();\n });\n }\n /** The direction the viewport scrolls. */\n get orientation() {\n return this._orientation;\n }\n set orientation(orientation) {\n if (this._orientation !== orientation) {\n this._orientation = orientation;\n this._calculateSpacerSize();\n }\n }\n ngOnInit() {\n super.ngOnInit();\n // It's still too early to measure the viewport at this point. Deferring with a promise allows\n // the Viewport to be rendered with the correct size before we measure. We run this outside the\n // zone to avoid causing more change detection cycles. We handle the change detection loop\n // ourselves instead.\n this.ngZone.runOutsideAngular(() => Promise.resolve().then(() => {\n this._measureViewportSize();\n this._scrollStrategy.attach(this);\n this.elementScrolled()\n .pipe(\n // Start off with a fake scroll event so we properly detect our initial position.\n startWith(null), \n // Collect multiple events into one until the next animation frame. This way if\n // there are multiple scroll events in the same frame we only need to recheck\n // our layout once.\n auditTime(0, SCROLL_SCHEDULER))\n .subscribe(() => this._scrollStrategy.onContentScrolled());\n this._markChangeDetectionNeeded();\n }));\n }\n ngOnDestroy() {\n this.detach();\n this._scrollStrategy.detach();\n // Complete all subjects\n this._renderedRangeSubject.complete();\n this._detachedSubject.complete();\n this._viewportChanges.unsubscribe();\n super.ngOnDestroy();\n }\n /** Attaches a `CdkVirtualScrollRepeater` to this viewport. */\n attach(forOf) {\n if (this._forOf && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('CdkVirtualScrollViewport is already attached.');\n }\n // Subscribe to the data stream of the CdkVirtualForOf to keep track of when the data length\n // changes. Run outside the zone to avoid triggering change detection, since we're managing the\n // change detection loop ourselves.\n this.ngZone.runOutsideAngular(() => {\n this._forOf = forOf;\n this._forOf.dataStream.pipe(takeUntil(this._detachedSubject)).subscribe(data => {\n const newLength = data.length;\n if (newLength !== this._dataLength) {\n this._dataLength = newLength;\n this._scrollStrategy.onDataLengthChanged();\n }\n this._doChangeDetection();\n });\n });\n }\n /** Detaches the current `CdkVirtualForOf`. */\n detach() {\n this._forOf = null;\n this._detachedSubject.next();\n }\n /** Gets the length of the data bound to this viewport (in number of items). */\n getDataLength() {\n return this._dataLength;\n }\n /** Gets the size of the viewport (in pixels). */\n getViewportSize() {\n return this._viewportSize;\n }\n // TODO(mmalerba): This is technically out of sync with what's really rendered until a render\n // cycle happens. I'm being careful to only call it after the render cycle is complete and before\n // setting it to something else, but its error prone and should probably be split into\n // `pendingRange` and `renderedRange`, the latter reflecting whats actually in the DOM.\n /** Get the current rendered range of items. */\n getRenderedRange() {\n return this._renderedRange;\n }\n /**\n * Sets the total size of all content (in pixels), including content that is not currently\n * rendered.\n */\n setTotalContentSize(size) {\n if (this._totalContentSize !== size) {\n this._totalContentSize = size;\n this._calculateSpacerSize();\n this._markChangeDetectionNeeded();\n }\n }\n /** Sets the currently rendered range of indices. */\n setRenderedRange(range) {\n if (!rangesEqual(this._renderedRange, range)) {\n this._renderedRangeSubject.next(this._renderedRange = range);\n this._markChangeDetectionNeeded(() => this._scrollStrategy.onContentRendered());\n }\n }\n /**\n * Gets the offset from the start of the viewport to the start of the rendered data (in pixels).\n */\n getOffsetToRenderedContentStart() {\n return this._renderedContentOffsetNeedsRewrite ? null : this._renderedContentOffset;\n }\n /**\n * Sets the offset from the start of the viewport to either the start or end of the rendered data\n * (in pixels).\n */\n setRenderedContentOffset(offset, to = 'to-start') {\n // For a horizontal viewport in a right-to-left language we need to translate along the x-axis\n // in the negative direction.\n const isRtl = this.dir && this.dir.value == 'rtl';\n const isHorizontal = this.orientation == 'horizontal';\n const axis = isHorizontal ? 'X' : 'Y';\n const axisDirection = isHorizontal && isRtl ? -1 : 1;\n let transform = `translate${axis}(${Number(axisDirection * offset)}px)`;\n this._renderedContentOffset = offset;\n if (to === 'to-end') {\n transform += ` translate${axis}(-100%)`;\n // The viewport should rewrite this as a `to-start` offset on the next render cycle. Otherwise\n // elements will appear to expand in the wrong direction (e.g. `mat-expansion-panel` would\n // expand upward).\n this._renderedContentOffsetNeedsRewrite = true;\n }\n if (this._renderedContentTransform != transform) {\n // We know this value is safe because we parse `offset` with `Number()` before passing it\n // into the string.\n this._renderedContentTransform = transform;\n this._markChangeDetectionNeeded(() => {\n if (this._renderedContentOffsetNeedsRewrite) {\n this._renderedContentOffset -= this.measureRenderedContentSize();\n this._renderedContentOffsetNeedsRewrite = false;\n this.setRenderedContentOffset(this._renderedContentOffset);\n }\n else {\n this._scrollStrategy.onRenderedOffsetChanged();\n }\n });\n }\n }\n /**\n * Scrolls to the given offset from the start of the viewport. Please note that this is not always\n * the same as setting `scrollTop` or `scrollLeft`. In a horizontal viewport with right-to-left\n * direction, this would be the equivalent of setting a fictional `scrollRight` property.\n * @param offset The offset to scroll to.\n * @param behavior The ScrollBehavior to use when scrolling. Default is behavior is `auto`.\n */\n scrollToOffset(offset, behavior = 'auto') {\n const options = { behavior };\n if (this.orientation === 'horizontal') {\n options.start = offset;\n }\n else {\n options.top = offset;\n }\n this.scrollTo(options);\n }\n /**\n * Scrolls to the offset for the given index.\n * @param index The index of the element to scroll to.\n * @param behavior The ScrollBehavior to use when scrolling. Default is behavior is `auto`.\n */\n scrollToIndex(index, behavior = 'auto') {\n this._scrollStrategy.scrollToIndex(index, behavior);\n }\n /**\n * Gets the current scroll offset from the start of the viewport (in pixels).\n * @param from The edge to measure the offset from. Defaults to 'top' in vertical mode and 'start'\n * in horizontal mode.\n */\n measureScrollOffset(from) {\n return from ?\n super.measureScrollOffset(from) :\n super.measureScrollOffset(this.orientation === 'horizontal' ? 'start' : 'top');\n }\n /** Measure the combined size of all of the rendered items. */\n measureRenderedContentSize() {\n const contentEl = this._contentWrapper.nativeElement;\n return this.orientation === 'horizontal' ? contentEl.offsetWidth : contentEl.offsetHeight;\n }\n /**\n * Measure the total combined size of the given range. Throws if the range includes items that are\n * not rendered.\n */\n measureRangeSize(range) {\n if (!this._forOf) {\n return 0;\n }\n return this._forOf.measureRangeSize(range, this.orientation);\n }\n /** Update the viewport dimensions and re-render. */\n checkViewportSize() {\n // TODO: Cleanup later when add logic for handling content resize\n this._measureViewportSize();\n this._scrollStrategy.onDataLengthChanged();\n }\n /** Measure the viewport size. */\n _measureViewportSize() {\n const viewportEl = this.elementRef.nativeElement;\n this._viewportSize = this.orientation === 'horizontal' ?\n viewportEl.clientWidth : viewportEl.clientHeight;\n }\n /** Queue up change detection to run. */\n _markChangeDetectionNeeded(runAfter) {\n if (runAfter) {\n this._runAfterChangeDetection.push(runAfter);\n }\n // Use a Promise to batch together calls to `_doChangeDetection`. This way if we set a bunch of\n // properties sequentially we only have to run `_doChangeDetection` once at the end.\n if (!this._isChangeDetectionPending) {\n this._isChangeDetectionPending = true;\n this.ngZone.runOutsideAngular(() => Promise.resolve().then(() => {\n this._doChangeDetection();\n }));\n }\n }\n /** Run change detection. */\n _doChangeDetection() {\n this._isChangeDetectionPending = false;\n // Apply the content transform. The transform can't be set via an Angular binding because\n // bypassSecurityTrustStyle is banned in Google. However the value is safe, it's composed of\n // string literals, a variable that can only be 'X' or 'Y', and user input that is run through\n // the `Number` function first to coerce it to a numeric value.\n this._contentWrapper.nativeElement.style.transform = this._renderedContentTransform;\n // Apply changes to Angular bindings. Note: We must call `markForCheck` to run change detection\n // from the root, since the repeated items are content projected in. Calling `detectChanges`\n // instead does not properly check the projected content.\n this.ngZone.run(() => this._changeDetectorRef.markForCheck());\n const runAfterChangeDetection = this._runAfterChangeDetection;\n this._runAfterChangeDetection = [];\n for (const fn of runAfterChangeDetection) {\n fn();\n }\n }\n /** Calculates the `style.width` and `style.height` for the spacer element. */\n _calculateSpacerSize() {\n this._totalContentHeight =\n this.orientation === 'horizontal' ? '' : `${this._totalContentSize}px`;\n this._totalContentWidth =\n this.orientation === 'horizontal' ? `${this._totalContentSize}px` : '';\n }\n}\nCdkVirtualScrollViewport.ɵfac = function CdkVirtualScrollViewport_Factory(t) { return new (t || CdkVirtualScrollViewport)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ChangeDetectorRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.NgZone), ɵngcc0.ɵɵdirectiveInject(VIRTUAL_SCROLL_STRATEGY, 8), ɵngcc0.ɵɵdirectiveInject(ɵngcc2.Directionality, 8), ɵngcc0.ɵɵdirectiveInject(ScrollDispatcher), ɵngcc0.ɵɵdirectiveInject(ViewportRuler)); };\nCdkVirtualScrollViewport.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: CdkVirtualScrollViewport, selectors: [[\"cdk-virtual-scroll-viewport\"]], viewQuery: function CdkVirtualScrollViewport_Query(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵviewQuery(_c0, 7);\n } if (rf & 2) {\n let _t;\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._contentWrapper = _t.first);\n } }, hostAttrs: [1, \"cdk-virtual-scroll-viewport\"], hostVars: 4, hostBindings: function CdkVirtualScrollViewport_HostBindings(rf, ctx) { if (rf & 2) {\n ɵngcc0.ɵɵclassProp(\"cdk-virtual-scroll-orientation-horizontal\", ctx.orientation === \"horizontal\")(\"cdk-virtual-scroll-orientation-vertical\", ctx.orientation !== \"horizontal\");\n } }, inputs: { orientation: \"orientation\" }, outputs: { scrolledIndexChange: \"scrolledIndexChange\" }, features: [ɵngcc0.ɵɵProvidersFeature([{\n provide: CdkScrollable,\n useExisting: CdkVirtualScrollViewport\n }]), ɵngcc0.ɵɵInheritDefinitionFeature], ngContentSelectors: _c1, decls: 4, vars: 4, consts: [[1, \"cdk-virtual-scroll-content-wrapper\"], [\"contentWrapper\", \"\"], [1, \"cdk-virtual-scroll-spacer\"]], template: function CdkVirtualScrollViewport_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵprojectionDef();\n ɵngcc0.ɵɵelementStart(0, \"div\", 0, 1);\n ɵngcc0.ɵɵprojection(2);\n ɵngcc0.ɵɵelementEnd();\n ɵngcc0.ɵɵelement(3, \"div\", 2);\n } if (rf & 2) {\n ɵngcc0.ɵɵadvance(3);\n ɵngcc0.ɵɵstyleProp(\"width\", ctx._totalContentWidth)(\"height\", ctx._totalContentHeight);\n } }, styles: [\"cdk-virtual-scroll-viewport{display:block;position:relative;overflow:auto;contain:strict;transform:translateZ(0);will-change:scroll-position;-webkit-overflow-scrolling:touch}.cdk-virtual-scroll-content-wrapper{position:absolute;top:0;left:0;contain:content}[dir=rtl] .cdk-virtual-scroll-content-wrapper{right:0;left:auto}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper{min-height:100%}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-left:0;padding-right:0;margin-left:0;margin-right:0;border-left-width:0;border-right-width:0;outline:none}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper{min-width:100%}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-top:0;padding-bottom:0;margin-top:0;margin-bottom:0;border-top-width:0;border-bottom-width:0;outline:none}.cdk-virtual-scroll-spacer{position:absolute;top:0;left:0;height:1px;width:1px;transform-origin:0 0}[dir=rtl] .cdk-virtual-scroll-spacer{right:0;left:auto;transform-origin:100% 0}\\n\"], encapsulation: 2, changeDetection: 0 });\nCdkVirtualScrollViewport.ctorParameters = () => [\n { type: ElementRef },\n { type: ChangeDetectorRef },\n { type: NgZone },\n { type: undefined, decorators: [{ type: Optional }, { type: Inject, args: [VIRTUAL_SCROLL_STRATEGY,] }] },\n { type: Directionality, decorators: [{ type: Optional }] },\n { type: ScrollDispatcher },\n { type: ViewportRuler }\n];\nCdkVirtualScrollViewport.propDecorators = {\n orientation: [{ type: Input }],\n scrolledIndexChange: [{ type: Output }],\n _contentWrapper: [{ type: ViewChild, args: ['contentWrapper', { static: true },] }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkVirtualScrollViewport, [{\n type: Component,\n args: [{\n selector: 'cdk-virtual-scroll-viewport',\n template: \"\\n
\\n \\n
\\n\\n\\n\",\n host: {\n 'class': 'cdk-virtual-scroll-viewport',\n '[class.cdk-virtual-scroll-orientation-horizontal]': 'orientation === \"horizontal\"',\n '[class.cdk-virtual-scroll-orientation-vertical]': 'orientation !== \"horizontal\"'\n },\n encapsulation: ViewEncapsulation.None,\n changeDetection: ChangeDetectionStrategy.OnPush,\n providers: [{\n provide: CdkScrollable,\n useExisting: CdkVirtualScrollViewport\n }],\n styles: [\"cdk-virtual-scroll-viewport{display:block;position:relative;overflow:auto;contain:strict;transform:translateZ(0);will-change:scroll-position;-webkit-overflow-scrolling:touch}.cdk-virtual-scroll-content-wrapper{position:absolute;top:0;left:0;contain:content}[dir=rtl] .cdk-virtual-scroll-content-wrapper{right:0;left:auto}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper{min-height:100%}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-left:0;padding-right:0;margin-left:0;margin-right:0;border-left-width:0;border-right-width:0;outline:none}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper{min-width:100%}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-top:0;padding-bottom:0;margin-top:0;margin-bottom:0;border-top-width:0;border-bottom-width:0;outline:none}.cdk-virtual-scroll-spacer{position:absolute;top:0;left:0;height:1px;width:1px;transform-origin:0 0}[dir=rtl] .cdk-virtual-scroll-spacer{right:0;left:auto;transform-origin:100% 0}\\n\"]\n }]\n }], function () { return [{ type: ɵngcc0.ElementRef }, { type: ɵngcc0.ChangeDetectorRef }, { type: ɵngcc0.NgZone }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [VIRTUAL_SCROLL_STRATEGY]\n }] }, { type: ɵngcc2.Directionality, decorators: [{\n type: Optional\n }] }, { type: ScrollDispatcher }, { type: ViewportRuler }]; }, { scrolledIndexChange: [{\n type: Output\n }], orientation: [{\n type: Input\n }], _contentWrapper: [{\n type: ViewChild,\n args: ['contentWrapper', { static: true }]\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Helper to extract the offset of a DOM Node in a certain direction. */\nfunction getOffset(orientation, direction, node) {\n const el = node;\n if (!el.getBoundingClientRect) {\n return 0;\n }\n const rect = el.getBoundingClientRect();\n if (orientation === 'horizontal') {\n return direction === 'start' ? rect.left : rect.right;\n }\n return direction === 'start' ? rect.top : rect.bottom;\n}\n/**\n * A directive similar to `ngForOf` to be used for rendering data inside a virtual scrolling\n * container.\n */\nclass CdkVirtualForOf {\n constructor(\n /** The view container to add items to. */\n _viewContainerRef, \n /** The template to use when stamping out new items. */\n _template, \n /** The set of available differs. */\n _differs, \n /** The strategy used to render items in the virtual scroll viewport. */\n _viewRepeater, \n /** The virtual scrolling viewport that these items are being rendered in. */\n _viewport, ngZone) {\n this._viewContainerRef = _viewContainerRef;\n this._template = _template;\n this._differs = _differs;\n this._viewRepeater = _viewRepeater;\n this._viewport = _viewport;\n /** Emits when the rendered view of the data changes. */\n this.viewChange = new Subject();\n /** Subject that emits when a new DataSource instance is given. */\n this._dataSourceChanges = new Subject();\n /** Emits whenever the data in the current DataSource changes. */\n this.dataStream = this._dataSourceChanges\n .pipe(\n // Start off with null `DataSource`.\n startWith(null), \n // Bundle up the previous and current data sources so we can work with both.\n pairwise(), \n // Use `_changeDataSource` to disconnect from the previous data source and connect to the\n // new one, passing back a stream of data changes which we run through `switchMap` to give\n // us a data stream that emits the latest data from whatever the current `DataSource` is.\n switchMap(([prev, cur]) => this._changeDataSource(prev, cur)), \n // Replay the last emitted data when someone subscribes.\n shareReplay(1));\n /** The differ used to calculate changes to the data. */\n this._differ = null;\n /** Whether the rendered data should be updated during the next ngDoCheck cycle. */\n this._needsUpdate = false;\n this._destroyed = new Subject();\n this.dataStream.subscribe(data => {\n this._data = data;\n this._onRenderedDataChange();\n });\n this._viewport.renderedRangeStream.pipe(takeUntil(this._destroyed)).subscribe(range => {\n this._renderedRange = range;\n ngZone.run(() => this.viewChange.next(this._renderedRange));\n this._onRenderedDataChange();\n });\n this._viewport.attach(this);\n }\n /** The DataSource to display. */\n get cdkVirtualForOf() {\n return this._cdkVirtualForOf;\n }\n set cdkVirtualForOf(value) {\n this._cdkVirtualForOf = value;\n if (isDataSource(value)) {\n this._dataSourceChanges.next(value);\n }\n else {\n // If value is an an NgIterable, convert it to an array.\n this._dataSourceChanges.next(new ArrayDataSource(isObservable(value) ? value : Array.from(value || [])));\n }\n }\n /**\n * The `TrackByFunction` to use for tracking changes. The `TrackByFunction` takes the index and\n * the item and produces a value to be used as the item's identity when tracking changes.\n */\n get cdkVirtualForTrackBy() {\n return this._cdkVirtualForTrackBy;\n }\n set cdkVirtualForTrackBy(fn) {\n this._needsUpdate = true;\n this._cdkVirtualForTrackBy = fn ?\n (index, item) => fn(index + (this._renderedRange ? this._renderedRange.start : 0), item) :\n undefined;\n }\n /** The template used to stamp out new elements. */\n set cdkVirtualForTemplate(value) {\n if (value) {\n this._needsUpdate = true;\n this._template = value;\n }\n }\n /**\n * The size of the cache used to store templates that are not being used for re-use later.\n * Setting the cache size to `0` will disable caching. Defaults to 20 templates.\n */\n get cdkVirtualForTemplateCacheSize() {\n return this._viewRepeater.viewCacheSize;\n }\n set cdkVirtualForTemplateCacheSize(size) {\n this._viewRepeater.viewCacheSize = coerceNumberProperty(size);\n }\n /**\n * Measures the combined size (width for horizontal orientation, height for vertical) of all items\n * in the specified range. Throws an error if the range includes items that are not currently\n * rendered.\n */\n measureRangeSize(range, orientation) {\n if (range.start >= range.end) {\n return 0;\n }\n if ((range.start < this._renderedRange.start || range.end > this._renderedRange.end) &&\n (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error(`Error: attempted to measure an item that isn't rendered.`);\n }\n // The index into the list of rendered views for the first item in the range.\n const renderedStartIndex = range.start - this._renderedRange.start;\n // The length of the range we're measuring.\n const rangeLen = range.end - range.start;\n // Loop over all the views, find the first and land node and compute the size by subtracting\n // the top of the first node from the bottom of the last one.\n let firstNode;\n let lastNode;\n // Find the first node by starting from the beginning and going forwards.\n for (let i = 0; i < rangeLen; i++) {\n const view = this._viewContainerRef.get(i + renderedStartIndex);\n if (view && view.rootNodes.length) {\n firstNode = lastNode = view.rootNodes[0];\n break;\n }\n }\n // Find the last node by starting from the end and going backwards.\n for (let i = rangeLen - 1; i > -1; i--) {\n const view = this._viewContainerRef.get(i + renderedStartIndex);\n if (view && view.rootNodes.length) {\n lastNode = view.rootNodes[view.rootNodes.length - 1];\n break;\n }\n }\n return firstNode && lastNode ?\n getOffset(orientation, 'end', lastNode) - getOffset(orientation, 'start', firstNode) : 0;\n }\n ngDoCheck() {\n if (this._differ && this._needsUpdate) {\n // TODO(mmalerba): We should differentiate needs update due to scrolling and a new portion of\n // this list being rendered (can use simpler algorithm) vs needs update due to data actually\n // changing (need to do this diff).\n const changes = this._differ.diff(this._renderedItems);\n if (!changes) {\n this._updateContext();\n }\n else {\n this._applyChanges(changes);\n }\n this._needsUpdate = false;\n }\n }\n ngOnDestroy() {\n this._viewport.detach();\n this._dataSourceChanges.next(undefined);\n this._dataSourceChanges.complete();\n this.viewChange.complete();\n this._destroyed.next();\n this._destroyed.complete();\n this._viewRepeater.detach();\n }\n /** React to scroll state changes in the viewport. */\n _onRenderedDataChange() {\n if (!this._renderedRange) {\n return;\n }\n this._renderedItems = this._data.slice(this._renderedRange.start, this._renderedRange.end);\n if (!this._differ) {\n // Use a wrapper function for the `trackBy` so any new values are\n // picked up automatically without having to recreate the differ.\n this._differ = this._differs.find(this._renderedItems).create((index, item) => {\n return this.cdkVirtualForTrackBy ? this.cdkVirtualForTrackBy(index, item) : item;\n });\n }\n this._needsUpdate = true;\n }\n /** Swap out one `DataSource` for another. */\n _changeDataSource(oldDs, newDs) {\n if (oldDs) {\n oldDs.disconnect(this);\n }\n this._needsUpdate = true;\n return newDs ? newDs.connect(this) : of();\n }\n /** Update the `CdkVirtualForOfContext` for all views. */\n _updateContext() {\n const count = this._data.length;\n let i = this._viewContainerRef.length;\n while (i--) {\n const view = this._viewContainerRef.get(i);\n view.context.index = this._renderedRange.start + i;\n view.context.count = count;\n this._updateComputedContextProperties(view.context);\n view.detectChanges();\n }\n }\n /** Apply changes to the DOM. */\n _applyChanges(changes) {\n this._viewRepeater.applyChanges(changes, this._viewContainerRef, (record, _adjustedPreviousIndex, currentIndex) => this._getEmbeddedViewArgs(record, currentIndex), (record) => record.item);\n // Update $implicit for any items that had an identity change.\n changes.forEachIdentityChange((record) => {\n const view = this._viewContainerRef.get(record.currentIndex);\n view.context.$implicit = record.item;\n });\n // Update the context variables on all items.\n const count = this._data.length;\n let i = this._viewContainerRef.length;\n while (i--) {\n const view = this._viewContainerRef.get(i);\n view.context.index = this._renderedRange.start + i;\n view.context.count = count;\n this._updateComputedContextProperties(view.context);\n }\n }\n /** Update the computed properties on the `CdkVirtualForOfContext`. */\n _updateComputedContextProperties(context) {\n context.first = context.index === 0;\n context.last = context.index === context.count - 1;\n context.even = context.index % 2 === 0;\n context.odd = !context.even;\n }\n _getEmbeddedViewArgs(record, index) {\n // Note that it's important that we insert the item directly at the proper index,\n // rather than inserting it and the moving it in place, because if there's a directive\n // on the same node that injects the `ViewContainerRef`, Angular will insert another\n // comment node which can throw off the move when it's being repeated for all items.\n return {\n templateRef: this._template,\n context: {\n $implicit: record.item,\n // It's guaranteed that the iterable is not \"undefined\" or \"null\" because we only\n // generate views for elements if the \"cdkVirtualForOf\" iterable has elements.\n cdkVirtualForOf: this._cdkVirtualForOf,\n index: -1,\n count: -1,\n first: false,\n last: false,\n odd: false,\n even: false\n },\n index,\n };\n }\n}\nCdkVirtualForOf.ɵfac = function CdkVirtualForOf_Factory(t) { return new (t || CdkVirtualForOf)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.IterableDiffers), ɵngcc0.ɵɵdirectiveInject(_VIEW_REPEATER_STRATEGY), ɵngcc0.ɵɵdirectiveInject(CdkVirtualScrollViewport, 4), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.NgZone)); };\nCdkVirtualForOf.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkVirtualForOf, selectors: [[\"\", \"cdkVirtualFor\", \"\", \"cdkVirtualForOf\", \"\"]], inputs: { cdkVirtualForOf: \"cdkVirtualForOf\", cdkVirtualForTrackBy: \"cdkVirtualForTrackBy\", cdkVirtualForTemplate: \"cdkVirtualForTemplate\", cdkVirtualForTemplateCacheSize: \"cdkVirtualForTemplateCacheSize\" }, features: [ɵngcc0.ɵɵProvidersFeature([\n { provide: _VIEW_REPEATER_STRATEGY, useClass: _RecycleViewRepeaterStrategy },\n ])] });\nCdkVirtualForOf.ctorParameters = () => [\n { type: ViewContainerRef },\n { type: TemplateRef },\n { type: IterableDiffers },\n { type: _RecycleViewRepeaterStrategy, decorators: [{ type: Inject, args: [_VIEW_REPEATER_STRATEGY,] }] },\n { type: CdkVirtualScrollViewport, decorators: [{ type: SkipSelf }] },\n { type: NgZone }\n];\nCdkVirtualForOf.propDecorators = {\n cdkVirtualForOf: [{ type: Input }],\n cdkVirtualForTrackBy: [{ type: Input }],\n cdkVirtualForTemplate: [{ type: Input }],\n cdkVirtualForTemplateCacheSize: [{ type: Input }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkVirtualForOf, [{\n type: Directive,\n args: [{\n selector: '[cdkVirtualFor][cdkVirtualForOf]',\n providers: [\n { provide: _VIEW_REPEATER_STRATEGY, useClass: _RecycleViewRepeaterStrategy },\n ]\n }]\n }], function () { return [{ type: ɵngcc0.ViewContainerRef }, { type: ɵngcc0.TemplateRef }, { type: ɵngcc0.IterableDiffers }, { type: ɵngcc3._RecycleViewRepeaterStrategy, decorators: [{\n type: Inject,\n args: [_VIEW_REPEATER_STRATEGY]\n }] }, { type: CdkVirtualScrollViewport, decorators: [{\n type: SkipSelf\n }] }, { type: ɵngcc0.NgZone }]; }, { cdkVirtualForOf: [{\n type: Input\n }], cdkVirtualForTrackBy: [{\n type: Input\n }], cdkVirtualForTemplate: [{\n type: Input\n }], cdkVirtualForTemplateCacheSize: [{\n type: Input\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass CdkScrollableModule {\n}\nCdkScrollableModule.ɵfac = function CdkScrollableModule_Factory(t) { return new (t || CdkScrollableModule)(); };\nCdkScrollableModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: CdkScrollableModule });\nCdkScrollableModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({});\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkScrollableModule, [{\n type: NgModule,\n args: [{\n exports: [CdkScrollable],\n declarations: [CdkScrollable]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(CdkScrollableModule, { declarations: [CdkScrollable], exports: [CdkScrollable] }); })();\n/**\n * @docs-primary-export\n */\nclass ScrollingModule {\n}\nScrollingModule.ɵfac = function ScrollingModule_Factory(t) { return new (t || ScrollingModule)(); };\nScrollingModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: ScrollingModule });\nScrollingModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({ imports: [[\n BidiModule,\n PlatformModule,\n CdkScrollableModule\n ], BidiModule, CdkScrollableModule] });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(ScrollingModule, [{\n type: NgModule,\n args: [{\n imports: [\n BidiModule,\n PlatformModule,\n CdkScrollableModule\n ],\n exports: [\n BidiModule,\n CdkScrollableModule,\n CdkFixedSizeVirtualScroll,\n CdkVirtualForOf,\n CdkVirtualScrollViewport,\n ],\n declarations: [\n CdkFixedSizeVirtualScroll,\n CdkVirtualForOf,\n CdkVirtualScrollViewport,\n ]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(ScrollingModule, { declarations: function () { return [CdkFixedSizeVirtualScroll, CdkVirtualForOf, CdkVirtualScrollViewport]; }, imports: function () { return [BidiModule,\n PlatformModule, CdkScrollableModule]; }, exports: function () { return [BidiModule, CdkScrollableModule, CdkFixedSizeVirtualScroll, CdkVirtualForOf, CdkVirtualScrollViewport]; } }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { CdkFixedSizeVirtualScroll, CdkScrollable, CdkScrollableModule, CdkVirtualForOf, CdkVirtualScrollViewport, DEFAULT_RESIZE_TIME, DEFAULT_SCROLL_TIME, FixedSizeVirtualScrollStrategy, ScrollDispatcher, ScrollingModule, VIRTUAL_SCROLL_STRATEGY, ViewportRuler, _fixedSizeVirtualScrollStrategyFactory };\n\n//# sourceMappingURL=scrolling.js.map","import { FocusKeyManager } from '@angular/cdk/a11y';\nimport { Directionality, BidiModule } from '@angular/cdk/bidi';\nimport { coerceBooleanProperty, coerceNumberProperty } from '@angular/cdk/coercion';\nimport { hasModifierKey, SPACE, ENTER } from '@angular/cdk/keycodes';\nimport { DOCUMENT } from '@angular/common';\nimport { Directive, ElementRef, TemplateRef, InjectionToken, EventEmitter, Component, ViewEncapsulation, ChangeDetectionStrategy, Inject, forwardRef, Optional, ContentChild, ViewChild, Input, Output, QueryList, ChangeDetectorRef, ContentChildren, HostListener, NgModule } from '@angular/core';\nimport { Subject, of } from 'rxjs';\nimport { startWith, takeUntil } from 'rxjs/operators';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nimport * as ɵngcc0 from '@angular/core';\nimport * as ɵngcc1 from '@angular/cdk/bidi';\n\nfunction CdkStep_ng_template_0_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵprojection(0);\n} }\nconst _c0 = [\"*\"];\nclass CdkStepHeader {\n constructor(_elementRef) {\n this._elementRef = _elementRef;\n }\n /** Focuses the step header. */\n focus() {\n this._elementRef.nativeElement.focus();\n }\n}\nCdkStepHeader.ɵfac = function CdkStepHeader_Factory(t) { return new (t || CdkStepHeader)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef)); };\nCdkStepHeader.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkStepHeader, selectors: [[\"\", \"cdkStepHeader\", \"\"]], hostAttrs: [\"role\", \"tab\"] });\nCdkStepHeader.ctorParameters = () => [\n { type: ElementRef }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkStepHeader, [{\n type: Directive,\n args: [{\n selector: '[cdkStepHeader]',\n host: {\n 'role': 'tab'\n }\n }]\n }], function () { return [{ type: ɵngcc0.ElementRef }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass CdkStepLabel {\n constructor(/** @docs-private */ template) {\n this.template = template;\n }\n}\nCdkStepLabel.ɵfac = function CdkStepLabel_Factory(t) { return new (t || CdkStepLabel)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef)); };\nCdkStepLabel.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkStepLabel, selectors: [[\"\", \"cdkStepLabel\", \"\"]] });\nCdkStepLabel.ctorParameters = () => [\n { type: TemplateRef }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkStepLabel, [{\n type: Directive,\n args: [{\n selector: '[cdkStepLabel]'\n }]\n }], function () { return [{ type: ɵngcc0.TemplateRef }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Used to generate unique ID for each stepper component. */\nlet nextId = 0;\n/** Change event emitted on selection changes. */\nclass StepperSelectionEvent {\n}\n/** Enum to represent the different states of the steps. */\nconst STEP_STATE = {\n NUMBER: 'number',\n EDIT: 'edit',\n DONE: 'done',\n ERROR: 'error'\n};\n/** InjectionToken that can be used to specify the global stepper options. */\nconst STEPPER_GLOBAL_OPTIONS = new InjectionToken('STEPPER_GLOBAL_OPTIONS');\nclass CdkStep {\n constructor(_stepper, stepperOptions) {\n this._stepper = _stepper;\n /** Whether user has attempted to move away from the step. */\n this.interacted = false;\n /** Emits when the user has attempted to move away from the step. */\n this.interactedStream = new EventEmitter();\n this._editable = true;\n this._optional = false;\n this._completedOverride = null;\n this._customError = null;\n this._stepperOptions = stepperOptions ? stepperOptions : {};\n this._displayDefaultIndicatorType = this._stepperOptions.displayDefaultIndicatorType !== false;\n }\n /** Whether the user can return to this step once it has been marked as completed. */\n get editable() {\n return this._editable;\n }\n set editable(value) {\n this._editable = coerceBooleanProperty(value);\n }\n /** Whether the completion of step is optional. */\n get optional() {\n return this._optional;\n }\n set optional(value) {\n this._optional = coerceBooleanProperty(value);\n }\n /** Whether step is marked as completed. */\n get completed() {\n return this._completedOverride == null ? this._getDefaultCompleted() : this._completedOverride;\n }\n set completed(value) {\n this._completedOverride = coerceBooleanProperty(value);\n }\n _getDefaultCompleted() {\n return this.stepControl ? this.stepControl.valid && this.interacted : this.interacted;\n }\n /** Whether step has an error. */\n get hasError() {\n return this._customError == null ? this._getDefaultError() : this._customError;\n }\n set hasError(value) {\n this._customError = coerceBooleanProperty(value);\n }\n _getDefaultError() {\n return this.stepControl && this.stepControl.invalid && this.interacted;\n }\n /** Selects this step component. */\n select() {\n this._stepper.selected = this;\n }\n /** Resets the step to its initial state. Note that this includes resetting form data. */\n reset() {\n this.interacted = false;\n if (this._completedOverride != null) {\n this._completedOverride = false;\n }\n if (this._customError != null) {\n this._customError = false;\n }\n if (this.stepControl) {\n this.stepControl.reset();\n }\n }\n ngOnChanges() {\n // Since basically all inputs of the MatStep get proxied through the view down to the\n // underlying MatStepHeader, we have to make sure that change detection runs correctly.\n this._stepper._stateChanged();\n }\n _markAsInteracted() {\n if (!this.interacted) {\n this.interacted = true;\n this.interactedStream.emit(this);\n }\n }\n /** Determines whether the error state can be shown. */\n _showError() {\n var _a;\n // We want to show the error state either if the user opted into/out of it using the\n // global options, or if they've explicitly set it through the `hasError` input.\n return (_a = this._stepperOptions.showError) !== null && _a !== void 0 ? _a : this._customError != null;\n }\n}\nCdkStep.ɵfac = function CdkStep_Factory(t) { return new (t || CdkStep)(ɵngcc0.ɵɵdirectiveInject(forwardRef(() => CdkStepper)), ɵngcc0.ɵɵdirectiveInject(STEPPER_GLOBAL_OPTIONS, 8)); };\nCdkStep.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: CdkStep, selectors: [[\"cdk-step\"]], contentQueries: function CdkStep_ContentQueries(rf, ctx, dirIndex) { if (rf & 1) {\n ɵngcc0.ɵɵcontentQuery(dirIndex, CdkStepLabel, 5);\n } if (rf & 2) {\n let _t;\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx.stepLabel = _t.first);\n } }, viewQuery: function CdkStep_Query(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵviewQuery(TemplateRef, 7);\n } if (rf & 2) {\n let _t;\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx.content = _t.first);\n } }, inputs: { editable: \"editable\", optional: \"optional\", completed: \"completed\", hasError: \"hasError\", stepControl: \"stepControl\", label: \"label\", errorMessage: \"errorMessage\", ariaLabel: [\"aria-label\", \"ariaLabel\"], ariaLabelledby: [\"aria-labelledby\", \"ariaLabelledby\"], state: \"state\" }, outputs: { interactedStream: \"interacted\" }, exportAs: [\"cdkStep\"], features: [ɵngcc0.ɵɵNgOnChangesFeature], ngContentSelectors: _c0, decls: 1, vars: 0, template: function CdkStep_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵprojectionDef();\n ɵngcc0.ɵɵtemplate(0, CdkStep_ng_template_0_Template, 1, 0, \"ng-template\");\n } }, encapsulation: 2, changeDetection: 0 });\nCdkStep.ctorParameters = () => [\n { type: CdkStepper, decorators: [{ type: Inject, args: [forwardRef(() => CdkStepper),] }] },\n { type: undefined, decorators: [{ type: Optional }, { type: Inject, args: [STEPPER_GLOBAL_OPTIONS,] }] }\n];\nCdkStep.propDecorators = {\n stepLabel: [{ type: ContentChild, args: [CdkStepLabel,] }],\n content: [{ type: ViewChild, args: [TemplateRef, { static: true },] }],\n stepControl: [{ type: Input }],\n interactedStream: [{ type: Output, args: ['interacted',] }],\n label: [{ type: Input }],\n errorMessage: [{ type: Input }],\n ariaLabel: [{ type: Input, args: ['aria-label',] }],\n ariaLabelledby: [{ type: Input, args: ['aria-labelledby',] }],\n state: [{ type: Input }],\n editable: [{ type: Input }],\n optional: [{ type: Input }],\n completed: [{ type: Input }],\n hasError: [{ type: Input }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkStep, [{\n type: Component,\n args: [{\n selector: 'cdk-step',\n exportAs: 'cdkStep',\n template: '',\n encapsulation: ViewEncapsulation.None,\n changeDetection: ChangeDetectionStrategy.OnPush\n }]\n }], function () { return [{ type: CdkStepper, decorators: [{\n type: Inject,\n args: [forwardRef(() => CdkStepper)]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [STEPPER_GLOBAL_OPTIONS]\n }] }]; }, { interactedStream: [{\n type: Output,\n args: ['interacted']\n }], editable: [{\n type: Input\n }], optional: [{\n type: Input\n }], completed: [{\n type: Input\n }], hasError: [{\n type: Input\n }], stepLabel: [{\n type: ContentChild,\n args: [CdkStepLabel]\n }], content: [{\n type: ViewChild,\n args: [TemplateRef, { static: true }]\n }], stepControl: [{\n type: Input\n }], label: [{\n type: Input\n }], errorMessage: [{\n type: Input\n }], ariaLabel: [{\n type: Input,\n args: ['aria-label']\n }], ariaLabelledby: [{\n type: Input,\n args: ['aria-labelledby']\n }], state: [{\n type: Input\n }] }); })();\nclass CdkStepper {\n constructor(_dir, _changeDetectorRef, _elementRef, _document) {\n this._dir = _dir;\n this._changeDetectorRef = _changeDetectorRef;\n this._elementRef = _elementRef;\n /** Emits when the component is destroyed. */\n this._destroyed = new Subject();\n /** Steps that belong to the current stepper, excluding ones from nested steppers. */\n this.steps = new QueryList();\n this._linear = false;\n this._selectedIndex = 0;\n /** Event emitted when the selected step has changed. */\n this.selectionChange = new EventEmitter();\n /**\n * @deprecated To be turned into a private property. Use `orientation` instead.\n * @breaking-change 13.0.0\n */\n this._orientation = 'horizontal';\n this._groupId = nextId++;\n this._document = _document;\n }\n /** Whether the validity of previous steps should be checked or not. */\n get linear() {\n return this._linear;\n }\n set linear(value) {\n this._linear = coerceBooleanProperty(value);\n }\n /** The index of the selected step. */\n get selectedIndex() {\n return this._selectedIndex;\n }\n set selectedIndex(index) {\n var _a;\n const newIndex = coerceNumberProperty(index);\n if (this.steps && this._steps) {\n // Ensure that the index can't be out of bounds.\n if (!this._isValidIndex(index) && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('cdkStepper: Cannot assign out-of-bounds value to `selectedIndex`.');\n }\n (_a = this.selected) === null || _a === void 0 ? void 0 : _a._markAsInteracted();\n if (this._selectedIndex !== newIndex && !this._anyControlsInvalidOrPending(newIndex) &&\n (newIndex >= this._selectedIndex || this.steps.toArray()[newIndex].editable)) {\n this._updateSelectedItemIndex(index);\n }\n }\n else {\n this._selectedIndex = newIndex;\n }\n }\n /** The step that is selected. */\n get selected() {\n return this.steps ? this.steps.toArray()[this.selectedIndex] : undefined;\n }\n set selected(step) {\n this.selectedIndex = (step && this.steps) ? this.steps.toArray().indexOf(step) : -1;\n }\n /** Orientation of the stepper. */\n get orientation() { return this._orientation; }\n set orientation(value) {\n // This is a protected method so that `MatSteppter` can hook into it.\n this._orientation = value;\n if (this._keyManager) {\n this._keyManager.withVerticalOrientation(value === 'vertical');\n }\n }\n ngAfterContentInit() {\n this._steps.changes\n .pipe(startWith(this._steps), takeUntil(this._destroyed))\n .subscribe((steps) => {\n this.steps.reset(steps.filter(step => step._stepper === this));\n this.steps.notifyOnChanges();\n });\n }\n ngAfterViewInit() {\n // Note that while the step headers are content children by default, any components that\n // extend this one might have them as view children. We initialize the keyboard handling in\n // AfterViewInit so we're guaranteed for both view and content children to be defined.\n this._keyManager = new FocusKeyManager(this._stepHeader)\n .withWrap()\n .withHomeAndEnd()\n .withVerticalOrientation(this._orientation === 'vertical');\n (this._dir ? this._dir.change : of())\n .pipe(startWith(this._layoutDirection()), takeUntil(this._destroyed))\n .subscribe(direction => this._keyManager.withHorizontalOrientation(direction));\n this._keyManager.updateActiveItem(this._selectedIndex);\n // No need to `takeUntil` here, because we're the ones destroying `steps`.\n this.steps.changes.subscribe(() => {\n if (!this.selected) {\n this._selectedIndex = Math.max(this._selectedIndex - 1, 0);\n }\n });\n // The logic which asserts that the selected index is within bounds doesn't run before the\n // steps are initialized, because we don't how many steps there are yet so we may have an\n // invalid index on init. If that's the case, auto-correct to the default so we don't throw.\n if (!this._isValidIndex(this._selectedIndex)) {\n this._selectedIndex = 0;\n }\n }\n ngOnDestroy() {\n this.steps.destroy();\n this._destroyed.next();\n this._destroyed.complete();\n }\n /** Selects and focuses the next step in list. */\n next() {\n this.selectedIndex = Math.min(this._selectedIndex + 1, this.steps.length - 1);\n }\n /** Selects and focuses the previous step in list. */\n previous() {\n this.selectedIndex = Math.max(this._selectedIndex - 1, 0);\n }\n /** Resets the stepper to its initial state. Note that this includes clearing form data. */\n reset() {\n this._updateSelectedItemIndex(0);\n this.steps.forEach(step => step.reset());\n this._stateChanged();\n }\n /** Returns a unique id for each step label element. */\n _getStepLabelId(i) {\n return `cdk-step-label-${this._groupId}-${i}`;\n }\n /** Returns unique id for each step content element. */\n _getStepContentId(i) {\n return `cdk-step-content-${this._groupId}-${i}`;\n }\n /** Marks the component to be change detected. */\n _stateChanged() {\n this._changeDetectorRef.markForCheck();\n }\n /** Returns position state of the step with the given index. */\n _getAnimationDirection(index) {\n const position = index - this._selectedIndex;\n if (position < 0) {\n return this._layoutDirection() === 'rtl' ? 'next' : 'previous';\n }\n else if (position > 0) {\n return this._layoutDirection() === 'rtl' ? 'previous' : 'next';\n }\n return 'current';\n }\n /** Returns the type of icon to be displayed. */\n _getIndicatorType(index, state = STEP_STATE.NUMBER) {\n const step = this.steps.toArray()[index];\n const isCurrentStep = this._isCurrentStep(index);\n return step._displayDefaultIndicatorType ? this._getDefaultIndicatorLogic(step, isCurrentStep) :\n this._getGuidelineLogic(step, isCurrentStep, state);\n }\n _getDefaultIndicatorLogic(step, isCurrentStep) {\n if (step._showError() && step.hasError && !isCurrentStep) {\n return STEP_STATE.ERROR;\n }\n else if (!step.completed || isCurrentStep) {\n return STEP_STATE.NUMBER;\n }\n else {\n return step.editable ? STEP_STATE.EDIT : STEP_STATE.DONE;\n }\n }\n _getGuidelineLogic(step, isCurrentStep, state = STEP_STATE.NUMBER) {\n if (step._showError() && step.hasError && !isCurrentStep) {\n return STEP_STATE.ERROR;\n }\n else if (step.completed && !isCurrentStep) {\n return STEP_STATE.DONE;\n }\n else if (step.completed && isCurrentStep) {\n return state;\n }\n else if (step.editable && isCurrentStep) {\n return STEP_STATE.EDIT;\n }\n else {\n return state;\n }\n }\n _isCurrentStep(index) {\n return this._selectedIndex === index;\n }\n /** Returns the index of the currently-focused step header. */\n _getFocusIndex() {\n return this._keyManager ? this._keyManager.activeItemIndex : this._selectedIndex;\n }\n _updateSelectedItemIndex(newIndex) {\n const stepsArray = this.steps.toArray();\n this.selectionChange.emit({\n selectedIndex: newIndex,\n previouslySelectedIndex: this._selectedIndex,\n selectedStep: stepsArray[newIndex],\n previouslySelectedStep: stepsArray[this._selectedIndex],\n });\n // If focus is inside the stepper, move it to the next header, otherwise it may become\n // lost when the active step content is hidden. We can't be more granular with the check\n // (e.g. checking whether focus is inside the active step), because we don't have a\n // reference to the elements that are rendering out the content.\n this._containsFocus() ? this._keyManager.setActiveItem(newIndex) :\n this._keyManager.updateActiveItem(newIndex);\n this._selectedIndex = newIndex;\n this._stateChanged();\n }\n _onKeydown(event) {\n const hasModifier = hasModifierKey(event);\n const keyCode = event.keyCode;\n const manager = this._keyManager;\n if (manager.activeItemIndex != null && !hasModifier &&\n (keyCode === SPACE || keyCode === ENTER)) {\n this.selectedIndex = manager.activeItemIndex;\n event.preventDefault();\n }\n else {\n manager.onKeydown(event);\n }\n }\n _anyControlsInvalidOrPending(index) {\n if (this._linear && index >= 0) {\n return this.steps.toArray().slice(0, index).some(step => {\n const control = step.stepControl;\n const isIncomplete = control ? (control.invalid || control.pending || !step.interacted) : !step.completed;\n return isIncomplete && !step.optional && !step._completedOverride;\n });\n }\n return false;\n }\n _layoutDirection() {\n return this._dir && this._dir.value === 'rtl' ? 'rtl' : 'ltr';\n }\n /** Checks whether the stepper contains the focused element. */\n _containsFocus() {\n const stepperElement = this._elementRef.nativeElement;\n const focusedElement = this._document.activeElement;\n return stepperElement === focusedElement || stepperElement.contains(focusedElement);\n }\n /** Checks whether the passed-in index is a valid step index. */\n _isValidIndex(index) {\n return index > -1 && (!this.steps || index < this.steps.length);\n }\n}\nCdkStepper.ɵfac = function CdkStepper_Factory(t) { return new (t || CdkStepper)(ɵngcc0.ɵɵdirectiveInject(ɵngcc1.Directionality, 8), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ChangeDetectorRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(DOCUMENT)); };\nCdkStepper.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkStepper, selectors: [[\"\", \"cdkStepper\", \"\"]], contentQueries: function CdkStepper_ContentQueries(rf, ctx, dirIndex) { if (rf & 1) {\n ɵngcc0.ɵɵcontentQuery(dirIndex, CdkStep, 5);\n ɵngcc0.ɵɵcontentQuery(dirIndex, CdkStepHeader, 5);\n } if (rf & 2) {\n let _t;\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._steps = _t);\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._stepHeader = _t);\n } }, inputs: { linear: \"linear\", selectedIndex: \"selectedIndex\", selected: \"selected\", orientation: \"orientation\" }, outputs: { selectionChange: \"selectionChange\" }, exportAs: [\"cdkStepper\"] });\nCdkStepper.ctorParameters = () => [\n { type: Directionality, decorators: [{ type: Optional }] },\n { type: ChangeDetectorRef },\n { type: ElementRef },\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] }\n];\nCdkStepper.propDecorators = {\n _steps: [{ type: ContentChildren, args: [CdkStep, { descendants: true },] }],\n _stepHeader: [{ type: ContentChildren, args: [CdkStepHeader, { descendants: true },] }],\n linear: [{ type: Input }],\n selectedIndex: [{ type: Input }],\n selected: [{ type: Input }],\n selectionChange: [{ type: Output }],\n orientation: [{ type: Input }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkStepper, [{\n type: Directive,\n args: [{\n selector: '[cdkStepper]',\n exportAs: 'cdkStepper'\n }]\n }], function () { return [{ type: ɵngcc1.Directionality, decorators: [{\n type: Optional\n }] }, { type: ɵngcc0.ChangeDetectorRef }, { type: ɵngcc0.ElementRef }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, { selectionChange: [{\n type: Output\n }], linear: [{\n type: Input\n }], selectedIndex: [{\n type: Input\n }], selected: [{\n type: Input\n }], orientation: [{\n type: Input\n }], _steps: [{\n type: ContentChildren,\n args: [CdkStep, { descendants: true }]\n }], _stepHeader: [{\n type: ContentChildren,\n args: [CdkStepHeader, { descendants: true }]\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Button that moves to the next step in a stepper workflow. */\nclass CdkStepperNext {\n constructor(_stepper) {\n this._stepper = _stepper;\n /** Type of the next button. Defaults to \"submit\" if not specified. */\n this.type = 'submit';\n }\n // We have to use a `HostListener` here in order to support both Ivy and ViewEngine.\n // In Ivy the `host` bindings will be merged when this class is extended, whereas in\n // ViewEngine they're overwritten.\n // TODO(crisbeto): we move this back into `host` once Ivy is turned on by default.\n // tslint:disable-next-line:no-host-decorator-in-concrete\n _handleClick() {\n this._stepper.next();\n }\n}\nCdkStepperNext.ɵfac = function CdkStepperNext_Factory(t) { return new (t || CdkStepperNext)(ɵngcc0.ɵɵdirectiveInject(CdkStepper)); };\nCdkStepperNext.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkStepperNext, selectors: [[\"button\", \"cdkStepperNext\", \"\"]], hostVars: 1, hostBindings: function CdkStepperNext_HostBindings(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵlistener(\"click\", function CdkStepperNext_click_HostBindingHandler() { return ctx._handleClick(); });\n } if (rf & 2) {\n ɵngcc0.ɵɵhostProperty(\"type\", ctx.type);\n } }, inputs: { type: \"type\" } });\nCdkStepperNext.ctorParameters = () => [\n { type: CdkStepper }\n];\nCdkStepperNext.propDecorators = {\n type: [{ type: Input }],\n _handleClick: [{ type: HostListener, args: ['click',] }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkStepperNext, [{\n type: Directive,\n args: [{\n selector: 'button[cdkStepperNext]',\n host: {\n '[type]': 'type'\n }\n }]\n }], function () { return [{ type: CdkStepper }]; }, { type: [{\n type: Input\n }], \n // We have to use a `HostListener` here in order to support both Ivy and ViewEngine.\n // In Ivy the `host` bindings will be merged when this class is extended, whereas in\n // ViewEngine they're overwritten.\n // TODO(crisbeto): we move this back into `host` once Ivy is turned on by default.\n // tslint:disable-next-line:no-host-decorator-in-concrete\n _handleClick: [{\n type: HostListener,\n args: ['click']\n }] }); })();\n/** Button that moves to the previous step in a stepper workflow. */\nclass CdkStepperPrevious {\n constructor(_stepper) {\n this._stepper = _stepper;\n /** Type of the previous button. Defaults to \"button\" if not specified. */\n this.type = 'button';\n }\n // We have to use a `HostListener` here in order to support both Ivy and ViewEngine.\n // In Ivy the `host` bindings will be merged when this class is extended, whereas in\n // ViewEngine they're overwritten.\n // TODO(crisbeto): we move this back into `host` once Ivy is turned on by default.\n // tslint:disable-next-line:no-host-decorator-in-concrete\n _handleClick() {\n this._stepper.previous();\n }\n}\nCdkStepperPrevious.ɵfac = function CdkStepperPrevious_Factory(t) { return new (t || CdkStepperPrevious)(ɵngcc0.ɵɵdirectiveInject(CdkStepper)); };\nCdkStepperPrevious.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkStepperPrevious, selectors: [[\"button\", \"cdkStepperPrevious\", \"\"]], hostVars: 1, hostBindings: function CdkStepperPrevious_HostBindings(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵlistener(\"click\", function CdkStepperPrevious_click_HostBindingHandler() { return ctx._handleClick(); });\n } if (rf & 2) {\n ɵngcc0.ɵɵhostProperty(\"type\", ctx.type);\n } }, inputs: { type: \"type\" } });\nCdkStepperPrevious.ctorParameters = () => [\n { type: CdkStepper }\n];\nCdkStepperPrevious.propDecorators = {\n type: [{ type: Input }],\n _handleClick: [{ type: HostListener, args: ['click',] }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkStepperPrevious, [{\n type: Directive,\n args: [{\n selector: 'button[cdkStepperPrevious]',\n host: {\n '[type]': 'type'\n }\n }]\n }], function () { return [{ type: CdkStepper }]; }, { type: [{\n type: Input\n }], \n // We have to use a `HostListener` here in order to support both Ivy and ViewEngine.\n // In Ivy the `host` bindings will be merged when this class is extended, whereas in\n // ViewEngine they're overwritten.\n // TODO(crisbeto): we move this back into `host` once Ivy is turned on by default.\n // tslint:disable-next-line:no-host-decorator-in-concrete\n _handleClick: [{\n type: HostListener,\n args: ['click']\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass CdkStepperModule {\n}\nCdkStepperModule.ɵfac = function CdkStepperModule_Factory(t) { return new (t || CdkStepperModule)(); };\nCdkStepperModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: CdkStepperModule });\nCdkStepperModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({ imports: [[BidiModule]] });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkStepperModule, [{\n type: NgModule,\n args: [{\n imports: [BidiModule],\n exports: [\n CdkStep,\n CdkStepper,\n CdkStepHeader,\n CdkStepLabel,\n CdkStepperNext,\n CdkStepperPrevious,\n ],\n declarations: [\n CdkStep,\n CdkStepper,\n CdkStepHeader,\n CdkStepLabel,\n CdkStepperNext,\n CdkStepperPrevious,\n ]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(CdkStepperModule, { declarations: function () { return [CdkStep, CdkStepper, CdkStepHeader, CdkStepLabel, CdkStepperNext, CdkStepperPrevious]; }, imports: function () { return [BidiModule]; }, exports: function () { return [CdkStep, CdkStepper, CdkStepHeader, CdkStepLabel, CdkStepperNext, CdkStepperPrevious]; } }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { CdkStep, CdkStepHeader, CdkStepLabel, CdkStepper, CdkStepperModule, CdkStepperNext, CdkStepperPrevious, STEPPER_GLOBAL_OPTIONS, STEP_STATE, StepperSelectionEvent };\n\n//# sourceMappingURL=stepper.js.map","import { Directionality } from '@angular/cdk/bidi';\nimport { coerceBooleanProperty } from '@angular/cdk/coercion';\nimport { _VIEW_REPEATER_STRATEGY, _RecycleViewRepeaterStrategy, isDataSource, _DisposeViewRepeaterStrategy } from '@angular/cdk/collections';\nimport * as ɵngcc0 from '@angular/core';\nimport * as ɵngcc1 from '@angular/cdk/bidi';\nimport * as ɵngcc2 from '@angular/cdk/platform';\nimport * as ɵngcc3 from '@angular/cdk/scrolling';\n\nconst _c0 = [[[\"caption\"]], [[\"colgroup\"], [\"col\"]]];\nconst _c1 = [\"caption\", \"colgroup, col\"];\nfunction CdkTextColumn_th_1_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementStart(0, \"th\", 3);\n ɵngcc0.ɵɵtext(1);\n ɵngcc0.ɵɵelementEnd();\n} if (rf & 2) {\n const ctx_r0 = ɵngcc0.ɵɵnextContext();\n ɵngcc0.ɵɵstyleProp(\"text-align\", ctx_r0.justify);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵtextInterpolate1(\" \", ctx_r0.headerText, \" \");\n} }\nfunction CdkTextColumn_td_2_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementStart(0, \"td\", 4);\n ɵngcc0.ɵɵtext(1);\n ɵngcc0.ɵɵelementEnd();\n} if (rf & 2) {\n const data_r2 = ctx.$implicit;\n const ctx_r1 = ɵngcc0.ɵɵnextContext();\n ɵngcc0.ɵɵstyleProp(\"text-align\", ctx_r1.justify);\n ɵngcc0.ɵɵadvance(1);\n ɵngcc0.ɵɵtextInterpolate1(\" \", ctx_r1.dataAccessor(data_r2, ctx_r1.name), \" \");\n} }\nexport { DataSource } from '@angular/cdk/collections';\nimport { Platform } from '@angular/cdk/platform';\nimport { ViewportRuler, ScrollingModule } from '@angular/cdk/scrolling';\nimport { DOCUMENT } from '@angular/common';\nimport { InjectionToken, Directive, TemplateRef, Inject, Optional, Input, ContentChild, ElementRef, Injectable, NgZone, IterableDiffers, ViewContainerRef, Component, ChangeDetectionStrategy, ViewEncapsulation, EmbeddedViewRef, ChangeDetectorRef, Attribute, SkipSelf, ViewChild, ContentChildren, NgModule } from '@angular/core';\nimport { Subject, from, BehaviorSubject, isObservable, of } from 'rxjs';\nimport { takeUntil, take } from 'rxjs/operators';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Mixin to provide a directive with a function that checks if the sticky input has been\n * changed since the last time the function was called. Essentially adds a dirty-check to the\n * sticky value.\n * @docs-private\n */\nfunction mixinHasStickyInput(base) {\n return class extends base {\n constructor(...args) {\n super(...args);\n this._sticky = false;\n /** Whether the sticky input has changed since it was last checked. */\n this._hasStickyChanged = false;\n }\n /** Whether sticky positioning should be applied. */\n get sticky() { return this._sticky; }\n set sticky(v) {\n const prevValue = this._sticky;\n this._sticky = coerceBooleanProperty(v);\n this._hasStickyChanged = prevValue !== this._sticky;\n }\n /** Whether the sticky value has changed since this was last called. */\n hasStickyChanged() {\n const hasStickyChanged = this._hasStickyChanged;\n this._hasStickyChanged = false;\n return hasStickyChanged;\n }\n /** Resets the dirty check for cases where the sticky state has been used without checking. */\n resetStickyChanged() {\n this._hasStickyChanged = false;\n }\n };\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Used to provide a table to some of the sub-components without causing a circular dependency.\n * @docs-private\n */\nconst CDK_TABLE = new InjectionToken('CDK_TABLE');\n/** Injection token that can be used to specify the text column options. */\nconst TEXT_COLUMN_OPTIONS = new InjectionToken('text-column-options');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Cell definition for a CDK table.\n * Captures the template of a column's data row cell as well as cell-specific properties.\n */\nclass CdkCellDef {\n constructor(/** @docs-private */ template) {\n this.template = template;\n }\n}\nCdkCellDef.ɵfac = function CdkCellDef_Factory(t) { return new (t || CdkCellDef)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef)); };\nCdkCellDef.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkCellDef, selectors: [[\"\", \"cdkCellDef\", \"\"]] });\nCdkCellDef.ctorParameters = () => [\n { type: TemplateRef }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkCellDef, [{\n type: Directive,\n args: [{ selector: '[cdkCellDef]' }]\n }], function () { return [{ type: ɵngcc0.TemplateRef }]; }, null); })();\n/**\n * Header cell definition for a CDK table.\n * Captures the template of a column's header cell and as well as cell-specific properties.\n */\nclass CdkHeaderCellDef {\n constructor(/** @docs-private */ template) {\n this.template = template;\n }\n}\nCdkHeaderCellDef.ɵfac = function CdkHeaderCellDef_Factory(t) { return new (t || CdkHeaderCellDef)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef)); };\nCdkHeaderCellDef.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkHeaderCellDef, selectors: [[\"\", \"cdkHeaderCellDef\", \"\"]] });\nCdkHeaderCellDef.ctorParameters = () => [\n { type: TemplateRef }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkHeaderCellDef, [{\n type: Directive,\n args: [{ selector: '[cdkHeaderCellDef]' }]\n }], function () { return [{ type: ɵngcc0.TemplateRef }]; }, null); })();\n/**\n * Footer cell definition for a CDK table.\n * Captures the template of a column's footer cell and as well as cell-specific properties.\n */\nclass CdkFooterCellDef {\n constructor(/** @docs-private */ template) {\n this.template = template;\n }\n}\nCdkFooterCellDef.ɵfac = function CdkFooterCellDef_Factory(t) { return new (t || CdkFooterCellDef)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef)); };\nCdkFooterCellDef.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkFooterCellDef, selectors: [[\"\", \"cdkFooterCellDef\", \"\"]] });\nCdkFooterCellDef.ctorParameters = () => [\n { type: TemplateRef }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkFooterCellDef, [{\n type: Directive,\n args: [{ selector: '[cdkFooterCellDef]' }]\n }], function () { return [{ type: ɵngcc0.TemplateRef }]; }, null); })();\n// Boilerplate for applying mixins to CdkColumnDef.\n/** @docs-private */\nclass CdkColumnDefBase {\n}\nconst _CdkColumnDefBase = mixinHasStickyInput(CdkColumnDefBase);\n/**\n * Column definition for the CDK table.\n * Defines a set of cells available for a table column.\n */\nclass CdkColumnDef extends _CdkColumnDefBase {\n constructor(_table) {\n super();\n this._table = _table;\n this._stickyEnd = false;\n }\n /** Unique name for this column. */\n get name() { return this._name; }\n set name(name) { this._setNameInput(name); }\n /**\n * Whether this column should be sticky positioned on the end of the row. Should make sure\n * that it mimics the `CanStick` mixin such that `_hasStickyChanged` is set to true if the value\n * has been changed.\n */\n get stickyEnd() {\n return this._stickyEnd;\n }\n set stickyEnd(v) {\n const prevValue = this._stickyEnd;\n this._stickyEnd = coerceBooleanProperty(v);\n this._hasStickyChanged = prevValue !== this._stickyEnd;\n }\n /**\n * Overridable method that sets the css classes that will be added to every cell in this\n * column.\n * In the future, columnCssClassName will change from type string[] to string and this\n * will set a single string value.\n * @docs-private\n */\n _updateColumnCssClassName() {\n this._columnCssClassName = [`cdk-column-${this.cssClassFriendlyName}`];\n }\n /**\n * This has been extracted to a util because of TS 4 and VE.\n * View Engine doesn't support property rename inheritance.\n * TS 4.0 doesn't allow properties to override accessors or vice-versa.\n * @docs-private\n */\n _setNameInput(value) {\n // If the directive is set without a name (updated programmatically), then this setter will\n // trigger with an empty string and should not overwrite the programmatically set value.\n if (value) {\n this._name = value;\n this.cssClassFriendlyName = value.replace(/[^a-z0-9_-]/ig, '-');\n this._updateColumnCssClassName();\n }\n }\n}\nCdkColumnDef.ɵfac = function CdkColumnDef_Factory(t) { return new (t || CdkColumnDef)(ɵngcc0.ɵɵdirectiveInject(CDK_TABLE, 8)); };\nCdkColumnDef.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkColumnDef, selectors: [[\"\", \"cdkColumnDef\", \"\"]], contentQueries: function CdkColumnDef_ContentQueries(rf, ctx, dirIndex) { if (rf & 1) {\n ɵngcc0.ɵɵcontentQuery(dirIndex, CdkCellDef, 5);\n ɵngcc0.ɵɵcontentQuery(dirIndex, CdkHeaderCellDef, 5);\n ɵngcc0.ɵɵcontentQuery(dirIndex, CdkFooterCellDef, 5);\n } if (rf & 2) {\n let _t;\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx.cell = _t.first);\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx.headerCell = _t.first);\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx.footerCell = _t.first);\n } }, inputs: { sticky: \"sticky\", name: [\"cdkColumnDef\", \"name\"], stickyEnd: \"stickyEnd\" }, features: [ɵngcc0.ɵɵProvidersFeature([{ provide: 'MAT_SORT_HEADER_COLUMN_DEF', useExisting: CdkColumnDef }]), ɵngcc0.ɵɵInheritDefinitionFeature] });\nCdkColumnDef.ctorParameters = () => [\n { type: undefined, decorators: [{ type: Inject, args: [CDK_TABLE,] }, { type: Optional }] }\n];\nCdkColumnDef.propDecorators = {\n name: [{ type: Input, args: ['cdkColumnDef',] }],\n stickyEnd: [{ type: Input, args: ['stickyEnd',] }],\n cell: [{ type: ContentChild, args: [CdkCellDef,] }],\n headerCell: [{ type: ContentChild, args: [CdkHeaderCellDef,] }],\n footerCell: [{ type: ContentChild, args: [CdkFooterCellDef,] }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkColumnDef, [{\n type: Directive,\n args: [{\n selector: '[cdkColumnDef]',\n inputs: ['sticky'],\n providers: [{ provide: 'MAT_SORT_HEADER_COLUMN_DEF', useExisting: CdkColumnDef }]\n }]\n }], function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [CDK_TABLE]\n }, {\n type: Optional\n }] }]; }, { name: [{\n type: Input,\n args: ['cdkColumnDef']\n }], stickyEnd: [{\n type: Input,\n args: ['stickyEnd']\n }], cell: [{\n type: ContentChild,\n args: [CdkCellDef]\n }], headerCell: [{\n type: ContentChild,\n args: [CdkHeaderCellDef]\n }], footerCell: [{\n type: ContentChild,\n args: [CdkFooterCellDef]\n }] }); })();\n/** Base class for the cells. Adds a CSS classname that identifies the column it renders in. */\nclass BaseCdkCell {\n constructor(columnDef, elementRef) {\n // If IE 11 is dropped before we switch to setting a single class name, change to multi param\n // with destructuring.\n const classList = elementRef.nativeElement.classList;\n for (const className of columnDef._columnCssClassName) {\n classList.add(className);\n }\n }\n}\n/** Header cell template container that adds the right classes and role. */\nclass CdkHeaderCell extends BaseCdkCell {\n constructor(columnDef, elementRef) {\n super(columnDef, elementRef);\n }\n}\nCdkHeaderCell.ɵfac = function CdkHeaderCell_Factory(t) { return new (t || CdkHeaderCell)(ɵngcc0.ɵɵdirectiveInject(CdkColumnDef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef)); };\nCdkHeaderCell.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkHeaderCell, selectors: [[\"cdk-header-cell\"], [\"th\", \"cdk-header-cell\", \"\"]], hostAttrs: [\"role\", \"columnheader\", 1, \"cdk-header-cell\"], features: [ɵngcc0.ɵɵInheritDefinitionFeature] });\nCdkHeaderCell.ctorParameters = () => [\n { type: CdkColumnDef },\n { type: ElementRef }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkHeaderCell, [{\n type: Directive,\n args: [{\n selector: 'cdk-header-cell, th[cdk-header-cell]',\n host: {\n 'class': 'cdk-header-cell',\n 'role': 'columnheader'\n }\n }]\n }], function () { return [{ type: CdkColumnDef }, { type: ɵngcc0.ElementRef }]; }, null); })();\n/** Footer cell template container that adds the right classes and role. */\nclass CdkFooterCell extends BaseCdkCell {\n constructor(columnDef, elementRef) {\n super(columnDef, elementRef);\n }\n}\nCdkFooterCell.ɵfac = function CdkFooterCell_Factory(t) { return new (t || CdkFooterCell)(ɵngcc0.ɵɵdirectiveInject(CdkColumnDef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef)); };\nCdkFooterCell.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkFooterCell, selectors: [[\"cdk-footer-cell\"], [\"td\", \"cdk-footer-cell\", \"\"]], hostAttrs: [\"role\", \"gridcell\", 1, \"cdk-footer-cell\"], features: [ɵngcc0.ɵɵInheritDefinitionFeature] });\nCdkFooterCell.ctorParameters = () => [\n { type: CdkColumnDef },\n { type: ElementRef }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkFooterCell, [{\n type: Directive,\n args: [{\n selector: 'cdk-footer-cell, td[cdk-footer-cell]',\n host: {\n 'class': 'cdk-footer-cell',\n 'role': 'gridcell'\n }\n }]\n }], function () { return [{ type: CdkColumnDef }, { type: ɵngcc0.ElementRef }]; }, null); })();\n/** Cell template container that adds the right classes and role. */\nclass CdkCell extends BaseCdkCell {\n constructor(columnDef, elementRef) {\n super(columnDef, elementRef);\n }\n}\nCdkCell.ɵfac = function CdkCell_Factory(t) { return new (t || CdkCell)(ɵngcc0.ɵɵdirectiveInject(CdkColumnDef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef)); };\nCdkCell.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkCell, selectors: [[\"cdk-cell\"], [\"td\", \"cdk-cell\", \"\"]], hostAttrs: [\"role\", \"gridcell\", 1, \"cdk-cell\"], features: [ɵngcc0.ɵɵInheritDefinitionFeature] });\nCdkCell.ctorParameters = () => [\n { type: CdkColumnDef },\n { type: ElementRef }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkCell, [{\n type: Directive,\n args: [{\n selector: 'cdk-cell, td[cdk-cell]',\n host: {\n 'class': 'cdk-cell',\n 'role': 'gridcell'\n }\n }]\n }], function () { return [{ type: CdkColumnDef }, { type: ɵngcc0.ElementRef }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @docs-private\n */\nclass _Schedule {\n constructor() {\n this.tasks = [];\n this.endTasks = [];\n }\n}\n/** Injection token used to provide a coalesced style scheduler. */\nconst _COALESCED_STYLE_SCHEDULER = new InjectionToken('_COALESCED_STYLE_SCHEDULER');\n/**\n * Allows grouping up CSSDom mutations after the current execution context.\n * This can significantly improve performance when separate consecutive functions are\n * reading from the CSSDom and then mutating it.\n *\n * @docs-private\n */\nclass _CoalescedStyleScheduler {\n constructor(_ngZone) {\n this._ngZone = _ngZone;\n this._currentSchedule = null;\n this._destroyed = new Subject();\n }\n /**\n * Schedules the specified task to run at the end of the current VM turn.\n */\n schedule(task) {\n this._createScheduleIfNeeded();\n this._currentSchedule.tasks.push(task);\n }\n /**\n * Schedules the specified task to run after other scheduled tasks at the end of the current\n * VM turn.\n */\n scheduleEnd(task) {\n this._createScheduleIfNeeded();\n this._currentSchedule.endTasks.push(task);\n }\n /** Prevent any further tasks from running. */\n ngOnDestroy() {\n this._destroyed.next();\n this._destroyed.complete();\n }\n _createScheduleIfNeeded() {\n if (this._currentSchedule) {\n return;\n }\n this._currentSchedule = new _Schedule();\n this._getScheduleObservable().pipe(takeUntil(this._destroyed)).subscribe(() => {\n while (this._currentSchedule.tasks.length || this._currentSchedule.endTasks.length) {\n const schedule = this._currentSchedule;\n // Capture new tasks scheduled by the current set of tasks.\n this._currentSchedule = new _Schedule();\n for (const task of schedule.tasks) {\n task();\n }\n for (const task of schedule.endTasks) {\n task();\n }\n }\n this._currentSchedule = null;\n });\n }\n _getScheduleObservable() {\n // Use onStable when in the context of an ongoing change detection cycle so that we\n // do not accidentally trigger additional cycles.\n return this._ngZone.isStable ?\n from(Promise.resolve(undefined)) :\n this._ngZone.onStable.pipe(take(1));\n }\n}\n_CoalescedStyleScheduler.ɵfac = function _CoalescedStyleScheduler_Factory(t) { return new (t || _CoalescedStyleScheduler)(ɵngcc0.ɵɵinject(ɵngcc0.NgZone)); };\n_CoalescedStyleScheduler.ɵprov = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjectable({ token: _CoalescedStyleScheduler, factory: _CoalescedStyleScheduler.ɵfac });\n_CoalescedStyleScheduler.ctorParameters = () => [\n { type: NgZone }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(_CoalescedStyleScheduler, [{\n type: Injectable\n }], function () { return [{ type: ɵngcc0.NgZone }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * The row template that can be used by the mat-table. Should not be used outside of the\n * material library.\n */\nconst CDK_ROW_TEMPLATE = ``;\n/**\n * Base class for the CdkHeaderRowDef and CdkRowDef that handles checking their columns inputs\n * for changes and notifying the table.\n */\nclass BaseRowDef {\n constructor(\n /** @docs-private */ template, _differs) {\n this.template = template;\n this._differs = _differs;\n }\n ngOnChanges(changes) {\n // Create a new columns differ if one does not yet exist. Initialize it based on initial value\n // of the columns property or an empty array if none is provided.\n if (!this._columnsDiffer) {\n const columns = (changes['columns'] && changes['columns'].currentValue) || [];\n this._columnsDiffer = this._differs.find(columns).create();\n this._columnsDiffer.diff(columns);\n }\n }\n /**\n * Returns the difference between the current columns and the columns from the last diff, or null\n * if there is no difference.\n */\n getColumnsDiff() {\n return this._columnsDiffer.diff(this.columns);\n }\n /** Gets this row def's relevant cell template from the provided column def. */\n extractCellTemplate(column) {\n if (this instanceof CdkHeaderRowDef) {\n return column.headerCell.template;\n }\n if (this instanceof CdkFooterRowDef) {\n return column.footerCell.template;\n }\n else {\n return column.cell.template;\n }\n }\n}\nBaseRowDef.ɵfac = function BaseRowDef_Factory(t) { return new (t || BaseRowDef)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.IterableDiffers)); };\nBaseRowDef.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: BaseRowDef, features: [ɵngcc0.ɵɵNgOnChangesFeature] });\nBaseRowDef.ctorParameters = () => [\n { type: TemplateRef },\n { type: IterableDiffers }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(BaseRowDef, [{\n type: Directive\n }], function () { return [{ type: ɵngcc0.TemplateRef }, { type: ɵngcc0.IterableDiffers }]; }, null); })();\n// Boilerplate for applying mixins to CdkHeaderRowDef.\n/** @docs-private */\nclass CdkHeaderRowDefBase extends BaseRowDef {\n}\nconst _CdkHeaderRowDefBase = mixinHasStickyInput(CdkHeaderRowDefBase);\n/**\n * Header row definition for the CDK table.\n * Captures the header row's template and other header properties such as the columns to display.\n */\nclass CdkHeaderRowDef extends _CdkHeaderRowDefBase {\n constructor(template, _differs, _table) {\n super(template, _differs);\n this._table = _table;\n }\n // Prerender fails to recognize that ngOnChanges in a part of this class through inheritance.\n // Explicitly define it so that the method is called as part of the Angular lifecycle.\n ngOnChanges(changes) {\n super.ngOnChanges(changes);\n }\n}\nCdkHeaderRowDef.ɵfac = function CdkHeaderRowDef_Factory(t) { return new (t || CdkHeaderRowDef)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.IterableDiffers), ɵngcc0.ɵɵdirectiveInject(CDK_TABLE, 8)); };\nCdkHeaderRowDef.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkHeaderRowDef, selectors: [[\"\", \"cdkHeaderRowDef\", \"\"]], inputs: { columns: [\"cdkHeaderRowDef\", \"columns\"], sticky: [\"cdkHeaderRowDefSticky\", \"sticky\"] }, features: [ɵngcc0.ɵɵInheritDefinitionFeature, ɵngcc0.ɵɵNgOnChangesFeature] });\nCdkHeaderRowDef.ctorParameters = () => [\n { type: TemplateRef },\n { type: IterableDiffers },\n { type: undefined, decorators: [{ type: Inject, args: [CDK_TABLE,] }, { type: Optional }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkHeaderRowDef, [{\n type: Directive,\n args: [{\n selector: '[cdkHeaderRowDef]',\n inputs: ['columns: cdkHeaderRowDef', 'sticky: cdkHeaderRowDefSticky']\n }]\n }], function () { return [{ type: ɵngcc0.TemplateRef }, { type: ɵngcc0.IterableDiffers }, { type: undefined, decorators: [{\n type: Inject,\n args: [CDK_TABLE]\n }, {\n type: Optional\n }] }]; }, null); })();\n// Boilerplate for applying mixins to CdkFooterRowDef.\n/** @docs-private */\nclass CdkFooterRowDefBase extends BaseRowDef {\n}\nconst _CdkFooterRowDefBase = mixinHasStickyInput(CdkFooterRowDefBase);\n/**\n * Footer row definition for the CDK table.\n * Captures the footer row's template and other footer properties such as the columns to display.\n */\nclass CdkFooterRowDef extends _CdkFooterRowDefBase {\n constructor(template, _differs, _table) {\n super(template, _differs);\n this._table = _table;\n }\n // Prerender fails to recognize that ngOnChanges in a part of this class through inheritance.\n // Explicitly define it so that the method is called as part of the Angular lifecycle.\n ngOnChanges(changes) {\n super.ngOnChanges(changes);\n }\n}\nCdkFooterRowDef.ɵfac = function CdkFooterRowDef_Factory(t) { return new (t || CdkFooterRowDef)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.IterableDiffers), ɵngcc0.ɵɵdirectiveInject(CDK_TABLE, 8)); };\nCdkFooterRowDef.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkFooterRowDef, selectors: [[\"\", \"cdkFooterRowDef\", \"\"]], inputs: { columns: [\"cdkFooterRowDef\", \"columns\"], sticky: [\"cdkFooterRowDefSticky\", \"sticky\"] }, features: [ɵngcc0.ɵɵInheritDefinitionFeature, ɵngcc0.ɵɵNgOnChangesFeature] });\nCdkFooterRowDef.ctorParameters = () => [\n { type: TemplateRef },\n { type: IterableDiffers },\n { type: undefined, decorators: [{ type: Inject, args: [CDK_TABLE,] }, { type: Optional }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkFooterRowDef, [{\n type: Directive,\n args: [{\n selector: '[cdkFooterRowDef]',\n inputs: ['columns: cdkFooterRowDef', 'sticky: cdkFooterRowDefSticky']\n }]\n }], function () { return [{ type: ɵngcc0.TemplateRef }, { type: ɵngcc0.IterableDiffers }, { type: undefined, decorators: [{\n type: Inject,\n args: [CDK_TABLE]\n }, {\n type: Optional\n }] }]; }, null); })();\n/**\n * Data row definition for the CDK table.\n * Captures the header row's template and other row properties such as the columns to display and\n * a when predicate that describes when this row should be used.\n */\nclass CdkRowDef extends BaseRowDef {\n // TODO(andrewseguin): Add an input for providing a switch function to determine\n // if this template should be used.\n constructor(template, _differs, _table) {\n super(template, _differs);\n this._table = _table;\n }\n}\nCdkRowDef.ɵfac = function CdkRowDef_Factory(t) { return new (t || CdkRowDef)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.IterableDiffers), ɵngcc0.ɵɵdirectiveInject(CDK_TABLE, 8)); };\nCdkRowDef.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkRowDef, selectors: [[\"\", \"cdkRowDef\", \"\"]], inputs: { columns: [\"cdkRowDefColumns\", \"columns\"], when: [\"cdkRowDefWhen\", \"when\"] }, features: [ɵngcc0.ɵɵInheritDefinitionFeature] });\nCdkRowDef.ctorParameters = () => [\n { type: TemplateRef },\n { type: IterableDiffers },\n { type: undefined, decorators: [{ type: Inject, args: [CDK_TABLE,] }, { type: Optional }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkRowDef, [{\n type: Directive,\n args: [{\n selector: '[cdkRowDef]',\n inputs: ['columns: cdkRowDefColumns', 'when: cdkRowDefWhen']\n }]\n }], function () { return [{ type: ɵngcc0.TemplateRef }, { type: ɵngcc0.IterableDiffers }, { type: undefined, decorators: [{\n type: Inject,\n args: [CDK_TABLE]\n }, {\n type: Optional\n }] }]; }, null); })();\n/**\n * Outlet for rendering cells inside of a row or header row.\n * @docs-private\n */\nclass CdkCellOutlet {\n constructor(_viewContainer) {\n this._viewContainer = _viewContainer;\n CdkCellOutlet.mostRecentCellOutlet = this;\n }\n ngOnDestroy() {\n // If this was the last outlet being rendered in the view, remove the reference\n // from the static property after it has been destroyed to avoid leaking memory.\n if (CdkCellOutlet.mostRecentCellOutlet === this) {\n CdkCellOutlet.mostRecentCellOutlet = null;\n }\n }\n}\nCdkCellOutlet.ɵfac = function CdkCellOutlet_Factory(t) { return new (t || CdkCellOutlet)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef)); };\nCdkCellOutlet.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkCellOutlet, selectors: [[\"\", \"cdkCellOutlet\", \"\"]] });\n/**\n * Static property containing the latest constructed instance of this class.\n * Used by the CDK table when each CdkHeaderRow and CdkRow component is created using\n * createEmbeddedView. After one of these components are created, this property will provide\n * a handle to provide that component's cells and context. After init, the CdkCellOutlet will\n * construct the cells with the provided context.\n */\nCdkCellOutlet.mostRecentCellOutlet = null;\nCdkCellOutlet.ctorParameters = () => [\n { type: ViewContainerRef }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkCellOutlet, [{\n type: Directive,\n args: [{ selector: '[cdkCellOutlet]' }]\n }], function () { return [{ type: ɵngcc0.ViewContainerRef }]; }, null); })();\n/** Header template container that contains the cell outlet. Adds the right class and role. */\nclass CdkHeaderRow {\n}\nCdkHeaderRow.ɵfac = function CdkHeaderRow_Factory(t) { return new (t || CdkHeaderRow)(); };\nCdkHeaderRow.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: CdkHeaderRow, selectors: [[\"cdk-header-row\"], [\"tr\", \"cdk-header-row\", \"\"]], hostAttrs: [\"role\", \"row\", 1, \"cdk-header-row\"], decls: 1, vars: 0, consts: [[\"cdkCellOutlet\", \"\"]], template: function CdkHeaderRow_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementContainer(0, 0);\n } }, directives: [CdkCellOutlet], encapsulation: 2 });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkHeaderRow, [{\n type: Component,\n args: [{\n selector: 'cdk-header-row, tr[cdk-header-row]',\n template: CDK_ROW_TEMPLATE,\n host: {\n 'class': 'cdk-header-row',\n 'role': 'row'\n },\n // See note on CdkTable for explanation on why this uses the default change detection strategy.\n // tslint:disable-next-line:validate-decorators\n changeDetection: ChangeDetectionStrategy.Default,\n encapsulation: ViewEncapsulation.None\n }]\n }], null, null); })();\n/** Footer template container that contains the cell outlet. Adds the right class and role. */\nclass CdkFooterRow {\n}\nCdkFooterRow.ɵfac = function CdkFooterRow_Factory(t) { return new (t || CdkFooterRow)(); };\nCdkFooterRow.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: CdkFooterRow, selectors: [[\"cdk-footer-row\"], [\"tr\", \"cdk-footer-row\", \"\"]], hostAttrs: [\"role\", \"row\", 1, \"cdk-footer-row\"], decls: 1, vars: 0, consts: [[\"cdkCellOutlet\", \"\"]], template: function CdkFooterRow_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementContainer(0, 0);\n } }, directives: [CdkCellOutlet], encapsulation: 2 });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkFooterRow, [{\n type: Component,\n args: [{\n selector: 'cdk-footer-row, tr[cdk-footer-row]',\n template: CDK_ROW_TEMPLATE,\n host: {\n 'class': 'cdk-footer-row',\n 'role': 'row'\n },\n // See note on CdkTable for explanation on why this uses the default change detection strategy.\n // tslint:disable-next-line:validate-decorators\n changeDetection: ChangeDetectionStrategy.Default,\n encapsulation: ViewEncapsulation.None\n }]\n }], null, null); })();\n/** Data row template container that contains the cell outlet. Adds the right class and role. */\nclass CdkRow {\n}\nCdkRow.ɵfac = function CdkRow_Factory(t) { return new (t || CdkRow)(); };\nCdkRow.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: CdkRow, selectors: [[\"cdk-row\"], [\"tr\", \"cdk-row\", \"\"]], hostAttrs: [\"role\", \"row\", 1, \"cdk-row\"], decls: 1, vars: 0, consts: [[\"cdkCellOutlet\", \"\"]], template: function CdkRow_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementContainer(0, 0);\n } }, directives: [CdkCellOutlet], encapsulation: 2 });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkRow, [{\n type: Component,\n args: [{\n selector: 'cdk-row, tr[cdk-row]',\n template: CDK_ROW_TEMPLATE,\n host: {\n 'class': 'cdk-row',\n 'role': 'row'\n },\n // See note on CdkTable for explanation on why this uses the default change detection strategy.\n // tslint:disable-next-line:validate-decorators\n changeDetection: ChangeDetectionStrategy.Default,\n encapsulation: ViewEncapsulation.None\n }]\n }], null, null); })();\n/** Row that can be used to display a message when no data is shown in the table. */\nclass CdkNoDataRow {\n constructor(templateRef) {\n this.templateRef = templateRef;\n }\n}\nCdkNoDataRow.ɵfac = function CdkNoDataRow_Factory(t) { return new (t || CdkNoDataRow)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef)); };\nCdkNoDataRow.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkNoDataRow, selectors: [[\"ng-template\", \"cdkNoDataRow\", \"\"]] });\nCdkNoDataRow.ctorParameters = () => [\n { type: TemplateRef }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkNoDataRow, [{\n type: Directive,\n args: [{\n selector: 'ng-template[cdkNoDataRow]'\n }]\n }], function () { return [{ type: ɵngcc0.TemplateRef }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * List of all possible directions that can be used for sticky positioning.\n * @docs-private\n */\nconst STICKY_DIRECTIONS = ['top', 'bottom', 'left', 'right'];\n/**\n * Applies and removes sticky positioning styles to the `CdkTable` rows and columns cells.\n * @docs-private\n */\nclass StickyStyler {\n /**\n * @param _isNativeHtmlTable Whether the sticky logic should be based on a table\n * that uses the native `
` element.\n * @param _stickCellCss The CSS class that will be applied to every row/cell that has\n * sticky positioning applied.\n * @param direction The directionality context of the table (ltr/rtl); affects column positioning\n * by reversing left/right positions.\n * @param _isBrowser Whether the table is currently being rendered on the server or the client.\n * @param _needsPositionStickyOnElement Whether we need to specify position: sticky on cells\n * using inline styles. If false, it is assumed that position: sticky is included in\n * the component stylesheet for _stickCellCss.\n * @param _positionListener A listener that is notified of changes to sticky rows/columns\n * and their dimensions.\n */\n constructor(_isNativeHtmlTable, _stickCellCss, direction, _coalescedStyleScheduler, _isBrowser = true, _needsPositionStickyOnElement = true, _positionListener) {\n this._isNativeHtmlTable = _isNativeHtmlTable;\n this._stickCellCss = _stickCellCss;\n this.direction = direction;\n this._coalescedStyleScheduler = _coalescedStyleScheduler;\n this._isBrowser = _isBrowser;\n this._needsPositionStickyOnElement = _needsPositionStickyOnElement;\n this._positionListener = _positionListener;\n this._cachedCellWidths = [];\n this._borderCellCss = {\n 'top': `${_stickCellCss}-border-elem-top`,\n 'bottom': `${_stickCellCss}-border-elem-bottom`,\n 'left': `${_stickCellCss}-border-elem-left`,\n 'right': `${_stickCellCss}-border-elem-right`,\n };\n }\n /**\n * Clears the sticky positioning styles from the row and its cells by resetting the `position`\n * style, setting the zIndex to 0, and unsetting each provided sticky direction.\n * @param rows The list of rows that should be cleared from sticking in the provided directions\n * @param stickyDirections The directions that should no longer be set as sticky on the rows.\n */\n clearStickyPositioning(rows, stickyDirections) {\n const elementsToClear = [];\n for (const row of rows) {\n // If the row isn't an element (e.g. if it's an `ng-container`),\n // it won't have inline styles or `children` so we skip it.\n if (row.nodeType !== row.ELEMENT_NODE) {\n continue;\n }\n elementsToClear.push(row);\n for (let i = 0; i < row.children.length; i++) {\n elementsToClear.push(row.children[i]);\n }\n }\n // Coalesce with sticky row/column updates (and potentially other changes like column resize).\n this._coalescedStyleScheduler.schedule(() => {\n for (const element of elementsToClear) {\n this._removeStickyStyle(element, stickyDirections);\n }\n });\n }\n /**\n * Applies sticky left and right positions to the cells of each row according to the sticky\n * states of the rendered column definitions.\n * @param rows The rows that should have its set of cells stuck according to the sticky states.\n * @param stickyStartStates A list of boolean states where each state represents whether the cell\n * in this index position should be stuck to the start of the row.\n * @param stickyEndStates A list of boolean states where each state represents whether the cell\n * in this index position should be stuck to the end of the row.\n * @param recalculateCellWidths Whether the sticky styler should recalculate the width of each\n * column cell. If `false` cached widths will be used instead.\n */\n updateStickyColumns(rows, stickyStartStates, stickyEndStates, recalculateCellWidths = true) {\n if (!rows.length || !this._isBrowser || !(stickyStartStates.some(state => state) ||\n stickyEndStates.some(state => state))) {\n if (this._positionListener) {\n this._positionListener.stickyColumnsUpdated({ sizes: [] });\n this._positionListener.stickyEndColumnsUpdated({ sizes: [] });\n }\n return;\n }\n const firstRow = rows[0];\n const numCells = firstRow.children.length;\n const cellWidths = this._getCellWidths(firstRow, recalculateCellWidths);\n const startPositions = this._getStickyStartColumnPositions(cellWidths, stickyStartStates);\n const endPositions = this._getStickyEndColumnPositions(cellWidths, stickyEndStates);\n const lastStickyStart = stickyStartStates.lastIndexOf(true);\n const firstStickyEnd = stickyEndStates.indexOf(true);\n // Coalesce with sticky row updates (and potentially other changes like column resize).\n this._coalescedStyleScheduler.schedule(() => {\n const isRtl = this.direction === 'rtl';\n const start = isRtl ? 'right' : 'left';\n const end = isRtl ? 'left' : 'right';\n for (const row of rows) {\n for (let i = 0; i < numCells; i++) {\n const cell = row.children[i];\n if (stickyStartStates[i]) {\n this._addStickyStyle(cell, start, startPositions[i], i === lastStickyStart);\n }\n if (stickyEndStates[i]) {\n this._addStickyStyle(cell, end, endPositions[i], i === firstStickyEnd);\n }\n }\n }\n if (this._positionListener) {\n this._positionListener.stickyColumnsUpdated({\n sizes: lastStickyStart === -1 ?\n [] :\n cellWidths\n .slice(0, lastStickyStart + 1)\n .map((width, index) => stickyStartStates[index] ? width : null)\n });\n this._positionListener.stickyEndColumnsUpdated({\n sizes: firstStickyEnd === -1 ?\n [] :\n cellWidths\n .slice(firstStickyEnd)\n .map((width, index) => stickyEndStates[index + firstStickyEnd] ? width : null)\n .reverse()\n });\n }\n });\n }\n /**\n * Applies sticky positioning to the row's cells if using the native table layout, and to the\n * row itself otherwise.\n * @param rowsToStick The list of rows that should be stuck according to their corresponding\n * sticky state and to the provided top or bottom position.\n * @param stickyStates A list of boolean states where each state represents whether the row\n * should be stuck in the particular top or bottom position.\n * @param position The position direction in which the row should be stuck if that row should be\n * sticky.\n *\n */\n stickRows(rowsToStick, stickyStates, position) {\n // Since we can't measure the rows on the server, we can't stick the rows properly.\n if (!this._isBrowser) {\n return;\n }\n // If positioning the rows to the bottom, reverse their order when evaluating the sticky\n // position such that the last row stuck will be \"bottom: 0px\" and so on. Note that the\n // sticky states need to be reversed as well.\n const rows = position === 'bottom' ? rowsToStick.slice().reverse() : rowsToStick;\n const states = position === 'bottom' ? stickyStates.slice().reverse() : stickyStates;\n // Measure row heights all at once before adding sticky styles to reduce layout thrashing.\n const stickyOffsets = [];\n const stickyCellHeights = [];\n const elementsToStick = [];\n for (let rowIndex = 0, stickyOffset = 0; rowIndex < rows.length; rowIndex++) {\n if (!states[rowIndex]) {\n continue;\n }\n stickyOffsets[rowIndex] = stickyOffset;\n const row = rows[rowIndex];\n elementsToStick[rowIndex] = this._isNativeHtmlTable ?\n Array.from(row.children) : [row];\n const height = row.getBoundingClientRect().height;\n stickyOffset += height;\n stickyCellHeights[rowIndex] = height;\n }\n const borderedRowIndex = states.lastIndexOf(true);\n // Coalesce with other sticky row updates (top/bottom), sticky columns updates\n // (and potentially other changes like column resize).\n this._coalescedStyleScheduler.schedule(() => {\n var _a, _b;\n for (let rowIndex = 0; rowIndex < rows.length; rowIndex++) {\n if (!states[rowIndex]) {\n continue;\n }\n const offset = stickyOffsets[rowIndex];\n const isBorderedRowIndex = rowIndex === borderedRowIndex;\n for (const element of elementsToStick[rowIndex]) {\n this._addStickyStyle(element, position, offset, isBorderedRowIndex);\n }\n }\n if (position === 'top') {\n (_a = this._positionListener) === null || _a === void 0 ? void 0 : _a.stickyHeaderRowsUpdated({ sizes: stickyCellHeights, offsets: stickyOffsets, elements: elementsToStick });\n }\n else {\n (_b = this._positionListener) === null || _b === void 0 ? void 0 : _b.stickyFooterRowsUpdated({ sizes: stickyCellHeights, offsets: stickyOffsets, elements: elementsToStick });\n }\n });\n }\n /**\n * When using the native table in Safari, sticky footer cells do not stick. The only way to stick\n * footer rows is to apply sticky styling to the tfoot container. This should only be done if\n * all footer rows are sticky. If not all footer rows are sticky, remove sticky positioning from\n * the tfoot element.\n */\n updateStickyFooterContainer(tableElement, stickyStates) {\n if (!this._isNativeHtmlTable) {\n return;\n }\n const tfoot = tableElement.querySelector('tfoot');\n // Coalesce with other sticky updates (and potentially other changes like column resize).\n this._coalescedStyleScheduler.schedule(() => {\n if (stickyStates.some(state => !state)) {\n this._removeStickyStyle(tfoot, ['bottom']);\n }\n else {\n this._addStickyStyle(tfoot, 'bottom', 0, false);\n }\n });\n }\n /**\n * Removes the sticky style on the element by removing the sticky cell CSS class, re-evaluating\n * the zIndex, removing each of the provided sticky directions, and removing the\n * sticky position if there are no more directions.\n */\n _removeStickyStyle(element, stickyDirections) {\n for (const dir of stickyDirections) {\n element.style[dir] = '';\n element.classList.remove(this._borderCellCss[dir]);\n }\n // If the element no longer has any more sticky directions, remove sticky positioning and\n // the sticky CSS class.\n // Short-circuit checking element.style[dir] for stickyDirections as they\n // were already removed above.\n const hasDirection = STICKY_DIRECTIONS.some(dir => stickyDirections.indexOf(dir) === -1 && element.style[dir]);\n if (hasDirection) {\n element.style.zIndex = this._getCalculatedZIndex(element);\n }\n else {\n // When not hasDirection, _getCalculatedZIndex will always return ''.\n element.style.zIndex = '';\n if (this._needsPositionStickyOnElement) {\n element.style.position = '';\n }\n element.classList.remove(this._stickCellCss);\n }\n }\n /**\n * Adds the sticky styling to the element by adding the sticky style class, changing position\n * to be sticky (and -webkit-sticky), setting the appropriate zIndex, and adding a sticky\n * direction and value.\n */\n _addStickyStyle(element, dir, dirValue, isBorderElement) {\n element.classList.add(this._stickCellCss);\n if (isBorderElement) {\n element.classList.add(this._borderCellCss[dir]);\n }\n element.style[dir] = `${dirValue}px`;\n element.style.zIndex = this._getCalculatedZIndex(element);\n if (this._needsPositionStickyOnElement) {\n element.style.cssText += 'position: -webkit-sticky; position: sticky; ';\n }\n }\n /**\n * Calculate what the z-index should be for the element, depending on what directions (top,\n * bottom, left, right) have been set. It should be true that elements with a top direction\n * should have the highest index since these are elements like a table header. If any of those\n * elements are also sticky in another direction, then they should appear above other elements\n * that are only sticky top (e.g. a sticky column on a sticky header). Bottom-sticky elements\n * (e.g. footer rows) should then be next in the ordering such that they are below the header\n * but above any non-sticky elements. Finally, left/right sticky elements (e.g. sticky columns)\n * should minimally increment so that they are above non-sticky elements but below top and bottom\n * elements.\n */\n _getCalculatedZIndex(element) {\n const zIndexIncrements = {\n top: 100,\n bottom: 10,\n left: 1,\n right: 1,\n };\n let zIndex = 0;\n // Use `Iterable` instead of `Array` because TypeScript, as of 3.6.3,\n // loses the array generic type in the `for of`. But we *also* have to use `Array` because\n // typescript won't iterate over an `Iterable` unless you compile with `--downlevelIteration`\n for (const dir of STICKY_DIRECTIONS) {\n if (element.style[dir]) {\n zIndex += zIndexIncrements[dir];\n }\n }\n return zIndex ? `${zIndex}` : '';\n }\n /** Gets the widths for each cell in the provided row. */\n _getCellWidths(row, recalculateCellWidths = true) {\n if (!recalculateCellWidths && this._cachedCellWidths.length) {\n return this._cachedCellWidths;\n }\n const cellWidths = [];\n const firstRowCells = row.children;\n for (let i = 0; i < firstRowCells.length; i++) {\n let cell = firstRowCells[i];\n cellWidths.push(cell.getBoundingClientRect().width);\n }\n this._cachedCellWidths = cellWidths;\n return cellWidths;\n }\n /**\n * Determines the left and right positions of each sticky column cell, which will be the\n * accumulation of all sticky column cell widths to the left and right, respectively.\n * Non-sticky cells do not need to have a value set since their positions will not be applied.\n */\n _getStickyStartColumnPositions(widths, stickyStates) {\n const positions = [];\n let nextPosition = 0;\n for (let i = 0; i < widths.length; i++) {\n if (stickyStates[i]) {\n positions[i] = nextPosition;\n nextPosition += widths[i];\n }\n }\n return positions;\n }\n /**\n * Determines the left and right positions of each sticky column cell, which will be the\n * accumulation of all sticky column cell widths to the left and right, respectively.\n * Non-sticky cells do not need to have a value set since their positions will not be applied.\n */\n _getStickyEndColumnPositions(widths, stickyStates) {\n const positions = [];\n let nextPosition = 0;\n for (let i = widths.length; i > 0; i--) {\n if (stickyStates[i]) {\n positions[i] = nextPosition;\n nextPosition += widths[i];\n }\n }\n return positions;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Returns an error to be thrown when attempting to find an unexisting column.\n * @param id Id whose lookup failed.\n * @docs-private\n */\nfunction getTableUnknownColumnError(id) {\n return Error(`Could not find column with id \"${id}\".`);\n}\n/**\n * Returns an error to be thrown when two column definitions have the same name.\n * @docs-private\n */\nfunction getTableDuplicateColumnNameError(name) {\n return Error(`Duplicate column definition name provided: \"${name}\".`);\n}\n/**\n * Returns an error to be thrown when there are multiple rows that are missing a when function.\n * @docs-private\n */\nfunction getTableMultipleDefaultRowDefsError() {\n return Error(`There can only be one default row without a when predicate function.`);\n}\n/**\n * Returns an error to be thrown when there are no matching row defs for a particular set of data.\n * @docs-private\n */\nfunction getTableMissingMatchingRowDefError(data) {\n return Error(`Could not find a matching row definition for the` +\n `provided row data: ${JSON.stringify(data)}`);\n}\n/**\n * Returns an error to be thrown when there is no row definitions present in the content.\n * @docs-private\n */\nfunction getTableMissingRowDefsError() {\n return Error('Missing definitions for header, footer, and row; ' +\n 'cannot determine which columns should be rendered.');\n}\n/**\n * Returns an error to be thrown when the data source does not match the compatible types.\n * @docs-private\n */\nfunction getTableUnknownDataSourceError() {\n return Error(`Provided data source did not match an array, Observable, or DataSource`);\n}\n/**\n * Returns an error to be thrown when the text column cannot find a parent table to inject.\n * @docs-private\n */\nfunction getTableTextColumnMissingParentTableError() {\n return Error(`Text column could not find a parent table for registration.`);\n}\n/**\n * Returns an error to be thrown when a table text column doesn't have a name.\n * @docs-private\n */\nfunction getTableTextColumnMissingNameError() {\n return Error(`Table text column must have a name.`);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** The injection token used to specify the StickyPositioningListener. */\nconst STICKY_POSITIONING_LISTENER = new InjectionToken('CDK_SPL');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Enables the recycle view repeater strategy, which reduces rendering latency. Not compatible with\n * tables that animate rows.\n */\nclass CdkRecycleRows {\n}\nCdkRecycleRows.ɵfac = function CdkRecycleRows_Factory(t) { return new (t || CdkRecycleRows)(); };\nCdkRecycleRows.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkRecycleRows, selectors: [[\"cdk-table\", \"recycleRows\", \"\"], [\"table\", \"cdk-table\", \"\", \"recycleRows\", \"\"]], features: [ɵngcc0.ɵɵProvidersFeature([\n { provide: _VIEW_REPEATER_STRATEGY, useClass: _RecycleViewRepeaterStrategy },\n ])] });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkRecycleRows, [{\n type: Directive,\n args: [{\n selector: 'cdk-table[recycleRows], table[cdk-table][recycleRows]',\n providers: [\n { provide: _VIEW_REPEATER_STRATEGY, useClass: _RecycleViewRepeaterStrategy },\n ]\n }]\n }], null, null); })();\n/**\n * Provides a handle for the table to grab the view container's ng-container to insert data rows.\n * @docs-private\n */\nclass DataRowOutlet {\n constructor(viewContainer, elementRef) {\n this.viewContainer = viewContainer;\n this.elementRef = elementRef;\n }\n}\nDataRowOutlet.ɵfac = function DataRowOutlet_Factory(t) { return new (t || DataRowOutlet)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef)); };\nDataRowOutlet.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: DataRowOutlet, selectors: [[\"\", \"rowOutlet\", \"\"]] });\nDataRowOutlet.ctorParameters = () => [\n { type: ViewContainerRef },\n { type: ElementRef }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(DataRowOutlet, [{\n type: Directive,\n args: [{ selector: '[rowOutlet]' }]\n }], function () { return [{ type: ɵngcc0.ViewContainerRef }, { type: ɵngcc0.ElementRef }]; }, null); })();\n/**\n * Provides a handle for the table to grab the view container's ng-container to insert the header.\n * @docs-private\n */\nclass HeaderRowOutlet {\n constructor(viewContainer, elementRef) {\n this.viewContainer = viewContainer;\n this.elementRef = elementRef;\n }\n}\nHeaderRowOutlet.ɵfac = function HeaderRowOutlet_Factory(t) { return new (t || HeaderRowOutlet)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef)); };\nHeaderRowOutlet.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: HeaderRowOutlet, selectors: [[\"\", \"headerRowOutlet\", \"\"]] });\nHeaderRowOutlet.ctorParameters = () => [\n { type: ViewContainerRef },\n { type: ElementRef }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(HeaderRowOutlet, [{\n type: Directive,\n args: [{ selector: '[headerRowOutlet]' }]\n }], function () { return [{ type: ɵngcc0.ViewContainerRef }, { type: ɵngcc0.ElementRef }]; }, null); })();\n/**\n * Provides a handle for the table to grab the view container's ng-container to insert the footer.\n * @docs-private\n */\nclass FooterRowOutlet {\n constructor(viewContainer, elementRef) {\n this.viewContainer = viewContainer;\n this.elementRef = elementRef;\n }\n}\nFooterRowOutlet.ɵfac = function FooterRowOutlet_Factory(t) { return new (t || FooterRowOutlet)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef)); };\nFooterRowOutlet.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: FooterRowOutlet, selectors: [[\"\", \"footerRowOutlet\", \"\"]] });\nFooterRowOutlet.ctorParameters = () => [\n { type: ViewContainerRef },\n { type: ElementRef }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(FooterRowOutlet, [{\n type: Directive,\n args: [{ selector: '[footerRowOutlet]' }]\n }], function () { return [{ type: ɵngcc0.ViewContainerRef }, { type: ɵngcc0.ElementRef }]; }, null); })();\n/**\n * Provides a handle for the table to grab the view\n * container's ng-container to insert the no data row.\n * @docs-private\n */\nclass NoDataRowOutlet {\n constructor(viewContainer, elementRef) {\n this.viewContainer = viewContainer;\n this.elementRef = elementRef;\n }\n}\nNoDataRowOutlet.ɵfac = function NoDataRowOutlet_Factory(t) { return new (t || NoDataRowOutlet)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef)); };\nNoDataRowOutlet.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: NoDataRowOutlet, selectors: [[\"\", \"noDataRowOutlet\", \"\"]] });\nNoDataRowOutlet.ctorParameters = () => [\n { type: ViewContainerRef },\n { type: ElementRef }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NoDataRowOutlet, [{\n type: Directive,\n args: [{ selector: '[noDataRowOutlet]' }]\n }], function () { return [{ type: ɵngcc0.ViewContainerRef }, { type: ɵngcc0.ElementRef }]; }, null); })();\n/**\n * The table template that can be used by the mat-table. Should not be used outside of the\n * material library.\n * @docs-private\n */\nconst CDK_TABLE_TEMPLATE = \n// Note that according to MDN, the `caption` element has to be projected as the **first**\n// element in the table. See https://developer.mozilla.org/en-US/docs/Web/HTML/Element/caption\n`\n \n \n \n \n \n \n`;\n/**\n * Class used to conveniently type the embedded view ref for rows with a context.\n * @docs-private\n */\nclass RowViewRef extends EmbeddedViewRef {\n}\n/**\n * A data table that can render a header row, data rows, and a footer row.\n * Uses the dataSource input to determine the data to be rendered. The data can be provided either\n * as a data array, an Observable stream that emits the data array to render, or a DataSource with a\n * connect function that will return an Observable stream that emits the data array to render.\n */\nclass CdkTable {\n constructor(_differs, _changeDetectorRef, _elementRef, role, _dir, _document, _platform, _viewRepeater, _coalescedStyleScheduler, _viewportRuler, \n /**\n * @deprecated `_stickyPositioningListener` parameter to become required.\n * @breaking-change 13.0.0\n */\n _stickyPositioningListener) {\n this._differs = _differs;\n this._changeDetectorRef = _changeDetectorRef;\n this._elementRef = _elementRef;\n this._dir = _dir;\n this._platform = _platform;\n this._viewRepeater = _viewRepeater;\n this._coalescedStyleScheduler = _coalescedStyleScheduler;\n this._viewportRuler = _viewportRuler;\n this._stickyPositioningListener = _stickyPositioningListener;\n /** Subject that emits when the component has been destroyed. */\n this._onDestroy = new Subject();\n /**\n * Map of all the user's defined columns (header, data, and footer cell template) identified by\n * name. Collection populated by the column definitions gathered by `ContentChildren` as well as\n * any custom column definitions added to `_customColumnDefs`.\n */\n this._columnDefsByName = new Map();\n /**\n * Column definitions that were defined outside of the direct content children of the table.\n * These will be defined when, e.g., creating a wrapper around the cdkTable that has\n * column definitions as *its* content child.\n */\n this._customColumnDefs = new Set();\n /**\n * Data row definitions that were defined outside of the direct content children of the table.\n * These will be defined when, e.g., creating a wrapper around the cdkTable that has\n * built-in data rows as *its* content child.\n */\n this._customRowDefs = new Set();\n /**\n * Header row definitions that were defined outside of the direct content children of the table.\n * These will be defined when, e.g., creating a wrapper around the cdkTable that has\n * built-in header rows as *its* content child.\n */\n this._customHeaderRowDefs = new Set();\n /**\n * Footer row definitions that were defined outside of the direct content children of the table.\n * These will be defined when, e.g., creating a wrapper around the cdkTable that has a\n * built-in footer row as *its* content child.\n */\n this._customFooterRowDefs = new Set();\n /**\n * Whether the header row definition has been changed. Triggers an update to the header row after\n * content is checked. Initialized as true so that the table renders the initial set of rows.\n */\n this._headerRowDefChanged = true;\n /**\n * Whether the footer row definition has been changed. Triggers an update to the footer row after\n * content is checked. Initialized as true so that the table renders the initial set of rows.\n */\n this._footerRowDefChanged = true;\n /**\n * Whether the sticky column styles need to be updated. Set to `true` when the visible columns\n * change.\n */\n this._stickyColumnStylesNeedReset = true;\n /**\n * Whether the sticky styler should recalculate cell widths when applying sticky styles. If\n * `false`, cached values will be used instead. This is only applicable to tables with\n * {@link fixedLayout} enabled. For other tables, cell widths will always be recalculated.\n */\n this._forceRecalculateCellWidths = true;\n /**\n * Cache of the latest rendered `RenderRow` objects as a map for easy retrieval when constructing\n * a new list of `RenderRow` objects for rendering rows. Since the new list is constructed with\n * the cached `RenderRow` objects when possible, the row identity is preserved when the data\n * and row template matches, which allows the `IterableDiffer` to check rows by reference\n * and understand which rows are added/moved/removed.\n *\n * Implemented as a map of maps where the first key is the `data: T` object and the second is the\n * `CdkRowDef` object. With the two keys, the cache points to a `RenderRow` object that\n * contains an array of created pairs. The array is necessary to handle cases where the data\n * array contains multiple duplicate data objects and each instantiated `RenderRow` must be\n * stored.\n */\n this._cachedRenderRowsMap = new Map();\n /**\n * CSS class added to any row or cell that has sticky positioning applied. May be overriden by\n * table subclasses.\n */\n this.stickyCssClass = 'cdk-table-sticky';\n /**\n * Whether to manually add positon: sticky to all sticky cell elements. Not needed if\n * the position is set in a selector associated with the value of stickyCssClass. May be\n * overridden by table subclasses\n */\n this.needsPositionStickyOnElement = true;\n /** Whether the no data row is currently showing anything. */\n this._isShowingNoDataRow = false;\n this._multiTemplateDataRows = false;\n this._fixedLayout = false;\n // TODO(andrewseguin): Remove max value as the end index\n // and instead calculate the view on init and scroll.\n /**\n * Stream containing the latest information on what rows are being displayed on screen.\n * Can be used by the data source to as a heuristic of what data should be provided.\n *\n * @docs-private\n */\n this.viewChange = new BehaviorSubject({ start: 0, end: Number.MAX_VALUE });\n if (!role) {\n this._elementRef.nativeElement.setAttribute('role', 'grid');\n }\n this._document = _document;\n this._isNativeHtmlTable = this._elementRef.nativeElement.nodeName === 'TABLE';\n }\n /**\n * Tracking function that will be used to check the differences in data changes. Used similarly\n * to `ngFor` `trackBy` function. Optimize row operations by identifying a row based on its data\n * relative to the function to know if a row should be added/removed/moved.\n * Accepts a function that takes two parameters, `index` and `item`.\n */\n get trackBy() {\n return this._trackByFn;\n }\n set trackBy(fn) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && fn != null && typeof fn !== 'function') {\n console.warn(`trackBy must be a function, but received ${JSON.stringify(fn)}.`);\n }\n this._trackByFn = fn;\n }\n /**\n * The table's source of data, which can be provided in three ways (in order of complexity):\n * - Simple data array (each object represents one table row)\n * - Stream that emits a data array each time the array changes\n * - `DataSource` object that implements the connect/disconnect interface.\n *\n * If a data array is provided, the table must be notified when the array's objects are\n * added, removed, or moved. This can be done by calling the `renderRows()` function which will\n * render the diff since the last table render. If the data array reference is changed, the table\n * will automatically trigger an update to the rows.\n *\n * When providing an Observable stream, the table will trigger an update automatically when the\n * stream emits a new array of data.\n *\n * Finally, when providing a `DataSource` object, the table will use the Observable stream\n * provided by the connect function and trigger updates when that stream emits new data array\n * values. During the table's ngOnDestroy or when the data source is removed from the table, the\n * table will call the DataSource's `disconnect` function (may be useful for cleaning up any\n * subscriptions registered during the connect process).\n */\n get dataSource() {\n return this._dataSource;\n }\n set dataSource(dataSource) {\n if (this._dataSource !== dataSource) {\n this._switchDataSource(dataSource);\n }\n }\n /**\n * Whether to allow multiple rows per data object by evaluating which rows evaluate their 'when'\n * predicate to true. If `multiTemplateDataRows` is false, which is the default value, then each\n * dataobject will render the first row that evaluates its when predicate to true, in the order\n * defined in the table, or otherwise the default row which does not have a when predicate.\n */\n get multiTemplateDataRows() {\n return this._multiTemplateDataRows;\n }\n set multiTemplateDataRows(v) {\n this._multiTemplateDataRows = coerceBooleanProperty(v);\n // In Ivy if this value is set via a static attribute (e.g.
),\n // this setter will be invoked before the row outlet has been defined hence the null check.\n if (this._rowOutlet && this._rowOutlet.viewContainer.length) {\n this._forceRenderDataRows();\n this.updateStickyColumnStyles();\n }\n }\n /**\n * Whether to use a fixed table layout. Enabling this option will enforce consistent column widths\n * and optimize rendering sticky styles for native tables. No-op for flex tables.\n */\n get fixedLayout() {\n return this._fixedLayout;\n }\n set fixedLayout(v) {\n this._fixedLayout = coerceBooleanProperty(v);\n // Toggling `fixedLayout` may change column widths. Sticky column styles should be recalculated.\n this._forceRecalculateCellWidths = true;\n this._stickyColumnStylesNeedReset = true;\n }\n ngOnInit() {\n this._setupStickyStyler();\n if (this._isNativeHtmlTable) {\n this._applyNativeTableSections();\n }\n // Set up the trackBy function so that it uses the `RenderRow` as its identity by default. If\n // the user has provided a custom trackBy, return the result of that function as evaluated\n // with the values of the `RenderRow`'s data and index.\n this._dataDiffer = this._differs.find([]).create((_i, dataRow) => {\n return this.trackBy ? this.trackBy(dataRow.dataIndex, dataRow.data) : dataRow;\n });\n this._viewportRuler.change().pipe(takeUntil(this._onDestroy)).subscribe(() => {\n this._forceRecalculateCellWidths = true;\n });\n }\n ngAfterContentChecked() {\n // Cache the row and column definitions gathered by ContentChildren and programmatic injection.\n this._cacheRowDefs();\n this._cacheColumnDefs();\n // Make sure that the user has at least added header, footer, or data row def.\n if (!this._headerRowDefs.length && !this._footerRowDefs.length && !this._rowDefs.length &&\n (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTableMissingRowDefsError();\n }\n // Render updates if the list of columns have been changed for the header, row, or footer defs.\n const columnsChanged = this._renderUpdatedColumns();\n const rowDefsChanged = columnsChanged || this._headerRowDefChanged || this._footerRowDefChanged;\n // Ensure sticky column styles are reset if set to `true` elsewhere.\n this._stickyColumnStylesNeedReset = this._stickyColumnStylesNeedReset || rowDefsChanged;\n this._forceRecalculateCellWidths = rowDefsChanged;\n // If the header row definition has been changed, trigger a render to the header row.\n if (this._headerRowDefChanged) {\n this._forceRenderHeaderRows();\n this._headerRowDefChanged = false;\n }\n // If the footer row definition has been changed, trigger a render to the footer row.\n if (this._footerRowDefChanged) {\n this._forceRenderFooterRows();\n this._footerRowDefChanged = false;\n }\n // If there is a data source and row definitions, connect to the data source unless a\n // connection has already been made.\n if (this.dataSource && this._rowDefs.length > 0 && !this._renderChangeSubscription) {\n this._observeRenderChanges();\n }\n else if (this._stickyColumnStylesNeedReset) {\n // In the above case, _observeRenderChanges will result in updateStickyColumnStyles being\n // called when it row data arrives. Otherwise, we need to call it proactively.\n this.updateStickyColumnStyles();\n }\n this._checkStickyStates();\n }\n ngOnDestroy() {\n this._rowOutlet.viewContainer.clear();\n this._noDataRowOutlet.viewContainer.clear();\n this._headerRowOutlet.viewContainer.clear();\n this._footerRowOutlet.viewContainer.clear();\n this._cachedRenderRowsMap.clear();\n this._onDestroy.next();\n this._onDestroy.complete();\n if (isDataSource(this.dataSource)) {\n this.dataSource.disconnect(this);\n }\n }\n /**\n * Renders rows based on the table's latest set of data, which was either provided directly as an\n * input or retrieved through an Observable stream (directly or from a DataSource).\n * Checks for differences in the data since the last diff to perform only the necessary\n * changes (add/remove/move rows).\n *\n * If the table's data source is a DataSource or Observable, this will be invoked automatically\n * each time the provided Observable stream emits a new data array. Otherwise if your data is\n * an array, this function will need to be called to render any changes.\n */\n renderRows() {\n this._renderRows = this._getAllRenderRows();\n const changes = this._dataDiffer.diff(this._renderRows);\n if (!changes) {\n this._updateNoDataRow();\n return;\n }\n const viewContainer = this._rowOutlet.viewContainer;\n this._viewRepeater.applyChanges(changes, viewContainer, (record, _adjustedPreviousIndex, currentIndex) => this._getEmbeddedViewArgs(record.item, currentIndex), (record) => record.item.data, (change) => {\n if (change.operation === 1 /* INSERTED */ && change.context) {\n this._renderCellTemplateForItem(change.record.item.rowDef, change.context);\n }\n });\n // Update the meta context of a row's context data (index, count, first, last, ...)\n this._updateRowIndexContext();\n // Update rows that did not get added/removed/moved but may have had their identity changed,\n // e.g. if trackBy matched data on some property but the actual data reference changed.\n changes.forEachIdentityChange((record) => {\n const rowView = viewContainer.get(record.currentIndex);\n rowView.context.$implicit = record.item.data;\n });\n this._updateNoDataRow();\n this.updateStickyColumnStyles();\n }\n /** Adds a column definition that was not included as part of the content children. */\n addColumnDef(columnDef) {\n this._customColumnDefs.add(columnDef);\n }\n /** Removes a column definition that was not included as part of the content children. */\n removeColumnDef(columnDef) {\n this._customColumnDefs.delete(columnDef);\n }\n /** Adds a row definition that was not included as part of the content children. */\n addRowDef(rowDef) {\n this._customRowDefs.add(rowDef);\n }\n /** Removes a row definition that was not included as part of the content children. */\n removeRowDef(rowDef) {\n this._customRowDefs.delete(rowDef);\n }\n /** Adds a header row definition that was not included as part of the content children. */\n addHeaderRowDef(headerRowDef) {\n this._customHeaderRowDefs.add(headerRowDef);\n this._headerRowDefChanged = true;\n }\n /** Removes a header row definition that was not included as part of the content children. */\n removeHeaderRowDef(headerRowDef) {\n this._customHeaderRowDefs.delete(headerRowDef);\n this._headerRowDefChanged = true;\n }\n /** Adds a footer row definition that was not included as part of the content children. */\n addFooterRowDef(footerRowDef) {\n this._customFooterRowDefs.add(footerRowDef);\n this._footerRowDefChanged = true;\n }\n /** Removes a footer row definition that was not included as part of the content children. */\n removeFooterRowDef(footerRowDef) {\n this._customFooterRowDefs.delete(footerRowDef);\n this._footerRowDefChanged = true;\n }\n /** Sets a no data row definition that was not included as a part of the content children. */\n setNoDataRow(noDataRow) {\n this._customNoDataRow = noDataRow;\n }\n /**\n * Updates the header sticky styles. First resets all applied styles with respect to the cells\n * sticking to the top. Then, evaluating which cells need to be stuck to the top. This is\n * automatically called when the header row changes its displayed set of columns, or if its\n * sticky input changes. May be called manually for cases where the cell content changes outside\n * of these events.\n */\n updateStickyHeaderRowStyles() {\n const headerRows = this._getRenderedRows(this._headerRowOutlet);\n const tableElement = this._elementRef.nativeElement;\n // Hide the thead element if there are no header rows. This is necessary to satisfy\n // overzealous a11y checkers that fail because the `rowgroup` element does not contain\n // required child `row`.\n const thead = tableElement.querySelector('thead');\n if (thead) {\n thead.style.display = headerRows.length ? '' : 'none';\n }\n const stickyStates = this._headerRowDefs.map(def => def.sticky);\n this._stickyStyler.clearStickyPositioning(headerRows, ['top']);\n this._stickyStyler.stickRows(headerRows, stickyStates, 'top');\n // Reset the dirty state of the sticky input change since it has been used.\n this._headerRowDefs.forEach(def => def.resetStickyChanged());\n }\n /**\n * Updates the footer sticky styles. First resets all applied styles with respect to the cells\n * sticking to the bottom. Then, evaluating which cells need to be stuck to the bottom. This is\n * automatically called when the footer row changes its displayed set of columns, or if its\n * sticky input changes. May be called manually for cases where the cell content changes outside\n * of these events.\n */\n updateStickyFooterRowStyles() {\n const footerRows = this._getRenderedRows(this._footerRowOutlet);\n const tableElement = this._elementRef.nativeElement;\n // Hide the tfoot element if there are no footer rows. This is necessary to satisfy\n // overzealous a11y checkers that fail because the `rowgroup` element does not contain\n // required child `row`.\n const tfoot = tableElement.querySelector('tfoot');\n if (tfoot) {\n tfoot.style.display = footerRows.length ? '' : 'none';\n }\n const stickyStates = this._footerRowDefs.map(def => def.sticky);\n this._stickyStyler.clearStickyPositioning(footerRows, ['bottom']);\n this._stickyStyler.stickRows(footerRows, stickyStates, 'bottom');\n this._stickyStyler.updateStickyFooterContainer(this._elementRef.nativeElement, stickyStates);\n // Reset the dirty state of the sticky input change since it has been used.\n this._footerRowDefs.forEach(def => def.resetStickyChanged());\n }\n /**\n * Updates the column sticky styles. First resets all applied styles with respect to the cells\n * sticking to the left and right. Then sticky styles are added for the left and right according\n * to the column definitions for each cell in each row. This is automatically called when\n * the data source provides a new set of data or when a column definition changes its sticky\n * input. May be called manually for cases where the cell content changes outside of these events.\n */\n updateStickyColumnStyles() {\n const headerRows = this._getRenderedRows(this._headerRowOutlet);\n const dataRows = this._getRenderedRows(this._rowOutlet);\n const footerRows = this._getRenderedRows(this._footerRowOutlet);\n // For tables not using a fixed layout, the column widths may change when new rows are rendered.\n // In a table using a fixed layout, row content won't affect column width, so sticky styles\n // don't need to be cleared unless either the sticky column config changes or one of the row\n // defs change.\n if ((this._isNativeHtmlTable && !this._fixedLayout)\n || this._stickyColumnStylesNeedReset) {\n // Clear the left and right positioning from all columns in the table across all rows since\n // sticky columns span across all table sections (header, data, footer)\n this._stickyStyler.clearStickyPositioning([...headerRows, ...dataRows, ...footerRows], ['left', 'right']);\n this._stickyColumnStylesNeedReset = false;\n }\n // Update the sticky styles for each header row depending on the def's sticky state\n headerRows.forEach((headerRow, i) => {\n this._addStickyColumnStyles([headerRow], this._headerRowDefs[i]);\n });\n // Update the sticky styles for each data row depending on its def's sticky state\n this._rowDefs.forEach(rowDef => {\n // Collect all the rows rendered with this row definition.\n const rows = [];\n for (let i = 0; i < dataRows.length; i++) {\n if (this._renderRows[i].rowDef === rowDef) {\n rows.push(dataRows[i]);\n }\n }\n this._addStickyColumnStyles(rows, rowDef);\n });\n // Update the sticky styles for each footer row depending on the def's sticky state\n footerRows.forEach((footerRow, i) => {\n this._addStickyColumnStyles([footerRow], this._footerRowDefs[i]);\n });\n // Reset the dirty state of the sticky input change since it has been used.\n Array.from(this._columnDefsByName.values()).forEach(def => def.resetStickyChanged());\n }\n /**\n * Get the list of RenderRow objects to render according to the current list of data and defined\n * row definitions. If the previous list already contained a particular pair, it should be reused\n * so that the differ equates their references.\n */\n _getAllRenderRows() {\n const renderRows = [];\n // Store the cache and create a new one. Any re-used RenderRow objects will be moved into the\n // new cache while unused ones can be picked up by garbage collection.\n const prevCachedRenderRows = this._cachedRenderRowsMap;\n this._cachedRenderRowsMap = new Map();\n // For each data object, get the list of rows that should be rendered, represented by the\n // respective `RenderRow` object which is the pair of `data` and `CdkRowDef`.\n for (let i = 0; i < this._data.length; i++) {\n let data = this._data[i];\n const renderRowsForData = this._getRenderRowsForData(data, i, prevCachedRenderRows.get(data));\n if (!this._cachedRenderRowsMap.has(data)) {\n this._cachedRenderRowsMap.set(data, new WeakMap());\n }\n for (let j = 0; j < renderRowsForData.length; j++) {\n let renderRow = renderRowsForData[j];\n const cache = this._cachedRenderRowsMap.get(renderRow.data);\n if (cache.has(renderRow.rowDef)) {\n cache.get(renderRow.rowDef).push(renderRow);\n }\n else {\n cache.set(renderRow.rowDef, [renderRow]);\n }\n renderRows.push(renderRow);\n }\n }\n return renderRows;\n }\n /**\n * Gets a list of `RenderRow` for the provided data object and any `CdkRowDef` objects that\n * should be rendered for this data. Reuses the cached RenderRow objects if they match the same\n * `(T, CdkRowDef)` pair.\n */\n _getRenderRowsForData(data, dataIndex, cache) {\n const rowDefs = this._getRowDefs(data, dataIndex);\n return rowDefs.map(rowDef => {\n const cachedRenderRows = (cache && cache.has(rowDef)) ? cache.get(rowDef) : [];\n if (cachedRenderRows.length) {\n const dataRow = cachedRenderRows.shift();\n dataRow.dataIndex = dataIndex;\n return dataRow;\n }\n else {\n return { data, rowDef, dataIndex };\n }\n });\n }\n /** Update the map containing the content's column definitions. */\n _cacheColumnDefs() {\n this._columnDefsByName.clear();\n const columnDefs = mergeArrayAndSet(this._getOwnDefs(this._contentColumnDefs), this._customColumnDefs);\n columnDefs.forEach(columnDef => {\n if (this._columnDefsByName.has(columnDef.name) &&\n (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTableDuplicateColumnNameError(columnDef.name);\n }\n this._columnDefsByName.set(columnDef.name, columnDef);\n });\n }\n /** Update the list of all available row definitions that can be used. */\n _cacheRowDefs() {\n this._headerRowDefs = mergeArrayAndSet(this._getOwnDefs(this._contentHeaderRowDefs), this._customHeaderRowDefs);\n this._footerRowDefs = mergeArrayAndSet(this._getOwnDefs(this._contentFooterRowDefs), this._customFooterRowDefs);\n this._rowDefs = mergeArrayAndSet(this._getOwnDefs(this._contentRowDefs), this._customRowDefs);\n // After all row definitions are determined, find the row definition to be considered default.\n const defaultRowDefs = this._rowDefs.filter(def => !def.when);\n if (!this.multiTemplateDataRows && defaultRowDefs.length > 1 &&\n (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTableMultipleDefaultRowDefsError();\n }\n this._defaultRowDef = defaultRowDefs[0];\n }\n /**\n * Check if the header, data, or footer rows have changed what columns they want to display or\n * whether the sticky states have changed for the header or footer. If there is a diff, then\n * re-render that section.\n */\n _renderUpdatedColumns() {\n const columnsDiffReducer = (acc, def) => acc || !!def.getColumnsDiff();\n // Force re-render data rows if the list of column definitions have changed.\n const dataColumnsChanged = this._rowDefs.reduce(columnsDiffReducer, false);\n if (dataColumnsChanged) {\n this._forceRenderDataRows();\n }\n // Force re-render header/footer rows if the list of column definitions have changed.\n const headerColumnsChanged = this._headerRowDefs.reduce(columnsDiffReducer, false);\n if (headerColumnsChanged) {\n this._forceRenderHeaderRows();\n }\n const footerColumnsChanged = this._footerRowDefs.reduce(columnsDiffReducer, false);\n if (footerColumnsChanged) {\n this._forceRenderFooterRows();\n }\n return dataColumnsChanged || headerColumnsChanged || footerColumnsChanged;\n }\n /**\n * Switch to the provided data source by resetting the data and unsubscribing from the current\n * render change subscription if one exists. If the data source is null, interpret this by\n * clearing the row outlet. Otherwise start listening for new data.\n */\n _switchDataSource(dataSource) {\n this._data = [];\n if (isDataSource(this.dataSource)) {\n this.dataSource.disconnect(this);\n }\n // Stop listening for data from the previous data source.\n if (this._renderChangeSubscription) {\n this._renderChangeSubscription.unsubscribe();\n this._renderChangeSubscription = null;\n }\n if (!dataSource) {\n if (this._dataDiffer) {\n this._dataDiffer.diff([]);\n }\n this._rowOutlet.viewContainer.clear();\n }\n this._dataSource = dataSource;\n }\n /** Set up a subscription for the data provided by the data source. */\n _observeRenderChanges() {\n // If no data source has been set, there is nothing to observe for changes.\n if (!this.dataSource) {\n return;\n }\n let dataStream;\n if (isDataSource(this.dataSource)) {\n dataStream = this.dataSource.connect(this);\n }\n else if (isObservable(this.dataSource)) {\n dataStream = this.dataSource;\n }\n else if (Array.isArray(this.dataSource)) {\n dataStream = of(this.dataSource);\n }\n if (dataStream === undefined && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTableUnknownDataSourceError();\n }\n this._renderChangeSubscription = dataStream.pipe(takeUntil(this._onDestroy))\n .subscribe(data => {\n this._data = data || [];\n this.renderRows();\n });\n }\n /**\n * Clears any existing content in the header row outlet and creates a new embedded view\n * in the outlet using the header row definition.\n */\n _forceRenderHeaderRows() {\n // Clear the header row outlet if any content exists.\n if (this._headerRowOutlet.viewContainer.length > 0) {\n this._headerRowOutlet.viewContainer.clear();\n }\n this._headerRowDefs.forEach((def, i) => this._renderRow(this._headerRowOutlet, def, i));\n this.updateStickyHeaderRowStyles();\n }\n /**\n * Clears any existing content in the footer row outlet and creates a new embedded view\n * in the outlet using the footer row definition.\n */\n _forceRenderFooterRows() {\n // Clear the footer row outlet if any content exists.\n if (this._footerRowOutlet.viewContainer.length > 0) {\n this._footerRowOutlet.viewContainer.clear();\n }\n this._footerRowDefs.forEach((def, i) => this._renderRow(this._footerRowOutlet, def, i));\n this.updateStickyFooterRowStyles();\n }\n /** Adds the sticky column styles for the rows according to the columns' stick states. */\n _addStickyColumnStyles(rows, rowDef) {\n const columnDefs = Array.from(rowDef.columns || []).map(columnName => {\n const columnDef = this._columnDefsByName.get(columnName);\n if (!columnDef && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTableUnknownColumnError(columnName);\n }\n return columnDef;\n });\n const stickyStartStates = columnDefs.map(columnDef => columnDef.sticky);\n const stickyEndStates = columnDefs.map(columnDef => columnDef.stickyEnd);\n this._stickyStyler.updateStickyColumns(rows, stickyStartStates, stickyEndStates, !this._fixedLayout || this._forceRecalculateCellWidths);\n }\n /** Gets the list of rows that have been rendered in the row outlet. */\n _getRenderedRows(rowOutlet) {\n const renderedRows = [];\n for (let i = 0; i < rowOutlet.viewContainer.length; i++) {\n const viewRef = rowOutlet.viewContainer.get(i);\n renderedRows.push(viewRef.rootNodes[0]);\n }\n return renderedRows;\n }\n /**\n * Get the matching row definitions that should be used for this row data. If there is only\n * one row definition, it is returned. Otherwise, find the row definitions that has a when\n * predicate that returns true with the data. If none return true, return the default row\n * definition.\n */\n _getRowDefs(data, dataIndex) {\n if (this._rowDefs.length == 1) {\n return [this._rowDefs[0]];\n }\n let rowDefs = [];\n if (this.multiTemplateDataRows) {\n rowDefs = this._rowDefs.filter(def => !def.when || def.when(dataIndex, data));\n }\n else {\n let rowDef = this._rowDefs.find(def => def.when && def.when(dataIndex, data)) || this._defaultRowDef;\n if (rowDef) {\n rowDefs.push(rowDef);\n }\n }\n if (!rowDefs.length && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTableMissingMatchingRowDefError(data);\n }\n return rowDefs;\n }\n _getEmbeddedViewArgs(renderRow, index) {\n const rowDef = renderRow.rowDef;\n const context = { $implicit: renderRow.data };\n return {\n templateRef: rowDef.template,\n context,\n index,\n };\n }\n /**\n * Creates a new row template in the outlet and fills it with the set of cell templates.\n * Optionally takes a context to provide to the row and cells, as well as an optional index\n * of where to place the new row template in the outlet.\n */\n _renderRow(outlet, rowDef, index, context = {}) {\n // TODO(andrewseguin): enforce that one outlet was instantiated from createEmbeddedView\n const view = outlet.viewContainer.createEmbeddedView(rowDef.template, context, index);\n this._renderCellTemplateForItem(rowDef, context);\n return view;\n }\n _renderCellTemplateForItem(rowDef, context) {\n for (let cellTemplate of this._getCellTemplates(rowDef)) {\n if (CdkCellOutlet.mostRecentCellOutlet) {\n CdkCellOutlet.mostRecentCellOutlet._viewContainer.createEmbeddedView(cellTemplate, context);\n }\n }\n this._changeDetectorRef.markForCheck();\n }\n /**\n * Updates the index-related context for each row to reflect any changes in the index of the rows,\n * e.g. first/last/even/odd.\n */\n _updateRowIndexContext() {\n const viewContainer = this._rowOutlet.viewContainer;\n for (let renderIndex = 0, count = viewContainer.length; renderIndex < count; renderIndex++) {\n const viewRef = viewContainer.get(renderIndex);\n const context = viewRef.context;\n context.count = count;\n context.first = renderIndex === 0;\n context.last = renderIndex === count - 1;\n context.even = renderIndex % 2 === 0;\n context.odd = !context.even;\n if (this.multiTemplateDataRows) {\n context.dataIndex = this._renderRows[renderIndex].dataIndex;\n context.renderIndex = renderIndex;\n }\n else {\n context.index = this._renderRows[renderIndex].dataIndex;\n }\n }\n }\n /** Gets the column definitions for the provided row def. */\n _getCellTemplates(rowDef) {\n if (!rowDef || !rowDef.columns) {\n return [];\n }\n return Array.from(rowDef.columns, columnId => {\n const column = this._columnDefsByName.get(columnId);\n if (!column && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTableUnknownColumnError(columnId);\n }\n return rowDef.extractCellTemplate(column);\n });\n }\n /** Adds native table sections (e.g. tbody) and moves the row outlets into them. */\n _applyNativeTableSections() {\n const documentFragment = this._document.createDocumentFragment();\n const sections = [\n { tag: 'thead', outlets: [this._headerRowOutlet] },\n { tag: 'tbody', outlets: [this._rowOutlet, this._noDataRowOutlet] },\n { tag: 'tfoot', outlets: [this._footerRowOutlet] },\n ];\n for (const section of sections) {\n const element = this._document.createElement(section.tag);\n element.setAttribute('role', 'rowgroup');\n for (const outlet of section.outlets) {\n element.appendChild(outlet.elementRef.nativeElement);\n }\n documentFragment.appendChild(element);\n }\n // Use a DocumentFragment so we don't hit the DOM on each iteration.\n this._elementRef.nativeElement.appendChild(documentFragment);\n }\n /**\n * Forces a re-render of the data rows. Should be called in cases where there has been an input\n * change that affects the evaluation of which rows should be rendered, e.g. toggling\n * `multiTemplateDataRows` or adding/removing row definitions.\n */\n _forceRenderDataRows() {\n this._dataDiffer.diff([]);\n this._rowOutlet.viewContainer.clear();\n this.renderRows();\n }\n /**\n * Checks if there has been a change in sticky states since last check and applies the correct\n * sticky styles. Since checking resets the \"dirty\" state, this should only be performed once\n * during a change detection and after the inputs are settled (after content check).\n */\n _checkStickyStates() {\n const stickyCheckReducer = (acc, d) => {\n return acc || d.hasStickyChanged();\n };\n // Note that the check needs to occur for every definition since it notifies the definition\n // that it can reset its dirty state. Using another operator like `some` may short-circuit\n // remaining definitions and leave them in an unchecked state.\n if (this._headerRowDefs.reduce(stickyCheckReducer, false)) {\n this.updateStickyHeaderRowStyles();\n }\n if (this._footerRowDefs.reduce(stickyCheckReducer, false)) {\n this.updateStickyFooterRowStyles();\n }\n if (Array.from(this._columnDefsByName.values()).reduce(stickyCheckReducer, false)) {\n this._stickyColumnStylesNeedReset = true;\n this.updateStickyColumnStyles();\n }\n }\n /**\n * Creates the sticky styler that will be used for sticky rows and columns. Listens\n * for directionality changes and provides the latest direction to the styler. Re-applies column\n * stickiness when directionality changes.\n */\n _setupStickyStyler() {\n const direction = this._dir ? this._dir.value : 'ltr';\n this._stickyStyler = new StickyStyler(this._isNativeHtmlTable, this.stickyCssClass, direction, this._coalescedStyleScheduler, this._platform.isBrowser, this.needsPositionStickyOnElement, this._stickyPositioningListener);\n (this._dir ? this._dir.change : of())\n .pipe(takeUntil(this._onDestroy))\n .subscribe(value => {\n this._stickyStyler.direction = value;\n this.updateStickyColumnStyles();\n });\n }\n /** Filters definitions that belong to this table from a QueryList. */\n _getOwnDefs(items) {\n return items.filter(item => !item._table || item._table === this);\n }\n /** Creates or removes the no data row, depending on whether any data is being shown. */\n _updateNoDataRow() {\n const noDataRow = this._customNoDataRow || this._noDataRow;\n if (noDataRow) {\n const shouldShow = this._rowOutlet.viewContainer.length === 0;\n if (shouldShow !== this._isShowingNoDataRow) {\n const container = this._noDataRowOutlet.viewContainer;\n shouldShow ? container.createEmbeddedView(noDataRow.templateRef) : container.clear();\n this._isShowingNoDataRow = shouldShow;\n }\n }\n }\n}\nCdkTable.ɵfac = function CdkTable_Factory(t) { return new (t || CdkTable)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.IterableDiffers), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ChangeDetectorRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵinjectAttribute('role'), ɵngcc0.ɵɵdirectiveInject(ɵngcc1.Directionality, 8), ɵngcc0.ɵɵdirectiveInject(DOCUMENT), ɵngcc0.ɵɵdirectiveInject(ɵngcc2.Platform), ɵngcc0.ɵɵdirectiveInject(_VIEW_REPEATER_STRATEGY), ɵngcc0.ɵɵdirectiveInject(_COALESCED_STYLE_SCHEDULER), ɵngcc0.ɵɵdirectiveInject(ɵngcc3.ViewportRuler), ɵngcc0.ɵɵdirectiveInject(STICKY_POSITIONING_LISTENER, 12)); };\nCdkTable.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: CdkTable, selectors: [[\"cdk-table\"], [\"table\", \"cdk-table\", \"\"]], contentQueries: function CdkTable_ContentQueries(rf, ctx, dirIndex) { if (rf & 1) {\n ɵngcc0.ɵɵcontentQuery(dirIndex, CdkNoDataRow, 5);\n ɵngcc0.ɵɵcontentQuery(dirIndex, CdkColumnDef, 5);\n ɵngcc0.ɵɵcontentQuery(dirIndex, CdkRowDef, 5);\n ɵngcc0.ɵɵcontentQuery(dirIndex, CdkHeaderRowDef, 5);\n ɵngcc0.ɵɵcontentQuery(dirIndex, CdkFooterRowDef, 5);\n } if (rf & 2) {\n let _t;\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._noDataRow = _t.first);\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._contentColumnDefs = _t);\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._contentRowDefs = _t);\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._contentHeaderRowDefs = _t);\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._contentFooterRowDefs = _t);\n } }, viewQuery: function CdkTable_Query(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵviewQuery(DataRowOutlet, 7);\n ɵngcc0.ɵɵviewQuery(HeaderRowOutlet, 7);\n ɵngcc0.ɵɵviewQuery(FooterRowOutlet, 7);\n ɵngcc0.ɵɵviewQuery(NoDataRowOutlet, 7);\n } if (rf & 2) {\n let _t;\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._rowOutlet = _t.first);\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._headerRowOutlet = _t.first);\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._footerRowOutlet = _t.first);\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._noDataRowOutlet = _t.first);\n } }, hostAttrs: [1, \"cdk-table\"], hostVars: 2, hostBindings: function CdkTable_HostBindings(rf, ctx) { if (rf & 2) {\n ɵngcc0.ɵɵclassProp(\"cdk-table-fixed-layout\", ctx.fixedLayout);\n } }, inputs: { trackBy: \"trackBy\", dataSource: \"dataSource\", multiTemplateDataRows: \"multiTemplateDataRows\", fixedLayout: \"fixedLayout\" }, exportAs: [\"cdkTable\"], features: [ɵngcc0.ɵɵProvidersFeature([\n { provide: CDK_TABLE, useExisting: CdkTable },\n { provide: _VIEW_REPEATER_STRATEGY, useClass: _DisposeViewRepeaterStrategy },\n { provide: _COALESCED_STYLE_SCHEDULER, useClass: _CoalescedStyleScheduler },\n // Prevent nested tables from seeing this table's StickyPositioningListener.\n { provide: STICKY_POSITIONING_LISTENER, useValue: null },\n ])], ngContentSelectors: _c1, decls: 6, vars: 0, consts: [[\"headerRowOutlet\", \"\"], [\"rowOutlet\", \"\"], [\"noDataRowOutlet\", \"\"], [\"footerRowOutlet\", \"\"]], template: function CdkTable_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵprojectionDef(_c0);\n ɵngcc0.ɵɵprojection(0);\n ɵngcc0.ɵɵprojection(1, 1);\n ɵngcc0.ɵɵelementContainer(2, 0);\n ɵngcc0.ɵɵelementContainer(3, 1);\n ɵngcc0.ɵɵelementContainer(4, 2);\n ɵngcc0.ɵɵelementContainer(5, 3);\n } }, directives: [HeaderRowOutlet, DataRowOutlet, NoDataRowOutlet, FooterRowOutlet], styles: [\".cdk-table-fixed-layout{table-layout:fixed}\\n\"], encapsulation: 2 });\nCdkTable.ctorParameters = () => [\n { type: IterableDiffers },\n { type: ChangeDetectorRef },\n { type: ElementRef },\n { type: String, decorators: [{ type: Attribute, args: ['role',] }] },\n { type: Directionality, decorators: [{ type: Optional }] },\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] },\n { type: Platform },\n { type: undefined, decorators: [{ type: Inject, args: [_VIEW_REPEATER_STRATEGY,] }] },\n { type: _CoalescedStyleScheduler, decorators: [{ type: Inject, args: [_COALESCED_STYLE_SCHEDULER,] }] },\n { type: ViewportRuler },\n { type: undefined, decorators: [{ type: Optional }, { type: SkipSelf }, { type: Inject, args: [STICKY_POSITIONING_LISTENER,] }] }\n];\nCdkTable.propDecorators = {\n trackBy: [{ type: Input }],\n dataSource: [{ type: Input }],\n multiTemplateDataRows: [{ type: Input }],\n fixedLayout: [{ type: Input }],\n _rowOutlet: [{ type: ViewChild, args: [DataRowOutlet, { static: true },] }],\n _headerRowOutlet: [{ type: ViewChild, args: [HeaderRowOutlet, { static: true },] }],\n _footerRowOutlet: [{ type: ViewChild, args: [FooterRowOutlet, { static: true },] }],\n _noDataRowOutlet: [{ type: ViewChild, args: [NoDataRowOutlet, { static: true },] }],\n _contentColumnDefs: [{ type: ContentChildren, args: [CdkColumnDef, { descendants: true },] }],\n _contentRowDefs: [{ type: ContentChildren, args: [CdkRowDef, { descendants: true },] }],\n _contentHeaderRowDefs: [{ type: ContentChildren, args: [CdkHeaderRowDef, {\n descendants: true\n },] }],\n _contentFooterRowDefs: [{ type: ContentChildren, args: [CdkFooterRowDef, {\n descendants: true\n },] }],\n _noDataRow: [{ type: ContentChild, args: [CdkNoDataRow,] }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkTable, [{\n type: Component,\n args: [{\n selector: 'cdk-table, table[cdk-table]',\n exportAs: 'cdkTable',\n template: CDK_TABLE_TEMPLATE,\n host: {\n 'class': 'cdk-table',\n '[class.cdk-table-fixed-layout]': 'fixedLayout'\n },\n encapsulation: ViewEncapsulation.None,\n // The \"OnPush\" status for the `MatTable` component is effectively a noop, so we are removing it.\n // The view for `MatTable` consists entirely of templates declared in other views. As they are\n // declared elsewhere, they are checked when their declaration points are checked.\n // tslint:disable-next-line:validate-decorators\n changeDetection: ChangeDetectionStrategy.Default,\n providers: [\n { provide: CDK_TABLE, useExisting: CdkTable },\n { provide: _VIEW_REPEATER_STRATEGY, useClass: _DisposeViewRepeaterStrategy },\n { provide: _COALESCED_STYLE_SCHEDULER, useClass: _CoalescedStyleScheduler },\n // Prevent nested tables from seeing this table's StickyPositioningListener.\n { provide: STICKY_POSITIONING_LISTENER, useValue: null },\n ],\n styles: [\".cdk-table-fixed-layout{table-layout:fixed}\\n\"]\n }]\n }], function () { return [{ type: ɵngcc0.IterableDiffers }, { type: ɵngcc0.ChangeDetectorRef }, { type: ɵngcc0.ElementRef }, { type: String, decorators: [{\n type: Attribute,\n args: ['role']\n }] }, { type: ɵngcc1.Directionality, decorators: [{\n type: Optional\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: ɵngcc2.Platform }, { type: undefined, decorators: [{\n type: Inject,\n args: [_VIEW_REPEATER_STRATEGY]\n }] }, { type: _CoalescedStyleScheduler, decorators: [{\n type: Inject,\n args: [_COALESCED_STYLE_SCHEDULER]\n }] }, { type: ɵngcc3.ViewportRuler }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: SkipSelf\n }, {\n type: Inject,\n args: [STICKY_POSITIONING_LISTENER]\n }] }]; }, { trackBy: [{\n type: Input\n }], dataSource: [{\n type: Input\n }], multiTemplateDataRows: [{\n type: Input\n }], fixedLayout: [{\n type: Input\n }], _rowOutlet: [{\n type: ViewChild,\n args: [DataRowOutlet, { static: true }]\n }], _headerRowOutlet: [{\n type: ViewChild,\n args: [HeaderRowOutlet, { static: true }]\n }], _footerRowOutlet: [{\n type: ViewChild,\n args: [FooterRowOutlet, { static: true }]\n }], _noDataRowOutlet: [{\n type: ViewChild,\n args: [NoDataRowOutlet, { static: true }]\n }], _contentColumnDefs: [{\n type: ContentChildren,\n args: [CdkColumnDef, { descendants: true }]\n }], _contentRowDefs: [{\n type: ContentChildren,\n args: [CdkRowDef, { descendants: true }]\n }], _contentHeaderRowDefs: [{\n type: ContentChildren,\n args: [CdkHeaderRowDef, {\n descendants: true\n }]\n }], _contentFooterRowDefs: [{\n type: ContentChildren,\n args: [CdkFooterRowDef, {\n descendants: true\n }]\n }], _noDataRow: [{\n type: ContentChild,\n args: [CdkNoDataRow]\n }] }); })();\n/** Utility function that gets a merged list of the entries in an array and values of a Set. */\nfunction mergeArrayAndSet(array, set) {\n return array.concat(Array.from(set));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Column that simply shows text content for the header and row cells. Assumes that the table\n * is using the native table implementation (`
`).\n *\n * By default, the name of this column will be the header text and data property accessor.\n * The header text can be overridden with the `headerText` input. Cell values can be overridden with\n * the `dataAccessor` input. Change the text justification to the start or end using the `justify`\n * input.\n */\nclass CdkTextColumn {\n constructor(\n // `CdkTextColumn` is always requiring a table, but we just assert it manually\n // for better error reporting.\n // tslint:disable-next-line: lightweight-tokens\n _table, _options) {\n this._table = _table;\n this._options = _options;\n /** Alignment of the cell values. */\n this.justify = 'start';\n this._options = _options || {};\n }\n /** Column name that should be used to reference this column. */\n get name() {\n return this._name;\n }\n set name(name) {\n this._name = name;\n // With Ivy, inputs can be initialized before static query results are\n // available. In that case, we defer the synchronization until \"ngOnInit\" fires.\n this._syncColumnDefName();\n }\n ngOnInit() {\n this._syncColumnDefName();\n if (this.headerText === undefined) {\n this.headerText = this._createDefaultHeaderText();\n }\n if (!this.dataAccessor) {\n this.dataAccessor =\n this._options.defaultDataAccessor || ((data, name) => data[name]);\n }\n if (this._table) {\n // Provide the cell and headerCell directly to the table with the static `ViewChild` query,\n // since the columnDef will not pick up its content by the time the table finishes checking\n // its content and initializing the rows.\n this.columnDef.cell = this.cell;\n this.columnDef.headerCell = this.headerCell;\n this._table.addColumnDef(this.columnDef);\n }\n else if (typeof ngDevMode === 'undefined' || ngDevMode) {\n throw getTableTextColumnMissingParentTableError();\n }\n }\n ngOnDestroy() {\n if (this._table) {\n this._table.removeColumnDef(this.columnDef);\n }\n }\n /**\n * Creates a default header text. Use the options' header text transformation function if one\n * has been provided. Otherwise simply capitalize the column name.\n */\n _createDefaultHeaderText() {\n const name = this.name;\n if (!name && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTableTextColumnMissingNameError();\n }\n if (this._options && this._options.defaultHeaderTextTransform) {\n return this._options.defaultHeaderTextTransform(name);\n }\n return name[0].toUpperCase() + name.slice(1);\n }\n /** Synchronizes the column definition name with the text column name. */\n _syncColumnDefName() {\n if (this.columnDef) {\n this.columnDef.name = this.name;\n }\n }\n}\nCdkTextColumn.ɵfac = function CdkTextColumn_Factory(t) { return new (t || CdkTextColumn)(ɵngcc0.ɵɵdirectiveInject(CdkTable, 8), ɵngcc0.ɵɵdirectiveInject(TEXT_COLUMN_OPTIONS, 8)); };\nCdkTextColumn.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: CdkTextColumn, selectors: [[\"cdk-text-column\"]], viewQuery: function CdkTextColumn_Query(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵviewQuery(CdkColumnDef, 7);\n ɵngcc0.ɵɵviewQuery(CdkCellDef, 7);\n ɵngcc0.ɵɵviewQuery(CdkHeaderCellDef, 7);\n } if (rf & 2) {\n let _t;\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx.columnDef = _t.first);\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx.cell = _t.first);\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx.headerCell = _t.first);\n } }, inputs: { justify: \"justify\", name: \"name\", headerText: \"headerText\", dataAccessor: \"dataAccessor\" }, decls: 3, vars: 0, consts: [[\"cdkColumnDef\", \"\"], [\"cdk-header-cell\", \"\", 3, \"text-align\", 4, \"cdkHeaderCellDef\"], [\"cdk-cell\", \"\", 3, \"text-align\", 4, \"cdkCellDef\"], [\"cdk-header-cell\", \"\"], [\"cdk-cell\", \"\"]], template: function CdkTextColumn_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementContainerStart(0, 0);\n ɵngcc0.ɵɵtemplate(1, CdkTextColumn_th_1_Template, 2, 3, \"th\", 1);\n ɵngcc0.ɵɵtemplate(2, CdkTextColumn_td_2_Template, 2, 3, \"td\", 2);\n ɵngcc0.ɵɵelementContainerEnd();\n } }, directives: [CdkColumnDef, CdkHeaderCellDef, CdkCellDef, CdkHeaderCell, CdkCell], encapsulation: 2 });\nCdkTextColumn.ctorParameters = () => [\n { type: CdkTable, decorators: [{ type: Optional }] },\n { type: undefined, decorators: [{ type: Optional }, { type: Inject, args: [TEXT_COLUMN_OPTIONS,] }] }\n];\nCdkTextColumn.propDecorators = {\n name: [{ type: Input }],\n headerText: [{ type: Input }],\n dataAccessor: [{ type: Input }],\n justify: [{ type: Input }],\n columnDef: [{ type: ViewChild, args: [CdkColumnDef, { static: true },] }],\n cell: [{ type: ViewChild, args: [CdkCellDef, { static: true },] }],\n headerCell: [{ type: ViewChild, args: [CdkHeaderCellDef, { static: true },] }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkTextColumn, [{\n type: Component,\n args: [{\n selector: 'cdk-text-column',\n template: `\n \n
\n {{headerText}}\n
\n
\n {{dataAccessor(data, name)}}\n
\n \n `,\n encapsulation: ViewEncapsulation.None,\n // Change detection is intentionally not set to OnPush. This component's template will be provided\n // to the table to be inserted into its view. This is problematic when change detection runs since\n // the bindings in this template will be evaluated _after_ the table's view is evaluated, which\n // mean's the template in the table's view will not have the updated value (and in fact will cause\n // an ExpressionChangedAfterItHasBeenCheckedError).\n // tslint:disable-next-line:validate-decorators\n changeDetection: ChangeDetectionStrategy.Default\n }]\n }], function () { return [{ type: CdkTable, decorators: [{\n type: Optional\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [TEXT_COLUMN_OPTIONS]\n }] }]; }, { justify: [{\n type: Input\n }], name: [{\n type: Input\n }], headerText: [{\n type: Input\n }], dataAccessor: [{\n type: Input\n }], columnDef: [{\n type: ViewChild,\n args: [CdkColumnDef, { static: true }]\n }], cell: [{\n type: ViewChild,\n args: [CdkCellDef, { static: true }]\n }], headerCell: [{\n type: ViewChild,\n args: [CdkHeaderCellDef, { static: true }]\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst EXPORTED_DECLARATIONS = [\n CdkTable,\n CdkRowDef,\n CdkCellDef,\n CdkCellOutlet,\n CdkHeaderCellDef,\n CdkFooterCellDef,\n CdkColumnDef,\n CdkCell,\n CdkRow,\n CdkHeaderCell,\n CdkFooterCell,\n CdkHeaderRow,\n CdkHeaderRowDef,\n CdkFooterRow,\n CdkFooterRowDef,\n DataRowOutlet,\n HeaderRowOutlet,\n FooterRowOutlet,\n CdkTextColumn,\n CdkNoDataRow,\n CdkRecycleRows,\n NoDataRowOutlet,\n];\nclass CdkTableModule {\n}\nCdkTableModule.ɵfac = function CdkTableModule_Factory(t) { return new (t || CdkTableModule)(); };\nCdkTableModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: CdkTableModule });\nCdkTableModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({ imports: [[ScrollingModule]] });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkTableModule, [{\n type: NgModule,\n args: [{\n exports: EXPORTED_DECLARATIONS,\n declarations: EXPORTED_DECLARATIONS,\n imports: [ScrollingModule]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(CdkTableModule, { declarations: function () { return [CdkTable, CdkRowDef, CdkCellDef, CdkCellOutlet, CdkHeaderCellDef, CdkFooterCellDef, CdkColumnDef, CdkCell, CdkRow, CdkHeaderCell, CdkFooterCell, CdkHeaderRow, CdkHeaderRowDef, CdkFooterRow, CdkFooterRowDef, DataRowOutlet, HeaderRowOutlet, FooterRowOutlet, CdkTextColumn, CdkNoDataRow, CdkRecycleRows, NoDataRowOutlet]; }, imports: function () { return [ScrollingModule]; }, exports: function () { return [CdkTable, CdkRowDef, CdkCellDef, CdkCellOutlet, CdkHeaderCellDef, CdkFooterCellDef, CdkColumnDef, CdkCell, CdkRow, CdkHeaderCell, CdkFooterCell, CdkHeaderRow, CdkHeaderRowDef, CdkFooterRow, CdkFooterRowDef, DataRowOutlet, HeaderRowOutlet, FooterRowOutlet, CdkTextColumn, CdkNoDataRow, CdkRecycleRows, NoDataRowOutlet]; } }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BaseCdkCell, BaseRowDef, CDK_ROW_TEMPLATE, CDK_TABLE, CDK_TABLE_TEMPLATE, CdkCell, CdkCellDef, CdkCellOutlet, CdkColumnDef, CdkFooterCell, CdkFooterCellDef, CdkFooterRow, CdkFooterRowDef, CdkHeaderCell, CdkHeaderCellDef, CdkHeaderRow, CdkHeaderRowDef, CdkNoDataRow, CdkRecycleRows, CdkRow, CdkRowDef, CdkTable, CdkTableModule, CdkTextColumn, DataRowOutlet, FooterRowOutlet, HeaderRowOutlet, NoDataRowOutlet, STICKY_DIRECTIONS, STICKY_POSITIONING_LISTENER, StickyStyler, TEXT_COLUMN_OPTIONS, _COALESCED_STYLE_SCHEDULER, _CoalescedStyleScheduler, _Schedule, mixinHasStickyInput };\n\n//# sourceMappingURL=table.js.map","import * as i1 from '@angular/cdk/platform';\nimport { normalizePassiveListenerOptions, Platform, PlatformModule } from '@angular/cdk/platform';\nimport * as i0 from '@angular/core';\nimport { Injectable, NgZone, EventEmitter, Directive, ElementRef, Output, Optional, Inject, Input, HostListener, NgModule } from '@angular/core';\nimport { coerceElement, coerceNumberProperty, coerceBooleanProperty } from '@angular/cdk/coercion';\nimport { EMPTY, Subject, fromEvent } from 'rxjs';\nimport { auditTime, takeUntil } from 'rxjs/operators';\nimport { DOCUMENT } from '@angular/common';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Options to pass to the animationstart listener. */\nimport * as ɵngcc0 from '@angular/core';\nimport * as ɵngcc1 from '@angular/cdk/platform';\nconst listenerOptions = normalizePassiveListenerOptions({ passive: true });\n/**\n * An injectable service that can be used to monitor the autofill state of an input.\n * Based on the following blog post:\n * https://medium.com/@brunn/detecting-autofilled-fields-in-javascript-aed598d25da7\n */\nclass AutofillMonitor {\n constructor(_platform, _ngZone) {\n this._platform = _platform;\n this._ngZone = _ngZone;\n this._monitoredElements = new Map();\n }\n monitor(elementOrRef) {\n if (!this._platform.isBrowser) {\n return EMPTY;\n }\n const element = coerceElement(elementOrRef);\n const info = this._monitoredElements.get(element);\n if (info) {\n return info.subject;\n }\n const result = new Subject();\n const cssClass = 'cdk-text-field-autofilled';\n const listener = ((event) => {\n // Animation events fire on initial element render, we check for the presence of the autofill\n // CSS class to make sure this is a real change in state, not just the initial render before\n // we fire off events.\n if (event.animationName === 'cdk-text-field-autofill-start' &&\n !element.classList.contains(cssClass)) {\n element.classList.add(cssClass);\n this._ngZone.run(() => result.next({ target: event.target, isAutofilled: true }));\n }\n else if (event.animationName === 'cdk-text-field-autofill-end' &&\n element.classList.contains(cssClass)) {\n element.classList.remove(cssClass);\n this._ngZone.run(() => result.next({ target: event.target, isAutofilled: false }));\n }\n });\n this._ngZone.runOutsideAngular(() => {\n element.addEventListener('animationstart', listener, listenerOptions);\n element.classList.add('cdk-text-field-autofill-monitored');\n });\n this._monitoredElements.set(element, {\n subject: result,\n unlisten: () => {\n element.removeEventListener('animationstart', listener, listenerOptions);\n }\n });\n return result;\n }\n stopMonitoring(elementOrRef) {\n const element = coerceElement(elementOrRef);\n const info = this._monitoredElements.get(element);\n if (info) {\n info.unlisten();\n info.subject.complete();\n element.classList.remove('cdk-text-field-autofill-monitored');\n element.classList.remove('cdk-text-field-autofilled');\n this._monitoredElements.delete(element);\n }\n }\n ngOnDestroy() {\n this._monitoredElements.forEach((_info, element) => this.stopMonitoring(element));\n }\n}\nAutofillMonitor.ɵfac = function AutofillMonitor_Factory(t) { return new (t || AutofillMonitor)(ɵngcc0.ɵɵinject(ɵngcc1.Platform), ɵngcc0.ɵɵinject(ɵngcc0.NgZone)); };\nAutofillMonitor.ɵprov = i0.ɵɵdefineInjectable({ factory: function AutofillMonitor_Factory() { return new AutofillMonitor(i0.ɵɵinject(i1.Platform), i0.ɵɵinject(i0.NgZone)); }, token: AutofillMonitor, providedIn: \"root\" });\nAutofillMonitor.ctorParameters = () => [\n { type: Platform },\n { type: NgZone }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(AutofillMonitor, [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], function () { return [{ type: ɵngcc1.Platform }, { type: ɵngcc0.NgZone }]; }, null); })();\n/** A directive that can be used to monitor the autofill state of an input. */\nclass CdkAutofill {\n constructor(_elementRef, _autofillMonitor) {\n this._elementRef = _elementRef;\n this._autofillMonitor = _autofillMonitor;\n /** Emits when the autofill state of the element changes. */\n this.cdkAutofill = new EventEmitter();\n }\n ngOnInit() {\n this._autofillMonitor\n .monitor(this._elementRef)\n .subscribe(event => this.cdkAutofill.emit(event));\n }\n ngOnDestroy() {\n this._autofillMonitor.stopMonitoring(this._elementRef);\n }\n}\nCdkAutofill.ɵfac = function CdkAutofill_Factory(t) { return new (t || CdkAutofill)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(AutofillMonitor)); };\nCdkAutofill.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkAutofill, selectors: [[\"\", \"cdkAutofill\", \"\"]], outputs: { cdkAutofill: \"cdkAutofill\" } });\nCdkAutofill.ctorParameters = () => [\n { type: ElementRef },\n { type: AutofillMonitor }\n];\nCdkAutofill.propDecorators = {\n cdkAutofill: [{ type: Output }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkAutofill, [{\n type: Directive,\n args: [{\n selector: '[cdkAutofill]'\n }]\n }], function () { return [{ type: ɵngcc0.ElementRef }, { type: AutofillMonitor }]; }, { cdkAutofill: [{\n type: Output\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Directive to automatically resize a textarea to fit its content. */\nclass CdkTextareaAutosize {\n constructor(_elementRef, _platform, _ngZone, \n /** @breaking-change 11.0.0 make document required */\n document) {\n this._elementRef = _elementRef;\n this._platform = _platform;\n this._ngZone = _ngZone;\n this._destroyed = new Subject();\n this._enabled = true;\n /**\n * Value of minRows as of last resize. If the minRows has decreased, the\n * height of the textarea needs to be recomputed to reflect the new minimum. The maxHeight\n * does not have the same problem because it does not affect the textarea's scrollHeight.\n */\n this._previousMinRows = -1;\n this._isViewInited = false;\n this._document = document;\n this._textareaElement = this._elementRef.nativeElement;\n this._measuringClass = _platform.FIREFOX ?\n 'cdk-textarea-autosize-measuring-firefox' :\n 'cdk-textarea-autosize-measuring';\n }\n /** Minimum amount of rows in the textarea. */\n get minRows() { return this._minRows; }\n set minRows(value) {\n this._minRows = coerceNumberProperty(value);\n this._setMinHeight();\n }\n /** Maximum amount of rows in the textarea. */\n get maxRows() { return this._maxRows; }\n set maxRows(value) {\n this._maxRows = coerceNumberProperty(value);\n this._setMaxHeight();\n }\n /** Whether autosizing is enabled or not */\n get enabled() { return this._enabled; }\n set enabled(value) {\n value = coerceBooleanProperty(value);\n // Only act if the actual value changed. This specifically helps to not run\n // resizeToFitContent too early (i.e. before ngAfterViewInit)\n if (this._enabled !== value) {\n (this._enabled = value) ? this.resizeToFitContent(true) : this.reset();\n }\n }\n get placeholder() { return this._textareaElement.placeholder; }\n set placeholder(value) {\n this._cachedPlaceholderHeight = undefined;\n this._textareaElement.placeholder = value;\n this._cacheTextareaPlaceholderHeight();\n }\n /** Sets the minimum height of the textarea as determined by minRows. */\n _setMinHeight() {\n const minHeight = this.minRows && this._cachedLineHeight ?\n `${this.minRows * this._cachedLineHeight}px` : null;\n if (minHeight) {\n this._textareaElement.style.minHeight = minHeight;\n }\n }\n /** Sets the maximum height of the textarea as determined by maxRows. */\n _setMaxHeight() {\n const maxHeight = this.maxRows && this._cachedLineHeight ?\n `${this.maxRows * this._cachedLineHeight}px` : null;\n if (maxHeight) {\n this._textareaElement.style.maxHeight = maxHeight;\n }\n }\n ngAfterViewInit() {\n if (this._platform.isBrowser) {\n // Remember the height which we started with in case autosizing is disabled\n this._initialHeight = this._textareaElement.style.height;\n this.resizeToFitContent();\n this._ngZone.runOutsideAngular(() => {\n const window = this._getWindow();\n fromEvent(window, 'resize')\n .pipe(auditTime(16), takeUntil(this._destroyed))\n .subscribe(() => this.resizeToFitContent(true));\n });\n this._isViewInited = true;\n this.resizeToFitContent(true);\n }\n }\n ngOnDestroy() {\n this._destroyed.next();\n this._destroyed.complete();\n }\n /**\n * Cache the height of a single-row textarea if it has not already been cached.\n *\n * We need to know how large a single \"row\" of a textarea is in order to apply minRows and\n * maxRows. For the initial version, we will assume that the height of a single line in the\n * textarea does not ever change.\n */\n _cacheTextareaLineHeight() {\n if (this._cachedLineHeight) {\n return;\n }\n // Use a clone element because we have to override some styles.\n let textareaClone = this._textareaElement.cloneNode(false);\n textareaClone.rows = 1;\n // Use `position: absolute` so that this doesn't cause a browser layout and use\n // `visibility: hidden` so that nothing is rendered. Clear any other styles that\n // would affect the height.\n textareaClone.style.position = 'absolute';\n textareaClone.style.visibility = 'hidden';\n textareaClone.style.border = 'none';\n textareaClone.style.padding = '0';\n textareaClone.style.height = '';\n textareaClone.style.minHeight = '';\n textareaClone.style.maxHeight = '';\n // In Firefox it happens that textarea elements are always bigger than the specified amount\n // of rows. This is because Firefox tries to add extra space for the horizontal scrollbar.\n // As a workaround that removes the extra space for the scrollbar, we can just set overflow\n // to hidden. This ensures that there is no invalid calculation of the line height.\n // See Firefox bug report: https://bugzilla.mozilla.org/show_bug.cgi?id=33654\n textareaClone.style.overflow = 'hidden';\n this._textareaElement.parentNode.appendChild(textareaClone);\n this._cachedLineHeight = textareaClone.clientHeight;\n this._textareaElement.parentNode.removeChild(textareaClone);\n // Min and max heights have to be re-calculated if the cached line height changes\n this._setMinHeight();\n this._setMaxHeight();\n }\n _measureScrollHeight() {\n // Reset the textarea height to auto in order to shrink back to its default size.\n // Also temporarily force overflow:hidden, so scroll bars do not interfere with calculations.\n this._textareaElement.classList.add(this._measuringClass);\n // The measuring class includes a 2px padding to workaround an issue with Chrome,\n // so we account for that extra space here by subtracting 4 (2px top + 2px bottom).\n const scrollHeight = this._textareaElement.scrollHeight - 4;\n this._textareaElement.classList.remove(this._measuringClass);\n return scrollHeight;\n }\n _cacheTextareaPlaceholderHeight() {\n if (!this._isViewInited || this._cachedPlaceholderHeight != undefined) {\n return;\n }\n if (!this.placeholder) {\n this._cachedPlaceholderHeight = 0;\n return;\n }\n const value = this._textareaElement.value;\n this._textareaElement.value = this._textareaElement.placeholder;\n this._cachedPlaceholderHeight = this._measureScrollHeight();\n this._textareaElement.value = value;\n }\n ngDoCheck() {\n if (this._platform.isBrowser) {\n this.resizeToFitContent();\n }\n }\n /**\n * Resize the textarea to fit its content.\n * @param force Whether to force a height recalculation. By default the height will be\n * recalculated only if the value changed since the last call.\n */\n resizeToFitContent(force = false) {\n // If autosizing is disabled, just skip everything else\n if (!this._enabled) {\n return;\n }\n this._cacheTextareaLineHeight();\n this._cacheTextareaPlaceholderHeight();\n // If we haven't determined the line-height yet, we know we're still hidden and there's no point\n // in checking the height of the textarea.\n if (!this._cachedLineHeight) {\n return;\n }\n const textarea = this._elementRef.nativeElement;\n const value = textarea.value;\n // Only resize if the value or minRows have changed since these calculations can be expensive.\n if (!force && this._minRows === this._previousMinRows && value === this._previousValue) {\n return;\n }\n const scrollHeight = this._measureScrollHeight();\n const height = Math.max(scrollHeight, this._cachedPlaceholderHeight || 0);\n // Use the scrollHeight to know how large the textarea *would* be if fit its entire value.\n textarea.style.height = `${height}px`;\n this._ngZone.runOutsideAngular(() => {\n if (typeof requestAnimationFrame !== 'undefined') {\n requestAnimationFrame(() => this._scrollToCaretPosition(textarea));\n }\n else {\n setTimeout(() => this._scrollToCaretPosition(textarea));\n }\n });\n this._previousValue = value;\n this._previousMinRows = this._minRows;\n }\n /**\n * Resets the textarea to its original size\n */\n reset() {\n // Do not try to change the textarea, if the initialHeight has not been determined yet\n // This might potentially remove styles when reset() is called before ngAfterViewInit\n if (this._initialHeight !== undefined) {\n this._textareaElement.style.height = this._initialHeight;\n }\n }\n // In Ivy the `host` metadata will be merged, whereas in ViewEngine it is overridden. In order\n // to avoid double event listeners, we need to use `HostListener`. Once Ivy is the default, we\n // can move this back into `host`.\n // tslint:disable:no-host-decorator-in-concrete\n _noopInputHandler() {\n // no-op handler that ensures we're running change detection on input events.\n }\n /** Access injected document if available or fallback to global document reference */\n _getDocument() {\n return this._document || document;\n }\n /** Use defaultView of injected document if available or fallback to global window reference */\n _getWindow() {\n const doc = this._getDocument();\n return doc.defaultView || window;\n }\n /**\n * Scrolls a textarea to the caret position. On Firefox resizing the textarea will\n * prevent it from scrolling to the caret position. We need to re-set the selection\n * in order for it to scroll to the proper position.\n */\n _scrollToCaretPosition(textarea) {\n const { selectionStart, selectionEnd } = textarea;\n const document = this._getDocument();\n // IE will throw an \"Unspecified error\" if we try to set the selection range after the\n // element has been removed from the DOM. Assert that the directive hasn't been destroyed\n // between the time we requested the animation frame and when it was executed.\n // Also note that we have to assert that the textarea is focused before we set the\n // selection range. Setting the selection range on a non-focused textarea will cause\n // it to receive focus on IE and Edge.\n if (!this._destroyed.isStopped && document.activeElement === textarea) {\n textarea.setSelectionRange(selectionStart, selectionEnd);\n }\n }\n}\nCdkTextareaAutosize.ɵfac = function CdkTextareaAutosize_Factory(t) { return new (t || CdkTextareaAutosize)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc1.Platform), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.NgZone), ɵngcc0.ɵɵdirectiveInject(DOCUMENT, 8)); };\nCdkTextareaAutosize.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkTextareaAutosize, selectors: [[\"textarea\", \"cdkTextareaAutosize\", \"\"]], hostAttrs: [\"rows\", \"1\", 1, \"cdk-textarea-autosize\"], hostBindings: function CdkTextareaAutosize_HostBindings(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵlistener(\"input\", function CdkTextareaAutosize_input_HostBindingHandler() { return ctx._noopInputHandler(); });\n } }, inputs: { minRows: [\"cdkAutosizeMinRows\", \"minRows\"], maxRows: [\"cdkAutosizeMaxRows\", \"maxRows\"], enabled: [\"cdkTextareaAutosize\", \"enabled\"], placeholder: \"placeholder\" }, exportAs: [\"cdkTextareaAutosize\"] });\nCdkTextareaAutosize.ctorParameters = () => [\n { type: ElementRef },\n { type: Platform },\n { type: NgZone },\n { type: undefined, decorators: [{ type: Optional }, { type: Inject, args: [DOCUMENT,] }] }\n];\nCdkTextareaAutosize.propDecorators = {\n minRows: [{ type: Input, args: ['cdkAutosizeMinRows',] }],\n maxRows: [{ type: Input, args: ['cdkAutosizeMaxRows',] }],\n enabled: [{ type: Input, args: ['cdkTextareaAutosize',] }],\n placeholder: [{ type: Input }],\n _noopInputHandler: [{ type: HostListener, args: ['input',] }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkTextareaAutosize, [{\n type: Directive,\n args: [{\n selector: 'textarea[cdkTextareaAutosize]',\n exportAs: 'cdkTextareaAutosize',\n host: {\n 'class': 'cdk-textarea-autosize',\n // Textarea elements that have the directive applied should have a single row by default.\n // Browsers normally show two rows by default and therefore this limits the minRows binding.\n 'rows': '1'\n }\n }]\n }], function () { return [{ type: ɵngcc0.ElementRef }, { type: ɵngcc1.Platform }, { type: ɵngcc0.NgZone }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, { minRows: [{\n type: Input,\n args: ['cdkAutosizeMinRows']\n }], maxRows: [{\n type: Input,\n args: ['cdkAutosizeMaxRows']\n }], enabled: [{\n type: Input,\n args: ['cdkTextareaAutosize']\n }], placeholder: [{\n type: Input\n }], \n // In Ivy the `host` metadata will be merged, whereas in ViewEngine it is overridden. In order\n // to avoid double event listeners, we need to use `HostListener`. Once Ivy is the default, we\n // can move this back into `host`.\n // tslint:disable:no-host-decorator-in-concrete\n _noopInputHandler: [{\n type: HostListener,\n args: ['input']\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass TextFieldModule {\n}\nTextFieldModule.ɵfac = function TextFieldModule_Factory(t) { return new (t || TextFieldModule)(); };\nTextFieldModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: TextFieldModule });\nTextFieldModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({ imports: [[PlatformModule]] });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(TextFieldModule, [{\n type: NgModule,\n args: [{\n declarations: [CdkAutofill, CdkTextareaAutosize],\n imports: [PlatformModule],\n exports: [CdkAutofill, CdkTextareaAutosize]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(TextFieldModule, { declarations: function () { return [CdkAutofill, CdkTextareaAutosize]; }, imports: function () { return [PlatformModule]; }, exports: function () { return [CdkAutofill, CdkTextareaAutosize]; } }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { AutofillMonitor, CdkAutofill, CdkTextareaAutosize, TextFieldModule };\n\n//# sourceMappingURL=text-field.js.map","import { SelectionModel, isDataSource } from '@angular/cdk/collections';\nimport { isObservable, Subject, BehaviorSubject, of } from 'rxjs';\nimport { take, filter, takeUntil } from 'rxjs/operators';\nimport { InjectionToken, Directive, ViewContainerRef, Inject, Optional, TemplateRef, Component, ViewEncapsulation, ChangeDetectionStrategy, IterableDiffers, ChangeDetectorRef, Input, ViewChild, ContentChildren, ElementRef, HostListener, NgModule } from '@angular/core';\nimport { coerceNumberProperty, coerceBooleanProperty } from '@angular/cdk/coercion';\nimport { Directionality } from '@angular/cdk/bidi';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Base tree control. It has basic toggle/expand/collapse operations on a single data node. */\nimport * as ɵngcc0 from '@angular/core';\nimport * as ɵngcc1 from '@angular/cdk/bidi';\nclass BaseTreeControl {\n constructor() {\n /** A selection model with multi-selection to track expansion status. */\n this.expansionModel = new SelectionModel(true);\n }\n /** Toggles one single data node's expanded/collapsed state. */\n toggle(dataNode) {\n this.expansionModel.toggle(this._trackByValue(dataNode));\n }\n /** Expands one single data node. */\n expand(dataNode) {\n this.expansionModel.select(this._trackByValue(dataNode));\n }\n /** Collapses one single data node. */\n collapse(dataNode) {\n this.expansionModel.deselect(this._trackByValue(dataNode));\n }\n /** Whether a given data node is expanded or not. Returns true if the data node is expanded. */\n isExpanded(dataNode) {\n return this.expansionModel.isSelected(this._trackByValue(dataNode));\n }\n /** Toggles a subtree rooted at `node` recursively. */\n toggleDescendants(dataNode) {\n this.expansionModel.isSelected(this._trackByValue(dataNode)) ?\n this.collapseDescendants(dataNode) :\n this.expandDescendants(dataNode);\n }\n /** Collapse all dataNodes in the tree. */\n collapseAll() {\n this.expansionModel.clear();\n }\n /** Expands a subtree rooted at given data node recursively. */\n expandDescendants(dataNode) {\n let toBeProcessed = [dataNode];\n toBeProcessed.push(...this.getDescendants(dataNode));\n this.expansionModel.select(...toBeProcessed.map(value => this._trackByValue(value)));\n }\n /** Collapses a subtree rooted at given data node recursively. */\n collapseDescendants(dataNode) {\n let toBeProcessed = [dataNode];\n toBeProcessed.push(...this.getDescendants(dataNode));\n this.expansionModel.deselect(...toBeProcessed.map(value => this._trackByValue(value)));\n }\n _trackByValue(value) {\n return this.trackBy ? this.trackBy(value) : value;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Flat tree control. Able to expand/collapse a subtree recursively for flattened tree. */\nclass FlatTreeControl extends BaseTreeControl {\n /** Construct with flat tree data node functions getLevel and isExpandable. */\n constructor(getLevel, isExpandable, options) {\n super();\n this.getLevel = getLevel;\n this.isExpandable = isExpandable;\n this.options = options;\n if (this.options) {\n this.trackBy = this.options.trackBy;\n }\n }\n /**\n * Gets a list of the data node's subtree of descendent data nodes.\n *\n * To make this working, the `dataNodes` of the TreeControl must be flattened tree nodes\n * with correct levels.\n */\n getDescendants(dataNode) {\n const startIndex = this.dataNodes.indexOf(dataNode);\n const results = [];\n // Goes through flattened tree nodes in the `dataNodes` array, and get all descendants.\n // The level of descendants of a tree node must be greater than the level of the given\n // tree node.\n // If we reach a node whose level is equal to the level of the tree node, we hit a sibling.\n // If we reach a node whose level is greater than the level of the tree node, we hit a\n // sibling of an ancestor.\n for (let i = startIndex + 1; i < this.dataNodes.length && this.getLevel(dataNode) < this.getLevel(this.dataNodes[i]); i++) {\n results.push(this.dataNodes[i]);\n }\n return results;\n }\n /**\n * Expands all data nodes in the tree.\n *\n * To make this working, the `dataNodes` variable of the TreeControl must be set to all flattened\n * data nodes of the tree.\n */\n expandAll() {\n this.expansionModel.select(...this.dataNodes.map(node => this._trackByValue(node)));\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Nested tree control. Able to expand/collapse a subtree recursively for NestedNode type. */\nclass NestedTreeControl extends BaseTreeControl {\n /** Construct with nested tree function getChildren. */\n constructor(getChildren, options) {\n super();\n this.getChildren = getChildren;\n this.options = options;\n if (this.options) {\n this.trackBy = this.options.trackBy;\n }\n }\n /**\n * Expands all dataNodes in the tree.\n *\n * To make this working, the `dataNodes` variable of the TreeControl must be set to all root level\n * data nodes of the tree.\n */\n expandAll() {\n this.expansionModel.clear();\n const allNodes = this.dataNodes.reduce((accumulator, dataNode) => [...accumulator, ...this.getDescendants(dataNode), dataNode], []);\n this.expansionModel.select(...allNodes.map(node => this._trackByValue(node)));\n }\n /** Gets a list of descendant dataNodes of a subtree rooted at given data node recursively. */\n getDescendants(dataNode) {\n const descendants = [];\n this._getDescendants(descendants, dataNode);\n // Remove the node itself\n return descendants.splice(1);\n }\n /** A helper function to get descendants recursively. */\n _getDescendants(descendants, dataNode) {\n descendants.push(dataNode);\n const childrenNodes = this.getChildren(dataNode);\n if (Array.isArray(childrenNodes)) {\n childrenNodes.forEach((child) => this._getDescendants(descendants, child));\n }\n else if (isObservable(childrenNodes)) {\n // TypeScript as of version 3.5 doesn't seem to treat `Boolean` like a function that\n // returns a `boolean` specifically in the context of `filter`, so we manually clarify that.\n childrenNodes.pipe(take(1), filter(Boolean))\n .subscribe(children => {\n for (const child of children) {\n this._getDescendants(descendants, child);\n }\n });\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injection token used to provide a `CdkTreeNode` to its outlet.\n * Used primarily to avoid circular imports.\n * @docs-private\n */\nconst CDK_TREE_NODE_OUTLET_NODE = new InjectionToken('CDK_TREE_NODE_OUTLET_NODE');\n/**\n * Outlet for nested CdkNode. Put `[cdkTreeNodeOutlet]` on a tag to place children dataNodes\n * inside the outlet.\n */\nclass CdkTreeNodeOutlet {\n constructor(viewContainer, _node) {\n this.viewContainer = viewContainer;\n this._node = _node;\n }\n}\nCdkTreeNodeOutlet.ɵfac = function CdkTreeNodeOutlet_Factory(t) { return new (t || CdkTreeNodeOutlet)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef), ɵngcc0.ɵɵdirectiveInject(CDK_TREE_NODE_OUTLET_NODE, 8)); };\nCdkTreeNodeOutlet.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkTreeNodeOutlet, selectors: [[\"\", \"cdkTreeNodeOutlet\", \"\"]] });\nCdkTreeNodeOutlet.ctorParameters = () => [\n { type: ViewContainerRef },\n { type: undefined, decorators: [{ type: Inject, args: [CDK_TREE_NODE_OUTLET_NODE,] }, { type: Optional }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkTreeNodeOutlet, [{\n type: Directive,\n args: [{\n selector: '[cdkTreeNodeOutlet]'\n }]\n }], function () { return [{ type: ɵngcc0.ViewContainerRef }, { type: undefined, decorators: [{\n type: Inject,\n args: [CDK_TREE_NODE_OUTLET_NODE]\n }, {\n type: Optional\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Context provided to the tree node component. */\nclass CdkTreeNodeOutletContext {\n constructor(data) {\n this.$implicit = data;\n }\n}\n/**\n * Data node definition for the CdkTree.\n * Captures the node's template and a when predicate that describes when this node should be used.\n */\nclass CdkTreeNodeDef {\n /** @docs-private */\n constructor(template) {\n this.template = template;\n }\n}\nCdkTreeNodeDef.ɵfac = function CdkTreeNodeDef_Factory(t) { return new (t || CdkTreeNodeDef)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef)); };\nCdkTreeNodeDef.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkTreeNodeDef, selectors: [[\"\", \"cdkTreeNodeDef\", \"\"]], inputs: { when: [\"cdkTreeNodeDefWhen\", \"when\"] } });\nCdkTreeNodeDef.ctorParameters = () => [\n { type: TemplateRef }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkTreeNodeDef, [{\n type: Directive,\n args: [{\n selector: '[cdkTreeNodeDef]',\n inputs: [\n 'when: cdkTreeNodeDefWhen'\n ]\n }]\n }], function () { return [{ type: ɵngcc0.TemplateRef }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Returns an error to be thrown when there is no usable data.\n * @docs-private\n */\nfunction getTreeNoValidDataSourceError() {\n return Error(`A valid data source must be provided.`);\n}\n/**\n * Returns an error to be thrown when there are multiple nodes that are missing a when function.\n * @docs-private\n */\nfunction getTreeMultipleDefaultNodeDefsError() {\n return Error(`There can only be one default row without a when predicate function.`);\n}\n/**\n * Returns an error to be thrown when there are no matching node defs for a particular set of data.\n * @docs-private\n */\nfunction getTreeMissingMatchingNodeDefError() {\n return Error(`Could not find a matching node definition for the provided node data.`);\n}\n/**\n * Returns an error to be thrown when there are tree control.\n * @docs-private\n */\nfunction getTreeControlMissingError() {\n return Error(`Could not find a tree control for the tree.`);\n}\n/**\n * Returns an error to be thrown when tree control did not implement functions for flat/nested node.\n * @docs-private\n */\nfunction getTreeControlFunctionsMissingError() {\n return Error(`Could not find functions for nested/flat tree in tree control.`);\n}\n\n/**\n * CDK tree component that connects with a data source to retrieve data of type `T` and renders\n * dataNodes with hierarchy. Updates the dataNodes when new data is provided by the data source.\n */\nclass CdkTree {\n constructor(_differs, _changeDetectorRef) {\n this._differs = _differs;\n this._changeDetectorRef = _changeDetectorRef;\n /** Subject that emits when the component has been destroyed. */\n this._onDestroy = new Subject();\n /** Level of nodes */\n this._levels = new Map();\n // TODO(tinayuangao): Setup a listener for scrolling, emit the calculated view to viewChange.\n // Remove the MAX_VALUE in viewChange\n /**\n * Stream containing the latest information on what rows are being displayed on screen.\n * Can be used by the data source to as a heuristic of what data should be provided.\n */\n this.viewChange = new BehaviorSubject({ start: 0, end: Number.MAX_VALUE });\n }\n /**\n * Provides a stream containing the latest data array to render. Influenced by the tree's\n * stream of view window (what dataNodes are currently on screen).\n * Data source can be an observable of data array, or a data array to render.\n */\n get dataSource() { return this._dataSource; }\n set dataSource(dataSource) {\n if (this._dataSource !== dataSource) {\n this._switchDataSource(dataSource);\n }\n }\n ngOnInit() {\n this._dataDiffer = this._differs.find([]).create(this.trackBy);\n if (!this.treeControl && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTreeControlMissingError();\n }\n }\n ngOnDestroy() {\n this._nodeOutlet.viewContainer.clear();\n this.viewChange.complete();\n this._onDestroy.next();\n this._onDestroy.complete();\n if (this._dataSource && typeof this._dataSource.disconnect === 'function') {\n this.dataSource.disconnect(this);\n }\n if (this._dataSubscription) {\n this._dataSubscription.unsubscribe();\n this._dataSubscription = null;\n }\n }\n ngAfterContentChecked() {\n const defaultNodeDefs = this._nodeDefs.filter(def => !def.when);\n if (defaultNodeDefs.length > 1 && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTreeMultipleDefaultNodeDefsError();\n }\n this._defaultNodeDef = defaultNodeDefs[0];\n if (this.dataSource && this._nodeDefs && !this._dataSubscription) {\n this._observeRenderChanges();\n }\n }\n // TODO(tinayuangao): Work on keyboard traversal and actions, make sure it's working for RTL\n // and nested trees.\n /**\n * Switch to the provided data source by resetting the data and unsubscribing from the current\n * render change subscription if one exists. If the data source is null, interpret this by\n * clearing the node outlet. Otherwise start listening for new data.\n */\n _switchDataSource(dataSource) {\n if (this._dataSource && typeof this._dataSource.disconnect === 'function') {\n this.dataSource.disconnect(this);\n }\n if (this._dataSubscription) {\n this._dataSubscription.unsubscribe();\n this._dataSubscription = null;\n }\n // Remove the all dataNodes if there is now no data source\n if (!dataSource) {\n this._nodeOutlet.viewContainer.clear();\n }\n this._dataSource = dataSource;\n if (this._nodeDefs) {\n this._observeRenderChanges();\n }\n }\n /** Set up a subscription for the data provided by the data source. */\n _observeRenderChanges() {\n let dataStream;\n if (isDataSource(this._dataSource)) {\n dataStream = this._dataSource.connect(this);\n }\n else if (isObservable(this._dataSource)) {\n dataStream = this._dataSource;\n }\n else if (Array.isArray(this._dataSource)) {\n dataStream = of(this._dataSource);\n }\n if (dataStream) {\n this._dataSubscription = dataStream.pipe(takeUntil(this._onDestroy))\n .subscribe(data => this.renderNodeChanges(data));\n }\n else if (typeof ngDevMode === 'undefined' || ngDevMode) {\n throw getTreeNoValidDataSourceError();\n }\n }\n /** Check for changes made in the data and render each change (node added/removed/moved). */\n renderNodeChanges(data, dataDiffer = this._dataDiffer, viewContainer = this._nodeOutlet.viewContainer, parentData) {\n const changes = dataDiffer.diff(data);\n if (!changes) {\n return;\n }\n changes.forEachOperation((item, adjustedPreviousIndex, currentIndex) => {\n if (item.previousIndex == null) {\n this.insertNode(data[currentIndex], currentIndex, viewContainer, parentData);\n }\n else if (currentIndex == null) {\n viewContainer.remove(adjustedPreviousIndex);\n this._levels.delete(item.item);\n }\n else {\n const view = viewContainer.get(adjustedPreviousIndex);\n viewContainer.move(view, currentIndex);\n }\n });\n this._changeDetectorRef.detectChanges();\n }\n /**\n * Finds the matching node definition that should be used for this node data. If there is only\n * one node definition, it is returned. Otherwise, find the node definition that has a when\n * predicate that returns true with the data. If none return true, return the default node\n * definition.\n */\n _getNodeDef(data, i) {\n if (this._nodeDefs.length === 1) {\n return this._nodeDefs.first;\n }\n const nodeDef = this._nodeDefs.find(def => def.when && def.when(i, data)) || this._defaultNodeDef;\n if (!nodeDef && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTreeMissingMatchingNodeDefError();\n }\n return nodeDef;\n }\n /**\n * Create the embedded view for the data node template and place it in the correct index location\n * within the data node view container.\n */\n insertNode(nodeData, index, viewContainer, parentData) {\n const node = this._getNodeDef(nodeData, index);\n // Node context that will be provided to created embedded view\n const context = new CdkTreeNodeOutletContext(nodeData);\n // If the tree is flat tree, then use the `getLevel` function in flat tree control\n // Otherwise, use the level of parent node.\n if (this.treeControl.getLevel) {\n context.level = this.treeControl.getLevel(nodeData);\n }\n else if (typeof parentData !== 'undefined' && this._levels.has(parentData)) {\n context.level = this._levels.get(parentData) + 1;\n }\n else {\n context.level = 0;\n }\n this._levels.set(nodeData, context.level);\n // Use default tree nodeOutlet, or nested node's nodeOutlet\n const container = viewContainer ? viewContainer : this._nodeOutlet.viewContainer;\n container.createEmbeddedView(node.template, context, index);\n // Set the data to just created `CdkTreeNode`.\n // The `CdkTreeNode` created from `createEmbeddedView` will be saved in static variable\n // `mostRecentTreeNode`. We get it from static variable and pass the node data to it.\n if (CdkTreeNode.mostRecentTreeNode) {\n CdkTreeNode.mostRecentTreeNode.data = nodeData;\n }\n }\n}\nCdkTree.ɵfac = function CdkTree_Factory(t) { return new (t || CdkTree)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.IterableDiffers), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ChangeDetectorRef)); };\nCdkTree.ɵcmp = /*@__PURE__*/ ɵngcc0.ɵɵdefineComponent({ type: CdkTree, selectors: [[\"cdk-tree\"]], contentQueries: function CdkTree_ContentQueries(rf, ctx, dirIndex) { if (rf & 1) {\n ɵngcc0.ɵɵcontentQuery(dirIndex, CdkTreeNodeDef, 5);\n } if (rf & 2) {\n let _t;\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._nodeDefs = _t);\n } }, viewQuery: function CdkTree_Query(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵviewQuery(CdkTreeNodeOutlet, 7);\n } if (rf & 2) {\n let _t;\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx._nodeOutlet = _t.first);\n } }, hostAttrs: [\"role\", \"tree\", 1, \"cdk-tree\"], inputs: { dataSource: \"dataSource\", treeControl: \"treeControl\", trackBy: \"trackBy\" }, exportAs: [\"cdkTree\"], decls: 1, vars: 0, consts: [[\"cdkTreeNodeOutlet\", \"\"]], template: function CdkTree_Template(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵelementContainer(0, 0);\n } }, directives: [CdkTreeNodeOutlet], encapsulation: 2 });\nCdkTree.ctorParameters = () => [\n { type: IterableDiffers },\n { type: ChangeDetectorRef }\n];\nCdkTree.propDecorators = {\n dataSource: [{ type: Input }],\n treeControl: [{ type: Input }],\n trackBy: [{ type: Input }],\n _nodeOutlet: [{ type: ViewChild, args: [CdkTreeNodeOutlet, { static: true },] }],\n _nodeDefs: [{ type: ContentChildren, args: [CdkTreeNodeDef, {\n // We need to use `descendants: true`, because Ivy will no longer match\n // indirect descendants if it's left as false.\n descendants: true\n },] }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkTree, [{\n type: Component,\n args: [{\n selector: 'cdk-tree',\n exportAs: 'cdkTree',\n template: ``,\n host: {\n 'class': 'cdk-tree',\n 'role': 'tree'\n },\n encapsulation: ViewEncapsulation.None,\n // The \"OnPush\" status for the `CdkTree` component is effectively a noop, so we are removing it.\n // The view for `CdkTree` consists entirely of templates declared in other views. As they are\n // declared elsewhere, they are checked when their declaration points are checked.\n // tslint:disable-next-line:validate-decorators\n changeDetection: ChangeDetectionStrategy.Default\n }]\n }], function () { return [{ type: ɵngcc0.IterableDiffers }, { type: ɵngcc0.ChangeDetectorRef }]; }, { dataSource: [{\n type: Input\n }], treeControl: [{\n type: Input\n }], trackBy: [{\n type: Input\n }], _nodeOutlet: [{\n type: ViewChild,\n args: [CdkTreeNodeOutlet, { static: true }]\n }], _nodeDefs: [{\n type: ContentChildren,\n args: [CdkTreeNodeDef, {\n // We need to use `descendants: true`, because Ivy will no longer match\n // indirect descendants if it's left as false.\n descendants: true\n }]\n }] }); })();\n/**\n * Tree node for CdkTree. It contains the data in the tree node.\n */\nclass CdkTreeNode {\n constructor(_elementRef, _tree) {\n this._elementRef = _elementRef;\n this._tree = _tree;\n /** Subject that emits when the component has been destroyed. */\n this._destroyed = new Subject();\n /** Emits when the node's data has changed. */\n this._dataChanges = new Subject();\n CdkTreeNode.mostRecentTreeNode = this;\n // The classes are directly added here instead of in the host property because classes on\n // the host property are not inherited with View Engine. It is not set as a @HostBinding because\n // it is not set by the time it's children nodes try to read the class from it.\n // TODO: move to host after View Engine deprecation\n this._elementRef.nativeElement.classList.add('cdk-tree-node');\n this.role = 'treeitem';\n }\n /**\n * The role of the tree node.\n * @deprecated The correct role is 'treeitem', 'group' should not be used. This input will be\n * removed in a future version.\n * @breaking-change 12.0.0 Remove this input\n */\n get role() { return 'treeitem'; }\n set role(_role) {\n // TODO: move to host after View Engine deprecation\n this._elementRef.nativeElement.setAttribute('role', _role);\n }\n /** The tree node's data. */\n get data() { return this._data; }\n set data(value) {\n if (value !== this._data) {\n this._data = value;\n this._setRoleFromData();\n this._dataChanges.next();\n }\n }\n get isExpanded() {\n return this._tree.treeControl.isExpanded(this._data);\n }\n _setExpanded(_expanded) {\n this._isAriaExpanded = _expanded;\n this._elementRef.nativeElement.setAttribute('aria-expanded', `${_expanded}`);\n }\n get level() {\n // If the treeControl has a getLevel method, use it to get the level. Otherwise read the\n // aria-level off the parent node and use it as the level for this node (note aria-level is\n // 1-indexed, while this property is 0-indexed, so we don't need to increment).\n return this._tree.treeControl.getLevel ?\n this._tree.treeControl.getLevel(this._data) : this._parentNodeAriaLevel;\n }\n ngOnInit() {\n this._parentNodeAriaLevel = getParentNodeAriaLevel(this._elementRef.nativeElement);\n this._elementRef.nativeElement.setAttribute('aria-level', `${this.level + 1}`);\n }\n ngDoCheck() {\n // aria-expanded is be set here because the expanded state is stored in the tree control and\n // the node isn't aware when the state is changed.\n // It is not set using a @HostBinding because they sometimes get lost with Mixin based classes.\n // TODO: move to host after View Engine deprecation\n if (this.isExpanded != this._isAriaExpanded) {\n this._setExpanded(this.isExpanded);\n }\n }\n ngOnDestroy() {\n // If this is the last tree node being destroyed,\n // clear out the reference to avoid leaking memory.\n if (CdkTreeNode.mostRecentTreeNode === this) {\n CdkTreeNode.mostRecentTreeNode = null;\n }\n this._dataChanges.complete();\n this._destroyed.next();\n this._destroyed.complete();\n }\n /** Focuses the menu item. Implements for FocusableOption. */\n focus() {\n this._elementRef.nativeElement.focus();\n }\n // TODO: role should eventually just be set in the component host\n _setRoleFromData() {\n if (!this._tree.treeControl.isExpandable && !this._tree.treeControl.getChildren &&\n (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTreeControlFunctionsMissingError();\n }\n this.role = 'treeitem';\n }\n}\nCdkTreeNode.ɵfac = function CdkTreeNode_Factory(t) { return new (t || CdkTreeNode)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(CdkTree)); };\nCdkTreeNode.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkTreeNode, selectors: [[\"cdk-tree-node\"]], inputs: { role: \"role\" }, exportAs: [\"cdkTreeNode\"] });\n/**\n * The most recently created `CdkTreeNode`. We save it in static variable so we can retrieve it\n * in `CdkTree` and set the data to it.\n */\nCdkTreeNode.mostRecentTreeNode = null;\nCdkTreeNode.ctorParameters = () => [\n { type: ElementRef },\n { type: CdkTree }\n];\nCdkTreeNode.propDecorators = {\n role: [{ type: Input }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkTreeNode, [{\n type: Directive,\n args: [{\n selector: 'cdk-tree-node',\n exportAs: 'cdkTreeNode'\n }]\n }], function () { return [{ type: ɵngcc0.ElementRef }, { type: CdkTree }]; }, { role: [{\n type: Input\n }] }); })();\nfunction getParentNodeAriaLevel(nodeElement) {\n let parent = nodeElement.parentElement;\n while (parent && !isNodeElement(parent)) {\n parent = parent.parentElement;\n }\n if (!parent) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n throw Error('Incorrect tree structure containing detached node.');\n }\n else {\n return -1;\n }\n }\n else if (parent.classList.contains('cdk-nested-tree-node')) {\n return coerceNumberProperty(parent.getAttribute('aria-level'));\n }\n else {\n // The ancestor element is the cdk-tree itself\n return 0;\n }\n}\nfunction isNodeElement(element) {\n const classList = element.classList;\n return !!((classList === null || classList === void 0 ? void 0 : classList.contains('cdk-nested-tree-node')) || (classList === null || classList === void 0 ? void 0 : classList.contains('cdk-tree')));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Nested node is a child of ``. It works with nested tree.\n * By using `cdk-nested-tree-node` component in tree node template, children of the parent node will\n * be added in the `cdkTreeNodeOutlet` in tree node template.\n * The children of node will be automatically added to `cdkTreeNodeOutlet`.\n */\nclass CdkNestedTreeNode extends CdkTreeNode {\n constructor(_elementRef, _tree, _differs) {\n super(_elementRef, _tree);\n this._elementRef = _elementRef;\n this._tree = _tree;\n this._differs = _differs;\n // The classes are directly added here instead of in the host property because classes on\n // the host property are not inherited with View Engine. It is not set as a @HostBinding because\n // it is not set by the time it's children nodes try to read the class from it.\n // TODO: move to host after View Engine deprecation\n this._elementRef.nativeElement.classList.add('cdk-nested-tree-node');\n }\n ngAfterContentInit() {\n this._dataDiffer = this._differs.find([]).create(this._tree.trackBy);\n if (!this._tree.treeControl.getChildren && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTreeControlFunctionsMissingError();\n }\n const childrenNodes = this._tree.treeControl.getChildren(this.data);\n if (Array.isArray(childrenNodes)) {\n this.updateChildrenNodes(childrenNodes);\n }\n else if (isObservable(childrenNodes)) {\n childrenNodes.pipe(takeUntil(this._destroyed))\n .subscribe(result => this.updateChildrenNodes(result));\n }\n this.nodeOutlet.changes.pipe(takeUntil(this._destroyed))\n .subscribe(() => this.updateChildrenNodes());\n }\n // This is a workaround for https://github.com/angular/angular/issues/23091\n // In aot mode, the lifecycle hooks from parent class are not called.\n ngOnInit() {\n super.ngOnInit();\n }\n ngDoCheck() {\n super.ngDoCheck();\n }\n ngOnDestroy() {\n this._clear();\n super.ngOnDestroy();\n }\n /** Add children dataNodes to the NodeOutlet */\n updateChildrenNodes(children) {\n const outlet = this._getNodeOutlet();\n if (children) {\n this._children = children;\n }\n if (outlet && this._children) {\n const viewContainer = outlet.viewContainer;\n this._tree.renderNodeChanges(this._children, this._dataDiffer, viewContainer, this._data);\n }\n else {\n // Reset the data differ if there's no children nodes displayed\n this._dataDiffer.diff([]);\n }\n }\n /** Clear the children dataNodes. */\n _clear() {\n const outlet = this._getNodeOutlet();\n if (outlet) {\n outlet.viewContainer.clear();\n this._dataDiffer.diff([]);\n }\n }\n /** Gets the outlet for the current node. */\n _getNodeOutlet() {\n const outlets = this.nodeOutlet;\n // Note that since we use `descendants: true` on the query, we have to ensure\n // that we don't pick up the outlet of a child node by accident.\n return outlets && outlets.find(outlet => !outlet._node || outlet._node === this);\n }\n}\nCdkNestedTreeNode.ɵfac = function CdkNestedTreeNode_Factory(t) { return new (t || CdkNestedTreeNode)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(CdkTree), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.IterableDiffers)); };\nCdkNestedTreeNode.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkNestedTreeNode, selectors: [[\"cdk-nested-tree-node\"]], contentQueries: function CdkNestedTreeNode_ContentQueries(rf, ctx, dirIndex) { if (rf & 1) {\n ɵngcc0.ɵɵcontentQuery(dirIndex, CdkTreeNodeOutlet, 5);\n } if (rf & 2) {\n let _t;\n ɵngcc0.ɵɵqueryRefresh(_t = ɵngcc0.ɵɵloadQuery()) && (ctx.nodeOutlet = _t);\n } }, inputs: { role: \"role\", disabled: \"disabled\", tabIndex: \"tabIndex\" }, exportAs: [\"cdkNestedTreeNode\"], features: [ɵngcc0.ɵɵProvidersFeature([\n { provide: CdkTreeNode, useExisting: CdkNestedTreeNode },\n { provide: CDK_TREE_NODE_OUTLET_NODE, useExisting: CdkNestedTreeNode }\n ]), ɵngcc0.ɵɵInheritDefinitionFeature] });\nCdkNestedTreeNode.ctorParameters = () => [\n { type: ElementRef },\n { type: CdkTree },\n { type: IterableDiffers }\n];\nCdkNestedTreeNode.propDecorators = {\n nodeOutlet: [{ type: ContentChildren, args: [CdkTreeNodeOutlet, {\n // We need to use `descendants: true`, because Ivy will no longer match\n // indirect descendants if it's left as false.\n descendants: true\n },] }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkNestedTreeNode, [{\n type: Directive,\n args: [{\n selector: 'cdk-nested-tree-node',\n exportAs: 'cdkNestedTreeNode',\n inputs: ['role', 'disabled', 'tabIndex'],\n providers: [\n { provide: CdkTreeNode, useExisting: CdkNestedTreeNode },\n { provide: CDK_TREE_NODE_OUTLET_NODE, useExisting: CdkNestedTreeNode }\n ]\n }]\n }], function () { return [{ type: ɵngcc0.ElementRef }, { type: CdkTree }, { type: ɵngcc0.IterableDiffers }]; }, { nodeOutlet: [{\n type: ContentChildren,\n args: [CdkTreeNodeOutlet, {\n // We need to use `descendants: true`, because Ivy will no longer match\n // indirect descendants if it's left as false.\n descendants: true\n }]\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Regex used to split a string on its CSS units. */\nconst cssUnitPattern = /([A-Za-z%]+)$/;\n/**\n * Indent for the children tree dataNodes.\n * This directive will add left-padding to the node to show hierarchy.\n */\nclass CdkTreeNodePadding {\n constructor(_treeNode, _tree, _element, _dir) {\n this._treeNode = _treeNode;\n this._tree = _tree;\n this._element = _element;\n this._dir = _dir;\n /** Subject that emits when the component has been destroyed. */\n this._destroyed = new Subject();\n /** CSS units used for the indentation value. */\n this.indentUnits = 'px';\n this._indent = 40;\n this._setPadding();\n if (_dir) {\n _dir.change.pipe(takeUntil(this._destroyed)).subscribe(() => this._setPadding(true));\n }\n // In Ivy the indentation binding might be set before the tree node's data has been added,\n // which means that we'll miss the first render. We have to subscribe to changes in the\n // data to ensure that everything is up to date.\n _treeNode._dataChanges.subscribe(() => this._setPadding());\n }\n /** The level of depth of the tree node. The padding will be `level * indent` pixels. */\n get level() { return this._level; }\n set level(value) { this._setLevelInput(value); }\n /**\n * The indent for each level. Can be a number or a CSS string.\n * Default number 40px from material design menu sub-menu spec.\n */\n get indent() { return this._indent; }\n set indent(indent) { this._setIndentInput(indent); }\n ngOnDestroy() {\n this._destroyed.next();\n this._destroyed.complete();\n }\n /** The padding indent value for the tree node. Returns a string with px numbers if not null. */\n _paddingIndent() {\n const nodeLevel = (this._treeNode.data && this._tree.treeControl.getLevel)\n ? this._tree.treeControl.getLevel(this._treeNode.data)\n : null;\n const level = this._level == null ? nodeLevel : this._level;\n return typeof level === 'number' ? `${level * this._indent}${this.indentUnits}` : null;\n }\n _setPadding(forceChange = false) {\n const padding = this._paddingIndent();\n if (padding !== this._currentPadding || forceChange) {\n const element = this._element.nativeElement;\n const paddingProp = this._dir && this._dir.value === 'rtl' ? 'paddingRight' : 'paddingLeft';\n const resetProp = paddingProp === 'paddingLeft' ? 'paddingRight' : 'paddingLeft';\n element.style[paddingProp] = padding || '';\n element.style[resetProp] = '';\n this._currentPadding = padding;\n }\n }\n /**\n * This has been extracted to a util because of TS 4 and VE.\n * View Engine doesn't support property rename inheritance.\n * TS 4.0 doesn't allow properties to override accessors or vice-versa.\n * @docs-private\n */\n _setLevelInput(value) {\n // Set to null as the fallback value so that _setPadding can fall back to the node level if the\n // consumer set the directive as `cdkTreeNodePadding=\"\"`. We still want to take this value if\n // they set 0 explicitly.\n this._level = coerceNumberProperty(value, null);\n this._setPadding();\n }\n /**\n * This has been extracted to a util because of TS 4 and VE.\n * View Engine doesn't support property rename inheritance.\n * TS 4.0 doesn't allow properties to override accessors or vice-versa.\n * @docs-private\n */\n _setIndentInput(indent) {\n let value = indent;\n let units = 'px';\n if (typeof indent === 'string') {\n const parts = indent.split(cssUnitPattern);\n value = parts[0];\n units = parts[1] || units;\n }\n this.indentUnits = units;\n this._indent = coerceNumberProperty(value);\n this._setPadding();\n }\n}\nCdkTreeNodePadding.ɵfac = function CdkTreeNodePadding_Factory(t) { return new (t || CdkTreeNodePadding)(ɵngcc0.ɵɵdirectiveInject(CdkTreeNode), ɵngcc0.ɵɵdirectiveInject(CdkTree), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc1.Directionality, 8)); };\nCdkTreeNodePadding.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkTreeNodePadding, selectors: [[\"\", \"cdkTreeNodePadding\", \"\"]], inputs: { level: [\"cdkTreeNodePadding\", \"level\"], indent: [\"cdkTreeNodePaddingIndent\", \"indent\"] } });\nCdkTreeNodePadding.ctorParameters = () => [\n { type: CdkTreeNode },\n { type: CdkTree },\n { type: ElementRef },\n { type: Directionality, decorators: [{ type: Optional }] }\n];\nCdkTreeNodePadding.propDecorators = {\n level: [{ type: Input, args: ['cdkTreeNodePadding',] }],\n indent: [{ type: Input, args: ['cdkTreeNodePaddingIndent',] }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkTreeNodePadding, [{\n type: Directive,\n args: [{\n selector: '[cdkTreeNodePadding]'\n }]\n }], function () { return [{ type: CdkTreeNode }, { type: CdkTree }, { type: ɵngcc0.ElementRef }, { type: ɵngcc1.Directionality, decorators: [{\n type: Optional\n }] }]; }, { level: [{\n type: Input,\n args: ['cdkTreeNodePadding']\n }], indent: [{\n type: Input,\n args: ['cdkTreeNodePaddingIndent']\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Node toggle to expand/collapse the node.\n */\nclass CdkTreeNodeToggle {\n constructor(_tree, _treeNode) {\n this._tree = _tree;\n this._treeNode = _treeNode;\n this._recursive = false;\n }\n /** Whether expand/collapse the node recursively. */\n get recursive() { return this._recursive; }\n set recursive(value) { this._recursive = coerceBooleanProperty(value); }\n // We have to use a `HostListener` here in order to support both Ivy and ViewEngine.\n // In Ivy the `host` bindings will be merged when this class is extended, whereas in\n // ViewEngine they're overwritten.\n // TODO(crisbeto): we move this back into `host` once Ivy is turned on by default.\n // tslint:disable-next-line:no-host-decorator-in-concrete\n _toggle(event) {\n this.recursive\n ? this._tree.treeControl.toggleDescendants(this._treeNode.data)\n : this._tree.treeControl.toggle(this._treeNode.data);\n event.stopPropagation();\n }\n}\nCdkTreeNodeToggle.ɵfac = function CdkTreeNodeToggle_Factory(t) { return new (t || CdkTreeNodeToggle)(ɵngcc0.ɵɵdirectiveInject(CdkTree), ɵngcc0.ɵɵdirectiveInject(CdkTreeNode)); };\nCdkTreeNodeToggle.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: CdkTreeNodeToggle, selectors: [[\"\", \"cdkTreeNodeToggle\", \"\"]], hostBindings: function CdkTreeNodeToggle_HostBindings(rf, ctx) { if (rf & 1) {\n ɵngcc0.ɵɵlistener(\"click\", function CdkTreeNodeToggle_click_HostBindingHandler($event) { return ctx._toggle($event); });\n } }, inputs: { recursive: [\"cdkTreeNodeToggleRecursive\", \"recursive\"] } });\nCdkTreeNodeToggle.ctorParameters = () => [\n { type: CdkTree },\n { type: CdkTreeNode }\n];\nCdkTreeNodeToggle.propDecorators = {\n recursive: [{ type: Input, args: ['cdkTreeNodeToggleRecursive',] }],\n _toggle: [{ type: HostListener, args: ['click', ['$event'],] }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkTreeNodeToggle, [{\n type: Directive,\n args: [{ selector: '[cdkTreeNodeToggle]' }]\n }], function () { return [{ type: CdkTree }, { type: CdkTreeNode }]; }, { recursive: [{\n type: Input,\n args: ['cdkTreeNodeToggleRecursive']\n }], \n // We have to use a `HostListener` here in order to support both Ivy and ViewEngine.\n // In Ivy the `host` bindings will be merged when this class is extended, whereas in\n // ViewEngine they're overwritten.\n // TODO(crisbeto): we move this back into `host` once Ivy is turned on by default.\n // tslint:disable-next-line:no-host-decorator-in-concrete\n _toggle: [{\n type: HostListener,\n args: ['click', ['$event']]\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst EXPORTED_DECLARATIONS = [\n CdkNestedTreeNode,\n CdkTreeNodeDef,\n CdkTreeNodePadding,\n CdkTreeNodeToggle,\n CdkTree,\n CdkTreeNode,\n CdkTreeNodeOutlet,\n];\nclass CdkTreeModule {\n}\nCdkTreeModule.ɵfac = function CdkTreeModule_Factory(t) { return new (t || CdkTreeModule)(); };\nCdkTreeModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: CdkTreeModule });\nCdkTreeModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({});\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CdkTreeModule, [{\n type: NgModule,\n args: [{\n exports: EXPORTED_DECLARATIONS,\n declarations: EXPORTED_DECLARATIONS\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(CdkTreeModule, { declarations: [CdkNestedTreeNode, CdkTreeNodeDef, CdkTreeNodePadding, CdkTreeNodeToggle, CdkTree, CdkTreeNode, CdkTreeNodeOutlet], exports: [CdkNestedTreeNode, CdkTreeNodeDef, CdkTreeNodePadding, CdkTreeNodeToggle, CdkTree, CdkTreeNode, CdkTreeNodeOutlet] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BaseTreeControl, CDK_TREE_NODE_OUTLET_NODE, CdkNestedTreeNode, CdkTree, CdkTreeModule, CdkTreeNode, CdkTreeNodeDef, CdkTreeNodeOutlet, CdkTreeNodeOutletContext, CdkTreeNodePadding, CdkTreeNodeToggle, FlatTreeControl, NestedTreeControl, getTreeControlFunctionsMissingError, getTreeControlMissingError, getTreeMissingMatchingNodeDefError, getTreeMultipleDefaultNodeDefsError, getTreeNoValidDataSourceError };\n\n//# sourceMappingURL=tree.js.map","import { ElementRef } from '@angular/core';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Coerces a data-bound value (typically a string) to a boolean. */\nfunction coerceBooleanProperty(value) {\n return value != null && `${value}` !== 'false';\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction coerceNumberProperty(value, fallbackValue = 0) {\n return _isNumberValue(value) ? Number(value) : fallbackValue;\n}\n/**\n * Whether the provided value is considered a number.\n * @docs-private\n */\nfunction _isNumberValue(value) {\n // parseFloat(value) handles most of the cases we're interested in (it treats null, empty string,\n // and other non-number values as NaN, where Number just uses 0) but it considers the string\n // '123hello' to be a valid number. Therefore we also check if Number(value) is NaN.\n return !isNaN(parseFloat(value)) && !isNaN(Number(value));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction coerceArray(value) {\n return Array.isArray(value) ? value : [value];\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Coerces a value to a CSS pixel value. */\nfunction coerceCssPixelValue(value) {\n if (value == null) {\n return '';\n }\n return typeof value === 'string' ? value : `${value}px`;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Coerces an ElementRef or an Element into an element.\n * Useful for APIs that can accept either a ref or the native element itself.\n */\nfunction coerceElement(elementOrRef) {\n return elementOrRef instanceof ElementRef ? elementOrRef.nativeElement : elementOrRef;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Coerces a value to an array of trimmed non-empty strings.\n * Any input that is not an array, `null` or `undefined` will be turned into a string\n * via `toString()` and subsequently split with the given separator.\n * `null` and `undefined` will result in an empty array.\n * This results in the following outcomes:\n * - `null` -> `[]`\n * - `[null]` -> `[\"null\"]`\n * - `[\"a\", \"b \", \" \"]` -> `[\"a\", \"b\"]`\n * - `[1, [2, 3]]` -> `[\"1\", \"2,3\"]`\n * - `[{ a: 0 }]` -> `[\"[object Object]\"]`\n * - `{ a: 0 }` -> `[\"[object\", \"Object]\"]`\n *\n * Useful for defining CSS classes or table columns.\n * @param value the value to coerce into an array of strings\n * @param separator split-separator if value isn't an array\n */\nfunction coerceStringArray(value, separator = /\\s+/) {\n const result = [];\n if (value != null) {\n const sourceValues = Array.isArray(value) ? value : `${value}`.split(separator);\n for (const sourceValue of sourceValues) {\n const trimmedString = `${sourceValue}`.trim();\n if (trimmedString) {\n result.push(trimmedString);\n }\n }\n }\n return result;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\nexport { _isNumberValue, coerceArray, coerceBooleanProperty, coerceCssPixelValue, coerceElement, coerceNumberProperty, coerceStringArray };\n//# sourceMappingURL=coercion.js.map\n","/**\n * @license Angular v12.1.3\n * (c) 2010-2021 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport { InjectionToken, ɵɵdefineInjectable, Injectable, ɵɵinject, Inject, Optional, EventEmitter, ɵfindLocaleData, ɵLocaleDataIndex, ɵgetLocaleCurrencyCode, ɵgetLocalePluralCase, LOCALE_ID, ɵregisterLocaleData, ɵisListLikeIterable, ɵstringify, Directive, IterableDiffers, KeyValueDiffers, ElementRef, Renderer2, Input, NgModuleRef, ComponentFactoryResolver, ViewContainerRef, TemplateRef, Host, ɵRuntimeError, Attribute, ɵisPromise, ɵisSubscribable, Pipe, ChangeDetectorRef, DEFAULT_CURRENCY_CODE, NgModule, Version } from '@angular/core';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nimport * as ɵngcc0 from '@angular/core';\nlet _DOM = null;\nfunction getDOM() {\n return _DOM;\n}\nfunction setDOM(adapter) {\n _DOM = adapter;\n}\nfunction setRootDomAdapter(adapter) {\n if (!_DOM) {\n _DOM = adapter;\n }\n}\n/* tslint:disable:requireParameterType */\n/**\n * Provides DOM operations in an environment-agnostic way.\n *\n * @security Tread carefully! Interacting with the DOM directly is dangerous and\n * can introduce XSS risks.\n */\nclass DomAdapter {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A DI Token representing the main rendering context. In a browser this is the DOM Document.\n *\n * Note: Document might not be available in the Application Context when Application and Rendering\n * Contexts are not the same (e.g. when running the application in a Web Worker).\n *\n * @publicApi\n */\nconst DOCUMENT = new InjectionToken('DocumentToken');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n *\n * `PlatformLocation` encapsulates all calls to DOM APIs, which allows the Router to be\n * platform-agnostic.\n * This means that we can have different implementation of `PlatformLocation` for the different\n * platforms that Angular supports. For example, `@angular/platform-browser` provides an\n * implementation specific to the browser environment, while `@angular/platform-server` provides\n * one suitable for use with server-side rendering.\n *\n * The `PlatformLocation` class is used directly by all implementations of {@link LocationStrategy}\n * when they need to interact with the DOM APIs like pushState, popState, etc.\n *\n * {@link LocationStrategy} in turn is used by the {@link Location} service which is used directly\n * by the {@link Router} in order to navigate between routes. Since all interactions between {@link\n * Router} /\n * {@link Location} / {@link LocationStrategy} and DOM APIs flow through the `PlatformLocation`\n * class, they are all platform-agnostic.\n *\n * @publicApi\n */\nclass PlatformLocation {\n historyGo(relativePosition) {\n throw new Error('Not implemented');\n }\n}\nPlatformLocation.ɵfac = function PlatformLocation_Factory(t) { return new (t || PlatformLocation)(); };\nPlatformLocation.ɵprov = ɵɵdefineInjectable({ factory: useBrowserPlatformLocation, token: PlatformLocation, providedIn: \"platform\" });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(PlatformLocation, [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n // See #23917\n useFactory: useBrowserPlatformLocation\n }]\n }], null, null); })();\nfunction useBrowserPlatformLocation() {\n return ɵɵinject(BrowserPlatformLocation);\n}\n/**\n * @description\n * Indicates when a location is initialized.\n *\n * @publicApi\n */\nconst LOCATION_INITIALIZED = new InjectionToken('Location Initialized');\n/**\n * `PlatformLocation` encapsulates all of the direct calls to platform APIs.\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n */\nclass BrowserPlatformLocation extends PlatformLocation {\n constructor(_doc) {\n super();\n this._doc = _doc;\n this._init();\n }\n // This is moved to its own method so that `MockPlatformLocationStrategy` can overwrite it\n /** @internal */\n _init() {\n this.location = window.location;\n this._history = window.history;\n }\n getBaseHrefFromDOM() {\n return getDOM().getBaseHref(this._doc);\n }\n onPopState(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('popstate', fn, false);\n return () => window.removeEventListener('popstate', fn);\n }\n onHashChange(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('hashchange', fn, false);\n return () => window.removeEventListener('hashchange', fn);\n }\n get href() {\n return this.location.href;\n }\n get protocol() {\n return this.location.protocol;\n }\n get hostname() {\n return this.location.hostname;\n }\n get port() {\n return this.location.port;\n }\n get pathname() {\n return this.location.pathname;\n }\n get search() {\n return this.location.search;\n }\n get hash() {\n return this.location.hash;\n }\n set pathname(newPath) {\n this.location.pathname = newPath;\n }\n pushState(state, title, url) {\n if (supportsState()) {\n this._history.pushState(state, title, url);\n }\n else {\n this.location.hash = url;\n }\n }\n replaceState(state, title, url) {\n if (supportsState()) {\n this._history.replaceState(state, title, url);\n }\n else {\n this.location.hash = url;\n }\n }\n forward() {\n this._history.forward();\n }\n back() {\n this._history.back();\n }\n historyGo(relativePosition = 0) {\n this._history.go(relativePosition);\n }\n getState() {\n return this._history.state;\n }\n}\nBrowserPlatformLocation.ɵfac = function BrowserPlatformLocation_Factory(t) { return new (t || BrowserPlatformLocation)(ɵngcc0.ɵɵinject(DOCUMENT)); };\nBrowserPlatformLocation.ɵprov = ɵɵdefineInjectable({ factory: createBrowserPlatformLocation, token: BrowserPlatformLocation, providedIn: \"platform\" });\nBrowserPlatformLocation.ctorParameters = () => [\n { type: undefined, decorators: [{ type: Inject, args: [DOCUMENT,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(BrowserPlatformLocation, [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n // See #23917\n useFactory: createBrowserPlatformLocation\n }]\n }], function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, null); })();\nfunction supportsState() {\n return !!window.history.pushState;\n}\nfunction createBrowserPlatformLocation() {\n return new BrowserPlatformLocation(ɵɵinject(DOCUMENT));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nfunction joinWithSlash(start, end) {\n if (start.length == 0) {\n return end;\n }\n if (end.length == 0) {\n return start;\n }\n let slashes = 0;\n if (start.endsWith('/')) {\n slashes++;\n }\n if (end.startsWith('/')) {\n slashes++;\n }\n if (slashes == 2) {\n return start + end.substring(1);\n }\n if (slashes == 1) {\n return start + end;\n }\n return start + '/' + end;\n}\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nfunction stripTrailingSlash(url) {\n const match = url.match(/#|\\?|$/);\n const pathEndIdx = match && match.index || url.length;\n const droppedSlashIdx = pathEndIdx - (url[pathEndIdx - 1] === '/' ? 1 : 0);\n return url.slice(0, droppedSlashIdx) + url.slice(pathEndIdx);\n}\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nfunction normalizeQueryParams(params) {\n return params && params[0] !== '?' ? '?' + params : params;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Enables the `Location` service to read route state from the browser's URL.\n * Angular provides two strategies:\n * `HashLocationStrategy` and `PathLocationStrategy`.\n *\n * Applications should use the `Router` or `Location` services to\n * interact with application route state.\n *\n * For instance, `HashLocationStrategy` produces URLs like\n * http://example.com#/foo,\n * and `PathLocationStrategy` produces\n * http://example.com/foo as an equivalent URL.\n *\n * See these two classes for more.\n *\n * @publicApi\n */\nclass LocationStrategy {\n historyGo(relativePosition) {\n throw new Error('Not implemented');\n }\n}\nLocationStrategy.ɵfac = function LocationStrategy_Factory(t) { return new (t || LocationStrategy)(); };\nLocationStrategy.ɵprov = ɵɵdefineInjectable({ factory: provideLocationStrategy, token: LocationStrategy, providedIn: \"root\" });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(LocationStrategy, [{\n type: Injectable,\n args: [{ providedIn: 'root', useFactory: provideLocationStrategy }]\n }], null, null); })();\nfunction provideLocationStrategy(platformLocation) {\n // See #23917\n const location = ɵɵinject(DOCUMENT).location;\n return new PathLocationStrategy(ɵɵinject(PlatformLocation), location && location.origin || '');\n}\n/**\n * A predefined [DI token](guide/glossary#di-token) for the base href\n * to be used with the `PathLocationStrategy`.\n * The base href is the URL prefix that should be preserved when generating\n * and recognizing URLs.\n *\n * @usageNotes\n *\n * The following example shows how to use this token to configure the root app injector\n * with a base href value, so that the DI framework can supply the dependency anywhere in the app.\n *\n * ```typescript\n * import {Component, NgModule} from '@angular/core';\n * import {APP_BASE_HREF} from '@angular/common';\n *\n * @NgModule({\n * providers: [{provide: APP_BASE_HREF, useValue: '/my/app'}]\n * })\n * class AppModule {}\n * ```\n *\n * @publicApi\n */\nconst APP_BASE_HREF = new InjectionToken('appBaseHref');\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [path](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax) of the\n * browser's URL.\n *\n * If you're using `PathLocationStrategy`, you must provide a {@link APP_BASE_HREF}\n * or add a `` element to the document.\n *\n * For instance, if you provide an `APP_BASE_HREF` of `'/my/app/'` and call\n * `location.go('/foo')`, the browser's URL will become\n * `example.com/my/app/foo`. To ensure all relative URIs resolve correctly,\n * the `` and/or `APP_BASE_HREF` should end with a `/`.\n *\n * Similarly, if you add `` to the document and call\n * `location.go('/foo')`, the browser's URL will become\n * `example.com/my/app/foo`.\n *\n * Note that when using `PathLocationStrategy`, neither the query nor\n * the fragment in the `` will be preserved, as outlined\n * by the [RFC](https://tools.ietf.org/html/rfc3986#section-5.2.2).\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/location/ts/path_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass PathLocationStrategy extends LocationStrategy {\n constructor(_platformLocation, href) {\n super();\n this._platformLocation = _platformLocation;\n this._removeListenerFns = [];\n if (href == null) {\n href = this._platformLocation.getBaseHrefFromDOM();\n }\n if (href == null) {\n throw new Error(`No base href set. Please provide a value for the APP_BASE_HREF token or add a base element to the document.`);\n }\n this._baseHref = href;\n }\n ngOnDestroy() {\n while (this._removeListenerFns.length) {\n this._removeListenerFns.pop()();\n }\n }\n onPopState(fn) {\n this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));\n }\n getBaseHref() {\n return this._baseHref;\n }\n prepareExternalUrl(internal) {\n return joinWithSlash(this._baseHref, internal);\n }\n path(includeHash = false) {\n const pathname = this._platformLocation.pathname + normalizeQueryParams(this._platformLocation.search);\n const hash = this._platformLocation.hash;\n return hash && includeHash ? `${pathname}${hash}` : pathname;\n }\n pushState(state, title, url, queryParams) {\n const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));\n this._platformLocation.pushState(state, title, externalUrl);\n }\n replaceState(state, title, url, queryParams) {\n const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));\n this._platformLocation.replaceState(state, title, externalUrl);\n }\n forward() {\n this._platformLocation.forward();\n }\n back() {\n this._platformLocation.back();\n }\n historyGo(relativePosition = 0) {\n var _a, _b;\n (_b = (_a = this._platformLocation).historyGo) === null || _b === void 0 ? void 0 : _b.call(_a, relativePosition);\n }\n}\nPathLocationStrategy.ɵfac = function PathLocationStrategy_Factory(t) { return new (t || PathLocationStrategy)(ɵngcc0.ɵɵinject(PlatformLocation), ɵngcc0.ɵɵinject(APP_BASE_HREF, 8)); };\nPathLocationStrategy.ɵprov = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjectable({ token: PathLocationStrategy, factory: PathLocationStrategy.ɵfac });\nPathLocationStrategy.ctorParameters = () => [\n { type: PlatformLocation },\n { type: String, decorators: [{ type: Optional }, { type: Inject, args: [APP_BASE_HREF,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(PathLocationStrategy, [{\n type: Injectable\n }], function () { return [{ type: PlatformLocation }, { type: String, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [APP_BASE_HREF]\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [hash fragment](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax)\n * of the browser's URL.\n *\n * For instance, if you call `location.go('/foo')`, the browser's URL will become\n * `example.com#/foo`.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/location/ts/hash_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass HashLocationStrategy extends LocationStrategy {\n constructor(_platformLocation, _baseHref) {\n super();\n this._platformLocation = _platformLocation;\n this._baseHref = '';\n this._removeListenerFns = [];\n if (_baseHref != null) {\n this._baseHref = _baseHref;\n }\n }\n ngOnDestroy() {\n while (this._removeListenerFns.length) {\n this._removeListenerFns.pop()();\n }\n }\n onPopState(fn) {\n this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));\n }\n getBaseHref() {\n return this._baseHref;\n }\n path(includeHash = false) {\n // the hash value is always prefixed with a `#`\n // and if it is empty then it will stay empty\n let path = this._platformLocation.hash;\n if (path == null)\n path = '#';\n return path.length > 0 ? path.substring(1) : path;\n }\n prepareExternalUrl(internal) {\n const url = joinWithSlash(this._baseHref, internal);\n return url.length > 0 ? ('#' + url) : url;\n }\n pushState(state, title, path, queryParams) {\n let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));\n if (url.length == 0) {\n url = this._platformLocation.pathname;\n }\n this._platformLocation.pushState(state, title, url);\n }\n replaceState(state, title, path, queryParams) {\n let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));\n if (url.length == 0) {\n url = this._platformLocation.pathname;\n }\n this._platformLocation.replaceState(state, title, url);\n }\n forward() {\n this._platformLocation.forward();\n }\n back() {\n this._platformLocation.back();\n }\n historyGo(relativePosition = 0) {\n var _a, _b;\n (_b = (_a = this._platformLocation).historyGo) === null || _b === void 0 ? void 0 : _b.call(_a, relativePosition);\n }\n}\nHashLocationStrategy.ɵfac = function HashLocationStrategy_Factory(t) { return new (t || HashLocationStrategy)(ɵngcc0.ɵɵinject(PlatformLocation), ɵngcc0.ɵɵinject(APP_BASE_HREF, 8)); };\nHashLocationStrategy.ɵprov = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjectable({ token: HashLocationStrategy, factory: HashLocationStrategy.ɵfac });\nHashLocationStrategy.ctorParameters = () => [\n { type: PlatformLocation },\n { type: String, decorators: [{ type: Optional }, { type: Inject, args: [APP_BASE_HREF,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(HashLocationStrategy, [{\n type: Injectable\n }], function () { return [{ type: PlatformLocation }, { type: String, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [APP_BASE_HREF]\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @description\n *\n * A service that applications can use to interact with a browser's URL.\n *\n * Depending on the `LocationStrategy` used, `Location` persists\n * to the URL's path or the URL's hash segment.\n *\n * @usageNotes\n *\n * It's better to use the `Router.navigate()` service to trigger route changes. Use\n * `Location` only if you need to interact with or create normalized URLs outside of\n * routing.\n *\n * `Location` is responsible for normalizing the URL against the application's base href.\n * A normalized URL is absolute from the URL host, includes the application's base href, and has no\n * trailing slash:\n * - `/my/app/user/123` is normalized\n * - `my/app/user/123` **is not** normalized\n * - `/my/app/user/123/` **is not** normalized\n *\n * ### Example\n *\n * \n *\n * @publicApi\n */\nclass Location {\n constructor(platformStrategy, platformLocation) {\n /** @internal */\n this._subject = new EventEmitter();\n /** @internal */\n this._urlChangeListeners = [];\n this._platformStrategy = platformStrategy;\n const browserBaseHref = this._platformStrategy.getBaseHref();\n this._platformLocation = platformLocation;\n this._baseHref = stripTrailingSlash(_stripIndexHtml(browserBaseHref));\n this._platformStrategy.onPopState((ev) => {\n this._subject.emit({\n 'url': this.path(true),\n 'pop': true,\n 'state': ev.state,\n 'type': ev.type,\n });\n });\n }\n /**\n * Normalizes the URL path for this location.\n *\n * @param includeHash True to include an anchor fragment in the path.\n *\n * @returns The normalized URL path.\n */\n // TODO: vsavkin. Remove the boolean flag and always include hash once the deprecated router is\n // removed.\n path(includeHash = false) {\n return this.normalize(this._platformStrategy.path(includeHash));\n }\n /**\n * Reports the current state of the location history.\n * @returns The current value of the `history.state` object.\n */\n getState() {\n return this._platformLocation.getState();\n }\n /**\n * Normalizes the given path and compares to the current normalized path.\n *\n * @param path The given URL path.\n * @param query Query parameters.\n *\n * @returns True if the given URL path is equal to the current normalized path, false\n * otherwise.\n */\n isCurrentPathEqualTo(path, query = '') {\n return this.path() == this.normalize(path + normalizeQueryParams(query));\n }\n /**\n * Normalizes a URL path by stripping any trailing slashes.\n *\n * @param url String representing a URL.\n *\n * @returns The normalized URL string.\n */\n normalize(url) {\n return Location.stripTrailingSlash(_stripBaseHref(this._baseHref, _stripIndexHtml(url)));\n }\n /**\n * Normalizes an external URL path.\n * If the given URL doesn't begin with a leading slash (`'/'`), adds one\n * before normalizing. Adds a hash if `HashLocationStrategy` is\n * in use, or the `APP_BASE_HREF` if the `PathLocationStrategy` is in use.\n *\n * @param url String representing a URL.\n *\n * @returns A normalized platform-specific URL.\n */\n prepareExternalUrl(url) {\n if (url && url[0] !== '/') {\n url = '/' + url;\n }\n return this._platformStrategy.prepareExternalUrl(url);\n }\n // TODO: rename this method to pushState\n /**\n * Changes the browser's URL to a normalized version of a given URL, and pushes a\n * new item onto the platform's history.\n *\n * @param path URL path to normalize.\n * @param query Query parameters.\n * @param state Location history state.\n *\n */\n go(path, query = '', state = null) {\n this._platformStrategy.pushState(state, '', path, query);\n this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);\n }\n /**\n * Changes the browser's URL to a normalized version of the given URL, and replaces\n * the top item on the platform's history stack.\n *\n * @param path URL path to normalize.\n * @param query Query parameters.\n * @param state Location history state.\n */\n replaceState(path, query = '', state = null) {\n this._platformStrategy.replaceState(state, '', path, query);\n this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);\n }\n /**\n * Navigates forward in the platform's history.\n */\n forward() {\n this._platformStrategy.forward();\n }\n /**\n * Navigates back in the platform's history.\n */\n back() {\n this._platformStrategy.back();\n }\n /**\n * Navigate to a specific page from session history, identified by its relative position to the\n * current page.\n *\n * @param relativePosition Position of the target page in the history relative to the current\n * page.\n * A negative value moves backwards, a positive value moves forwards, e.g. `location.historyGo(2)`\n * moves forward two pages and `location.historyGo(-2)` moves back two pages. When we try to go\n * beyond what's stored in the history session, we stay in the current page. Same behaviour occurs\n * when `relativePosition` equals 0.\n * @see https://developer.mozilla.org/en-US/docs/Web/API/History_API#Moving_to_a_specific_point_in_history\n */\n historyGo(relativePosition = 0) {\n var _a, _b;\n (_b = (_a = this._platformStrategy).historyGo) === null || _b === void 0 ? void 0 : _b.call(_a, relativePosition);\n }\n /**\n * Registers a URL change listener. Use to catch updates performed by the Angular\n * framework that are not detectible through \"popstate\" or \"hashchange\" events.\n *\n * @param fn The change handler function, which take a URL and a location history state.\n */\n onUrlChange(fn) {\n this._urlChangeListeners.push(fn);\n if (!this._urlChangeSubscription) {\n this._urlChangeSubscription = this.subscribe(v => {\n this._notifyUrlChangeListeners(v.url, v.state);\n });\n }\n }\n /** @internal */\n _notifyUrlChangeListeners(url = '', state) {\n this._urlChangeListeners.forEach(fn => fn(url, state));\n }\n /**\n * Subscribes to the platform's `popState` events.\n *\n * Note: `Location.go()` does not trigger the `popState` event in the browser. Use\n * `Location.onUrlChange()` to subscribe to URL changes instead.\n *\n * @param value Event that is triggered when the state history changes.\n * @param exception The exception to throw.\n *\n * @see [onpopstate](https://developer.mozilla.org/en-US/docs/Web/API/WindowEventHandlers/onpopstate)\n *\n * @returns Subscribed events.\n */\n subscribe(onNext, onThrow, onReturn) {\n return this._subject.subscribe({ next: onNext, error: onThrow, complete: onReturn });\n }\n}\nLocation.ɵfac = function Location_Factory(t) { return new (t || Location)(ɵngcc0.ɵɵinject(LocationStrategy), ɵngcc0.ɵɵinject(PlatformLocation)); };\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nLocation.normalizeQueryParams = normalizeQueryParams;\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nLocation.joinWithSlash = joinWithSlash;\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nLocation.stripTrailingSlash = stripTrailingSlash;\nLocation.ɵprov = ɵɵdefineInjectable({ factory: createLocation, token: Location, providedIn: \"root\" });\nLocation.ctorParameters = () => [\n { type: LocationStrategy },\n { type: PlatformLocation }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(Location, [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n // See #23917\n useFactory: createLocation\n }]\n }], function () { return [{ type: LocationStrategy }, { type: PlatformLocation }]; }, null); })();\nfunction createLocation() {\n return new Location(ɵɵinject(LocationStrategy), ɵɵinject(PlatformLocation));\n}\nfunction _stripBaseHref(baseHref, url) {\n return baseHref && url.startsWith(baseHref) ? url.substring(baseHref.length) : url;\n}\nfunction _stripIndexHtml(url) {\n return url.replace(/\\/index.html$/, '');\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** @internal */\nconst CURRENCIES_EN = {\n 'ADP': [undefined, undefined, 0],\n 'AFN': [undefined, undefined, 0],\n 'ALL': [undefined, undefined, 0],\n 'AMD': [undefined, undefined, 2],\n 'AOA': [undefined, 'Kz'],\n 'ARS': [undefined, '$'],\n 'AUD': ['A$', '$'],\n 'BAM': [undefined, 'KM'],\n 'BBD': [undefined, '$'],\n 'BDT': [undefined, '৳'],\n 'BHD': [undefined, undefined, 3],\n 'BIF': [undefined, undefined, 0],\n 'BMD': [undefined, '$'],\n 'BND': [undefined, '$'],\n 'BOB': [undefined, 'Bs'],\n 'BRL': ['R$'],\n 'BSD': [undefined, '$'],\n 'BWP': [undefined, 'P'],\n 'BYN': [undefined, 'р.', 2],\n 'BYR': [undefined, undefined, 0],\n 'BZD': [undefined, '$'],\n 'CAD': ['CA$', '$', 2],\n 'CHF': [undefined, undefined, 2],\n 'CLF': [undefined, undefined, 4],\n 'CLP': [undefined, '$', 0],\n 'CNY': ['CN¥', '¥'],\n 'COP': [undefined, '$', 2],\n 'CRC': [undefined, '₡', 2],\n 'CUC': [undefined, '$'],\n 'CUP': [undefined, '$'],\n 'CZK': [undefined, 'Kč', 2],\n 'DJF': [undefined, undefined, 0],\n 'DKK': [undefined, 'kr', 2],\n 'DOP': [undefined, '$'],\n 'EGP': [undefined, 'E£'],\n 'ESP': [undefined, '₧', 0],\n 'EUR': ['€'],\n 'FJD': [undefined, '$'],\n 'FKP': [undefined, '£'],\n 'GBP': ['£'],\n 'GEL': [undefined, '₾'],\n 'GIP': [undefined, '£'],\n 'GNF': [undefined, 'FG', 0],\n 'GTQ': [undefined, 'Q'],\n 'GYD': [undefined, '$', 2],\n 'HKD': ['HK$', '$'],\n 'HNL': [undefined, 'L'],\n 'HRK': [undefined, 'kn'],\n 'HUF': [undefined, 'Ft', 2],\n 'IDR': [undefined, 'Rp', 2],\n 'ILS': ['₪'],\n 'INR': ['₹'],\n 'IQD': [undefined, undefined, 0],\n 'IRR': [undefined, undefined, 0],\n 'ISK': [undefined, 'kr', 0],\n 'ITL': [undefined, undefined, 0],\n 'JMD': [undefined, '$'],\n 'JOD': [undefined, undefined, 3],\n 'JPY': ['¥', undefined, 0],\n 'KHR': [undefined, '៛'],\n 'KMF': [undefined, 'CF', 0],\n 'KPW': [undefined, '₩', 0],\n 'KRW': ['₩', undefined, 0],\n 'KWD': [undefined, undefined, 3],\n 'KYD': [undefined, '$'],\n 'KZT': [undefined, '₸'],\n 'LAK': [undefined, '₭', 0],\n 'LBP': [undefined, 'L£', 0],\n 'LKR': [undefined, 'Rs'],\n 'LRD': [undefined, '$'],\n 'LTL': [undefined, 'Lt'],\n 'LUF': [undefined, undefined, 0],\n 'LVL': [undefined, 'Ls'],\n 'LYD': [undefined, undefined, 3],\n 'MGA': [undefined, 'Ar', 0],\n 'MGF': [undefined, undefined, 0],\n 'MMK': [undefined, 'K', 0],\n 'MNT': [undefined, '₮', 2],\n 'MRO': [undefined, undefined, 0],\n 'MUR': [undefined, 'Rs', 2],\n 'MXN': ['MX$', '$'],\n 'MYR': [undefined, 'RM'],\n 'NAD': [undefined, '$'],\n 'NGN': [undefined, '₦'],\n 'NIO': [undefined, 'C$'],\n 'NOK': [undefined, 'kr', 2],\n 'NPR': [undefined, 'Rs'],\n 'NZD': ['NZ$', '$'],\n 'OMR': [undefined, undefined, 3],\n 'PHP': [undefined, '₱'],\n 'PKR': [undefined, 'Rs', 2],\n 'PLN': [undefined, 'zł'],\n 'PYG': [undefined, '₲', 0],\n 'RON': [undefined, 'lei'],\n 'RSD': [undefined, undefined, 0],\n 'RUB': [undefined, '₽'],\n 'RUR': [undefined, 'р.'],\n 'RWF': [undefined, 'RF', 0],\n 'SBD': [undefined, '$'],\n 'SEK': [undefined, 'kr', 2],\n 'SGD': [undefined, '$'],\n 'SHP': [undefined, '£'],\n 'SLL': [undefined, undefined, 0],\n 'SOS': [undefined, undefined, 0],\n 'SRD': [undefined, '$'],\n 'SSP': [undefined, '£'],\n 'STD': [undefined, undefined, 0],\n 'STN': [undefined, 'Db'],\n 'SYP': [undefined, '£', 0],\n 'THB': [undefined, '฿'],\n 'TMM': [undefined, undefined, 0],\n 'TND': [undefined, undefined, 3],\n 'TOP': [undefined, 'T$'],\n 'TRL': [undefined, undefined, 0],\n 'TRY': [undefined, '₺'],\n 'TTD': [undefined, '$'],\n 'TWD': ['NT$', '$', 2],\n 'TZS': [undefined, undefined, 2],\n 'UAH': [undefined, '₴'],\n 'UGX': [undefined, undefined, 0],\n 'USD': ['$'],\n 'UYI': [undefined, undefined, 0],\n 'UYU': [undefined, '$'],\n 'UYW': [undefined, undefined, 4],\n 'UZS': [undefined, undefined, 2],\n 'VEF': [undefined, 'Bs', 2],\n 'VND': ['₫', undefined, 0],\n 'VUV': [undefined, undefined, 0],\n 'XAF': ['FCFA', undefined, 0],\n 'XCD': ['EC$', '$'],\n 'XOF': ['CFA', undefined, 0],\n 'XPF': ['CFPF', undefined, 0],\n 'XXX': ['¤'],\n 'YER': [undefined, undefined, 0],\n 'ZAR': [undefined, 'R'],\n 'ZMK': [undefined, undefined, 0],\n 'ZMW': [undefined, 'ZK'],\n 'ZWD': [undefined, undefined, 0]\n};\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Format styles that can be used to represent numbers.\n * @see `getLocaleNumberFormat()`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nvar NumberFormatStyle;\n(function (NumberFormatStyle) {\n NumberFormatStyle[NumberFormatStyle[\"Decimal\"] = 0] = \"Decimal\";\n NumberFormatStyle[NumberFormatStyle[\"Percent\"] = 1] = \"Percent\";\n NumberFormatStyle[NumberFormatStyle[\"Currency\"] = 2] = \"Currency\";\n NumberFormatStyle[NumberFormatStyle[\"Scientific\"] = 3] = \"Scientific\";\n})(NumberFormatStyle || (NumberFormatStyle = {}));\n/**\n * Plurality cases used for translating plurals to different languages.\n *\n * @see `NgPlural`\n * @see `NgPluralCase`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nvar Plural;\n(function (Plural) {\n Plural[Plural[\"Zero\"] = 0] = \"Zero\";\n Plural[Plural[\"One\"] = 1] = \"One\";\n Plural[Plural[\"Two\"] = 2] = \"Two\";\n Plural[Plural[\"Few\"] = 3] = \"Few\";\n Plural[Plural[\"Many\"] = 4] = \"Many\";\n Plural[Plural[\"Other\"] = 5] = \"Other\";\n})(Plural || (Plural = {}));\n/**\n * Context-dependant translation forms for strings.\n * Typically the standalone version is for the nominative form of the word,\n * and the format version is used for the genitive case.\n * @see [CLDR website](http://cldr.unicode.org/translation/date-time-1/date-time#TOC-Standalone-vs.-Format-Styles)\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nvar FormStyle;\n(function (FormStyle) {\n FormStyle[FormStyle[\"Format\"] = 0] = \"Format\";\n FormStyle[FormStyle[\"Standalone\"] = 1] = \"Standalone\";\n})(FormStyle || (FormStyle = {}));\n/**\n * String widths available for translations.\n * The specific character widths are locale-specific.\n * Examples are given for the word \"Sunday\" in English.\n *\n * @publicApi\n */\nvar TranslationWidth;\n(function (TranslationWidth) {\n /** 1 character for `en-US`. For example: 'S' */\n TranslationWidth[TranslationWidth[\"Narrow\"] = 0] = \"Narrow\";\n /** 3 characters for `en-US`. For example: 'Sun' */\n TranslationWidth[TranslationWidth[\"Abbreviated\"] = 1] = \"Abbreviated\";\n /** Full length for `en-US`. For example: \"Sunday\" */\n TranslationWidth[TranslationWidth[\"Wide\"] = 2] = \"Wide\";\n /** 2 characters for `en-US`, For example: \"Su\" */\n TranslationWidth[TranslationWidth[\"Short\"] = 3] = \"Short\";\n})(TranslationWidth || (TranslationWidth = {}));\n/**\n * String widths available for date-time formats.\n * The specific character widths are locale-specific.\n * Examples are given for `en-US`.\n *\n * @see `getLocaleDateFormat()`\n * @see `getLocaleTimeFormat()`\n * @see `getLocaleDateTimeFormat()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n * @publicApi\n */\nvar FormatWidth;\n(function (FormatWidth) {\n /**\n * For `en-US`, 'M/d/yy, h:mm a'`\n * (Example: `6/15/15, 9:03 AM`)\n */\n FormatWidth[FormatWidth[\"Short\"] = 0] = \"Short\";\n /**\n * For `en-US`, `'MMM d, y, h:mm:ss a'`\n * (Example: `Jun 15, 2015, 9:03:01 AM`)\n */\n FormatWidth[FormatWidth[\"Medium\"] = 1] = \"Medium\";\n /**\n * For `en-US`, `'MMMM d, y, h:mm:ss a z'`\n * (Example: `June 15, 2015 at 9:03:01 AM GMT+1`)\n */\n FormatWidth[FormatWidth[\"Long\"] = 2] = \"Long\";\n /**\n * For `en-US`, `'EEEE, MMMM d, y, h:mm:ss a zzzz'`\n * (Example: `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00`)\n */\n FormatWidth[FormatWidth[\"Full\"] = 3] = \"Full\";\n})(FormatWidth || (FormatWidth = {}));\n/**\n * Symbols that can be used to replace placeholders in number patterns.\n * Examples are based on `en-US` values.\n *\n * @see `getLocaleNumberSymbol()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nvar NumberSymbol;\n(function (NumberSymbol) {\n /**\n * Decimal separator.\n * For `en-US`, the dot character.\n * Example: 2,345`.`67\n */\n NumberSymbol[NumberSymbol[\"Decimal\"] = 0] = \"Decimal\";\n /**\n * Grouping separator, typically for thousands.\n * For `en-US`, the comma character.\n * Example: 2`,`345.67\n */\n NumberSymbol[NumberSymbol[\"Group\"] = 1] = \"Group\";\n /**\n * List-item separator.\n * Example: \"one, two, and three\"\n */\n NumberSymbol[NumberSymbol[\"List\"] = 2] = \"List\";\n /**\n * Sign for percentage (out of 100).\n * Example: 23.4%\n */\n NumberSymbol[NumberSymbol[\"PercentSign\"] = 3] = \"PercentSign\";\n /**\n * Sign for positive numbers.\n * Example: +23\n */\n NumberSymbol[NumberSymbol[\"PlusSign\"] = 4] = \"PlusSign\";\n /**\n * Sign for negative numbers.\n * Example: -23\n */\n NumberSymbol[NumberSymbol[\"MinusSign\"] = 5] = \"MinusSign\";\n /**\n * Computer notation for exponential value (n times a power of 10).\n * Example: 1.2E3\n */\n NumberSymbol[NumberSymbol[\"Exponential\"] = 6] = \"Exponential\";\n /**\n * Human-readable format of exponential.\n * Example: 1.2x103\n */\n NumberSymbol[NumberSymbol[\"SuperscriptingExponent\"] = 7] = \"SuperscriptingExponent\";\n /**\n * Sign for permille (out of 1000).\n * Example: 23.4‰\n */\n NumberSymbol[NumberSymbol[\"PerMille\"] = 8] = \"PerMille\";\n /**\n * Infinity, can be used with plus and minus.\n * Example: ∞, +∞, -∞\n */\n NumberSymbol[NumberSymbol[\"Infinity\"] = 9] = \"Infinity\";\n /**\n * Not a number.\n * Example: NaN\n */\n NumberSymbol[NumberSymbol[\"NaN\"] = 10] = \"NaN\";\n /**\n * Symbol used between time units.\n * Example: 10:52\n */\n NumberSymbol[NumberSymbol[\"TimeSeparator\"] = 11] = \"TimeSeparator\";\n /**\n * Decimal separator for currency values (fallback to `Decimal`).\n * Example: $2,345.67\n */\n NumberSymbol[NumberSymbol[\"CurrencyDecimal\"] = 12] = \"CurrencyDecimal\";\n /**\n * Group separator for currency values (fallback to `Group`).\n * Example: $2,345.67\n */\n NumberSymbol[NumberSymbol[\"CurrencyGroup\"] = 13] = \"CurrencyGroup\";\n})(NumberSymbol || (NumberSymbol = {}));\n/**\n * The value for each day of the week, based on the `en-US` locale\n *\n * @publicApi\n */\nvar WeekDay;\n(function (WeekDay) {\n WeekDay[WeekDay[\"Sunday\"] = 0] = \"Sunday\";\n WeekDay[WeekDay[\"Monday\"] = 1] = \"Monday\";\n WeekDay[WeekDay[\"Tuesday\"] = 2] = \"Tuesday\";\n WeekDay[WeekDay[\"Wednesday\"] = 3] = \"Wednesday\";\n WeekDay[WeekDay[\"Thursday\"] = 4] = \"Thursday\";\n WeekDay[WeekDay[\"Friday\"] = 5] = \"Friday\";\n WeekDay[WeekDay[\"Saturday\"] = 6] = \"Saturday\";\n})(WeekDay || (WeekDay = {}));\n/**\n * Retrieves the locale ID from the currently loaded locale.\n * The loaded locale could be, for example, a global one rather than a regional one.\n * @param locale A locale code, such as `fr-FR`.\n * @returns The locale code. For example, `fr`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleId(locale) {\n return ɵfindLocaleData(locale)[ɵLocaleDataIndex.LocaleId];\n}\n/**\n * Retrieves day period strings for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized period strings. For example, `[AM, PM]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const amPmData = [\n data[ɵLocaleDataIndex.DayPeriodsFormat], data[ɵLocaleDataIndex.DayPeriodsStandalone]\n ];\n const amPm = getLastDefinedValue(amPmData, formStyle);\n return getLastDefinedValue(amPm, width);\n}\n/**\n * Retrieves days of the week for the given locale, using the Gregorian calendar.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized name strings.\n * For example,`[Sunday, Monday, ... Saturday]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleDayNames(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const daysData = [data[ɵLocaleDataIndex.DaysFormat], data[ɵLocaleDataIndex.DaysStandalone]];\n const days = getLastDefinedValue(daysData, formStyle);\n return getLastDefinedValue(days, width);\n}\n/**\n * Retrieves months of the year for the given locale, using the Gregorian calendar.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized name strings.\n * For example, `[January, February, ...]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleMonthNames(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const monthsData = [data[ɵLocaleDataIndex.MonthsFormat], data[ɵLocaleDataIndex.MonthsStandalone]];\n const months = getLastDefinedValue(monthsData, formStyle);\n return getLastDefinedValue(months, width);\n}\n/**\n * Retrieves Gregorian-calendar eras for the given locale.\n * @param locale A locale code for the locale format rules to use.\n * @param width The required character width.\n\n * @returns An array of localized era strings.\n * For example, `[AD, BC]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleEraNames(locale, width) {\n const data = ɵfindLocaleData(locale);\n const erasData = data[ɵLocaleDataIndex.Eras];\n return getLastDefinedValue(erasData, width);\n}\n/**\n * Retrieves the first day of the week for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns A day index number, using the 0-based week-day index for `en-US`\n * (Sunday = 0, Monday = 1, ...).\n * For example, for `fr-FR`, returns 1 to indicate that the first day is Monday.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleFirstDayOfWeek(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.FirstDayOfWeek];\n}\n/**\n * Range of week days that are considered the week-end for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The range of day values, `[startDay, endDay]`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleWeekEndRange(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.WeekendRange];\n}\n/**\n * Retrieves a localized date-value formating string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formating string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleDateFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n return getLastDefinedValue(data[ɵLocaleDataIndex.DateFormat], width);\n}\n/**\n * Retrieves a localized time-value formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n\n * @publicApi\n */\nfunction getLocaleTimeFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n return getLastDefinedValue(data[ɵLocaleDataIndex.TimeFormat], width);\n}\n/**\n * Retrieves a localized date-time formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleDateTimeFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n const dateTimeFormatData = data[ɵLocaleDataIndex.DateTimeFormat];\n return getLastDefinedValue(dateTimeFormatData, width);\n}\n/**\n * Retrieves a localized number symbol that can be used to replace placeholders in number formats.\n * @param locale The locale code.\n * @param symbol The symbol to localize.\n * @returns The character for the localized symbol.\n * @see `NumberSymbol`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleNumberSymbol(locale, symbol) {\n const data = ɵfindLocaleData(locale);\n const res = data[ɵLocaleDataIndex.NumberSymbols][symbol];\n if (typeof res === 'undefined') {\n if (symbol === NumberSymbol.CurrencyDecimal) {\n return data[ɵLocaleDataIndex.NumberSymbols][NumberSymbol.Decimal];\n }\n else if (symbol === NumberSymbol.CurrencyGroup) {\n return data[ɵLocaleDataIndex.NumberSymbols][NumberSymbol.Group];\n }\n }\n return res;\n}\n/**\n * Retrieves a number format for a given locale.\n *\n * Numbers are formatted using patterns, like `#,###.00`. For example, the pattern `#,###.00`\n * when used to format the number 12345.678 could result in \"12'345,678\". That would happen if the\n * grouping separator for your language is an apostrophe, and the decimal separator is a comma.\n *\n * Important: The characters `.` `,` `0` `#` (and others below) are special placeholders\n * that stand for the decimal separator, and so on, and are NOT real characters.\n * You must NOT \"translate\" the placeholders. For example, don't change `.` to `,` even though in\n * your language the decimal point is written with a comma. The symbols should be replaced by the\n * local equivalents, using the appropriate `NumberSymbol` for your language.\n *\n * Here are the special characters used in number patterns:\n *\n * | Symbol | Meaning |\n * |--------|---------|\n * | . | Replaced automatically by the character used for the decimal point. |\n * | , | Replaced by the \"grouping\" (thousands) separator. |\n * | 0 | Replaced by a digit (or zero if there aren't enough digits). |\n * | # | Replaced by a digit (or nothing if there aren't enough). |\n * | ¤ | Replaced by a currency symbol, such as $ or USD. |\n * | % | Marks a percent format. The % symbol may change position, but must be retained. |\n * | E | Marks a scientific format. The E symbol may change position, but must be retained. |\n * | ' | Special characters used as literal characters are quoted with ASCII single quotes. |\n *\n * @param locale A locale code for the locale format rules to use.\n * @param type The type of numeric value to be formatted (such as `Decimal` or `Currency`.)\n * @returns The localized format string.\n * @see `NumberFormatStyle`\n * @see [CLDR website](http://cldr.unicode.org/translation/number-patterns)\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleNumberFormat(locale, type) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.NumberFormats][type];\n}\n/**\n * Retrieves the symbol used to represent the currency for the main country\n * corresponding to a given locale. For example, '$' for `en-US`.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The localized symbol character,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleCurrencySymbol(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencySymbol] || null;\n}\n/**\n * Retrieves the name of the currency for the main country corresponding\n * to a given locale. For example, 'US Dollar' for `en-US`.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency name,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleCurrencyName(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencyName] || null;\n}\n/**\n * Retrieves the default currency code for the given locale.\n *\n * The default is defined as the first currency which is still in use.\n *\n * @param locale The code of the locale whose currency code we want.\n * @returns The code of the default currency for the given locale.\n *\n * @publicApi\n */\nfunction getLocaleCurrencyCode(locale) {\n return ɵgetLocaleCurrencyCode(locale);\n}\n/**\n * Retrieves the currency values for a given locale.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency values.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n */\nfunction getLocaleCurrencies(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Currencies];\n}\n/**\n * @alias core/ɵgetLocalePluralCase\n * @publicApi\n */\nconst getLocalePluralCase = ɵgetLocalePluralCase;\nfunction checkFullData(data) {\n if (!data[ɵLocaleDataIndex.ExtraData]) {\n throw new Error(`Missing extra locale data for the locale \"${data[ɵLocaleDataIndex\n .LocaleId]}\". Use \"registerLocaleData\" to load new data. See the \"I18n guide\" on angular.io to know more.`);\n }\n}\n/**\n * Retrieves locale-specific rules used to determine which day period to use\n * when more than one period is defined for a locale.\n *\n * There is a rule for each defined day period. The\n * first rule is applied to the first day period and so on.\n * Fall back to AM/PM when no rules are available.\n *\n * A rule can specify a period as time range, or as a single time value.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n#i18n-pipes).\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The rules for the locale, a single time value or array of *from-time, to-time*,\n * or null if no periods are available.\n *\n * @see `getLocaleExtraDayPeriods()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleExtraDayPeriodRules(locale) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const rules = data[ɵLocaleDataIndex.ExtraData][2 /* ExtraDayPeriodsRules */] || [];\n return rules.map((rule) => {\n if (typeof rule === 'string') {\n return extractTime(rule);\n }\n return [extractTime(rule[0]), extractTime(rule[1])];\n });\n}\n/**\n * Retrieves locale-specific day periods, which indicate roughly how a day is broken up\n * in different languages.\n * For example, for `en-US`, periods are morning, noon, afternoon, evening, and midnight.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n#i18n-pipes).\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns The translated day-period strings.\n * @see `getLocaleExtraDayPeriodRules()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLocaleExtraDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const dayPeriodsData = [\n data[ɵLocaleDataIndex.ExtraData][0 /* ExtraDayPeriodFormats */],\n data[ɵLocaleDataIndex.ExtraData][1 /* ExtraDayPeriodStandalone */]\n ];\n const dayPeriods = getLastDefinedValue(dayPeriodsData, formStyle) || [];\n return getLastDefinedValue(dayPeriods, width) || [];\n}\n/**\n * Retrieves the writing direction of a specified locale\n * @param locale A locale code for the locale format rules to use.\n * @publicApi\n * @returns 'rtl' or 'ltr'\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n */\nfunction getLocaleDirection(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Directionality];\n}\n/**\n * Retrieves the first value that is defined in an array, going backwards from an index position.\n *\n * To avoid repeating the same data (as when the \"format\" and \"standalone\" forms are the same)\n * add the first value to the locale data arrays, and add other values only if they are different.\n *\n * @param data The data array to retrieve from.\n * @param index A 0-based index into the array to start from.\n * @returns The value immediately before the given index position.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getLastDefinedValue(data, index) {\n for (let i = index; i > -1; i--) {\n if (typeof data[i] !== 'undefined') {\n return data[i];\n }\n }\n throw new Error('Locale data API: locale data undefined');\n}\n/**\n * Extracts the hours and minutes from a string like \"15:45\"\n */\nfunction extractTime(time) {\n const [h, m] = time.split(':');\n return { hours: +h, minutes: +m };\n}\n/**\n * Retrieves the currency symbol for a given currency code.\n *\n * For example, for the default `en-US` locale, the code `USD` can\n * be represented by the narrow symbol `$` or the wide symbol `US$`.\n *\n * @param code The currency code.\n * @param format The format, `wide` or `narrow`.\n * @param locale A locale code for the locale format rules to use.\n *\n * @returns The symbol, or the currency code if no symbol is available.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getCurrencySymbol(code, format, locale = 'en') {\n const currency = getLocaleCurrencies(locale)[code] || CURRENCIES_EN[code] || [];\n const symbolNarrow = currency[1 /* SymbolNarrow */];\n if (format === 'narrow' && typeof symbolNarrow === 'string') {\n return symbolNarrow;\n }\n return currency[0 /* Symbol */] || code;\n}\n// Most currencies have cents, that's why the default is 2\nconst DEFAULT_NB_OF_CURRENCY_DIGITS = 2;\n/**\n * Reports the number of decimal digits for a given currency.\n * The value depends upon the presence of cents in that particular currency.\n *\n * @param code The currency code.\n * @returns The number of decimal digits, typically 0 or 2.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction getNumberOfCurrencyDigits(code) {\n let digits;\n const currency = CURRENCIES_EN[code];\n if (currency) {\n digits = currency[2 /* NbOfDigits */];\n }\n return typeof digits === 'number' ? digits : DEFAULT_NB_OF_CURRENCY_DIGITS;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ISO8601_DATE_REGEX = /^(\\d{4})-?(\\d\\d)-?(\\d\\d)(?:T(\\d\\d)(?::?(\\d\\d)(?::?(\\d\\d)(?:\\.(\\d+))?)?)?(Z|([+-])(\\d\\d):?(\\d\\d))?)?$/;\n// 1 2 3 4 5 6 7 8 9 10 11\nconst NAMED_FORMATS = {};\nconst DATE_FORMATS_SPLIT = /((?:[^BEGHLMOSWYZabcdhmswyz']+)|(?:'(?:[^']|'')*')|(?:G{1,5}|y{1,4}|Y{1,4}|M{1,5}|L{1,5}|w{1,2}|W{1}|d{1,2}|E{1,6}|c{1,6}|a{1,5}|b{1,5}|B{1,5}|h{1,2}|H{1,2}|m{1,2}|s{1,2}|S{1,3}|z{1,4}|Z{1,5}|O{1,4}))([\\s\\S]*)/;\nvar ZoneWidth;\n(function (ZoneWidth) {\n ZoneWidth[ZoneWidth[\"Short\"] = 0] = \"Short\";\n ZoneWidth[ZoneWidth[\"ShortGMT\"] = 1] = \"ShortGMT\";\n ZoneWidth[ZoneWidth[\"Long\"] = 2] = \"Long\";\n ZoneWidth[ZoneWidth[\"Extended\"] = 3] = \"Extended\";\n})(ZoneWidth || (ZoneWidth = {}));\nvar DateType;\n(function (DateType) {\n DateType[DateType[\"FullYear\"] = 0] = \"FullYear\";\n DateType[DateType[\"Month\"] = 1] = \"Month\";\n DateType[DateType[\"Date\"] = 2] = \"Date\";\n DateType[DateType[\"Hours\"] = 3] = \"Hours\";\n DateType[DateType[\"Minutes\"] = 4] = \"Minutes\";\n DateType[DateType[\"Seconds\"] = 5] = \"Seconds\";\n DateType[DateType[\"FractionalSeconds\"] = 6] = \"FractionalSeconds\";\n DateType[DateType[\"Day\"] = 7] = \"Day\";\n})(DateType || (DateType = {}));\nvar TranslationType;\n(function (TranslationType) {\n TranslationType[TranslationType[\"DayPeriods\"] = 0] = \"DayPeriods\";\n TranslationType[TranslationType[\"Days\"] = 1] = \"Days\";\n TranslationType[TranslationType[\"Months\"] = 2] = \"Months\";\n TranslationType[TranslationType[\"Eras\"] = 3] = \"Eras\";\n})(TranslationType || (TranslationType = {}));\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date according to locale rules.\n *\n * @param value The date to format, as a Date, or a number (milliseconds since UTC epoch)\n * or an [ISO date-time string](https://www.w3.org/TR/NOTE-datetime).\n * @param format The date-time components to include. See `DatePipe` for details.\n * @param locale A locale code for the locale format rules to use.\n * @param timezone The time zone. A time zone offset from GMT (such as `'+0430'`),\n * or a standard UTC/GMT or continental US time zone abbreviation.\n * If not specified, uses host system settings.\n *\n * @returns The formatted date string.\n *\n * @see `DatePipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction formatDate(value, format, locale, timezone) {\n let date = toDate(value);\n const namedFormat = getNamedFormat(locale, format);\n format = namedFormat || format;\n let parts = [];\n let match;\n while (format) {\n match = DATE_FORMATS_SPLIT.exec(format);\n if (match) {\n parts = parts.concat(match.slice(1));\n const part = parts.pop();\n if (!part) {\n break;\n }\n format = part;\n }\n else {\n parts.push(format);\n break;\n }\n }\n let dateTimezoneOffset = date.getTimezoneOffset();\n if (timezone) {\n dateTimezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n date = convertTimezoneToLocal(date, timezone, true);\n }\n let text = '';\n parts.forEach(value => {\n const dateFormatter = getDateFormatter(value);\n text += dateFormatter ?\n dateFormatter(date, locale, dateTimezoneOffset) :\n value === '\\'\\'' ? '\\'' : value.replace(/(^'|'$)/g, '').replace(/''/g, '\\'');\n });\n return text;\n}\n/**\n * Create a new Date object with the given date value, and the time set to midnight.\n *\n * We cannot use `new Date(year, month, date)` because it maps years between 0 and 99 to 1900-1999.\n * See: https://github.com/angular/angular/issues/40377\n *\n * Note that this function returns a Date object whose time is midnight in the current locale's\n * timezone. In the future we might want to change this to be midnight in UTC, but this would be a\n * considerable breaking change.\n */\nfunction createDate(year, month, date) {\n // The `newDate` is set to midnight (UTC) on January 1st 1970.\n // - In PST this will be December 31st 1969 at 4pm.\n // - In GMT this will be January 1st 1970 at 1am.\n // Note that they even have different years, dates and months!\n const newDate = new Date(0);\n // `setFullYear()` allows years like 0001 to be set correctly. This function does not\n // change the internal time of the date.\n // Consider calling `setFullYear(2019, 8, 20)` (September 20, 2019).\n // - In PST this will now be September 20, 2019 at 4pm\n // - In GMT this will now be September 20, 2019 at 1am\n newDate.setFullYear(year, month, date);\n // We want the final date to be at local midnight, so we reset the time.\n // - In PST this will now be September 20, 2019 at 12am\n // - In GMT this will now be September 20, 2019 at 12am\n newDate.setHours(0, 0, 0);\n return newDate;\n}\nfunction getNamedFormat(locale, format) {\n const localeId = getLocaleId(locale);\n NAMED_FORMATS[localeId] = NAMED_FORMATS[localeId] || {};\n if (NAMED_FORMATS[localeId][format]) {\n return NAMED_FORMATS[localeId][format];\n }\n let formatValue = '';\n switch (format) {\n case 'shortDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Short);\n break;\n case 'mediumDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Medium);\n break;\n case 'longDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Long);\n break;\n case 'fullDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Full);\n break;\n case 'shortTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Short);\n break;\n case 'mediumTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Medium);\n break;\n case 'longTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Long);\n break;\n case 'fullTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Full);\n break;\n case 'short':\n const shortTime = getNamedFormat(locale, 'shortTime');\n const shortDate = getNamedFormat(locale, 'shortDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Short), [shortTime, shortDate]);\n break;\n case 'medium':\n const mediumTime = getNamedFormat(locale, 'mediumTime');\n const mediumDate = getNamedFormat(locale, 'mediumDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Medium), [mediumTime, mediumDate]);\n break;\n case 'long':\n const longTime = getNamedFormat(locale, 'longTime');\n const longDate = getNamedFormat(locale, 'longDate');\n formatValue =\n formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Long), [longTime, longDate]);\n break;\n case 'full':\n const fullTime = getNamedFormat(locale, 'fullTime');\n const fullDate = getNamedFormat(locale, 'fullDate');\n formatValue =\n formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Full), [fullTime, fullDate]);\n break;\n }\n if (formatValue) {\n NAMED_FORMATS[localeId][format] = formatValue;\n }\n return formatValue;\n}\nfunction formatDateTime(str, opt_values) {\n if (opt_values) {\n str = str.replace(/\\{([^}]+)}/g, function (match, key) {\n return (opt_values != null && key in opt_values) ? opt_values[key] : match;\n });\n }\n return str;\n}\nfunction padNumber(num, digits, minusSign = '-', trim, negWrap) {\n let neg = '';\n if (num < 0 || (negWrap && num <= 0)) {\n if (negWrap) {\n num = -num + 1;\n }\n else {\n num = -num;\n neg = minusSign;\n }\n }\n let strNum = String(num);\n while (strNum.length < digits) {\n strNum = '0' + strNum;\n }\n if (trim) {\n strNum = strNum.substr(strNum.length - digits);\n }\n return neg + strNum;\n}\nfunction formatFractionalSeconds(milliseconds, digits) {\n const strMs = padNumber(milliseconds, 3);\n return strMs.substr(0, digits);\n}\n/**\n * Returns a date formatter that transforms a date into its locale digit representation\n */\nfunction dateGetter(name, size, offset = 0, trim = false, negWrap = false) {\n return function (date, locale) {\n let part = getDatePart(name, date);\n if (offset > 0 || part > -offset) {\n part += offset;\n }\n if (name === DateType.Hours) {\n if (part === 0 && offset === -12) {\n part = 12;\n }\n }\n else if (name === DateType.FractionalSeconds) {\n return formatFractionalSeconds(part, size);\n }\n const localeMinus = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n return padNumber(part, size, localeMinus, trim, negWrap);\n };\n}\nfunction getDatePart(part, date) {\n switch (part) {\n case DateType.FullYear:\n return date.getFullYear();\n case DateType.Month:\n return date.getMonth();\n case DateType.Date:\n return date.getDate();\n case DateType.Hours:\n return date.getHours();\n case DateType.Minutes:\n return date.getMinutes();\n case DateType.Seconds:\n return date.getSeconds();\n case DateType.FractionalSeconds:\n return date.getMilliseconds();\n case DateType.Day:\n return date.getDay();\n default:\n throw new Error(`Unknown DateType value \"${part}\".`);\n }\n}\n/**\n * Returns a date formatter that transforms a date into its locale string representation\n */\nfunction dateStrGetter(name, width, form = FormStyle.Format, extended = false) {\n return function (date, locale) {\n return getDateTranslation(date, locale, name, width, form, extended);\n };\n}\n/**\n * Returns the locale translation of a date for a given form, type and width\n */\nfunction getDateTranslation(date, locale, name, width, form, extended) {\n switch (name) {\n case TranslationType.Months:\n return getLocaleMonthNames(locale, form, width)[date.getMonth()];\n case TranslationType.Days:\n return getLocaleDayNames(locale, form, width)[date.getDay()];\n case TranslationType.DayPeriods:\n const currentHours = date.getHours();\n const currentMinutes = date.getMinutes();\n if (extended) {\n const rules = getLocaleExtraDayPeriodRules(locale);\n const dayPeriods = getLocaleExtraDayPeriods(locale, form, width);\n const index = rules.findIndex(rule => {\n if (Array.isArray(rule)) {\n // morning, afternoon, evening, night\n const [from, to] = rule;\n const afterFrom = currentHours >= from.hours && currentMinutes >= from.minutes;\n const beforeTo = (currentHours < to.hours ||\n (currentHours === to.hours && currentMinutes < to.minutes));\n // We must account for normal rules that span a period during the day (e.g. 6am-9am)\n // where `from` is less (earlier) than `to`. But also rules that span midnight (e.g.\n // 10pm - 5am) where `from` is greater (later!) than `to`.\n //\n // In the first case the current time must be BOTH after `from` AND before `to`\n // (e.g. 8am is after 6am AND before 10am).\n //\n // In the second case the current time must be EITHER after `from` OR before `to`\n // (e.g. 4am is before 5am but not after 10pm; and 11pm is not before 5am but it is\n // after 10pm).\n if (from.hours < to.hours) {\n if (afterFrom && beforeTo) {\n return true;\n }\n }\n else if (afterFrom || beforeTo) {\n return true;\n }\n }\n else { // noon or midnight\n if (rule.hours === currentHours && rule.minutes === currentMinutes) {\n return true;\n }\n }\n return false;\n });\n if (index !== -1) {\n return dayPeriods[index];\n }\n }\n // if no rules for the day periods, we use am/pm by default\n return getLocaleDayPeriods(locale, form, width)[currentHours < 12 ? 0 : 1];\n case TranslationType.Eras:\n return getLocaleEraNames(locale, width)[date.getFullYear() <= 0 ? 0 : 1];\n default:\n // This default case is not needed by TypeScript compiler, as the switch is exhaustive.\n // However Closure Compiler does not understand that and reports an error in typed mode.\n // The `throw new Error` below works around the problem, and the unexpected: never variable\n // makes sure tsc still checks this code is unreachable.\n const unexpected = name;\n throw new Error(`unexpected translation type ${unexpected}`);\n }\n}\n/**\n * Returns a date formatter that transforms a date and an offset into a timezone with ISO8601 or\n * GMT format depending on the width (eg: short = +0430, short:GMT = GMT+4, long = GMT+04:30,\n * extended = +04:30)\n */\nfunction timeZoneGetter(width) {\n return function (date, locale, offset) {\n const zone = -1 * offset;\n const minusSign = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n const hours = zone > 0 ? Math.floor(zone / 60) : Math.ceil(zone / 60);\n switch (width) {\n case ZoneWidth.Short:\n return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n case ZoneWidth.ShortGMT:\n return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 1, minusSign);\n case ZoneWidth.Long:\n return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n case ZoneWidth.Extended:\n if (offset === 0) {\n return 'Z';\n }\n else {\n return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n }\n default:\n throw new Error(`Unknown zone width \"${width}\"`);\n }\n };\n}\nconst JANUARY = 0;\nconst THURSDAY = 4;\nfunction getFirstThursdayOfYear(year) {\n const firstDayOfYear = createDate(year, JANUARY, 1).getDay();\n return createDate(year, 0, 1 + ((firstDayOfYear <= THURSDAY) ? THURSDAY : THURSDAY + 7) - firstDayOfYear);\n}\nfunction getThursdayThisWeek(datetime) {\n return createDate(datetime.getFullYear(), datetime.getMonth(), datetime.getDate() + (THURSDAY - datetime.getDay()));\n}\nfunction weekGetter(size, monthBased = false) {\n return function (date, locale) {\n let result;\n if (monthBased) {\n const nbDaysBefore1stDayOfMonth = new Date(date.getFullYear(), date.getMonth(), 1).getDay() - 1;\n const today = date.getDate();\n result = 1 + Math.floor((today + nbDaysBefore1stDayOfMonth) / 7);\n }\n else {\n const thisThurs = getThursdayThisWeek(date);\n // Some days of a year are part of next year according to ISO 8601.\n // Compute the firstThurs from the year of this week's Thursday\n const firstThurs = getFirstThursdayOfYear(thisThurs.getFullYear());\n const diff = thisThurs.getTime() - firstThurs.getTime();\n result = 1 + Math.round(diff / 6.048e8); // 6.048e8 ms per week\n }\n return padNumber(result, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n };\n}\n/**\n * Returns a date formatter that provides the week-numbering year for the input date.\n */\nfunction weekNumberingYearGetter(size, trim = false) {\n return function (date, locale) {\n const thisThurs = getThursdayThisWeek(date);\n const weekNumberingYear = thisThurs.getFullYear();\n return padNumber(weekNumberingYear, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign), trim);\n };\n}\nconst DATE_FORMATS = {};\n// Based on CLDR formats:\n// See complete list: http://www.unicode.org/reports/tr35/tr35-dates.html#Date_Field_Symbol_Table\n// See also explanations: http://cldr.unicode.org/translation/date-time\n// TODO(ocombe): support all missing cldr formats: U, Q, D, F, e, j, J, C, A, v, V, X, x\nfunction getDateFormatter(format) {\n if (DATE_FORMATS[format]) {\n return DATE_FORMATS[format];\n }\n let formatter;\n switch (format) {\n // Era name (AD/BC)\n case 'G':\n case 'GG':\n case 'GGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Abbreviated);\n break;\n case 'GGGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Wide);\n break;\n case 'GGGGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Narrow);\n break;\n // 1 digit representation of the year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'y':\n formatter = dateGetter(DateType.FullYear, 1, 0, false, true);\n break;\n // 2 digit representation of the year, padded (00-99). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yy':\n formatter = dateGetter(DateType.FullYear, 2, 0, true, true);\n break;\n // 3 digit representation of the year, padded (000-999). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yyy':\n formatter = dateGetter(DateType.FullYear, 3, 0, false, true);\n break;\n // 4 digit representation of the year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'yyyy':\n formatter = dateGetter(DateType.FullYear, 4, 0, false, true);\n break;\n // 1 digit representation of the week-numbering year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'Y':\n formatter = weekNumberingYearGetter(1);\n break;\n // 2 digit representation of the week-numbering year, padded (00-99). (e.g. AD 2001 => 01, AD\n // 2010 => 10)\n case 'YY':\n formatter = weekNumberingYearGetter(2, true);\n break;\n // 3 digit representation of the week-numbering year, padded (000-999). (e.g. AD 1 => 001, AD\n // 2010 => 2010)\n case 'YYY':\n formatter = weekNumberingYearGetter(3);\n break;\n // 4 digit representation of the week-numbering year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'YYYY':\n formatter = weekNumberingYearGetter(4);\n break;\n // Month of the year (1-12), numeric\n case 'M':\n case 'L':\n formatter = dateGetter(DateType.Month, 1, 1);\n break;\n case 'MM':\n case 'LL':\n formatter = dateGetter(DateType.Month, 2, 1);\n break;\n // Month of the year (January, ...), string, format\n case 'MMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated);\n break;\n case 'MMMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Wide);\n break;\n case 'MMMMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Narrow);\n break;\n // Month of the year (January, ...), string, standalone\n case 'LLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'LLLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'LLLLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n // Week of the year (1, ... 52)\n case 'w':\n formatter = weekGetter(1);\n break;\n case 'ww':\n formatter = weekGetter(2);\n break;\n // Week of the month (1, ...)\n case 'W':\n formatter = weekGetter(1, true);\n break;\n // Day of the month (1-31)\n case 'd':\n formatter = dateGetter(DateType.Date, 1);\n break;\n case 'dd':\n formatter = dateGetter(DateType.Date, 2);\n break;\n // Day of the Week StandAlone (1, 1, Mon, Monday, M, Mo)\n case 'c':\n case 'cc':\n formatter = dateGetter(DateType.Day, 1);\n break;\n case 'ccc':\n formatter =\n dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'cccc':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'ccccc':\n formatter =\n dateStrGetter(TranslationType.Days, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n case 'cccccc':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short, FormStyle.Standalone);\n break;\n // Day of the Week\n case 'E':\n case 'EE':\n case 'EEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated);\n break;\n case 'EEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide);\n break;\n case 'EEEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Narrow);\n break;\n case 'EEEEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short);\n break;\n // Generic period of the day (am-pm)\n case 'a':\n case 'aa':\n case 'aaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated);\n break;\n case 'aaaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide);\n break;\n case 'aaaaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow);\n break;\n // Extended period of the day (midnight, at night, ...), standalone\n case 'b':\n case 'bb':\n case 'bbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Standalone, true);\n break;\n case 'bbbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Standalone, true);\n break;\n case 'bbbbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Standalone, true);\n break;\n // Extended period of the day (midnight, night, ...), standalone\n case 'B':\n case 'BB':\n case 'BBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Format, true);\n break;\n case 'BBBB':\n formatter =\n dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Format, true);\n break;\n case 'BBBBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Format, true);\n break;\n // Hour in AM/PM, (1-12)\n case 'h':\n formatter = dateGetter(DateType.Hours, 1, -12);\n break;\n case 'hh':\n formatter = dateGetter(DateType.Hours, 2, -12);\n break;\n // Hour of the day (0-23)\n case 'H':\n formatter = dateGetter(DateType.Hours, 1);\n break;\n // Hour in day, padded (00-23)\n case 'HH':\n formatter = dateGetter(DateType.Hours, 2);\n break;\n // Minute of the hour (0-59)\n case 'm':\n formatter = dateGetter(DateType.Minutes, 1);\n break;\n case 'mm':\n formatter = dateGetter(DateType.Minutes, 2);\n break;\n // Second of the minute (0-59)\n case 's':\n formatter = dateGetter(DateType.Seconds, 1);\n break;\n case 'ss':\n formatter = dateGetter(DateType.Seconds, 2);\n break;\n // Fractional second\n case 'S':\n formatter = dateGetter(DateType.FractionalSeconds, 1);\n break;\n case 'SS':\n formatter = dateGetter(DateType.FractionalSeconds, 2);\n break;\n case 'SSS':\n formatter = dateGetter(DateType.FractionalSeconds, 3);\n break;\n // Timezone ISO8601 short format (-0430)\n case 'Z':\n case 'ZZ':\n case 'ZZZ':\n formatter = timeZoneGetter(ZoneWidth.Short);\n break;\n // Timezone ISO8601 extended format (-04:30)\n case 'ZZZZZ':\n formatter = timeZoneGetter(ZoneWidth.Extended);\n break;\n // Timezone GMT short format (GMT+4)\n case 'O':\n case 'OO':\n case 'OOO':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'z':\n case 'zz':\n case 'zzz':\n formatter = timeZoneGetter(ZoneWidth.ShortGMT);\n break;\n // Timezone GMT long format (GMT+0430)\n case 'OOOO':\n case 'ZZZZ':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'zzzz':\n formatter = timeZoneGetter(ZoneWidth.Long);\n break;\n default:\n return null;\n }\n DATE_FORMATS[format] = formatter;\n return formatter;\n}\nfunction timezoneToOffset(timezone, fallback) {\n // Support: IE 11 only, Edge 13-15+\n // IE/Edge do not \"understand\" colon (`:`) in timezone\n timezone = timezone.replace(/:/g, '');\n const requestedTimezoneOffset = Date.parse('Jan 01, 1970 00:00:00 ' + timezone) / 60000;\n return isNaN(requestedTimezoneOffset) ? fallback : requestedTimezoneOffset;\n}\nfunction addDateMinutes(date, minutes) {\n date = new Date(date.getTime());\n date.setMinutes(date.getMinutes() + minutes);\n return date;\n}\nfunction convertTimezoneToLocal(date, timezone, reverse) {\n const reverseValue = reverse ? -1 : 1;\n const dateTimezoneOffset = date.getTimezoneOffset();\n const timezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n return addDateMinutes(date, reverseValue * (timezoneOffset - dateTimezoneOffset));\n}\n/**\n * Converts a value to date.\n *\n * Supported input formats:\n * - `Date`\n * - number: timestamp\n * - string: numeric (e.g. \"1234\"), ISO and date strings in a format supported by\n * [Date.parse()](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/parse).\n * Note: ISO strings without time return a date without timeoffset.\n *\n * Throws if unable to convert to a date.\n */\nfunction toDate(value) {\n if (isDate(value)) {\n return value;\n }\n if (typeof value === 'number' && !isNaN(value)) {\n return new Date(value);\n }\n if (typeof value === 'string') {\n value = value.trim();\n if (/^(\\d{4}(-\\d{1,2}(-\\d{1,2})?)?)$/.test(value)) {\n /* For ISO Strings without time the day, month and year must be extracted from the ISO String\n before Date creation to avoid time offset and errors in the new Date.\n If we only replace '-' with ',' in the ISO String (\"2015,01,01\"), and try to create a new\n date, some browsers (e.g. IE 9) will throw an invalid Date error.\n If we leave the '-' (\"2015-01-01\") and try to create a new Date(\"2015-01-01\") the timeoffset\n is applied.\n Note: ISO months are 0 for January, 1 for February, ... */\n const [y, m = 1, d = 1] = value.split('-').map((val) => +val);\n return createDate(y, m - 1, d);\n }\n const parsedNb = parseFloat(value);\n // any string that only contains numbers, like \"1234\" but not like \"1234hello\"\n if (!isNaN(value - parsedNb)) {\n return new Date(parsedNb);\n }\n let match;\n if (match = value.match(ISO8601_DATE_REGEX)) {\n return isoStringToDate(match);\n }\n }\n const date = new Date(value);\n if (!isDate(date)) {\n throw new Error(`Unable to convert \"${value}\" into a date`);\n }\n return date;\n}\n/**\n * Converts a date in ISO8601 to a Date.\n * Used instead of `Date.parse` because of browser discrepancies.\n */\nfunction isoStringToDate(match) {\n const date = new Date(0);\n let tzHour = 0;\n let tzMin = 0;\n // match[8] means that the string contains \"Z\" (UTC) or a timezone like \"+01:00\" or \"+0100\"\n const dateSetter = match[8] ? date.setUTCFullYear : date.setFullYear;\n const timeSetter = match[8] ? date.setUTCHours : date.setHours;\n // if there is a timezone defined like \"+01:00\" or \"+0100\"\n if (match[9]) {\n tzHour = Number(match[9] + match[10]);\n tzMin = Number(match[9] + match[11]);\n }\n dateSetter.call(date, Number(match[1]), Number(match[2]) - 1, Number(match[3]));\n const h = Number(match[4] || 0) - tzHour;\n const m = Number(match[5] || 0) - tzMin;\n const s = Number(match[6] || 0);\n // The ECMAScript specification (https://www.ecma-international.org/ecma-262/5.1/#sec-15.9.1.11)\n // defines that `DateTime` milliseconds should always be rounded down, so that `999.9ms`\n // becomes `999ms`.\n const ms = Math.floor(parseFloat('0.' + (match[7] || 0)) * 1000);\n timeSetter.call(date, h, m, s, ms);\n return date;\n}\nfunction isDate(value) {\n return value instanceof Date && !isNaN(value.valueOf());\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst NUMBER_FORMAT_REGEXP = /^(\\d+)?\\.((\\d+)(-(\\d+))?)?$/;\nconst MAX_DIGITS = 22;\nconst DECIMAL_SEP = '.';\nconst ZERO_CHAR = '0';\nconst PATTERN_SEP = ';';\nconst GROUP_SEP = ',';\nconst DIGIT_CHAR = '#';\nconst CURRENCY_CHAR = '¤';\nconst PERCENT_CHAR = '%';\n/**\n * Transforms a number to a locale string based on a style and a format.\n */\nfunction formatNumberToLocaleString(value, pattern, locale, groupSymbol, decimalSymbol, digitsInfo, isPercent = false) {\n let formattedText = '';\n let isZero = false;\n if (!isFinite(value)) {\n formattedText = getLocaleNumberSymbol(locale, NumberSymbol.Infinity);\n }\n else {\n let parsedNumber = parseNumber(value);\n if (isPercent) {\n parsedNumber = toPercent(parsedNumber);\n }\n let minInt = pattern.minInt;\n let minFraction = pattern.minFrac;\n let maxFraction = pattern.maxFrac;\n if (digitsInfo) {\n const parts = digitsInfo.match(NUMBER_FORMAT_REGEXP);\n if (parts === null) {\n throw new Error(`${digitsInfo} is not a valid digit info`);\n }\n const minIntPart = parts[1];\n const minFractionPart = parts[3];\n const maxFractionPart = parts[5];\n if (minIntPart != null) {\n minInt = parseIntAutoRadix(minIntPart);\n }\n if (minFractionPart != null) {\n minFraction = parseIntAutoRadix(minFractionPart);\n }\n if (maxFractionPart != null) {\n maxFraction = parseIntAutoRadix(maxFractionPart);\n }\n else if (minFractionPart != null && minFraction > maxFraction) {\n maxFraction = minFraction;\n }\n }\n roundNumber(parsedNumber, minFraction, maxFraction);\n let digits = parsedNumber.digits;\n let integerLen = parsedNumber.integerLen;\n const exponent = parsedNumber.exponent;\n let decimals = [];\n isZero = digits.every(d => !d);\n // pad zeros for small numbers\n for (; integerLen < minInt; integerLen++) {\n digits.unshift(0);\n }\n // pad zeros for small numbers\n for (; integerLen < 0; integerLen++) {\n digits.unshift(0);\n }\n // extract decimals digits\n if (integerLen > 0) {\n decimals = digits.splice(integerLen, digits.length);\n }\n else {\n decimals = digits;\n digits = [0];\n }\n // format the integer digits with grouping separators\n const groups = [];\n if (digits.length >= pattern.lgSize) {\n groups.unshift(digits.splice(-pattern.lgSize, digits.length).join(''));\n }\n while (digits.length > pattern.gSize) {\n groups.unshift(digits.splice(-pattern.gSize, digits.length).join(''));\n }\n if (digits.length) {\n groups.unshift(digits.join(''));\n }\n formattedText = groups.join(getLocaleNumberSymbol(locale, groupSymbol));\n // append the decimal digits\n if (decimals.length) {\n formattedText += getLocaleNumberSymbol(locale, decimalSymbol) + decimals.join('');\n }\n if (exponent) {\n formattedText += getLocaleNumberSymbol(locale, NumberSymbol.Exponential) + '+' + exponent;\n }\n }\n if (value < 0 && !isZero) {\n formattedText = pattern.negPre + formattedText + pattern.negSuf;\n }\n else {\n formattedText = pattern.posPre + formattedText + pattern.posSuf;\n }\n return formattedText;\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as currency using locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param currency A string containing the currency symbol or its name,\n * such as \"$\" or \"Canadian Dollar\". Used in output string, but does not affect the operation\n * of the function.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217)\n * currency code, such as `USD` for the US dollar and `EUR` for the euro.\n * Used to determine the number of digits in the decimal part.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted currency value.\n *\n * @see `formatNumber()`\n * @see `DecimalPipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction formatCurrency(value, locale, currency, currencyCode, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Currency);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n pattern.minFrac = getNumberOfCurrencyDigits(currencyCode);\n pattern.maxFrac = pattern.minFrac;\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.CurrencyGroup, NumberSymbol.CurrencyDecimal, digitsInfo);\n return res\n .replace(CURRENCY_CHAR, currency)\n // if we have 2 time the currency character, the second one is ignored\n .replace(CURRENCY_CHAR, '')\n // If there is a spacing between currency character and the value and\n // the currency character is supressed by passing an empty string, the\n // spacing character would remain as part of the string. Then we\n // should remove it.\n .trim();\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as a percentage according to locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted percentage value.\n *\n * @see `formatNumber()`\n * @see `DecimalPipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n * @publicApi\n *\n */\nfunction formatPercent(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Percent);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo, true);\n return res.replace(new RegExp(PERCENT_CHAR, 'g'), getLocaleNumberSymbol(locale, NumberSymbol.PercentSign));\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as text, with group sizing, separator, and other\n * parameters based on the locale.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted text string.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)\n *\n * @publicApi\n */\nfunction formatNumber(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Decimal);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n return formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo);\n}\nfunction parseNumberFormat(format, minusSign = '-') {\n const p = {\n minInt: 1,\n minFrac: 0,\n maxFrac: 0,\n posPre: '',\n posSuf: '',\n negPre: '',\n negSuf: '',\n gSize: 0,\n lgSize: 0\n };\n const patternParts = format.split(PATTERN_SEP);\n const positive = patternParts[0];\n const negative = patternParts[1];\n const positiveParts = positive.indexOf(DECIMAL_SEP) !== -1 ?\n positive.split(DECIMAL_SEP) :\n [\n positive.substring(0, positive.lastIndexOf(ZERO_CHAR) + 1),\n positive.substring(positive.lastIndexOf(ZERO_CHAR) + 1)\n ], integer = positiveParts[0], fraction = positiveParts[1] || '';\n p.posPre = integer.substr(0, integer.indexOf(DIGIT_CHAR));\n for (let i = 0; i < fraction.length; i++) {\n const ch = fraction.charAt(i);\n if (ch === ZERO_CHAR) {\n p.minFrac = p.maxFrac = i + 1;\n }\n else if (ch === DIGIT_CHAR) {\n p.maxFrac = i + 1;\n }\n else {\n p.posSuf += ch;\n }\n }\n const groups = integer.split(GROUP_SEP);\n p.gSize = groups[1] ? groups[1].length : 0;\n p.lgSize = (groups[2] || groups[1]) ? (groups[2] || groups[1]).length : 0;\n if (negative) {\n const trunkLen = positive.length - p.posPre.length - p.posSuf.length, pos = negative.indexOf(DIGIT_CHAR);\n p.negPre = negative.substr(0, pos).replace(/'/g, '');\n p.negSuf = negative.substr(pos + trunkLen).replace(/'/g, '');\n }\n else {\n p.negPre = minusSign + p.posPre;\n p.negSuf = p.posSuf;\n }\n return p;\n}\n// Transforms a parsed number into a percentage by multiplying it by 100\nfunction toPercent(parsedNumber) {\n // if the number is 0, don't do anything\n if (parsedNumber.digits[0] === 0) {\n return parsedNumber;\n }\n // Getting the current number of decimals\n const fractionLen = parsedNumber.digits.length - parsedNumber.integerLen;\n if (parsedNumber.exponent) {\n parsedNumber.exponent += 2;\n }\n else {\n if (fractionLen === 0) {\n parsedNumber.digits.push(0, 0);\n }\n else if (fractionLen === 1) {\n parsedNumber.digits.push(0);\n }\n parsedNumber.integerLen += 2;\n }\n return parsedNumber;\n}\n/**\n * Parses a number.\n * Significant bits of this parse algorithm came from https://github.com/MikeMcl/big.js/\n */\nfunction parseNumber(num) {\n let numStr = Math.abs(num) + '';\n let exponent = 0, digits, integerLen;\n let i, j, zeros;\n // Decimal point?\n if ((integerLen = numStr.indexOf(DECIMAL_SEP)) > -1) {\n numStr = numStr.replace(DECIMAL_SEP, '');\n }\n // Exponential form?\n if ((i = numStr.search(/e/i)) > 0) {\n // Work out the exponent.\n if (integerLen < 0)\n integerLen = i;\n integerLen += +numStr.slice(i + 1);\n numStr = numStr.substring(0, i);\n }\n else if (integerLen < 0) {\n // There was no decimal point or exponent so it is an integer.\n integerLen = numStr.length;\n }\n // Count the number of leading zeros.\n for (i = 0; numStr.charAt(i) === ZERO_CHAR; i++) { /* empty */\n }\n if (i === (zeros = numStr.length)) {\n // The digits are all zero.\n digits = [0];\n integerLen = 1;\n }\n else {\n // Count the number of trailing zeros\n zeros--;\n while (numStr.charAt(zeros) === ZERO_CHAR)\n zeros--;\n // Trailing zeros are insignificant so ignore them\n integerLen -= i;\n digits = [];\n // Convert string to array of digits without leading/trailing zeros.\n for (j = 0; i <= zeros; i++, j++) {\n digits[j] = Number(numStr.charAt(i));\n }\n }\n // If the number overflows the maximum allowed digits then use an exponent.\n if (integerLen > MAX_DIGITS) {\n digits = digits.splice(0, MAX_DIGITS - 1);\n exponent = integerLen - 1;\n integerLen = 1;\n }\n return { digits, exponent, integerLen };\n}\n/**\n * Round the parsed number to the specified number of decimal places\n * This function changes the parsedNumber in-place\n */\nfunction roundNumber(parsedNumber, minFrac, maxFrac) {\n if (minFrac > maxFrac) {\n throw new Error(`The minimum number of digits after fraction (${minFrac}) is higher than the maximum (${maxFrac}).`);\n }\n let digits = parsedNumber.digits;\n let fractionLen = digits.length - parsedNumber.integerLen;\n const fractionSize = Math.min(Math.max(minFrac, fractionLen), maxFrac);\n // The index of the digit to where rounding is to occur\n let roundAt = fractionSize + parsedNumber.integerLen;\n let digit = digits[roundAt];\n if (roundAt > 0) {\n // Drop fractional digits beyond `roundAt`\n digits.splice(Math.max(parsedNumber.integerLen, roundAt));\n // Set non-fractional digits beyond `roundAt` to 0\n for (let j = roundAt; j < digits.length; j++) {\n digits[j] = 0;\n }\n }\n else {\n // We rounded to zero so reset the parsedNumber\n fractionLen = Math.max(0, fractionLen);\n parsedNumber.integerLen = 1;\n digits.length = Math.max(1, roundAt = fractionSize + 1);\n digits[0] = 0;\n for (let i = 1; i < roundAt; i++)\n digits[i] = 0;\n }\n if (digit >= 5) {\n if (roundAt - 1 < 0) {\n for (let k = 0; k > roundAt; k--) {\n digits.unshift(0);\n parsedNumber.integerLen++;\n }\n digits.unshift(1);\n parsedNumber.integerLen++;\n }\n else {\n digits[roundAt - 1]++;\n }\n }\n // Pad out with zeros to get the required fraction length\n for (; fractionLen < Math.max(0, fractionSize); fractionLen++)\n digits.push(0);\n let dropTrailingZeros = fractionSize !== 0;\n // Minimal length = nb of decimals required + current nb of integers\n // Any number besides that is optional and can be removed if it's a trailing 0\n const minLen = minFrac + parsedNumber.integerLen;\n // Do any carrying, e.g. a digit was rounded up to 10\n const carry = digits.reduceRight(function (carry, d, i, digits) {\n d = d + carry;\n digits[i] = d < 10 ? d : d - 10; // d % 10\n if (dropTrailingZeros) {\n // Do not keep meaningless fractional trailing zeros (e.g. 15.52000 --> 15.52)\n if (digits[i] === 0 && i >= minLen) {\n digits.pop();\n }\n else {\n dropTrailingZeros = false;\n }\n }\n return d >= 10 ? 1 : 0; // Math.floor(d / 10);\n }, 0);\n if (carry) {\n digits.unshift(carry);\n parsedNumber.integerLen++;\n }\n}\nfunction parseIntAutoRadix(text) {\n const result = parseInt(text);\n if (isNaN(result)) {\n throw new Error('Invalid integer literal when parsing ' + text);\n }\n return result;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nclass NgLocalization {\n}\n/**\n * Returns the plural category for a given value.\n * - \"=value\" when the case exists,\n * - the plural category otherwise\n */\nfunction getPluralCategory(value, cases, ngLocalization, locale) {\n let key = `=${value}`;\n if (cases.indexOf(key) > -1) {\n return key;\n }\n key = ngLocalization.getPluralCategory(value, locale);\n if (cases.indexOf(key) > -1) {\n return key;\n }\n if (cases.indexOf('other') > -1) {\n return 'other';\n }\n throw new Error(`No plural message found for value \"${value}\"`);\n}\n/**\n * Returns the plural case based on the locale\n *\n * @publicApi\n */\nclass NgLocaleLocalization extends NgLocalization {\n constructor(locale) {\n super();\n this.locale = locale;\n }\n getPluralCategory(value, locale) {\n const plural = getLocalePluralCase(locale || this.locale)(value);\n switch (plural) {\n case Plural.Zero:\n return 'zero';\n case Plural.One:\n return 'one';\n case Plural.Two:\n return 'two';\n case Plural.Few:\n return 'few';\n case Plural.Many:\n return 'many';\n default:\n return 'other';\n }\n }\n}\nNgLocaleLocalization.ɵfac = function NgLocaleLocalization_Factory(t) { return new (t || NgLocaleLocalization)(ɵngcc0.ɵɵinject(LOCALE_ID)); };\nNgLocaleLocalization.ɵprov = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjectable({ token: NgLocaleLocalization, factory: NgLocaleLocalization.ɵfac });\nNgLocaleLocalization.ctorParameters = () => [\n { type: String, decorators: [{ type: Inject, args: [LOCALE_ID,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgLocaleLocalization, [{\n type: Injectable\n }], function () { return [{ type: String, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Register global data to be used internally by Angular. See the\n * [\"I18n guide\"](guide/i18n#i18n-pipes) to know how to import additional locale data.\n *\n * The signature registerLocaleData(data: any, extraData?: any) is deprecated since v5.1\n *\n * @publicApi\n */\nfunction registerLocaleData(data, localeId, extraData) {\n return ɵregisterLocaleData(data, localeId, extraData);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction parseCookieValue(cookieStr, name) {\n name = encodeURIComponent(name);\n for (const cookie of cookieStr.split(';')) {\n const eqIndex = cookie.indexOf('=');\n const [cookieName, cookieValue] = eqIndex == -1 ? [cookie, ''] : [cookie.slice(0, eqIndex), cookie.slice(eqIndex + 1)];\n if (cookieName.trim() === name) {\n return decodeURIComponent(cookieValue);\n }\n }\n return null;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n * ...\n *\n * ...\n *\n * ...\n *\n * ...\n *\n * ...\n * ```\n *\n * @description\n *\n * Adds and removes CSS classes on an HTML element.\n *\n * The CSS classes are updated as follows, depending on the type of the expression evaluation:\n * - `string` - the CSS classes listed in the string (space delimited) are added,\n * - `Array` - the CSS classes declared as Array elements are added,\n * - `Object` - keys are CSS classes that get added when the expression given in the value\n * evaluates to a truthy value, otherwise they are removed.\n *\n * @publicApi\n */\nclass NgClass {\n constructor(_iterableDiffers, _keyValueDiffers, _ngEl, _renderer) {\n this._iterableDiffers = _iterableDiffers;\n this._keyValueDiffers = _keyValueDiffers;\n this._ngEl = _ngEl;\n this._renderer = _renderer;\n this._iterableDiffer = null;\n this._keyValueDiffer = null;\n this._initialClasses = [];\n this._rawClass = null;\n }\n set klass(value) {\n this._removeClasses(this._initialClasses);\n this._initialClasses = typeof value === 'string' ? value.split(/\\s+/) : [];\n this._applyClasses(this._initialClasses);\n this._applyClasses(this._rawClass);\n }\n set ngClass(value) {\n this._removeClasses(this._rawClass);\n this._applyClasses(this._initialClasses);\n this._iterableDiffer = null;\n this._keyValueDiffer = null;\n this._rawClass = typeof value === 'string' ? value.split(/\\s+/) : value;\n if (this._rawClass) {\n if (ɵisListLikeIterable(this._rawClass)) {\n this._iterableDiffer = this._iterableDiffers.find(this._rawClass).create();\n }\n else {\n this._keyValueDiffer = this._keyValueDiffers.find(this._rawClass).create();\n }\n }\n }\n ngDoCheck() {\n if (this._iterableDiffer) {\n const iterableChanges = this._iterableDiffer.diff(this._rawClass);\n if (iterableChanges) {\n this._applyIterableChanges(iterableChanges);\n }\n }\n else if (this._keyValueDiffer) {\n const keyValueChanges = this._keyValueDiffer.diff(this._rawClass);\n if (keyValueChanges) {\n this._applyKeyValueChanges(keyValueChanges);\n }\n }\n }\n _applyKeyValueChanges(changes) {\n changes.forEachAddedItem((record) => this._toggleClass(record.key, record.currentValue));\n changes.forEachChangedItem((record) => this._toggleClass(record.key, record.currentValue));\n changes.forEachRemovedItem((record) => {\n if (record.previousValue) {\n this._toggleClass(record.key, false);\n }\n });\n }\n _applyIterableChanges(changes) {\n changes.forEachAddedItem((record) => {\n if (typeof record.item === 'string') {\n this._toggleClass(record.item, true);\n }\n else {\n throw new Error(`NgClass can only toggle CSS classes expressed as strings, got ${ɵstringify(record.item)}`);\n }\n });\n changes.forEachRemovedItem((record) => this._toggleClass(record.item, false));\n }\n /**\n * Applies a collection of CSS classes to the DOM element.\n *\n * For argument of type Set and Array CSS class names contained in those collections are always\n * added.\n * For argument of type Map CSS class name in the map's key is toggled based on the value (added\n * for truthy and removed for falsy).\n */\n _applyClasses(rawClassVal) {\n if (rawClassVal) {\n if (Array.isArray(rawClassVal) || rawClassVal instanceof Set) {\n rawClassVal.forEach((klass) => this._toggleClass(klass, true));\n }\n else {\n Object.keys(rawClassVal).forEach(klass => this._toggleClass(klass, !!rawClassVal[klass]));\n }\n }\n }\n /**\n * Removes a collection of CSS classes from the DOM element. This is mostly useful for cleanup\n * purposes.\n */\n _removeClasses(rawClassVal) {\n if (rawClassVal) {\n if (Array.isArray(rawClassVal) || rawClassVal instanceof Set) {\n rawClassVal.forEach((klass) => this._toggleClass(klass, false));\n }\n else {\n Object.keys(rawClassVal).forEach(klass => this._toggleClass(klass, false));\n }\n }\n }\n _toggleClass(klass, enabled) {\n klass = klass.trim();\n if (klass) {\n klass.split(/\\s+/g).forEach(klass => {\n if (enabled) {\n this._renderer.addClass(this._ngEl.nativeElement, klass);\n }\n else {\n this._renderer.removeClass(this._ngEl.nativeElement, klass);\n }\n });\n }\n }\n}\nNgClass.ɵfac = function NgClass_Factory(t) { return new (t || NgClass)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.IterableDiffers), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.KeyValueDiffers), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.Renderer2)); };\nNgClass.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: NgClass, selectors: [[\"\", \"ngClass\", \"\"]], inputs: { klass: [\"class\", \"klass\"], ngClass: \"ngClass\" } });\nNgClass.ctorParameters = () => [\n { type: IterableDiffers },\n { type: KeyValueDiffers },\n { type: ElementRef },\n { type: Renderer2 }\n];\nNgClass.propDecorators = {\n klass: [{ type: Input, args: ['class',] }],\n ngClass: [{ type: Input, args: ['ngClass',] }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgClass, [{\n type: Directive,\n args: [{ selector: '[ngClass]' }]\n }], function () { return [{ type: ɵngcc0.IterableDiffers }, { type: ɵngcc0.KeyValueDiffers }, { type: ɵngcc0.ElementRef }, { type: ɵngcc0.Renderer2 }]; }, { klass: [{\n type: Input,\n args: ['class']\n }], ngClass: [{\n type: Input,\n args: ['ngClass']\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Instantiates a single {@link Component} type and inserts its Host View into current View.\n * `NgComponentOutlet` provides a declarative approach for dynamic component creation.\n *\n * `NgComponentOutlet` requires a component type, if a falsy value is set the view will clear and\n * any existing component will get destroyed.\n *\n * @usageNotes\n *\n * ### Fine tune control\n *\n * You can control the component creation process by using the following optional attributes:\n *\n * * `ngComponentOutletInjector`: Optional custom {@link Injector} that will be used as parent for\n * the Component. Defaults to the injector of the current view container.\n *\n * * `ngComponentOutletContent`: Optional list of projectable nodes to insert into the content\n * section of the component, if exists.\n *\n * * `ngComponentOutletNgModuleFactory`: Optional module factory to allow dynamically loading other\n * module, then load a component from that module.\n *\n * ### Syntax\n *\n * Simple\n * ```\n * \n * ```\n *\n * Customized injector/content\n * ```\n * \n * \n * ```\n *\n * Customized ngModuleFactory\n * ```\n * \n * \n * ```\n *\n * ### A simple example\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='SimpleExample'}\n *\n * A more complete example with additional options:\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='CompleteExample'}\n *\n * @publicApi\n * @ngModule CommonModule\n */\nclass NgComponentOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this._componentRef = null;\n this._moduleRef = null;\n }\n ngOnChanges(changes) {\n this._viewContainerRef.clear();\n this._componentRef = null;\n if (this.ngComponentOutlet) {\n const elInjector = this.ngComponentOutletInjector || this._viewContainerRef.parentInjector;\n if (changes['ngComponentOutletNgModuleFactory']) {\n if (this._moduleRef)\n this._moduleRef.destroy();\n if (this.ngComponentOutletNgModuleFactory) {\n const parentModule = elInjector.get(NgModuleRef);\n this._moduleRef = this.ngComponentOutletNgModuleFactory.create(parentModule.injector);\n }\n else {\n this._moduleRef = null;\n }\n }\n const componentFactoryResolver = this._moduleRef ? this._moduleRef.componentFactoryResolver :\n elInjector.get(ComponentFactoryResolver);\n const componentFactory = componentFactoryResolver.resolveComponentFactory(this.ngComponentOutlet);\n this._componentRef = this._viewContainerRef.createComponent(componentFactory, this._viewContainerRef.length, elInjector, this.ngComponentOutletContent);\n }\n }\n ngOnDestroy() {\n if (this._moduleRef)\n this._moduleRef.destroy();\n }\n}\nNgComponentOutlet.ɵfac = function NgComponentOutlet_Factory(t) { return new (t || NgComponentOutlet)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef)); };\nNgComponentOutlet.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: NgComponentOutlet, selectors: [[\"\", \"ngComponentOutlet\", \"\"]], inputs: { ngComponentOutlet: \"ngComponentOutlet\", ngComponentOutletInjector: \"ngComponentOutletInjector\", ngComponentOutletContent: \"ngComponentOutletContent\", ngComponentOutletNgModuleFactory: \"ngComponentOutletNgModuleFactory\" }, features: [ɵngcc0.ɵɵNgOnChangesFeature] });\nNgComponentOutlet.ctorParameters = () => [\n { type: ViewContainerRef }\n];\nNgComponentOutlet.propDecorators = {\n ngComponentOutlet: [{ type: Input }],\n ngComponentOutletInjector: [{ type: Input }],\n ngComponentOutletContent: [{ type: Input }],\n ngComponentOutletNgModuleFactory: [{ type: Input }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgComponentOutlet, [{\n type: Directive,\n args: [{ selector: '[ngComponentOutlet]' }]\n }], function () { return [{ type: ɵngcc0.ViewContainerRef }]; }, { ngComponentOutlet: [{\n type: Input\n }], ngComponentOutletInjector: [{\n type: Input\n }], ngComponentOutletContent: [{\n type: Input\n }], ngComponentOutletNgModuleFactory: [{\n type: Input\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nclass NgForOfContext {\n constructor($implicit, ngForOf, index, count) {\n this.$implicit = $implicit;\n this.ngForOf = ngForOf;\n this.index = index;\n this.count = count;\n }\n get first() {\n return this.index === 0;\n }\n get last() {\n return this.index === this.count - 1;\n }\n get even() {\n return this.index % 2 === 0;\n }\n get odd() {\n return !this.even;\n }\n}\n/**\n * A [structural directive](guide/structural-directives) that renders\n * a template for each item in a collection.\n * The directive is placed on an element, which becomes the parent\n * of the cloned templates.\n *\n * The `ngForOf` directive is generally used in the\n * [shorthand form](guide/structural-directives#asterisk) `*ngFor`.\n * In this form, the template to be rendered for each iteration is the content\n * of an anchor element containing the directive.\n *\n * The following example shows the shorthand syntax with some options,\n * contained in an `
` element.\n *\n * ```\n *
...
\n * ```\n *\n * The shorthand form expands into a long form that uses the `ngForOf` selector\n * on an `` element.\n * The content of the `` element is the `
` element that held the\n * short-form directive.\n *\n * Here is the expanded version of the short-form example.\n *\n * ```\n * \n *
...
\n * \n * ```\n *\n * Angular automatically expands the shorthand syntax as it compiles the template.\n * The context for each embedded view is logically merged to the current component\n * context according to its lexical position.\n *\n * When using the shorthand syntax, Angular allows only [one structural directive\n * on an element](guide/built-in-directives#one-per-element).\n * If you want to iterate conditionally, for example,\n * put the `*ngIf` on a container element that wraps the `*ngFor` element.\n * For futher discussion, see\n * [Structural Directives](guide/built-in-directives#one-per-element).\n *\n * @usageNotes\n *\n * ### Local variables\n *\n * `NgForOf` provides exported values that can be aliased to local variables.\n * For example:\n *\n * ```\n *
\n * {{i}}/{{users.length}}. {{user}} default\n *
\n * ```\n *\n * The following exported values can be aliased to local variables:\n *\n * - `$implicit: T`: The value of the individual items in the iterable (`ngForOf`).\n * - `ngForOf: NgIterable`: The value of the iterable expression. Useful when the expression is\n * more complex then a property access, for example when using the async pipe (`userStreams |\n * async`).\n * - `index: number`: The index of the current item in the iterable.\n * - `count: number`: The length of the iterable.\n * - `first: boolean`: True when the item is the first item in the iterable.\n * - `last: boolean`: True when the item is the last item in the iterable.\n * - `even: boolean`: True when the item has an even index in the iterable.\n * - `odd: boolean`: True when the item has an odd index in the iterable.\n *\n * ### Change propagation\n *\n * When the contents of the iterator changes, `NgForOf` makes the corresponding changes to the DOM:\n *\n * * When an item is added, a new instance of the template is added to the DOM.\n * * When an item is removed, its template instance is removed from the DOM.\n * * When items are reordered, their respective templates are reordered in the DOM.\n *\n * Angular uses object identity to track insertions and deletions within the iterator and reproduce\n * those changes in the DOM. This has important implications for animations and any stateful\n * controls that are present, such as `` elements that accept user input. Inserted rows can\n * be animated in, deleted rows can be animated out, and unchanged rows retain any unsaved state\n * such as user input.\n * For more on animations, see [Transitions and Triggers](guide/transition-and-triggers).\n *\n * The identities of elements in the iterator can change while the data does not.\n * This can happen, for example, if the iterator is produced from an RPC to the server, and that\n * RPC is re-run. Even if the data hasn't changed, the second response produces objects with\n * different identities, and Angular must tear down the entire DOM and rebuild it (as if all old\n * elements were deleted and all new elements inserted).\n *\n * To avoid this expensive operation, you can customize the default tracking algorithm.\n * by supplying the `trackBy` option to `NgForOf`.\n * `trackBy` takes a function that has two arguments: `index` and `item`.\n * If `trackBy` is given, Angular tracks changes by the return value of the function.\n *\n * @see [Structural Directives](guide/structural-directives)\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgForOf {\n constructor(_viewContainer, _template, _differs) {\n this._viewContainer = _viewContainer;\n this._template = _template;\n this._differs = _differs;\n this._ngForOf = null;\n this._ngForOfDirty = true;\n this._differ = null;\n }\n /**\n * The value of the iterable expression, which can be used as a\n * [template input variable](guide/structural-directives#shorthand).\n */\n set ngForOf(ngForOf) {\n this._ngForOf = ngForOf;\n this._ngForOfDirty = true;\n }\n /**\n * Specifies a custom `TrackByFunction` to compute the identity of items in an iterable.\n *\n * If a custom `TrackByFunction` is not provided, `NgForOf` will use the item's [object\n * identity](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/is)\n * as the key.\n *\n * `NgForOf` uses the computed key to associate items in an iterable with DOM elements\n * it produces for these items.\n *\n * A custom `TrackByFunction` is useful to provide good user experience in cases when items in an\n * iterable rendered using `NgForOf` have a natural identifier (for example, custom ID or a\n * primary key), and this iterable could be updated with new object instances that still\n * represent the same underlying entity (for example, when data is re-fetched from the server,\n * and the iterable is recreated and re-rendered, but most of the data is still the same).\n *\n * @see `TrackByFunction`\n */\n set ngForTrackBy(fn) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && fn != null && typeof fn !== 'function') {\n // TODO(vicb): use a log service once there is a public one available\n if (console && console.warn) {\n console.warn(`trackBy must be a function, but received ${JSON.stringify(fn)}. ` +\n `See https://angular.io/api/common/NgForOf#change-propagation for more information.`);\n }\n }\n this._trackByFn = fn;\n }\n get ngForTrackBy() {\n return this._trackByFn;\n }\n /**\n * A reference to the template that is stamped out for each item in the iterable.\n * @see [template reference variable](guide/template-reference-variables)\n */\n set ngForTemplate(value) {\n // TODO(TS2.1): make TemplateRef>> once we move to TS v2.1\n // The current type is too restrictive; a template that just uses index, for example,\n // should be acceptable.\n if (value) {\n this._template = value;\n }\n }\n /**\n * Applies the changes when needed.\n */\n ngDoCheck() {\n if (this._ngForOfDirty) {\n this._ngForOfDirty = false;\n // React on ngForOf changes only once all inputs have been initialized\n const value = this._ngForOf;\n if (!this._differ && value) {\n try {\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n catch (_a) {\n throw new Error(`Cannot find a differ supporting object '${value}' of type '${getTypeName(value)}'. NgFor only supports binding to Iterables such as Arrays.`);\n }\n }\n }\n if (this._differ) {\n const changes = this._differ.diff(this._ngForOf);\n if (changes)\n this._applyChanges(changes);\n }\n }\n _applyChanges(changes) {\n const insertTuples = [];\n changes.forEachOperation((item, adjustedPreviousIndex, currentIndex) => {\n if (item.previousIndex == null) {\n // NgForOf is never \"null\" or \"undefined\" here because the differ detected\n // that a new item needs to be inserted from the iterable. This implies that\n // there is an iterable value for \"_ngForOf\".\n const view = this._viewContainer.createEmbeddedView(this._template, new NgForOfContext(null, this._ngForOf, -1, -1), currentIndex === null ? undefined : currentIndex);\n const tuple = new RecordViewTuple(item, view);\n insertTuples.push(tuple);\n }\n else if (currentIndex == null) {\n this._viewContainer.remove(adjustedPreviousIndex === null ? undefined : adjustedPreviousIndex);\n }\n else if (adjustedPreviousIndex !== null) {\n const view = this._viewContainer.get(adjustedPreviousIndex);\n this._viewContainer.move(view, currentIndex);\n const tuple = new RecordViewTuple(item, view);\n insertTuples.push(tuple);\n }\n });\n for (let i = 0; i < insertTuples.length; i++) {\n this._perViewChange(insertTuples[i].view, insertTuples[i].record);\n }\n for (let i = 0, ilen = this._viewContainer.length; i < ilen; i++) {\n const viewRef = this._viewContainer.get(i);\n viewRef.context.index = i;\n viewRef.context.count = ilen;\n viewRef.context.ngForOf = this._ngForOf;\n }\n changes.forEachIdentityChange((record) => {\n const viewRef = this._viewContainer.get(record.currentIndex);\n viewRef.context.$implicit = record.item;\n });\n }\n _perViewChange(view, record) {\n view.context.$implicit = record.item;\n }\n /**\n * Asserts the correct type of the context for the template that `NgForOf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgForOf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n}\nNgForOf.ɵfac = function NgForOf_Factory(t) { return new (t || NgForOf)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.IterableDiffers)); };\nNgForOf.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: NgForOf, selectors: [[\"\", \"ngFor\", \"\", \"ngForOf\", \"\"]], inputs: { ngForOf: \"ngForOf\", ngForTrackBy: \"ngForTrackBy\", ngForTemplate: \"ngForTemplate\" } });\nNgForOf.ctorParameters = () => [\n { type: ViewContainerRef },\n { type: TemplateRef },\n { type: IterableDiffers }\n];\nNgForOf.propDecorators = {\n ngForOf: [{ type: Input }],\n ngForTrackBy: [{ type: Input }],\n ngForTemplate: [{ type: Input }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgForOf, [{\n type: Directive,\n args: [{ selector: '[ngFor][ngForOf]' }]\n }], function () { return [{ type: ɵngcc0.ViewContainerRef }, { type: ɵngcc0.TemplateRef }, { type: ɵngcc0.IterableDiffers }]; }, { ngForOf: [{\n type: Input\n }], ngForTrackBy: [{\n type: Input\n }], ngForTemplate: [{\n type: Input\n }] }); })();\nclass RecordViewTuple {\n constructor(record, view) {\n this.record = record;\n this.view = view;\n }\n}\nfunction getTypeName(type) {\n return type['name'] || typeof type;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A structural directive that conditionally includes a template based on the value of\n * an expression coerced to Boolean.\n * When the expression evaluates to true, Angular renders the template\n * provided in a `then` clause, and when false or null,\n * Angular renders the template provided in an optional `else` clause. The default\n * template for the `else` clause is blank.\n *\n * A [shorthand form](guide/structural-directives#asterisk) of the directive,\n * `*ngIf=\"condition\"`, is generally used, provided\n * as an attribute of the anchor element for the inserted template.\n * Angular expands this into a more explicit version, in which the anchor element\n * is contained in an `` element.\n *\n * Simple form with shorthand syntax:\n *\n * ```\n *
Content to render when condition is true.
\n * ```\n *\n * Simple form with expanded syntax:\n *\n * ```\n *
Content to render when condition is\n * true.
\n * ```\n *\n * Form with an \"else\" block:\n *\n * ```\n *
Content to render when condition is true.
\n * Content to render when condition is false.\n * ```\n *\n * Shorthand form with \"then\" and \"else\" blocks:\n *\n * ```\n * \n * Content to render when condition is true.\n * Content to render when condition is false.\n * ```\n *\n * Form with storing the value locally:\n *\n * ```\n *
{{value}}
\n * Content to render when value is null.\n * ```\n *\n * @usageNotes\n *\n * The `*ngIf` directive is most commonly used to conditionally show an inline template,\n * as seen in the following example.\n * The default `else` template is blank.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfSimple'}\n *\n * ### Showing an alternative template using `else`\n *\n * To display a template when `expression` evaluates to false, use an `else` template\n * binding as shown in the following example.\n * The `else` binding points to an `` element labeled `#elseBlock`.\n * The template can be defined anywhere in the component view, but is typically placed right after\n * `ngIf` for readability.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfElse'}\n *\n * ### Using an external `then` template\n *\n * In the previous example, the then-clause template is specified inline, as the content of the\n * tag that contains the `ngIf` directive. You can also specify a template that is defined\n * externally, by referencing a labeled `` element. When you do this, you can\n * change which template to use at runtime, as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfThenElse'}\n *\n * ### Storing a conditional result in a variable\n *\n * You might want to show a set of properties from the same object. If you are waiting\n * for asynchronous data, the object can be undefined.\n * In this case, you can use `ngIf` and store the result of the condition in a local\n * variable as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfAs'}\n *\n * This code uses only one `AsyncPipe`, so only one subscription is created.\n * The conditional statement stores the result of `userStream|async` in the local variable `user`.\n * You can then bind the local `user` repeatedly.\n *\n * The conditional displays the data only if `userStream` returns a value,\n * so you don't need to use the\n * safe-navigation-operator (`?.`)\n * to guard against null values when accessing properties.\n * You can display an alternative template while waiting for the data.\n *\n * ### Shorthand syntax\n *\n * The shorthand syntax `*ngIf` expands into two separate template specifications\n * for the \"then\" and \"else\" clauses. For example, consider the following shorthand statement,\n * that is meant to show a loading page while waiting for data to be loaded.\n *\n * ```\n *
\n * ...\n *
\n *\n * \n *
Loading...
\n * \n * ```\n *\n * You can see that the \"else\" clause references the ``\n * with the `#loading` label, and the template for the \"then\" clause\n * is provided as the content of the anchor element.\n *\n * However, when Angular expands the shorthand syntax, it creates\n * another `` tag, with `ngIf` and `ngIfElse` directives.\n * The anchor element containing the template for the \"then\" clause becomes\n * the content of this unlabeled `` tag.\n *\n * ```\n * \n *
\n * ...\n *
\n * \n *\n * \n *
Loading...
\n * \n * ```\n *\n * The presence of the implicit template object has implications for the nesting of\n * structural directives. For more on this subject, see\n * [Structural Directives](https://angular.io/guide/built-in-directives#one-per-element).\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgIf {\n constructor(_viewContainer, templateRef) {\n this._viewContainer = _viewContainer;\n this._context = new NgIfContext();\n this._thenTemplateRef = null;\n this._elseTemplateRef = null;\n this._thenViewRef = null;\n this._elseViewRef = null;\n this._thenTemplateRef = templateRef;\n }\n /**\n * The Boolean expression to evaluate as the condition for showing a template.\n */\n set ngIf(condition) {\n this._context.$implicit = this._context.ngIf = condition;\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to true.\n */\n set ngIfThen(templateRef) {\n assertTemplate('ngIfThen', templateRef);\n this._thenTemplateRef = templateRef;\n this._thenViewRef = null; // clear previous view if any.\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to false.\n */\n set ngIfElse(templateRef) {\n assertTemplate('ngIfElse', templateRef);\n this._elseTemplateRef = templateRef;\n this._elseViewRef = null; // clear previous view if any.\n this._updateView();\n }\n _updateView() {\n if (this._context.$implicit) {\n if (!this._thenViewRef) {\n this._viewContainer.clear();\n this._elseViewRef = null;\n if (this._thenTemplateRef) {\n this._thenViewRef =\n this._viewContainer.createEmbeddedView(this._thenTemplateRef, this._context);\n }\n }\n }\n else {\n if (!this._elseViewRef) {\n this._viewContainer.clear();\n this._thenViewRef = null;\n if (this._elseTemplateRef) {\n this._elseViewRef =\n this._viewContainer.createEmbeddedView(this._elseTemplateRef, this._context);\n }\n }\n }\n }\n /**\n * Asserts the correct type of the context for the template that `NgIf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgIf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n}\nNgIf.ɵfac = function NgIf_Factory(t) { return new (t || NgIf)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef)); };\nNgIf.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: NgIf, selectors: [[\"\", \"ngIf\", \"\"]], inputs: { ngIf: \"ngIf\", ngIfThen: \"ngIfThen\", ngIfElse: \"ngIfElse\" } });\nNgIf.ctorParameters = () => [\n { type: ViewContainerRef },\n { type: TemplateRef }\n];\nNgIf.propDecorators = {\n ngIf: [{ type: Input }],\n ngIfThen: [{ type: Input }],\n ngIfElse: [{ type: Input }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgIf, [{\n type: Directive,\n args: [{ selector: '[ngIf]' }]\n }], function () { return [{ type: ɵngcc0.ViewContainerRef }, { type: ɵngcc0.TemplateRef }]; }, { ngIf: [{\n type: Input\n }], ngIfThen: [{\n type: Input\n }], ngIfElse: [{\n type: Input\n }] }); })();\n/**\n * @publicApi\n */\nclass NgIfContext {\n constructor() {\n this.$implicit = null;\n this.ngIf = null;\n }\n}\nfunction assertTemplate(property, templateRef) {\n const isTemplateRefOrNull = !!(!templateRef || templateRef.createEmbeddedView);\n if (!isTemplateRefOrNull) {\n throw new Error(`${property} must be a TemplateRef, but received '${ɵstringify(templateRef)}'.`);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass SwitchView {\n constructor(_viewContainerRef, _templateRef) {\n this._viewContainerRef = _viewContainerRef;\n this._templateRef = _templateRef;\n this._created = false;\n }\n create() {\n this._created = true;\n this._viewContainerRef.createEmbeddedView(this._templateRef);\n }\n destroy() {\n this._created = false;\n this._viewContainerRef.clear();\n }\n enforceState(created) {\n if (created && !this._created) {\n this.create();\n }\n else if (!created && this._created) {\n this.destroy();\n }\n }\n}\n/**\n * @ngModule CommonModule\n *\n * @description\n * The `[ngSwitch]` directive on a container specifies an expression to match against.\n * The expressions to match are provided by `ngSwitchCase` directives on views within the container.\n * - Every view that matches is rendered.\n * - If there are no matches, a view with the `ngSwitchDefault` directive is rendered.\n * - Elements within the `[NgSwitch]` statement but outside of any `NgSwitchCase`\n * or `ngSwitchDefault` directive are preserved at the location.\n *\n * @usageNotes\n * Define a container element for the directive, and specify the switch expression\n * to match against as an attribute:\n *\n * ```\n * \n * ```\n *\n * Within the container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ...\n * ...\n * ...\n * \n * ```\n *\n * ### Usage Examples\n *\n * The following example shows how to use more than one case to display the same view:\n *\n * ```\n * \n * \n * ...\n * ...\n * ...\n * \n * ...\n * \n * ```\n *\n * The following example shows how cases can be nested:\n * ```\n * \n * ...\n * ...\n * ...\n * \n * \n * \n * \n * \n * ...\n * \n * ```\n *\n * @publicApi\n * @see `NgSwitchCase`\n * @see `NgSwitchDefault`\n * @see [Structural Directives](guide/structural-directives)\n *\n */\nclass NgSwitch {\n constructor() {\n this._defaultUsed = false;\n this._caseCount = 0;\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n set ngSwitch(newValue) {\n this._ngSwitch = newValue;\n if (this._caseCount === 0) {\n this._updateDefaultCases(true);\n }\n }\n /** @internal */\n _addCase() {\n return this._caseCount++;\n }\n /** @internal */\n _addDefault(view) {\n if (!this._defaultViews) {\n this._defaultViews = [];\n }\n this._defaultViews.push(view);\n }\n /** @internal */\n _matchCase(value) {\n const matched = value == this._ngSwitch;\n this._lastCasesMatched = this._lastCasesMatched || matched;\n this._lastCaseCheckIndex++;\n if (this._lastCaseCheckIndex === this._caseCount) {\n this._updateDefaultCases(!this._lastCasesMatched);\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n return matched;\n }\n _updateDefaultCases(useDefault) {\n if (this._defaultViews && useDefault !== this._defaultUsed) {\n this._defaultUsed = useDefault;\n for (let i = 0; i < this._defaultViews.length; i++) {\n const defaultView = this._defaultViews[i];\n defaultView.enforceState(useDefault);\n }\n }\n }\n}\nNgSwitch.ɵfac = function NgSwitch_Factory(t) { return new (t || NgSwitch)(); };\nNgSwitch.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: NgSwitch, selectors: [[\"\", \"ngSwitch\", \"\"]], inputs: { ngSwitch: \"ngSwitch\" } });\nNgSwitch.propDecorators = {\n ngSwitch: [{ type: Input }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgSwitch, [{\n type: Directive,\n args: [{ selector: '[ngSwitch]' }]\n }], function () { return []; }, { ngSwitch: [{\n type: Input\n }] }); })();\n/**\n * @ngModule CommonModule\n *\n * @description\n * Provides a switch case expression to match against an enclosing `ngSwitch` expression.\n * When the expressions match, the given `NgSwitchCase` template is rendered.\n * If multiple match expressions match the switch expression value, all of them are displayed.\n *\n * @usageNotes\n *\n * Within a switch container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ...\n * ...\n * ...\n * \n * ```\n *\n * Each switch-case statement contains an in-line HTML template or template reference\n * that defines the subtree to be selected if the value of the match expression\n * matches the value of the switch expression.\n *\n * Unlike JavaScript, which uses strict equality, Angular uses loose equality.\n * This means that the empty string, `\"\"` matches 0.\n *\n * @publicApi\n * @see `NgSwitch`\n * @see `NgSwitchDefault`\n *\n */\nclass NgSwitchCase {\n constructor(viewContainer, templateRef, ngSwitch) {\n this.ngSwitch = ngSwitch;\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchCase', 'NgSwitchCase');\n }\n ngSwitch._addCase();\n this._view = new SwitchView(viewContainer, templateRef);\n }\n /**\n * Performs case matching. For internal use only.\n */\n ngDoCheck() {\n this._view.enforceState(this.ngSwitch._matchCase(this.ngSwitchCase));\n }\n}\nNgSwitchCase.ɵfac = function NgSwitchCase_Factory(t) { return new (t || NgSwitchCase)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef), ɵngcc0.ɵɵdirectiveInject(NgSwitch, 9)); };\nNgSwitchCase.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: NgSwitchCase, selectors: [[\"\", \"ngSwitchCase\", \"\"]], inputs: { ngSwitchCase: \"ngSwitchCase\" } });\nNgSwitchCase.ctorParameters = () => [\n { type: ViewContainerRef },\n { type: TemplateRef },\n { type: NgSwitch, decorators: [{ type: Optional }, { type: Host }] }\n];\nNgSwitchCase.propDecorators = {\n ngSwitchCase: [{ type: Input }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgSwitchCase, [{\n type: Directive,\n args: [{ selector: '[ngSwitchCase]' }]\n }], function () { return [{ type: ɵngcc0.ViewContainerRef }, { type: ɵngcc0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }]; }, { ngSwitchCase: [{\n type: Input\n }] }); })();\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that is rendered when no `NgSwitchCase` expressions\n * match the `NgSwitch` expression.\n * This statement should be the final case in an `NgSwitch`.\n *\n * @publicApi\n * @see `NgSwitch`\n * @see `NgSwitchCase`\n *\n */\nclass NgSwitchDefault {\n constructor(viewContainer, templateRef, ngSwitch) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchDefault', 'NgSwitchDefault');\n }\n ngSwitch._addDefault(new SwitchView(viewContainer, templateRef));\n }\n}\nNgSwitchDefault.ɵfac = function NgSwitchDefault_Factory(t) { return new (t || NgSwitchDefault)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef), ɵngcc0.ɵɵdirectiveInject(NgSwitch, 9)); };\nNgSwitchDefault.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: NgSwitchDefault, selectors: [[\"\", \"ngSwitchDefault\", \"\"]] });\nNgSwitchDefault.ctorParameters = () => [\n { type: ViewContainerRef },\n { type: TemplateRef },\n { type: NgSwitch, decorators: [{ type: Optional }, { type: Host }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgSwitchDefault, [{\n type: Directive,\n args: [{ selector: '[ngSwitchDefault]' }]\n }], function () { return [{ type: ɵngcc0.ViewContainerRef }, { type: ɵngcc0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }]; }, null); })();\nfunction throwNgSwitchProviderNotFoundError(attrName, directiveName) {\n throw new ɵRuntimeError(\"305\" /* TEMPLATE_STRUCTURE_ERROR */, `An element with the \"${attrName}\" attribute ` +\n `(matching the \"${directiveName}\" directive) must be located inside an element with the \"ngSwitch\" attribute ` +\n `(matching \"NgSwitch\" directive)`);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n * \n * there is nothing\n * there is one\n * there are a few\n * \n * ```\n *\n * @description\n *\n * Adds / removes DOM sub-trees based on a numeric value. Tailored for pluralization.\n *\n * Displays DOM sub-trees that match the switch expression value, or failing that, DOM sub-trees\n * that match the switch expression's pluralization category.\n *\n * To use this directive you must provide a container element that sets the `[ngPlural]` attribute\n * to a switch expression. Inner elements with a `[ngPluralCase]` will display based on their\n * expression:\n * - if `[ngPluralCase]` is set to a value starting with `=`, it will only display if the value\n * matches the switch expression exactly,\n * - otherwise, the view will be treated as a \"category match\", and will only display if exact\n * value matches aren't found and the value maps to its category for the defined locale.\n *\n * See http://cldr.unicode.org/index/cldr-spec/plural-rules\n *\n * @publicApi\n */\nclass NgPlural {\n constructor(_localization) {\n this._localization = _localization;\n this._caseViews = {};\n }\n set ngPlural(value) {\n this._switchValue = value;\n this._updateView();\n }\n addCase(value, switchView) {\n this._caseViews[value] = switchView;\n }\n _updateView() {\n this._clearViews();\n const cases = Object.keys(this._caseViews);\n const key = getPluralCategory(this._switchValue, cases, this._localization);\n this._activateView(this._caseViews[key]);\n }\n _clearViews() {\n if (this._activeView)\n this._activeView.destroy();\n }\n _activateView(view) {\n if (view) {\n this._activeView = view;\n this._activeView.create();\n }\n }\n}\nNgPlural.ɵfac = function NgPlural_Factory(t) { return new (t || NgPlural)(ɵngcc0.ɵɵdirectiveInject(NgLocalization)); };\nNgPlural.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: NgPlural, selectors: [[\"\", \"ngPlural\", \"\"]], inputs: { ngPlural: \"ngPlural\" } });\nNgPlural.ctorParameters = () => [\n { type: NgLocalization }\n];\nNgPlural.propDecorators = {\n ngPlural: [{ type: Input }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgPlural, [{\n type: Directive,\n args: [{ selector: '[ngPlural]' }]\n }], function () { return [{ type: NgLocalization }]; }, { ngPlural: [{\n type: Input\n }] }); })();\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that will be added/removed from the parent {@link NgPlural} when the\n * given expression matches the plural expression according to CLDR rules.\n *\n * @usageNotes\n * ```\n * \n * ...\n * ...\n * \n *```\n *\n * See {@link NgPlural} for more details and example.\n *\n * @publicApi\n */\nclass NgPluralCase {\n constructor(value, template, viewContainer, ngPlural) {\n this.value = value;\n const isANumber = !isNaN(Number(value));\n ngPlural.addCase(isANumber ? `=${value}` : value, new SwitchView(viewContainer, template));\n }\n}\nNgPluralCase.ɵfac = function NgPluralCase_Factory(t) { return new (t || NgPluralCase)(ɵngcc0.ɵɵinjectAttribute('ngPluralCase'), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.TemplateRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef), ɵngcc0.ɵɵdirectiveInject(NgPlural, 1)); };\nNgPluralCase.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: NgPluralCase, selectors: [[\"\", \"ngPluralCase\", \"\"]] });\nNgPluralCase.ctorParameters = () => [\n { type: String, decorators: [{ type: Attribute, args: ['ngPluralCase',] }] },\n { type: TemplateRef },\n { type: ViewContainerRef },\n { type: NgPlural, decorators: [{ type: Host }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgPluralCase, [{\n type: Directive,\n args: [{ selector: '[ngPluralCase]' }]\n }], function () { return [{ type: String, decorators: [{\n type: Attribute,\n args: ['ngPluralCase']\n }] }, { type: ɵngcc0.TemplateRef }, { type: ɵngcc0.ViewContainerRef }, { type: NgPlural, decorators: [{\n type: Host\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n *\n * Set the font of the containing element to the result of an expression.\n *\n * ```\n * ...\n * ```\n *\n * Set the width of the containing element to a pixel value returned by an expression.\n *\n * ```\n * ...\n * ```\n *\n * Set a collection of style values using an expression that returns key-value pairs.\n *\n * ```\n * ...\n * ```\n *\n * @description\n *\n * An attribute directive that updates styles for the containing HTML element.\n * Sets one or more style properties, specified as colon-separated key-value pairs.\n * The key is a style name, with an optional `.` suffix\n * (such as 'top.px', 'font-style.em').\n * The value is an expression to be evaluated.\n * The resulting non-null value, expressed in the given unit,\n * is assigned to the given style property.\n * If the result of evaluation is null, the corresponding style is removed.\n *\n * @publicApi\n */\nclass NgStyle {\n constructor(_ngEl, _differs, _renderer) {\n this._ngEl = _ngEl;\n this._differs = _differs;\n this._renderer = _renderer;\n this._ngStyle = null;\n this._differ = null;\n }\n set ngStyle(values) {\n this._ngStyle = values;\n if (!this._differ && values) {\n this._differ = this._differs.find(values).create();\n }\n }\n ngDoCheck() {\n if (this._differ) {\n const changes = this._differ.diff(this._ngStyle);\n if (changes) {\n this._applyChanges(changes);\n }\n }\n }\n _setStyle(nameAndUnit, value) {\n const [name, unit] = nameAndUnit.split('.');\n value = value != null && unit ? `${value}${unit}` : value;\n if (value != null) {\n this._renderer.setStyle(this._ngEl.nativeElement, name, value);\n }\n else {\n this._renderer.removeStyle(this._ngEl.nativeElement, name);\n }\n }\n _applyChanges(changes) {\n changes.forEachRemovedItem((record) => this._setStyle(record.key, null));\n changes.forEachAddedItem((record) => this._setStyle(record.key, record.currentValue));\n changes.forEachChangedItem((record) => this._setStyle(record.key, record.currentValue));\n }\n}\nNgStyle.ɵfac = function NgStyle_Factory(t) { return new (t || NgStyle)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ElementRef), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.KeyValueDiffers), ɵngcc0.ɵɵdirectiveInject(ɵngcc0.Renderer2)); };\nNgStyle.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: NgStyle, selectors: [[\"\", \"ngStyle\", \"\"]], inputs: { ngStyle: \"ngStyle\" } });\nNgStyle.ctorParameters = () => [\n { type: ElementRef },\n { type: KeyValueDiffers },\n { type: Renderer2 }\n];\nNgStyle.propDecorators = {\n ngStyle: [{ type: Input, args: ['ngStyle',] }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgStyle, [{\n type: Directive,\n args: [{ selector: '[ngStyle]' }]\n }], function () { return [{ type: ɵngcc0.ElementRef }, { type: ɵngcc0.KeyValueDiffers }, { type: ɵngcc0.Renderer2 }]; }, { ngStyle: [{\n type: Input,\n args: ['ngStyle']\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Inserts an embedded view from a prepared `TemplateRef`.\n *\n * You can attach a context object to the `EmbeddedViewRef` by setting `[ngTemplateOutletContext]`.\n * `[ngTemplateOutletContext]` should be an object, the object's keys will be available for binding\n * by the local template `let` declarations.\n *\n * @usageNotes\n * ```\n * \n * ```\n *\n * Using the key `$implicit` in the context object will set its value as default.\n *\n * ### Example\n *\n * {@example common/ngTemplateOutlet/ts/module.ts region='NgTemplateOutlet'}\n *\n * @publicApi\n */\nclass NgTemplateOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this._viewRef = null;\n /**\n * A context object to attach to the {@link EmbeddedViewRef}. This should be an\n * object, the object's keys will be available for binding by the local template `let`\n * declarations.\n * Using the key `$implicit` in the context object will set its value as default.\n */\n this.ngTemplateOutletContext = null;\n /**\n * A string defining the template reference and optionally the context object for the template.\n */\n this.ngTemplateOutlet = null;\n }\n ngOnChanges(changes) {\n if (changes['ngTemplateOutlet']) {\n const viewContainerRef = this._viewContainerRef;\n if (this._viewRef) {\n viewContainerRef.remove(viewContainerRef.indexOf(this._viewRef));\n }\n this._viewRef = this.ngTemplateOutlet ?\n viewContainerRef.createEmbeddedView(this.ngTemplateOutlet, this.ngTemplateOutletContext) :\n null;\n }\n else if (this._viewRef && changes['ngTemplateOutletContext'] && this.ngTemplateOutletContext) {\n this._viewRef.context = this.ngTemplateOutletContext;\n }\n }\n}\nNgTemplateOutlet.ɵfac = function NgTemplateOutlet_Factory(t) { return new (t || NgTemplateOutlet)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ViewContainerRef)); };\nNgTemplateOutlet.ɵdir = /*@__PURE__*/ ɵngcc0.ɵɵdefineDirective({ type: NgTemplateOutlet, selectors: [[\"\", \"ngTemplateOutlet\", \"\"]], inputs: { ngTemplateOutletContext: \"ngTemplateOutletContext\", ngTemplateOutlet: \"ngTemplateOutlet\" }, features: [ɵngcc0.ɵɵNgOnChangesFeature] });\nNgTemplateOutlet.ctorParameters = () => [\n { type: ViewContainerRef }\n];\nNgTemplateOutlet.propDecorators = {\n ngTemplateOutletContext: [{ type: Input }],\n ngTemplateOutlet: [{ type: Input }]\n};\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NgTemplateOutlet, [{\n type: Directive,\n args: [{ selector: '[ngTemplateOutlet]' }]\n }], function () { return [{ type: ɵngcc0.ViewContainerRef }]; }, { ngTemplateOutletContext: [{\n type: Input\n }], ngTemplateOutlet: [{\n type: Input\n }] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A collection of Angular directives that are likely to be used in each and every Angular\n * application.\n */\nconst COMMON_DIRECTIVES = [\n NgClass,\n NgComponentOutlet,\n NgForOf,\n NgIf,\n NgTemplateOutlet,\n NgStyle,\n NgSwitch,\n NgSwitchCase,\n NgSwitchDefault,\n NgPlural,\n NgPluralCase,\n];\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction invalidPipeArgumentError(type, value) {\n return Error(`InvalidPipeArgument: '${value}' for pipe '${ɵstringify(type)}'`);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass SubscribableStrategy {\n createSubscription(async, updateLatestValue) {\n return async.subscribe({\n next: updateLatestValue,\n error: (e) => {\n throw e;\n }\n });\n }\n dispose(subscription) {\n subscription.unsubscribe();\n }\n onDestroy(subscription) {\n subscription.unsubscribe();\n }\n}\nclass PromiseStrategy {\n createSubscription(async, updateLatestValue) {\n return async.then(updateLatestValue, e => {\n throw e;\n });\n }\n dispose(subscription) { }\n onDestroy(subscription) { }\n}\nconst _promiseStrategy = new PromiseStrategy();\nconst _subscribableStrategy = new SubscribableStrategy();\n/**\n * @ngModule CommonModule\n * @description\n *\n * Unwraps a value from an asynchronous primitive.\n *\n * The `async` pipe subscribes to an `Observable` or `Promise` and returns the latest value it has\n * emitted. When a new value is emitted, the `async` pipe marks the component to be checked for\n * changes. When the component gets destroyed, the `async` pipe unsubscribes automatically to avoid\n * potential memory leaks.\n *\n * @usageNotes\n *\n * ### Examples\n *\n * This example binds a `Promise` to the view. Clicking the `Resolve` button resolves the\n * promise.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipePromise'}\n *\n * It's also possible to use `async` with Observables. The example below binds the `time` Observable\n * to the view. The Observable continuously updates the view with the current time.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipeObservable'}\n *\n * @publicApi\n */\nclass AsyncPipe {\n constructor(_ref) {\n this._ref = _ref;\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n this._strategy = null;\n }\n ngOnDestroy() {\n if (this._subscription) {\n this._dispose();\n }\n }\n transform(obj) {\n if (!this._obj) {\n if (obj) {\n this._subscribe(obj);\n }\n return this._latestValue;\n }\n if (obj !== this._obj) {\n this._dispose();\n return this.transform(obj);\n }\n return this._latestValue;\n }\n _subscribe(obj) {\n this._obj = obj;\n this._strategy = this._selectStrategy(obj);\n this._subscription = this._strategy.createSubscription(obj, (value) => this._updateLatestValue(obj, value));\n }\n _selectStrategy(obj) {\n if (ɵisPromise(obj)) {\n return _promiseStrategy;\n }\n if (ɵisSubscribable(obj)) {\n return _subscribableStrategy;\n }\n throw invalidPipeArgumentError(AsyncPipe, obj);\n }\n _dispose() {\n this._strategy.dispose(this._subscription);\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n }\n _updateLatestValue(async, value) {\n if (async === this._obj) {\n this._latestValue = value;\n this._ref.markForCheck();\n }\n }\n}\nAsyncPipe.ɵfac = function AsyncPipe_Factory(t) { return new (t || AsyncPipe)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.ChangeDetectorRef, 16)); };\nAsyncPipe.ɵpipe = /*@__PURE__*/ ɵngcc0.ɵɵdefinePipe({ name: \"async\", type: AsyncPipe, pure: false });\nAsyncPipe.ctorParameters = () => [\n { type: ChangeDetectorRef }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(AsyncPipe, [{\n type: Pipe,\n args: [{ name: 'async', pure: false }]\n }], function () { return [{ type: ɵngcc0.ChangeDetectorRef }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Transforms text to all lower case.\n *\n * @see `UpperCasePipe`\n * @see `TitleCasePipe`\n * @usageNotes\n *\n * The following example defines a view that allows the user to enter\n * text, and then uses the pipe to convert the input text to all lower case.\n *\n * \n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass LowerCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(LowerCasePipe, value);\n }\n return value.toLowerCase();\n }\n}\nLowerCasePipe.ɵfac = function LowerCasePipe_Factory(t) { return new (t || LowerCasePipe)(); };\nLowerCasePipe.ɵpipe = /*@__PURE__*/ ɵngcc0.ɵɵdefinePipe({ name: \"lowercase\", type: LowerCasePipe, pure: true });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(LowerCasePipe, [{\n type: Pipe,\n args: [{ name: 'lowercase' }]\n }], null, null); })();\n//\n// Regex below matches any Unicode word and compatible with ES5. In ES2018 the same result\n// can be achieved by using /\\p{L}\\S*/gu and also known as Unicode Property Escapes\n// (https://2ality.com/2017/07/regexp-unicode-property-escapes.html). Since there is no\n// transpilation of this functionality down to ES5 without external tool, the only solution is\n// to use already transpiled form. Example can be found here -\n// https://mothereff.in/regexpu#input=var+regex+%3D+/%5Cp%7BL%7D/u%3B&unicodePropertyEscape=1\n//\nconst unicodeWordMatch = /(?:[A-Za-z\\xAA\\xB5\\xBA\\xC0-\\xD6\\xD8-\\xF6\\xF8-\\u02C1\\u02C6-\\u02D1\\u02E0-\\u02E4\\u02EC\\u02EE\\u0370-\\u0374\\u0376\\u0377\\u037A-\\u037D\\u037F\\u0386\\u0388-\\u038A\\u038C\\u038E-\\u03A1\\u03A3-\\u03F5\\u03F7-\\u0481\\u048A-\\u052F\\u0531-\\u0556\\u0559\\u0561-\\u0587\\u05D0-\\u05EA\\u05F0-\\u05F2\\u0620-\\u064A\\u066E\\u066F\\u0671-\\u06D3\\u06D5\\u06E5\\u06E6\\u06EE\\u06EF\\u06FA-\\u06FC\\u06FF\\u0710\\u0712-\\u072F\\u074D-\\u07A5\\u07B1\\u07CA-\\u07EA\\u07F4\\u07F5\\u07FA\\u0800-\\u0815\\u081A\\u0824\\u0828\\u0840-\\u0858\\u0860-\\u086A\\u08A0-\\u08B4\\u08B6-\\u08BD\\u0904-\\u0939\\u093D\\u0950\\u0958-\\u0961\\u0971-\\u0980\\u0985-\\u098C\\u098F\\u0990\\u0993-\\u09A8\\u09AA-\\u09B0\\u09B2\\u09B6-\\u09B9\\u09BD\\u09CE\\u09DC\\u09DD\\u09DF-\\u09E1\\u09F0\\u09F1\\u09FC\\u0A05-\\u0A0A\\u0A0F\\u0A10\\u0A13-\\u0A28\\u0A2A-\\u0A30\\u0A32\\u0A33\\u0A35\\u0A36\\u0A38\\u0A39\\u0A59-\\u0A5C\\u0A5E\\u0A72-\\u0A74\\u0A85-\\u0A8D\\u0A8F-\\u0A91\\u0A93-\\u0AA8\\u0AAA-\\u0AB0\\u0AB2\\u0AB3\\u0AB5-\\u0AB9\\u0ABD\\u0AD0\\u0AE0\\u0AE1\\u0AF9\\u0B05-\\u0B0C\\u0B0F\\u0B10\\u0B13-\\u0B28\\u0B2A-\\u0B30\\u0B32\\u0B33\\u0B35-\\u0B39\\u0B3D\\u0B5C\\u0B5D\\u0B5F-\\u0B61\\u0B71\\u0B83\\u0B85-\\u0B8A\\u0B8E-\\u0B90\\u0B92-\\u0B95\\u0B99\\u0B9A\\u0B9C\\u0B9E\\u0B9F\\u0BA3\\u0BA4\\u0BA8-\\u0BAA\\u0BAE-\\u0BB9\\u0BD0\\u0C05-\\u0C0C\\u0C0E-\\u0C10\\u0C12-\\u0C28\\u0C2A-\\u0C39\\u0C3D\\u0C58-\\u0C5A\\u0C60\\u0C61\\u0C80\\u0C85-\\u0C8C\\u0C8E-\\u0C90\\u0C92-\\u0CA8\\u0CAA-\\u0CB3\\u0CB5-\\u0CB9\\u0CBD\\u0CDE\\u0CE0\\u0CE1\\u0CF1\\u0CF2\\u0D05-\\u0D0C\\u0D0E-\\u0D10\\u0D12-\\u0D3A\\u0D3D\\u0D4E\\u0D54-\\u0D56\\u0D5F-\\u0D61\\u0D7A-\\u0D7F\\u0D85-\\u0D96\\u0D9A-\\u0DB1\\u0DB3-\\u0DBB\\u0DBD\\u0DC0-\\u0DC6\\u0E01-\\u0E30\\u0E32\\u0E33\\u0E40-\\u0E46\\u0E81\\u0E82\\u0E84\\u0E87\\u0E88\\u0E8A\\u0E8D\\u0E94-\\u0E97\\u0E99-\\u0E9F\\u0EA1-\\u0EA3\\u0EA5\\u0EA7\\u0EAA\\u0EAB\\u0EAD-\\u0EB0\\u0EB2\\u0EB3\\u0EBD\\u0EC0-\\u0EC4\\u0EC6\\u0EDC-\\u0EDF\\u0F00\\u0F40-\\u0F47\\u0F49-\\u0F6C\\u0F88-\\u0F8C\\u1000-\\u102A\\u103F\\u1050-\\u1055\\u105A-\\u105D\\u1061\\u1065\\u1066\\u106E-\\u1070\\u1075-\\u1081\\u108E\\u10A0-\\u10C5\\u10C7\\u10CD\\u10D0-\\u10FA\\u10FC-\\u1248\\u124A-\\u124D\\u1250-\\u1256\\u1258\\u125A-\\u125D\\u1260-\\u1288\\u128A-\\u128D\\u1290-\\u12B0\\u12B2-\\u12B5\\u12B8-\\u12BE\\u12C0\\u12C2-\\u12C5\\u12C8-\\u12D6\\u12D8-\\u1310\\u1312-\\u1315\\u1318-\\u135A\\u1380-\\u138F\\u13A0-\\u13F5\\u13F8-\\u13FD\\u1401-\\u166C\\u166F-\\u167F\\u1681-\\u169A\\u16A0-\\u16EA\\u16F1-\\u16F8\\u1700-\\u170C\\u170E-\\u1711\\u1720-\\u1731\\u1740-\\u1751\\u1760-\\u176C\\u176E-\\u1770\\u1780-\\u17B3\\u17D7\\u17DC\\u1820-\\u1877\\u1880-\\u1884\\u1887-\\u18A8\\u18AA\\u18B0-\\u18F5\\u1900-\\u191E\\u1950-\\u196D\\u1970-\\u1974\\u1980-\\u19AB\\u19B0-\\u19C9\\u1A00-\\u1A16\\u1A20-\\u1A54\\u1AA7\\u1B05-\\u1B33\\u1B45-\\u1B4B\\u1B83-\\u1BA0\\u1BAE\\u1BAF\\u1BBA-\\u1BE5\\u1C00-\\u1C23\\u1C4D-\\u1C4F\\u1C5A-\\u1C7D\\u1C80-\\u1C88\\u1CE9-\\u1CEC\\u1CEE-\\u1CF1\\u1CF5\\u1CF6\\u1D00-\\u1DBF\\u1E00-\\u1F15\\u1F18-\\u1F1D\\u1F20-\\u1F45\\u1F48-\\u1F4D\\u1F50-\\u1F57\\u1F59\\u1F5B\\u1F5D\\u1F5F-\\u1F7D\\u1F80-\\u1FB4\\u1FB6-\\u1FBC\\u1FBE\\u1FC2-\\u1FC4\\u1FC6-\\u1FCC\\u1FD0-\\u1FD3\\u1FD6-\\u1FDB\\u1FE0-\\u1FEC\\u1FF2-\\u1FF4\\u1FF6-\\u1FFC\\u2071\\u207F\\u2090-\\u209C\\u2102\\u2107\\u210A-\\u2113\\u2115\\u2119-\\u211D\\u2124\\u2126\\u2128\\u212A-\\u212D\\u212F-\\u2139\\u213C-\\u213F\\u2145-\\u2149\\u214E\\u2183\\u2184\\u2C00-\\u2C2E\\u2C30-\\u2C5E\\u2C60-\\u2CE4\\u2CEB-\\u2CEE\\u2CF2\\u2CF3\\u2D00-\\u2D25\\u2D27\\u2D2D\\u2D30-\\u2D67\\u2D6F\\u2D80-\\u2D96\\u2DA0-\\u2DA6\\u2DA8-\\u2DAE\\u2DB0-\\u2DB6\\u2DB8-\\u2DBE\\u2DC0-\\u2DC6\\u2DC8-\\u2DCE\\u2DD0-\\u2DD6\\u2DD8-\\u2DDE\\u2E2F\\u3005\\u3006\\u3031-\\u3035\\u303B\\u303C\\u3041-\\u3096\\u309D-\\u309F\\u30A1-\\u30FA\\u30FC-\\u30FF\\u3105-\\u312E\\u3131-\\u318E\\u31A0-\\u31BA\\u31F0-\\u31FF\\u3400-\\u4DB5\\u4E00-\\u9FEA\\uA000-\\uA48C\\uA4D0-\\uA4FD\\uA500-\\uA60C\\uA610-\\uA61F\\uA62A\\uA62B\\uA640-\\uA66E\\uA67F-\\uA69D\\uA6A0-\\uA6E5\\uA717-\\uA71F\\uA722-\\uA788\\uA78B-\\uA7AE\\uA7B0-\\uA7B7\\uA7F7-\\uA801\\uA803-\\uA805\\uA807-\\uA80A\\uA80C-\\uA822\\uA840-\\uA873\\uA882-\\uA8B3\\uA8F2-\\uA8F7\\uA8FB\\uA8FD\\uA90A-\\uA925\\uA930-\\uA946\\uA960-\\uA97C\\uA984-\\uA9B2\\uA9CF\\uA9E0-\\uA9E4\\uA9E6-\\uA9EF\\uA9FA-\\uA9FE\\uAA00-\\uAA28\\uAA40-\\uAA42\\uAA44-\\uAA4B\\uAA60-\\uAA76\\uAA7A\\uAA7E-\\uAAAF\\uAAB1\\uAAB5\\uAAB6\\uAAB9-\\uAABD\\uAAC0\\uAAC2\\uAADB-\\uAADD\\uAAE0-\\uAAEA\\uAAF2-\\uAAF4\\uAB01-\\uAB06\\uAB09-\\uAB0E\\uAB11-\\uAB16\\uAB20-\\uAB26\\uAB28-\\uAB2E\\uAB30-\\uAB5A\\uAB5C-\\uAB65\\uAB70-\\uABE2\\uAC00-\\uD7A3\\uD7B0-\\uD7C6\\uD7CB-\\uD7FB\\uF900-\\uFA6D\\uFA70-\\uFAD9\\uFB00-\\uFB06\\uFB13-\\uFB17\\uFB1D\\uFB1F-\\uFB28\\uFB2A-\\uFB36\\uFB38-\\uFB3C\\uFB3E\\uFB40\\uFB41\\uFB43\\uFB44\\uFB46-\\uFBB1\\uFBD3-\\uFD3D\\uFD50-\\uFD8F\\uFD92-\\uFDC7\\uFDF0-\\uFDFB\\uFE70-\\uFE74\\uFE76-\\uFEFC\\uFF21-\\uFF3A\\uFF41-\\uFF5A\\uFF66-\\uFFBE\\uFFC2-\\uFFC7\\uFFCA-\\uFFCF\\uFFD2-\\uFFD7\\uFFDA-\\uFFDC]|\\uD800[\\uDC00-\\uDC0B\\uDC0D-\\uDC26\\uDC28-\\uDC3A\\uDC3C\\uDC3D\\uDC3F-\\uDC4D\\uDC50-\\uDC5D\\uDC80-\\uDCFA\\uDE80-\\uDE9C\\uDEA0-\\uDED0\\uDF00-\\uDF1F\\uDF2D-\\uDF40\\uDF42-\\uDF49\\uDF50-\\uDF75\\uDF80-\\uDF9D\\uDFA0-\\uDFC3\\uDFC8-\\uDFCF]|\\uD801[\\uDC00-\\uDC9D\\uDCB0-\\uDCD3\\uDCD8-\\uDCFB\\uDD00-\\uDD27\\uDD30-\\uDD63\\uDE00-\\uDF36\\uDF40-\\uDF55\\uDF60-\\uDF67]|\\uD802[\\uDC00-\\uDC05\\uDC08\\uDC0A-\\uDC35\\uDC37\\uDC38\\uDC3C\\uDC3F-\\uDC55\\uDC60-\\uDC76\\uDC80-\\uDC9E\\uDCE0-\\uDCF2\\uDCF4\\uDCF5\\uDD00-\\uDD15\\uDD20-\\uDD39\\uDD80-\\uDDB7\\uDDBE\\uDDBF\\uDE00\\uDE10-\\uDE13\\uDE15-\\uDE17\\uDE19-\\uDE33\\uDE60-\\uDE7C\\uDE80-\\uDE9C\\uDEC0-\\uDEC7\\uDEC9-\\uDEE4\\uDF00-\\uDF35\\uDF40-\\uDF55\\uDF60-\\uDF72\\uDF80-\\uDF91]|\\uD803[\\uDC00-\\uDC48\\uDC80-\\uDCB2\\uDCC0-\\uDCF2]|\\uD804[\\uDC03-\\uDC37\\uDC83-\\uDCAF\\uDCD0-\\uDCE8\\uDD03-\\uDD26\\uDD50-\\uDD72\\uDD76\\uDD83-\\uDDB2\\uDDC1-\\uDDC4\\uDDDA\\uDDDC\\uDE00-\\uDE11\\uDE13-\\uDE2B\\uDE80-\\uDE86\\uDE88\\uDE8A-\\uDE8D\\uDE8F-\\uDE9D\\uDE9F-\\uDEA8\\uDEB0-\\uDEDE\\uDF05-\\uDF0C\\uDF0F\\uDF10\\uDF13-\\uDF28\\uDF2A-\\uDF30\\uDF32\\uDF33\\uDF35-\\uDF39\\uDF3D\\uDF50\\uDF5D-\\uDF61]|\\uD805[\\uDC00-\\uDC34\\uDC47-\\uDC4A\\uDC80-\\uDCAF\\uDCC4\\uDCC5\\uDCC7\\uDD80-\\uDDAE\\uDDD8-\\uDDDB\\uDE00-\\uDE2F\\uDE44\\uDE80-\\uDEAA\\uDF00-\\uDF19]|\\uD806[\\uDCA0-\\uDCDF\\uDCFF\\uDE00\\uDE0B-\\uDE32\\uDE3A\\uDE50\\uDE5C-\\uDE83\\uDE86-\\uDE89\\uDEC0-\\uDEF8]|\\uD807[\\uDC00-\\uDC08\\uDC0A-\\uDC2E\\uDC40\\uDC72-\\uDC8F\\uDD00-\\uDD06\\uDD08\\uDD09\\uDD0B-\\uDD30\\uDD46]|\\uD808[\\uDC00-\\uDF99]|\\uD809[\\uDC80-\\uDD43]|[\\uD80C\\uD81C-\\uD820\\uD840-\\uD868\\uD86A-\\uD86C\\uD86F-\\uD872\\uD874-\\uD879][\\uDC00-\\uDFFF]|\\uD80D[\\uDC00-\\uDC2E]|\\uD811[\\uDC00-\\uDE46]|\\uD81A[\\uDC00-\\uDE38\\uDE40-\\uDE5E\\uDED0-\\uDEED\\uDF00-\\uDF2F\\uDF40-\\uDF43\\uDF63-\\uDF77\\uDF7D-\\uDF8F]|\\uD81B[\\uDF00-\\uDF44\\uDF50\\uDF93-\\uDF9F\\uDFE0\\uDFE1]|\\uD821[\\uDC00-\\uDFEC]|\\uD822[\\uDC00-\\uDEF2]|\\uD82C[\\uDC00-\\uDD1E\\uDD70-\\uDEFB]|\\uD82F[\\uDC00-\\uDC6A\\uDC70-\\uDC7C\\uDC80-\\uDC88\\uDC90-\\uDC99]|\\uD835[\\uDC00-\\uDC54\\uDC56-\\uDC9C\\uDC9E\\uDC9F\\uDCA2\\uDCA5\\uDCA6\\uDCA9-\\uDCAC\\uDCAE-\\uDCB9\\uDCBB\\uDCBD-\\uDCC3\\uDCC5-\\uDD05\\uDD07-\\uDD0A\\uDD0D-\\uDD14\\uDD16-\\uDD1C\\uDD1E-\\uDD39\\uDD3B-\\uDD3E\\uDD40-\\uDD44\\uDD46\\uDD4A-\\uDD50\\uDD52-\\uDEA5\\uDEA8-\\uDEC0\\uDEC2-\\uDEDA\\uDEDC-\\uDEFA\\uDEFC-\\uDF14\\uDF16-\\uDF34\\uDF36-\\uDF4E\\uDF50-\\uDF6E\\uDF70-\\uDF88\\uDF8A-\\uDFA8\\uDFAA-\\uDFC2\\uDFC4-\\uDFCB]|\\uD83A[\\uDC00-\\uDCC4\\uDD00-\\uDD43]|\\uD83B[\\uDE00-\\uDE03\\uDE05-\\uDE1F\\uDE21\\uDE22\\uDE24\\uDE27\\uDE29-\\uDE32\\uDE34-\\uDE37\\uDE39\\uDE3B\\uDE42\\uDE47\\uDE49\\uDE4B\\uDE4D-\\uDE4F\\uDE51\\uDE52\\uDE54\\uDE57\\uDE59\\uDE5B\\uDE5D\\uDE5F\\uDE61\\uDE62\\uDE64\\uDE67-\\uDE6A\\uDE6C-\\uDE72\\uDE74-\\uDE77\\uDE79-\\uDE7C\\uDE7E\\uDE80-\\uDE89\\uDE8B-\\uDE9B\\uDEA1-\\uDEA3\\uDEA5-\\uDEA9\\uDEAB-\\uDEBB]|\\uD869[\\uDC00-\\uDED6\\uDF00-\\uDFFF]|\\uD86D[\\uDC00-\\uDF34\\uDF40-\\uDFFF]|\\uD86E[\\uDC00-\\uDC1D\\uDC20-\\uDFFF]|\\uD873[\\uDC00-\\uDEA1\\uDEB0-\\uDFFF]|\\uD87A[\\uDC00-\\uDFE0]|\\uD87E[\\uDC00-\\uDE1D])\\S*/g;\n/**\n * Transforms text to title case.\n * Capitalizes the first letter of each word and transforms the\n * rest of the word to lower case.\n * Words are delimited by any whitespace character, such as a space, tab, or line-feed character.\n *\n * @see `LowerCasePipe`\n * @see `UpperCasePipe`\n *\n * @usageNotes\n * The following example shows the result of transforming various strings into title case.\n *\n * \n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass TitleCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(TitleCasePipe, value);\n }\n return value.replace(unicodeWordMatch, (txt => txt[0].toUpperCase() + txt.substr(1).toLowerCase()));\n }\n}\nTitleCasePipe.ɵfac = function TitleCasePipe_Factory(t) { return new (t || TitleCasePipe)(); };\nTitleCasePipe.ɵpipe = /*@__PURE__*/ ɵngcc0.ɵɵdefinePipe({ name: \"titlecase\", type: TitleCasePipe, pure: true });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(TitleCasePipe, [{\n type: Pipe,\n args: [{ name: 'titlecase' }]\n }], null, null); })();\n/**\n * Transforms text to all upper case.\n * @see `LowerCasePipe`\n * @see `TitleCasePipe`\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass UpperCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(UpperCasePipe, value);\n }\n return value.toUpperCase();\n }\n}\nUpperCasePipe.ɵfac = function UpperCasePipe_Factory(t) { return new (t || UpperCasePipe)(); };\nUpperCasePipe.ɵpipe = /*@__PURE__*/ ɵngcc0.ɵɵdefinePipe({ name: \"uppercase\", type: UpperCasePipe, pure: true });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(UpperCasePipe, [{\n type: Pipe,\n args: [{ name: 'uppercase' }]\n }], null, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// clang-format off\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date value according to locale rules.\n *\n * `DatePipe` is executed only when it detects a pure change to the input value.\n * A pure change is either a change to a primitive input value\n * (such as `String`, `Number`, `Boolean`, or `Symbol`),\n * or a changed object reference (such as `Date`, `Array`, `Function`, or `Object`).\n *\n * Note that mutating a `Date` object does not cause the pipe to be rendered again.\n * To ensure that the pipe is executed, you must create a new `Date` object.\n *\n * Only the `en-US` locale data comes with Angular. To localize dates\n * in another language, you must import the corresponding locale data.\n * See the [I18n guide](guide/i18n#i18n-pipes) for more information.\n *\n * @see `formatDate()`\n *\n *\n * @usageNotes\n *\n * The result of this pipe is not reevaluated when the input is mutated. To avoid the need to\n * reformat the date on every change-detection cycle, treat the date as an immutable object\n * and change the reference when the pipe needs to run again.\n *\n * ### Pre-defined format options\n *\n * | Option | Equivalent to | Examples (given in `en-US` locale) |\n * |---------------|-------------------------------------|-------------------------------------------------|\n * | `'short'` | `'M/d/yy, h:mm a'` | `6/15/15, 9:03 AM` |\n * | `'medium'` | `'MMM d, y, h:mm:ss a'` | `Jun 15, 2015, 9:03:01 AM` |\n * | `'long'` | `'MMMM d, y, h:mm:ss a z'` | `June 15, 2015 at 9:03:01 AM GMT+1` |\n * | `'full'` | `'EEEE, MMMM d, y, h:mm:ss a zzzz'` | `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00` |\n * | `'shortDate'` | `'M/d/yy'` | `6/15/15` |\n * | `'mediumDate'`| `'MMM d, y'` | `Jun 15, 2015` |\n * | `'longDate'` | `'MMMM d, y'` | `June 15, 2015` |\n * | `'fullDate'` | `'EEEE, MMMM d, y'` | `Monday, June 15, 2015` |\n * | `'shortTime'` | `'h:mm a'` | `9:03 AM` |\n * | `'mediumTime'`| `'h:mm:ss a'` | `9:03:01 AM` |\n * | `'longTime'` | `'h:mm:ss a z'` | `9:03:01 AM GMT+1` |\n * | `'fullTime'` | `'h:mm:ss a zzzz'` | `9:03:01 AM GMT+01:00` |\n *\n * ### Custom format options\n *\n * You can construct a format string using symbols to specify the components\n * of a date-time value, as described in the following table.\n * Format details depend on the locale.\n * Fields marked with (*) are only available in the extra data set for the given locale.\n *\n * | Field type | Format | Description | Example Value |\n * |-------------------- |-------------|---------------------------------------------------------------|------------------------------------------------------------|\n * | Era | G, GG & GGG | Abbreviated | AD |\n * | | GGGG | Wide | Anno Domini |\n * | | GGGGG | Narrow | A |\n * | Year | y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | yy | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | yyy | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | yyyy | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | Week-numbering year | Y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | YY | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | YYY | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | YYYY | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | Month | M | Numeric: 1 digit | 9, 12 |\n * | | MM | Numeric: 2 digits + zero padded | 09, 12 |\n * | | MMM | Abbreviated | Sep |\n * | | MMMM | Wide | September |\n * | | MMMMM | Narrow | S |\n * | Month standalone | L | Numeric: 1 digit | 9, 12 |\n * | | LL | Numeric: 2 digits + zero padded | 09, 12 |\n * | | LLL | Abbreviated | Sep |\n * | | LLLL | Wide | September |\n * | | LLLLL | Narrow | S |\n * | Week of year | w | Numeric: minimum digits | 1... 53 |\n * | | ww | Numeric: 2 digits + zero padded | 01... 53 |\n * | Week of month | W | Numeric: 1 digit | 1... 5 |\n * | Day of month | d | Numeric: minimum digits | 1 |\n * | | dd | Numeric: 2 digits + zero padded | 01 |\n * | Week day | E, EE & EEE | Abbreviated | Tue |\n * | | EEEE | Wide | Tuesday |\n * | | EEEEE | Narrow | T |\n * | | EEEEEE | Short | Tu |\n * | Week day standalone | c, cc | Numeric: 1 digit | 2 |\n * | | ccc | Abbreviated | Tue |\n * | | cccc | Wide | Tuesday |\n * | | ccccc | Narrow | T |\n * | | cccccc | Short | Tu |\n * | Period | a, aa & aaa | Abbreviated | am/pm or AM/PM |\n * | | aaaa | Wide (fallback to `a` when missing) | ante meridiem/post meridiem |\n * | | aaaaa | Narrow | a/p |\n * | Period* | B, BB & BBB | Abbreviated | mid. |\n * | | BBBB | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | BBBBB | Narrow | md |\n * | Period standalone* | b, bb & bbb | Abbreviated | mid. |\n * | | bbbb | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | bbbbb | Narrow | md |\n * | Hour 1-12 | h | Numeric: minimum digits | 1, 12 |\n * | | hh | Numeric: 2 digits + zero padded | 01, 12 |\n * | Hour 0-23 | H | Numeric: minimum digits | 0, 23 |\n * | | HH | Numeric: 2 digits + zero padded | 00, 23 |\n * | Minute | m | Numeric: minimum digits | 8, 59 |\n * | | mm | Numeric: 2 digits + zero padded | 08, 59 |\n * | Second | s | Numeric: minimum digits | 0... 59 |\n * | | ss | Numeric: 2 digits + zero padded | 00... 59 |\n * | Fractional seconds | S | Numeric: 1 digit | 0... 9 |\n * | | SS | Numeric: 2 digits + zero padded | 00... 99 |\n * | | SSS | Numeric: 3 digits + zero padded (= milliseconds) | 000... 999 |\n * | Zone | z, zz & zzz | Short specific non location format (fallback to O) | GMT-8 |\n * | | zzzz | Long specific non location format (fallback to OOOO) | GMT-08:00 |\n * | | Z, ZZ & ZZZ | ISO8601 basic format | -0800 |\n * | | ZZZZ | Long localized GMT format | GMT-8:00 |\n * | | ZZZZZ | ISO8601 extended format + Z indicator for offset 0 (= XXXXX) | -08:00 |\n * | | O, OO & OOO | Short localized GMT format | GMT-8 |\n * | | OOOO | Long localized GMT format | GMT-08:00 |\n *\n *\n * ### Format examples\n *\n * These examples transform a date into various formats,\n * assuming that `dateObj` is a JavaScript `Date` object for\n * year: 2015, month: 6, day: 15, hour: 21, minute: 43, second: 11,\n * given in the local time for the `en-US` locale.\n *\n * ```\n * {{ dateObj | date }} // output is 'Jun 15, 2015'\n * {{ dateObj | date:'medium' }} // output is 'Jun 15, 2015, 9:43:11 PM'\n * {{ dateObj | date:'shortTime' }} // output is '9:43 PM'\n * {{ dateObj | date:'mm:ss' }} // output is '43:11'\n * ```\n *\n * ### Usage example\n *\n * The following component uses a date pipe to display the current date in different formats.\n *\n * ```\n * @Component({\n * selector: 'date-pipe',\n * template: `
\n *
Today is {{today | date}}
\n *
Or if you prefer, {{today | date:'fullDate'}}
\n *
The time is {{today | date:'h:mm a z'}}
\n *
`\n * })\n * // Get the current date and time as a date-time value.\n * export class DatePipeComponent {\n * today: number = Date.now();\n * }\n * ```\n *\n * @publicApi\n */\n// clang-format on\nclass DatePipe {\n constructor(locale) {\n this.locale = locale;\n }\n transform(value, format = 'mediumDate', timezone, locale) {\n if (value == null || value === '' || value !== value)\n return null;\n try {\n return formatDate(value, format, locale || this.locale, timezone);\n }\n catch (error) {\n throw invalidPipeArgumentError(DatePipe, error.message);\n }\n }\n}\nDatePipe.ɵfac = function DatePipe_Factory(t) { return new (t || DatePipe)(ɵngcc0.ɵɵdirectiveInject(LOCALE_ID, 16)); };\nDatePipe.ɵpipe = /*@__PURE__*/ ɵngcc0.ɵɵdefinePipe({ name: \"date\", type: DatePipe, pure: true });\nDatePipe.ctorParameters = () => [\n { type: String, decorators: [{ type: Inject, args: [LOCALE_ID,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(DatePipe, [{\n type: Pipe,\n args: [{ name: 'date', pure: true }]\n }], function () { return [{ type: String, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst _INTERPOLATION_REGEXP = /#/g;\n/**\n * @ngModule CommonModule\n * @description\n *\n * Maps a value to a string that pluralizes the value according to locale rules.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/pipes/ts/i18n_pipe.ts region='I18nPluralPipeComponent'}\n *\n * @publicApi\n */\nclass I18nPluralPipe {\n constructor(_localization) {\n this._localization = _localization;\n }\n /**\n * @param value the number to be formatted\n * @param pluralMap an object that mimics the ICU format, see\n * http://userguide.icu-project.org/formatparse/messages.\n * @param locale a `string` defining the locale to use (uses the current {@link LOCALE_ID} by\n * default).\n */\n transform(value, pluralMap, locale) {\n if (value == null)\n return '';\n if (typeof pluralMap !== 'object' || pluralMap === null) {\n throw invalidPipeArgumentError(I18nPluralPipe, pluralMap);\n }\n const key = getPluralCategory(value, Object.keys(pluralMap), this._localization, locale);\n return pluralMap[key].replace(_INTERPOLATION_REGEXP, value.toString());\n }\n}\nI18nPluralPipe.ɵfac = function I18nPluralPipe_Factory(t) { return new (t || I18nPluralPipe)(ɵngcc0.ɵɵdirectiveInject(NgLocalization, 16)); };\nI18nPluralPipe.ɵpipe = /*@__PURE__*/ ɵngcc0.ɵɵdefinePipe({ name: \"i18nPlural\", type: I18nPluralPipe, pure: true });\nI18nPluralPipe.ctorParameters = () => [\n { type: NgLocalization }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(I18nPluralPipe, [{\n type: Pipe,\n args: [{ name: 'i18nPlural', pure: true }]\n }], function () { return [{ type: NgLocalization }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n * @description\n *\n * Generic selector that displays the string that matches the current value.\n *\n * If none of the keys of the `mapping` match the `value`, then the content\n * of the `other` key is returned when present, otherwise an empty string is returned.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/pipes/ts/i18n_pipe.ts region='I18nSelectPipeComponent'}\n *\n * @publicApi\n */\nclass I18nSelectPipe {\n /**\n * @param value a string to be internationalized.\n * @param mapping an object that indicates the text that should be displayed\n * for different values of the provided `value`.\n */\n transform(value, mapping) {\n if (value == null)\n return '';\n if (typeof mapping !== 'object' || typeof value !== 'string') {\n throw invalidPipeArgumentError(I18nSelectPipe, mapping);\n }\n if (mapping.hasOwnProperty(value)) {\n return mapping[value];\n }\n if (mapping.hasOwnProperty('other')) {\n return mapping['other'];\n }\n return '';\n }\n}\nI18nSelectPipe.ɵfac = function I18nSelectPipe_Factory(t) { return new (t || I18nSelectPipe)(); };\nI18nSelectPipe.ɵpipe = /*@__PURE__*/ ɵngcc0.ɵɵdefinePipe({ name: \"i18nSelect\", type: I18nSelectPipe, pure: true });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(I18nSelectPipe, [{\n type: Pipe,\n args: [{ name: 'i18nSelect', pure: true }]\n }], null, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n * @description\n *\n * Converts a value into its JSON-format representation. Useful for debugging.\n *\n * @usageNotes\n *\n * The following component uses a JSON pipe to convert an object\n * to JSON format, and displays the string in both formats for comparison.\n *\n * {@example common/pipes/ts/json_pipe.ts region='JsonPipe'}\n *\n * @publicApi\n */\nclass JsonPipe {\n /**\n * @param value A value of any type to convert into a JSON-format string.\n */\n transform(value) {\n return JSON.stringify(value, null, 2);\n }\n}\nJsonPipe.ɵfac = function JsonPipe_Factory(t) { return new (t || JsonPipe)(); };\nJsonPipe.ɵpipe = /*@__PURE__*/ ɵngcc0.ɵɵdefinePipe({ name: \"json\", type: JsonPipe, pure: false });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(JsonPipe, [{\n type: Pipe,\n args: [{ name: 'json', pure: false }]\n }], null, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction makeKeyValuePair(key, value) {\n return { key: key, value: value };\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms Object or Map into an array of key value pairs.\n *\n * The output array will be ordered by keys.\n * By default the comparator will be by Unicode point value.\n * You can optionally pass a compareFn if your keys are complex types.\n *\n * @usageNotes\n * ### Examples\n *\n * This examples show how an Object or a Map can be iterated by ngFor with the use of this\n * keyvalue pipe.\n *\n * {@example common/pipes/ts/keyvalue_pipe.ts region='KeyValuePipe'}\n *\n * @publicApi\n */\nclass KeyValuePipe {\n constructor(differs) {\n this.differs = differs;\n this.keyValues = [];\n this.compareFn = defaultComparator;\n }\n transform(input, compareFn = defaultComparator) {\n if (!input || (!(input instanceof Map) && typeof input !== 'object')) {\n return null;\n }\n if (!this.differ) {\n // make a differ for whatever type we've been passed in\n this.differ = this.differs.find(input).create();\n }\n const differChanges = this.differ.diff(input);\n const compareFnChanged = compareFn !== this.compareFn;\n if (differChanges) {\n this.keyValues = [];\n differChanges.forEachItem((r) => {\n this.keyValues.push(makeKeyValuePair(r.key, r.currentValue));\n });\n }\n if (differChanges || compareFnChanged) {\n this.keyValues.sort(compareFn);\n this.compareFn = compareFn;\n }\n return this.keyValues;\n }\n}\nKeyValuePipe.ɵfac = function KeyValuePipe_Factory(t) { return new (t || KeyValuePipe)(ɵngcc0.ɵɵdirectiveInject(ɵngcc0.KeyValueDiffers, 16)); };\nKeyValuePipe.ɵpipe = /*@__PURE__*/ ɵngcc0.ɵɵdefinePipe({ name: \"keyvalue\", type: KeyValuePipe, pure: false });\nKeyValuePipe.ctorParameters = () => [\n { type: KeyValueDiffers }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(KeyValuePipe, [{\n type: Pipe,\n args: [{ name: 'keyvalue', pure: false }]\n }], function () { return [{ type: ɵngcc0.KeyValueDiffers }]; }, null); })();\nfunction defaultComparator(keyValueA, keyValueB) {\n const a = keyValueA.key;\n const b = keyValueB.key;\n // if same exit with 0;\n if (a === b)\n return 0;\n // make sure that undefined are at the end of the sort.\n if (a === undefined)\n return 1;\n if (b === undefined)\n return -1;\n // make sure that nulls are at the end of the sort.\n if (a === null)\n return 1;\n if (b === null)\n return -1;\n if (typeof a == 'string' && typeof b == 'string') {\n return a < b ? -1 : 1;\n }\n if (typeof a == 'number' && typeof b == 'number') {\n return a - b;\n }\n if (typeof a == 'boolean' && typeof b == 'boolean') {\n return a < b ? -1 : 1;\n }\n // `a` and `b` are of different types. Compare their string values.\n const aString = String(a);\n const bString = String(b);\n return aString == bString ? 0 : aString < bString ? -1 : 1;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a value according to digit options and locale rules.\n * Locale determines group sizing and separator,\n * decimal point character, and other locale-specific configurations.\n *\n * @see `formatNumber()`\n *\n * @usageNotes\n *\n * ### digitsInfo\n *\n * The value's decimal representation is specified by the `digitsInfo`\n * parameter, written in the following format: \n *\n * ```\n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}\n * ```\n *\n * - `minIntegerDigits`:\n * The minimum number of integer digits before the decimal point.\n * Default is 1.\n *\n * - `minFractionDigits`:\n * The minimum number of digits after the decimal point.\n * Default is 0.\n *\n * - `maxFractionDigits`:\n * The maximum number of digits after the decimal point.\n * Default is 3.\n *\n * If the formatted value is truncated it will be rounded using the \"to-nearest\" method:\n *\n * ```\n * {{3.6 | number: '1.0-0'}}\n * \n *\n * {{-3.6 | number:'1.0-0'}}\n * \n * ```\n *\n * ### locale\n *\n * `locale` will format a value according to locale rules.\n * Locale determines group sizing and separator,\n * decimal point character, and other locale-specific configurations.\n *\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n *\n * See [Setting your app locale](guide/i18n#setting-up-the-locale-of-your-app).\n *\n * ### Example\n *\n * The following code shows how the pipe transforms values\n * according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass DecimalPipe {\n constructor(_locale) {\n this._locale = _locale;\n }\n /**\n * @param value The value to be formatted.\n * @param digitsInfo Sets digit and decimal representation.\n * [See more](#digitsinfo).\n * @param locale Specifies what locale format rules to use.\n * [See more](#locale).\n */\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n try {\n const num = strToNumber(value);\n return formatNumber(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(DecimalPipe, error.message);\n }\n }\n}\nDecimalPipe.ɵfac = function DecimalPipe_Factory(t) { return new (t || DecimalPipe)(ɵngcc0.ɵɵdirectiveInject(LOCALE_ID, 16)); };\nDecimalPipe.ɵpipe = /*@__PURE__*/ ɵngcc0.ɵɵdefinePipe({ name: \"number\", type: DecimalPipe, pure: true });\nDecimalPipe.ctorParameters = () => [\n { type: String, decorators: [{ type: Inject, args: [LOCALE_ID,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(DecimalPipe, [{\n type: Pipe,\n args: [{ name: 'number' }]\n }], function () { return [{ type: String, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; }, null); })();\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a percentage\n * string, formatted according to locale rules that determine group sizing and\n * separator, decimal-point character, and other locale-specific\n * configurations.\n *\n * @see `formatPercent()`\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass PercentPipe {\n constructor(_locale) {\n this._locale = _locale;\n }\n /**\n *\n * @param value The number to be formatted as a percentage.\n * @param digitsInfo Decimal representation options, specified by a string\n * in the following format: \n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `0`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `0`.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n#setting-up-the-locale-of-your-app).\n */\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n try {\n const num = strToNumber(value);\n return formatPercent(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(PercentPipe, error.message);\n }\n }\n}\nPercentPipe.ɵfac = function PercentPipe_Factory(t) { return new (t || PercentPipe)(ɵngcc0.ɵɵdirectiveInject(LOCALE_ID, 16)); };\nPercentPipe.ɵpipe = /*@__PURE__*/ ɵngcc0.ɵɵdefinePipe({ name: \"percent\", type: PercentPipe, pure: true });\nPercentPipe.ctorParameters = () => [\n { type: String, decorators: [{ type: Inject, args: [LOCALE_ID,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(PercentPipe, [{\n type: Pipe,\n args: [{ name: 'percent' }]\n }], function () { return [{ type: String, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; }, null); })();\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a currency string, formatted according to locale rules\n * that determine group sizing and separator, decimal-point character,\n * and other locale-specific configurations.\n *\n * {@a currency-code-deprecation}\n *
\n *\n * **Deprecation notice:**\n *\n * The default currency code is currently always `USD` but this is deprecated from v9.\n *\n * **In v11 the default currency code will be taken from the current locale identified by\n * the `LOCALE_ID` token. See the [i18n guide](guide/i18n#setting-up-the-locale-of-your-app) for\n * more information.**\n *\n * If you need the previous behavior then set it by creating a `DEFAULT_CURRENCY_CODE` provider in\n * your application `NgModule`:\n *\n * ```ts\n * {provide: DEFAULT_CURRENCY_CODE, useValue: 'USD'}\n * ```\n *\n *
\n *\n * @see `getCurrencySymbol()`\n * @see `formatCurrency()`\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass CurrencyPipe {\n constructor(_locale, _defaultCurrencyCode = 'USD') {\n this._locale = _locale;\n this._defaultCurrencyCode = _defaultCurrencyCode;\n }\n /**\n *\n * @param value The number to be formatted as currency.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) currency code,\n * such as `USD` for the US dollar and `EUR` for the euro. The default currency code can be\n * configured using the `DEFAULT_CURRENCY_CODE` injection token.\n * @param display The format for the currency indicator. One of the following:\n * - `code`: Show the code (such as `USD`).\n * - `symbol`(default): Show the symbol (such as `$`).\n * - `symbol-narrow`: Use the narrow symbol for locales that have two symbols for their\n * currency.\n * For example, the Canadian dollar CAD has the symbol `CA$` and the symbol-narrow `$`. If the\n * locale has no narrow symbol, uses the standard symbol for the locale.\n * - String: Use the given string value instead of a code or a symbol.\n * For example, an empty string will suppress the currency & symbol.\n * - Boolean (marked deprecated in v5): `true` for symbol and false for `code`.\n *\n * @param digitsInfo Decimal representation options, specified by a string\n * in the following format: \n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `2`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `2`.\n * If not provided, the number will be formatted with the proper amount of digits,\n * depending on what the [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) specifies.\n * For example, the Canadian dollar has 2 digits, whereas the Chilean peso has none.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n#setting-up-the-locale-of-your-app).\n */\n transform(value, currencyCode = this._defaultCurrencyCode, display = 'symbol', digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n if (typeof display === 'boolean') {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && console && console.warn) {\n console.warn(`Warning: the currency pipe has been changed in Angular v5. The symbolDisplay option (third parameter) is now a string instead of a boolean. The accepted values are \"code\", \"symbol\" or \"symbol-narrow\".`);\n }\n display = display ? 'symbol' : 'code';\n }\n let currency = currencyCode || this._defaultCurrencyCode;\n if (display !== 'code') {\n if (display === 'symbol' || display === 'symbol-narrow') {\n currency = getCurrencySymbol(currency, display === 'symbol' ? 'wide' : 'narrow', locale);\n }\n else {\n currency = display;\n }\n }\n try {\n const num = strToNumber(value);\n return formatCurrency(num, locale, currency, currencyCode, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(CurrencyPipe, error.message);\n }\n }\n}\nCurrencyPipe.ɵfac = function CurrencyPipe_Factory(t) { return new (t || CurrencyPipe)(ɵngcc0.ɵɵdirectiveInject(LOCALE_ID, 16), ɵngcc0.ɵɵdirectiveInject(DEFAULT_CURRENCY_CODE, 16)); };\nCurrencyPipe.ɵpipe = /*@__PURE__*/ ɵngcc0.ɵɵdefinePipe({ name: \"currency\", type: CurrencyPipe, pure: true });\nCurrencyPipe.ctorParameters = () => [\n { type: String, decorators: [{ type: Inject, args: [LOCALE_ID,] }] },\n { type: String, decorators: [{ type: Inject, args: [DEFAULT_CURRENCY_CODE,] }] }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CurrencyPipe, [{\n type: Pipe,\n args: [{ name: 'currency' }]\n }], function () { return [{ type: String, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: String, decorators: [{\n type: Inject,\n args: [DEFAULT_CURRENCY_CODE]\n }] }]; }, null); })();\nfunction isValue(value) {\n return !(value == null || value === '' || value !== value);\n}\n/**\n * Transforms a string into a number (if needed).\n */\nfunction strToNumber(value) {\n // Convert strings to numbers\n if (typeof value === 'string' && !isNaN(Number(value) - parseFloat(value))) {\n return Number(value);\n }\n if (typeof value !== 'number') {\n throw new Error(`${value} is not a number`);\n }\n return value;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n * @description\n *\n * Creates a new `Array` or `String` containing a subset (slice) of the elements.\n *\n * @usageNotes\n *\n * All behavior is based on the expected behavior of the JavaScript API `Array.prototype.slice()`\n * and `String.prototype.slice()`.\n *\n * When operating on an `Array`, the returned `Array` is always a copy even when all\n * the elements are being returned.\n *\n * When operating on a blank value, the pipe returns the blank value.\n *\n * ### List Example\n *\n * This `ngFor` example:\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_list'}\n *\n * produces the following:\n *\n * ```html\n *
b
\n *
c
\n * ```\n *\n * ### String Examples\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_string'}\n *\n * @publicApi\n */\nclass SlicePipe {\n transform(value, start, end) {\n if (value == null)\n return null;\n if (!this.supports(value)) {\n throw invalidPipeArgumentError(SlicePipe, value);\n }\n return value.slice(start, end);\n }\n supports(obj) {\n return typeof obj === 'string' || Array.isArray(obj);\n }\n}\nSlicePipe.ɵfac = function SlicePipe_Factory(t) { return new (t || SlicePipe)(); };\nSlicePipe.ɵpipe = /*@__PURE__*/ ɵngcc0.ɵɵdefinePipe({ name: \"slice\", type: SlicePipe, pure: false });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(SlicePipe, [{\n type: Pipe,\n args: [{ name: 'slice', pure: false }]\n }], null, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A collection of Angular pipes that are likely to be used in each and every application.\n */\nconst COMMON_PIPES = [\n AsyncPipe,\n UpperCasePipe,\n LowerCasePipe,\n JsonPipe,\n SlicePipe,\n DecimalPipe,\n PercentPipe,\n TitleCasePipe,\n CurrencyPipe,\n DatePipe,\n I18nPluralPipe,\n I18nSelectPipe,\n KeyValuePipe,\n];\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Note: This does not contain the location providers,\n// as they need some platform specific implementations to work.\n/**\n * Exports all the basic Angular directives and pipes,\n * such as `NgIf`, `NgForOf`, `DecimalPipe`, and so on.\n * Re-exported by `BrowserModule`, which is included automatically in the root\n * `AppModule` when you create a new app with the CLI `new` command.\n *\n * * The `providers` options configure the NgModule's injector to provide\n * localization dependencies to members.\n * * The `exports` options make the declared directives and pipes available for import\n * by other NgModules.\n *\n * @publicApi\n */\nclass CommonModule {\n}\nCommonModule.ɵfac = function CommonModule_Factory(t) { return new (t || CommonModule)(); };\nCommonModule.ɵmod = /*@__PURE__*/ ɵngcc0.ɵɵdefineNgModule({ type: CommonModule });\nCommonModule.ɵinj = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjector({ providers: [\n { provide: NgLocalization, useClass: NgLocaleLocalization },\n ] });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(CommonModule, [{\n type: NgModule,\n args: [{\n declarations: [COMMON_DIRECTIVES, COMMON_PIPES],\n exports: [COMMON_DIRECTIVES, COMMON_PIPES],\n providers: [\n { provide: NgLocalization, useClass: NgLocaleLocalization },\n ]\n }]\n }], null, null); })();\n(function () { (typeof ngJitMode === \"undefined\" || ngJitMode) && ɵngcc0.ɵɵsetNgModuleScope(CommonModule, { declarations: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe], exports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe] }); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst PLATFORM_BROWSER_ID = 'browser';\nconst PLATFORM_SERVER_ID = 'server';\nconst PLATFORM_WORKER_APP_ID = 'browserWorkerApp';\nconst PLATFORM_WORKER_UI_ID = 'browserWorkerUi';\n/**\n * Returns whether a platform id represents a browser platform.\n * @publicApi\n */\nfunction isPlatformBrowser(platformId) {\n return platformId === PLATFORM_BROWSER_ID;\n}\n/**\n * Returns whether a platform id represents a server platform.\n * @publicApi\n */\nfunction isPlatformServer(platformId) {\n return platformId === PLATFORM_SERVER_ID;\n}\n/**\n * Returns whether a platform id represents a web worker app platform.\n * @publicApi\n */\nfunction isPlatformWorkerApp(platformId) {\n return platformId === PLATFORM_WORKER_APP_ID;\n}\n/**\n * Returns whether a platform id represents a web worker UI platform.\n * @publicApi\n */\nfunction isPlatformWorkerUi(platformId) {\n return platformId === PLATFORM_WORKER_UI_ID;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nconst VERSION = new Version('12.1.3');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Defines a scroll position manager. Implemented by `BrowserViewportScroller`.\n *\n * @publicApi\n */\nclass ViewportScroller {\n}\n// De-sugared tree-shakable injection\n// See #23917\n/** @nocollapse */\nViewportScroller.ɵprov = ɵɵdefineInjectable({\n token: ViewportScroller,\n providedIn: 'root',\n factory: () => new BrowserViewportScroller(ɵɵinject(DOCUMENT), window)\n});\n/**\n * Manages the scroll position for a browser window.\n */\nclass BrowserViewportScroller {\n constructor(document, window) {\n this.document = document;\n this.window = window;\n this.offset = () => [0, 0];\n }\n /**\n * Configures the top offset used when scrolling to an anchor.\n * @param offset A position in screen coordinates (a tuple with x and y values)\n * or a function that returns the top offset position.\n *\n */\n setOffset(offset) {\n if (Array.isArray(offset)) {\n this.offset = () => offset;\n }\n else {\n this.offset = offset;\n }\n }\n /**\n * Retrieves the current scroll position.\n * @returns The position in screen coordinates.\n */\n getScrollPosition() {\n if (this.supportsScrolling()) {\n return [this.window.pageXOffset, this.window.pageYOffset];\n }\n else {\n return [0, 0];\n }\n }\n /**\n * Sets the scroll position.\n * @param position The new position in screen coordinates.\n */\n scrollToPosition(position) {\n if (this.supportsScrolling()) {\n this.window.scrollTo(position[0], position[1]);\n }\n }\n /**\n * Scrolls to an element and attempts to focus the element.\n *\n * Note that the function name here is misleading in that the target string may be an ID for a\n * non-anchor element.\n *\n * @param target The ID of an element or name of the anchor.\n *\n * @see https://html.spec.whatwg.org/#the-indicated-part-of-the-document\n * @see https://html.spec.whatwg.org/#scroll-to-fragid\n */\n scrollToAnchor(target) {\n if (!this.supportsScrolling()) {\n return;\n }\n // TODO(atscott): The correct behavior for `getElementsByName` would be to also verify that the\n // element is an anchor. However, this could be considered a breaking change and should be\n // done in a major version.\n const elSelected = findAnchorFromDocument(this.document, target);\n if (elSelected) {\n this.scrollToElement(elSelected);\n // After scrolling to the element, the spec dictates that we follow the focus steps for the\n // target. Rather than following the robust steps, simply attempt focus.\n this.attemptFocus(elSelected);\n }\n }\n /**\n * Disables automatic scroll restoration provided by the browser.\n */\n setHistoryScrollRestoration(scrollRestoration) {\n if (this.supportScrollRestoration()) {\n const history = this.window.history;\n if (history && history.scrollRestoration) {\n history.scrollRestoration = scrollRestoration;\n }\n }\n }\n /**\n * Scrolls to an element using the native offset and the specified offset set on this scroller.\n *\n * The offset can be used when we know that there is a floating header and scrolling naively to an\n * element (ex: `scrollIntoView`) leaves the element hidden behind the floating header.\n */\n scrollToElement(el) {\n const rect = el.getBoundingClientRect();\n const left = rect.left + this.window.pageXOffset;\n const top = rect.top + this.window.pageYOffset;\n const offset = this.offset();\n this.window.scrollTo(left - offset[0], top - offset[1]);\n }\n /**\n * Calls `focus` on the `focusTarget` and returns `true` if the element was focused successfully.\n *\n * If `false`, further steps may be necessary to determine a valid substitute to be focused\n * instead.\n *\n * @see https://html.spec.whatwg.org/#get-the-focusable-area\n * @see https://developer.mozilla.org/en-US/docs/Web/API/HTMLOrForeignElement/focus\n * @see https://html.spec.whatwg.org/#focusable-area\n */\n attemptFocus(focusTarget) {\n focusTarget.focus();\n return this.document.activeElement === focusTarget;\n }\n /**\n * We only support scroll restoration when we can get a hold of window.\n * This means that we do not support this behavior when running in a web worker.\n *\n * Lifting this restriction right now would require more changes in the dom adapter.\n * Since webworkers aren't widely used, we will lift it once RouterScroller is\n * battle-tested.\n */\n supportScrollRestoration() {\n try {\n if (!this.supportsScrolling()) {\n return false;\n }\n // The `scrollRestoration` property could be on the `history` instance or its prototype.\n const scrollRestorationDescriptor = getScrollRestorationProperty(this.window.history) ||\n getScrollRestorationProperty(Object.getPrototypeOf(this.window.history));\n // We can write to the `scrollRestoration` property if it is a writable data field or it has a\n // setter function.\n return !!scrollRestorationDescriptor &&\n !!(scrollRestorationDescriptor.writable || scrollRestorationDescriptor.set);\n }\n catch (_a) {\n return false;\n }\n }\n supportsScrolling() {\n try {\n return !!this.window && !!this.window.scrollTo && 'pageXOffset' in this.window;\n }\n catch (_a) {\n return false;\n }\n }\n}\nfunction getScrollRestorationProperty(obj) {\n return Object.getOwnPropertyDescriptor(obj, 'scrollRestoration');\n}\nfunction findAnchorFromDocument(document, target) {\n const documentResult = document.getElementById(target) || document.getElementsByName(target)[0];\n if (documentResult) {\n return documentResult;\n }\n // `getElementById` and `getElementsByName` won't pierce through the shadow DOM so we\n // have to traverse the DOM manually and do the lookup through the shadow roots.\n if (typeof document.createTreeWalker === 'function' && document.body &&\n (document.body.createShadowRoot || document.body.attachShadow)) {\n const treeWalker = document.createTreeWalker(document.body, NodeFilter.SHOW_ELEMENT);\n let currentNode = treeWalker.currentNode;\n while (currentNode) {\n const shadowRoot = currentNode.shadowRoot;\n if (shadowRoot) {\n // Note that `ShadowRoot` doesn't support `getElementsByName`\n // so we have to fall back to `querySelector`.\n const result = shadowRoot.getElementById(target) || shadowRoot.querySelector(`[name=\"${target}\"]`);\n if (result) {\n return result;\n }\n }\n currentNode = treeWalker.nextNode();\n }\n }\n return null;\n}\n/**\n * Provides an empty implementation of the viewport scroller.\n */\nclass NullViewportScroller {\n /**\n * Empty implementation\n */\n setOffset(offset) { }\n /**\n * Empty implementation\n */\n getScrollPosition() {\n return [0, 0];\n }\n /**\n * Empty implementation\n */\n scrollToPosition(position) { }\n /**\n * Empty implementation\n */\n scrollToAnchor(anchor) { }\n /**\n * Empty implementation\n */\n setHistoryScrollRestoration(scrollRestoration) { }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A wrapper around the `XMLHttpRequest` constructor.\n *\n * @publicApi\n */\nclass XhrFactory {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// This file only reexports content of the `src` folder. Keep it that way.\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { APP_BASE_HREF, AsyncPipe, CommonModule, CurrencyPipe, DOCUMENT, DatePipe, DecimalPipe, FormStyle, FormatWidth, HashLocationStrategy, I18nPluralPipe, I18nSelectPipe, JsonPipe, KeyValuePipe, LOCATION_INITIALIZED, Location, LocationStrategy, LowerCasePipe, NgClass, NgComponentOutlet, NgForOf, NgForOfContext, NgIf, NgIfContext, NgLocaleLocalization, NgLocalization, NgPlural, NgPluralCase, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgTemplateOutlet, NumberFormatStyle, NumberSymbol, PathLocationStrategy, PercentPipe, PlatformLocation, Plural, SlicePipe, TitleCasePipe, TranslationWidth, UpperCasePipe, VERSION, ViewportScroller, WeekDay, XhrFactory, formatCurrency, formatDate, formatNumber, formatPercent, getCurrencySymbol, getLocaleCurrencyCode, getLocaleCurrencyName, getLocaleCurrencySymbol, getLocaleDateFormat, getLocaleDateTimeFormat, getLocaleDayNames, getLocaleDayPeriods, getLocaleDirection, getLocaleEraNames, getLocaleExtraDayPeriodRules, getLocaleExtraDayPeriods, getLocaleFirstDayOfWeek, getLocaleId, getLocaleMonthNames, getLocaleNumberFormat, getLocaleNumberSymbol, getLocalePluralCase, getLocaleTimeFormat, getLocaleWeekEndRange, getNumberOfCurrencyDigits, isPlatformBrowser, isPlatformServer, isPlatformWorkerApp, isPlatformWorkerUi, registerLocaleData, BrowserPlatformLocation as ɵBrowserPlatformLocation, DomAdapter as ɵDomAdapter, NullViewportScroller as ɵNullViewportScroller, PLATFORM_BROWSER_ID as ɵPLATFORM_BROWSER_ID, PLATFORM_SERVER_ID as ɵPLATFORM_SERVER_ID, PLATFORM_WORKER_APP_ID as ɵPLATFORM_WORKER_APP_ID, PLATFORM_WORKER_UI_ID as ɵPLATFORM_WORKER_UI_ID, useBrowserPlatformLocation as ɵangular_packages_common_common_a, createBrowserPlatformLocation as ɵangular_packages_common_common_b, createLocation as ɵangular_packages_common_common_c, provideLocationStrategy as ɵangular_packages_common_common_d, COMMON_DIRECTIVES as ɵangular_packages_common_common_e, COMMON_PIPES as ɵangular_packages_common_common_f, getDOM as ɵgetDOM, parseCookieValue as ɵparseCookieValue, setRootDomAdapter as ɵsetRootDomAdapter };\n\n//# sourceMappingURL=common.js.map","/**\n * @license Angular v12.1.3\n * (c) 2010-2021 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport { DOCUMENT, XhrFactory as XhrFactory$1, ɵparseCookieValue } from '@angular/common';\nimport { Injectable, InjectionToken, Inject, PLATFORM_ID, Injector, NgModule } from '@angular/core';\nimport { of, Observable } from 'rxjs';\nimport { concatMap, filter, map } from 'rxjs/operators';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Transforms an `HttpRequest` into a stream of `HttpEvent`s, one of which will likely be a\n * `HttpResponse`.\n *\n * `HttpHandler` is injectable. When injected, the handler instance dispatches requests to the\n * first interceptor in the chain, which dispatches to the second, etc, eventually reaching the\n * `HttpBackend`.\n *\n * In an `HttpInterceptor`, the `HttpHandler` parameter is the next interceptor in the chain.\n *\n * @publicApi\n */\nimport * as ɵngcc0 from '@angular/core';\nimport * as ɵngcc1 from '@angular/common';\nclass HttpHandler {\n}\n/**\n * A final `HttpHandler` which will dispatch the request via browser HTTP APIs to a backend.\n *\n * Interceptors sit between the `HttpClient` interface and the `HttpBackend`.\n *\n * When injected, `HttpBackend` dispatches requests directly to the backend, without going\n * through the interceptor chain.\n *\n * @publicApi\n */\nclass HttpBackend {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Represents the header configuration options for an HTTP request.\n * Instances are immutable. Modifying methods return a cloned\n * instance with the change. The original object is never changed.\n *\n * @publicApi\n */\nclass HttpHeaders {\n /** Constructs a new HTTP header object with the given values.*/\n constructor(headers) {\n /**\n * Internal map of lowercased header names to the normalized\n * form of the name (the form seen first).\n */\n this.normalizedNames = new Map();\n /**\n * Queued updates to be materialized the next initialization.\n */\n this.lazyUpdate = null;\n if (!headers) {\n this.headers = new Map();\n }\n else if (typeof headers === 'string') {\n this.lazyInit = () => {\n this.headers = new Map();\n headers.split('\\n').forEach(line => {\n const index = line.indexOf(':');\n if (index > 0) {\n const name = line.slice(0, index);\n const key = name.toLowerCase();\n const value = line.slice(index + 1).trim();\n this.maybeSetNormalizedName(name, key);\n if (this.headers.has(key)) {\n this.headers.get(key).push(value);\n }\n else {\n this.headers.set(key, [value]);\n }\n }\n });\n };\n }\n else {\n this.lazyInit = () => {\n this.headers = new Map();\n Object.keys(headers).forEach(name => {\n let values = headers[name];\n const key = name.toLowerCase();\n if (typeof values === 'string') {\n values = [values];\n }\n if (values.length > 0) {\n this.headers.set(key, values);\n this.maybeSetNormalizedName(name, key);\n }\n });\n };\n }\n }\n /**\n * Checks for existence of a given header.\n *\n * @param name The header name to check for existence.\n *\n * @returns True if the header exists, false otherwise.\n */\n has(name) {\n this.init();\n return this.headers.has(name.toLowerCase());\n }\n /**\n * Retrieves the first value of a given header.\n *\n * @param name The header name.\n *\n * @returns The value string if the header exists, null otherwise\n */\n get(name) {\n this.init();\n const values = this.headers.get(name.toLowerCase());\n return values && values.length > 0 ? values[0] : null;\n }\n /**\n * Retrieves the names of the headers.\n *\n * @returns A list of header names.\n */\n keys() {\n this.init();\n return Array.from(this.normalizedNames.values());\n }\n /**\n * Retrieves a list of values for a given header.\n *\n * @param name The header name from which to retrieve values.\n *\n * @returns A string of values if the header exists, null otherwise.\n */\n getAll(name) {\n this.init();\n return this.headers.get(name.toLowerCase()) || null;\n }\n /**\n * Appends a new value to the existing set of values for a header\n * and returns them in a clone of the original instance.\n *\n * @param name The header name for which to append the values.\n * @param value The value to append.\n *\n * @returns A clone of the HTTP headers object with the value appended to the given header.\n */\n append(name, value) {\n return this.clone({ name, value, op: 'a' });\n }\n /**\n * Sets or modifies a value for a given header in a clone of the original instance.\n * If the header already exists, its value is replaced with the given value\n * in the returned object.\n *\n * @param name The header name.\n * @param value The value or values to set or overide for the given header.\n *\n * @returns A clone of the HTTP headers object with the newly set header value.\n */\n set(name, value) {\n return this.clone({ name, value, op: 's' });\n }\n /**\n * Deletes values for a given header in a clone of the original instance.\n *\n * @param name The header name.\n * @param value The value or values to delete for the given header.\n *\n * @returns A clone of the HTTP headers object with the given value deleted.\n */\n delete(name, value) {\n return this.clone({ name, value, op: 'd' });\n }\n maybeSetNormalizedName(name, lcName) {\n if (!this.normalizedNames.has(lcName)) {\n this.normalizedNames.set(lcName, name);\n }\n }\n init() {\n if (!!this.lazyInit) {\n if (this.lazyInit instanceof HttpHeaders) {\n this.copyFrom(this.lazyInit);\n }\n else {\n this.lazyInit();\n }\n this.lazyInit = null;\n if (!!this.lazyUpdate) {\n this.lazyUpdate.forEach(update => this.applyUpdate(update));\n this.lazyUpdate = null;\n }\n }\n }\n copyFrom(other) {\n other.init();\n Array.from(other.headers.keys()).forEach(key => {\n this.headers.set(key, other.headers.get(key));\n this.normalizedNames.set(key, other.normalizedNames.get(key));\n });\n }\n clone(update) {\n const clone = new HttpHeaders();\n clone.lazyInit =\n (!!this.lazyInit && this.lazyInit instanceof HttpHeaders) ? this.lazyInit : this;\n clone.lazyUpdate = (this.lazyUpdate || []).concat([update]);\n return clone;\n }\n applyUpdate(update) {\n const key = update.name.toLowerCase();\n switch (update.op) {\n case 'a':\n case 's':\n let value = update.value;\n if (typeof value === 'string') {\n value = [value];\n }\n if (value.length === 0) {\n return;\n }\n this.maybeSetNormalizedName(update.name, key);\n const base = (update.op === 'a' ? this.headers.get(key) : undefined) || [];\n base.push(...value);\n this.headers.set(key, base);\n break;\n case 'd':\n const toDelete = update.value;\n if (!toDelete) {\n this.headers.delete(key);\n this.normalizedNames.delete(key);\n }\n else {\n let existing = this.headers.get(key);\n if (!existing) {\n return;\n }\n existing = existing.filter(value => toDelete.indexOf(value) === -1);\n if (existing.length === 0) {\n this.headers.delete(key);\n this.normalizedNames.delete(key);\n }\n else {\n this.headers.set(key, existing);\n }\n }\n break;\n }\n }\n /**\n * @internal\n */\n forEach(fn) {\n this.init();\n Array.from(this.normalizedNames.keys())\n .forEach(key => fn(this.normalizedNames.get(key), this.headers.get(key)));\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Provides encoding and decoding of URL parameter and query-string values.\n *\n * Serializes and parses URL parameter keys and values to encode and decode them.\n * If you pass URL query parameters without encoding,\n * the query parameters can be misinterpreted at the receiving end.\n *\n *\n * @publicApi\n */\nclass HttpUrlEncodingCodec {\n /**\n * Encodes a key name for a URL parameter or query-string.\n * @param key The key name.\n * @returns The encoded key name.\n */\n encodeKey(key) {\n return standardEncoding(key);\n }\n /**\n * Encodes the value of a URL parameter or query-string.\n * @param value The value.\n * @returns The encoded value.\n */\n encodeValue(value) {\n return standardEncoding(value);\n }\n /**\n * Decodes an encoded URL parameter or query-string key.\n * @param key The encoded key name.\n * @returns The decoded key name.\n */\n decodeKey(key) {\n return decodeURIComponent(key);\n }\n /**\n * Decodes an encoded URL parameter or query-string value.\n * @param value The encoded value.\n * @returns The decoded value.\n */\n decodeValue(value) {\n return decodeURIComponent(value);\n }\n}\nfunction paramParser(rawParams, codec) {\n const map = new Map();\n if (rawParams.length > 0) {\n // The `window.location.search` can be used while creating an instance of the `HttpParams` class\n // (e.g. `new HttpParams({ fromString: window.location.search })`). The `window.location.search`\n // may start with the `?` char, so we strip it if it's present.\n const params = rawParams.replace(/^\\?/, '').split('&');\n params.forEach((param) => {\n const eqIdx = param.indexOf('=');\n const [key, val] = eqIdx == -1 ?\n [codec.decodeKey(param), ''] :\n [codec.decodeKey(param.slice(0, eqIdx)), codec.decodeValue(param.slice(eqIdx + 1))];\n const list = map.get(key) || [];\n list.push(val);\n map.set(key, list);\n });\n }\n return map;\n}\nfunction standardEncoding(v) {\n return encodeURIComponent(v)\n .replace(/%40/gi, '@')\n .replace(/%3A/gi, ':')\n .replace(/%24/gi, '$')\n .replace(/%2C/gi, ',')\n .replace(/%3B/gi, ';')\n .replace(/%2B/gi, '+')\n .replace(/%3D/gi, '=')\n .replace(/%3F/gi, '?')\n .replace(/%2F/gi, '/');\n}\nfunction valueToString(value) {\n return `${value}`;\n}\n/**\n * An HTTP request/response body that represents serialized parameters,\n * per the MIME type `application/x-www-form-urlencoded`.\n *\n * This class is immutable; all mutation operations return a new instance.\n *\n * @publicApi\n */\nclass HttpParams {\n constructor(options = {}) {\n this.updates = null;\n this.cloneFrom = null;\n this.encoder = options.encoder || new HttpUrlEncodingCodec();\n if (!!options.fromString) {\n if (!!options.fromObject) {\n throw new Error(`Cannot specify both fromString and fromObject.`);\n }\n this.map = paramParser(options.fromString, this.encoder);\n }\n else if (!!options.fromObject) {\n this.map = new Map();\n Object.keys(options.fromObject).forEach(key => {\n const value = options.fromObject[key];\n this.map.set(key, Array.isArray(value) ? value : [value]);\n });\n }\n else {\n this.map = null;\n }\n }\n /**\n * Reports whether the body includes one or more values for a given parameter.\n * @param param The parameter name.\n * @returns True if the parameter has one or more values,\n * false if it has no value or is not present.\n */\n has(param) {\n this.init();\n return this.map.has(param);\n }\n /**\n * Retrieves the first value for a parameter.\n * @param param The parameter name.\n * @returns The first value of the given parameter,\n * or `null` if the parameter is not present.\n */\n get(param) {\n this.init();\n const res = this.map.get(param);\n return !!res ? res[0] : null;\n }\n /**\n * Retrieves all values for a parameter.\n * @param param The parameter name.\n * @returns All values in a string array,\n * or `null` if the parameter not present.\n */\n getAll(param) {\n this.init();\n return this.map.get(param) || null;\n }\n /**\n * Retrieves all the parameters for this body.\n * @returns The parameter names in a string array.\n */\n keys() {\n this.init();\n return Array.from(this.map.keys());\n }\n /**\n * Appends a new value to existing values for a parameter.\n * @param param The parameter name.\n * @param value The new value to add.\n * @return A new body with the appended value.\n */\n append(param, value) {\n return this.clone({ param, value, op: 'a' });\n }\n /**\n * Constructs a new body with appended values for the given parameter name.\n * @param params parameters and values\n * @return A new body with the new value.\n */\n appendAll(params) {\n const updates = [];\n Object.keys(params).forEach(param => {\n const value = params[param];\n if (Array.isArray(value)) {\n value.forEach(_value => {\n updates.push({ param, value: _value, op: 'a' });\n });\n }\n else {\n updates.push({ param, value: value, op: 'a' });\n }\n });\n return this.clone(updates);\n }\n /**\n * Replaces the value for a parameter.\n * @param param The parameter name.\n * @param value The new value.\n * @return A new body with the new value.\n */\n set(param, value) {\n return this.clone({ param, value, op: 's' });\n }\n /**\n * Removes a given value or all values from a parameter.\n * @param param The parameter name.\n * @param value The value to remove, if provided.\n * @return A new body with the given value removed, or with all values\n * removed if no value is specified.\n */\n delete(param, value) {\n return this.clone({ param, value, op: 'd' });\n }\n /**\n * Serializes the body to an encoded string, where key-value pairs (separated by `=`) are\n * separated by `&`s.\n */\n toString() {\n this.init();\n return this.keys()\n .map(key => {\n const eKey = this.encoder.encodeKey(key);\n // `a: ['1']` produces `'a=1'`\n // `b: []` produces `''`\n // `c: ['1', '2']` produces `'c=1&c=2'`\n return this.map.get(key).map(value => eKey + '=' + this.encoder.encodeValue(value))\n .join('&');\n })\n // filter out empty values because `b: []` produces `''`\n // which results in `a=1&&c=1&c=2` instead of `a=1&c=1&c=2` if we don't\n .filter(param => param !== '')\n .join('&');\n }\n clone(update) {\n const clone = new HttpParams({ encoder: this.encoder });\n clone.cloneFrom = this.cloneFrom || this;\n clone.updates = (this.updates || []).concat(update);\n return clone;\n }\n init() {\n if (this.map === null) {\n this.map = new Map();\n }\n if (this.cloneFrom !== null) {\n this.cloneFrom.init();\n this.cloneFrom.keys().forEach(key => this.map.set(key, this.cloneFrom.map.get(key)));\n this.updates.forEach(update => {\n switch (update.op) {\n case 'a':\n case 's':\n const base = (update.op === 'a' ? this.map.get(update.param) : undefined) || [];\n base.push(valueToString(update.value));\n this.map.set(update.param, base);\n break;\n case 'd':\n if (update.value !== undefined) {\n let base = this.map.get(update.param) || [];\n const idx = base.indexOf(valueToString(update.value));\n if (idx !== -1) {\n base.splice(idx, 1);\n }\n if (base.length > 0) {\n this.map.set(update.param, base);\n }\n else {\n this.map.delete(update.param);\n }\n }\n else {\n this.map.delete(update.param);\n break;\n }\n }\n });\n this.cloneFrom = this.updates = null;\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A token used to manipulate and access values stored in `HttpContext`.\n *\n * @publicApi\n */\nclass HttpContextToken {\n constructor(defaultValue) {\n this.defaultValue = defaultValue;\n }\n}\n/**\n * Http context stores arbitrary user defined values and ensures type safety without\n * actually knowing the types. It is backed by a `Map` and guarantees that keys do not clash.\n *\n * This context is mutable and is shared between cloned requests unless explicitly specified.\n *\n * @usageNotes\n *\n * ### Usage Example\n *\n * ```typescript\n * // inside cache.interceptors.ts\n * export const IS_CACHE_ENABLED = new HttpContextToken(() => false);\n *\n * export class CacheInterceptor implements HttpInterceptor {\n *\n * intercept(req: HttpRequest, delegate: HttpHandler): Observable> {\n * if (req.context.get(IS_CACHE_ENABLED) === true) {\n * return ...;\n * }\n * return delegate.handle(req);\n * }\n * }\n *\n * // inside a service\n *\n * this.httpClient.get('/api/weather', {\n * context: new HttpContext().set(IS_CACHE_ENABLED, true)\n * }).subscribe(...);\n * ```\n *\n * @publicApi\n */\nclass HttpContext {\n constructor() {\n this.map = new Map();\n }\n /**\n * Store a value in the context. If a value is already present it will be overwritten.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n * @param value The value to store.\n *\n * @returns A reference to itself for easy chaining.\n */\n set(token, value) {\n this.map.set(token, value);\n return this;\n }\n /**\n * Retrieve the value associated with the given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns The stored value or default if one is defined.\n */\n get(token) {\n if (!this.map.has(token)) {\n this.map.set(token, token.defaultValue());\n }\n return this.map.get(token);\n }\n /**\n * Delete the value associated with the given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns A reference to itself for easy chaining.\n */\n delete(token) {\n this.map.delete(token);\n return this;\n }\n /**\n * @returns a list of tokens currently stored in the context.\n */\n keys() {\n return this.map.keys();\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Determine whether the given HTTP method may include a body.\n */\nfunction mightHaveBody(method) {\n switch (method) {\n case 'DELETE':\n case 'GET':\n case 'HEAD':\n case 'OPTIONS':\n case 'JSONP':\n return false;\n default:\n return true;\n }\n}\n/**\n * Safely assert whether the given value is an ArrayBuffer.\n *\n * In some execution environments ArrayBuffer is not defined.\n */\nfunction isArrayBuffer(value) {\n return typeof ArrayBuffer !== 'undefined' && value instanceof ArrayBuffer;\n}\n/**\n * Safely assert whether the given value is a Blob.\n *\n * In some execution environments Blob is not defined.\n */\nfunction isBlob(value) {\n return typeof Blob !== 'undefined' && value instanceof Blob;\n}\n/**\n * Safely assert whether the given value is a FormData instance.\n *\n * In some execution environments FormData is not defined.\n */\nfunction isFormData(value) {\n return typeof FormData !== 'undefined' && value instanceof FormData;\n}\n/**\n * Safely assert whether the given value is a URLSearchParams instance.\n *\n * In some execution environments URLSearchParams is not defined.\n */\nfunction isUrlSearchParams(value) {\n return typeof URLSearchParams !== 'undefined' && value instanceof URLSearchParams;\n}\n/**\n * An outgoing HTTP request with an optional typed body.\n *\n * `HttpRequest` represents an outgoing request, including URL, method,\n * headers, body, and other request configuration options. Instances should be\n * assumed to be immutable. To modify a `HttpRequest`, the `clone`\n * method should be used.\n *\n * @publicApi\n */\nclass HttpRequest {\n constructor(method, url, third, fourth) {\n this.url = url;\n /**\n * The request body, or `null` if one isn't set.\n *\n * Bodies are not enforced to be immutable, as they can include a reference to any\n * user-defined data type. However, interceptors should take care to preserve\n * idempotence by treating them as such.\n */\n this.body = null;\n /**\n * Whether this request should be made in a way that exposes progress events.\n *\n * Progress events are expensive (change detection runs on each event) and so\n * they should only be requested if the consumer intends to monitor them.\n */\n this.reportProgress = false;\n /**\n * Whether this request should be sent with outgoing credentials (cookies).\n */\n this.withCredentials = false;\n /**\n * The expected response type of the server.\n *\n * This is used to parse the response appropriately before returning it to\n * the requestee.\n */\n this.responseType = 'json';\n this.method = method.toUpperCase();\n // Next, need to figure out which argument holds the HttpRequestInit\n // options, if any.\n let options;\n // Check whether a body argument is expected. The only valid way to omit\n // the body argument is to use a known no-body method like GET.\n if (mightHaveBody(this.method) || !!fourth) {\n // Body is the third argument, options are the fourth.\n this.body = (third !== undefined) ? third : null;\n options = fourth;\n }\n else {\n // No body required, options are the third argument. The body stays null.\n options = third;\n }\n // If options have been passed, interpret them.\n if (options) {\n // Normalize reportProgress and withCredentials.\n this.reportProgress = !!options.reportProgress;\n this.withCredentials = !!options.withCredentials;\n // Override default response type of 'json' if one is provided.\n if (!!options.responseType) {\n this.responseType = options.responseType;\n }\n // Override headers if they're provided.\n if (!!options.headers) {\n this.headers = options.headers;\n }\n if (!!options.context) {\n this.context = options.context;\n }\n if (!!options.params) {\n this.params = options.params;\n }\n }\n // If no headers have been passed in, construct a new HttpHeaders instance.\n if (!this.headers) {\n this.headers = new HttpHeaders();\n }\n // If no context have been passed in, construct a new HttpContext instance.\n if (!this.context) {\n this.context = new HttpContext();\n }\n // If no parameters have been passed in, construct a new HttpUrlEncodedParams instance.\n if (!this.params) {\n this.params = new HttpParams();\n this.urlWithParams = url;\n }\n else {\n // Encode the parameters to a string in preparation for inclusion in the URL.\n const params = this.params.toString();\n if (params.length === 0) {\n // No parameters, the visible URL is just the URL given at creation time.\n this.urlWithParams = url;\n }\n else {\n // Does the URL already have query parameters? Look for '?'.\n const qIdx = url.indexOf('?');\n // There are 3 cases to handle:\n // 1) No existing parameters -> append '?' followed by params.\n // 2) '?' exists and is followed by existing query string ->\n // append '&' followed by params.\n // 3) '?' exists at the end of the url -> append params directly.\n // This basically amounts to determining the character, if any, with\n // which to join the URL and parameters.\n const sep = qIdx === -1 ? '?' : (qIdx < url.length - 1 ? '&' : '');\n this.urlWithParams = url + sep + params;\n }\n }\n }\n /**\n * Transform the free-form body into a serialized format suitable for\n * transmission to the server.\n */\n serializeBody() {\n // If no body is present, no need to serialize it.\n if (this.body === null) {\n return null;\n }\n // Check whether the body is already in a serialized form. If so,\n // it can just be returned directly.\n if (isArrayBuffer(this.body) || isBlob(this.body) || isFormData(this.body) ||\n isUrlSearchParams(this.body) || typeof this.body === 'string') {\n return this.body;\n }\n // Check whether the body is an instance of HttpUrlEncodedParams.\n if (this.body instanceof HttpParams) {\n return this.body.toString();\n }\n // Check whether the body is an object or array, and serialize with JSON if so.\n if (typeof this.body === 'object' || typeof this.body === 'boolean' ||\n Array.isArray(this.body)) {\n return JSON.stringify(this.body);\n }\n // Fall back on toString() for everything else.\n return this.body.toString();\n }\n /**\n * Examine the body and attempt to infer an appropriate MIME type\n * for it.\n *\n * If no such type can be inferred, this method will return `null`.\n */\n detectContentTypeHeader() {\n // An empty body has no content type.\n if (this.body === null) {\n return null;\n }\n // FormData bodies rely on the browser's content type assignment.\n if (isFormData(this.body)) {\n return null;\n }\n // Blobs usually have their own content type. If it doesn't, then\n // no type can be inferred.\n if (isBlob(this.body)) {\n return this.body.type || null;\n }\n // Array buffers have unknown contents and thus no type can be inferred.\n if (isArrayBuffer(this.body)) {\n return null;\n }\n // Technically, strings could be a form of JSON data, but it's safe enough\n // to assume they're plain strings.\n if (typeof this.body === 'string') {\n return 'text/plain';\n }\n // `HttpUrlEncodedParams` has its own content-type.\n if (this.body instanceof HttpParams) {\n return 'application/x-www-form-urlencoded;charset=UTF-8';\n }\n // Arrays, objects, boolean and numbers will be encoded as JSON.\n if (typeof this.body === 'object' || typeof this.body === 'number' ||\n typeof this.body === 'boolean') {\n return 'application/json';\n }\n // No type could be inferred.\n return null;\n }\n clone(update = {}) {\n var _a;\n // For method, url, and responseType, take the current value unless\n // it is overridden in the update hash.\n const method = update.method || this.method;\n const url = update.url || this.url;\n const responseType = update.responseType || this.responseType;\n // The body is somewhat special - a `null` value in update.body means\n // whatever current body is present is being overridden with an empty\n // body, whereas an `undefined` value in update.body implies no\n // override.\n const body = (update.body !== undefined) ? update.body : this.body;\n // Carefully handle the boolean options to differentiate between\n // `false` and `undefined` in the update args.\n const withCredentials = (update.withCredentials !== undefined) ? update.withCredentials : this.withCredentials;\n const reportProgress = (update.reportProgress !== undefined) ? update.reportProgress : this.reportProgress;\n // Headers and params may be appended to if `setHeaders` or\n // `setParams` are used.\n let headers = update.headers || this.headers;\n let params = update.params || this.params;\n // Pass on context if needed\n const context = (_a = update.context) !== null && _a !== void 0 ? _a : this.context;\n // Check whether the caller has asked to add headers.\n if (update.setHeaders !== undefined) {\n // Set every requested header.\n headers =\n Object.keys(update.setHeaders)\n .reduce((headers, name) => headers.set(name, update.setHeaders[name]), headers);\n }\n // Check whether the caller has asked to set params.\n if (update.setParams) {\n // Set every requested param.\n params = Object.keys(update.setParams)\n .reduce((params, param) => params.set(param, update.setParams[param]), params);\n }\n // Finally, construct the new HttpRequest using the pieces from above.\n return new HttpRequest(method, url, body, {\n params,\n headers,\n context,\n reportProgress,\n responseType,\n withCredentials,\n });\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Type enumeration for the different kinds of `HttpEvent`.\n *\n * @publicApi\n */\nvar HttpEventType;\n(function (HttpEventType) {\n /**\n * The request was sent out over the wire.\n */\n HttpEventType[HttpEventType[\"Sent\"] = 0] = \"Sent\";\n /**\n * An upload progress event was received.\n */\n HttpEventType[HttpEventType[\"UploadProgress\"] = 1] = \"UploadProgress\";\n /**\n * The response status code and headers were received.\n */\n HttpEventType[HttpEventType[\"ResponseHeader\"] = 2] = \"ResponseHeader\";\n /**\n * A download progress event was received.\n */\n HttpEventType[HttpEventType[\"DownloadProgress\"] = 3] = \"DownloadProgress\";\n /**\n * The full response including the body was received.\n */\n HttpEventType[HttpEventType[\"Response\"] = 4] = \"Response\";\n /**\n * A custom event from an interceptor or a backend.\n */\n HttpEventType[HttpEventType[\"User\"] = 5] = \"User\";\n})(HttpEventType || (HttpEventType = {}));\n/**\n * Base class for both `HttpResponse` and `HttpHeaderResponse`.\n *\n * @publicApi\n */\nclass HttpResponseBase {\n /**\n * Super-constructor for all responses.\n *\n * The single parameter accepted is an initialization hash. Any properties\n * of the response passed there will override the default values.\n */\n constructor(init, defaultStatus = 200 /* Ok */, defaultStatusText = 'OK') {\n // If the hash has values passed, use them to initialize the response.\n // Otherwise use the default values.\n this.headers = init.headers || new HttpHeaders();\n this.status = init.status !== undefined ? init.status : defaultStatus;\n this.statusText = init.statusText || defaultStatusText;\n this.url = init.url || null;\n // Cache the ok value to avoid defining a getter.\n this.ok = this.status >= 200 && this.status < 300;\n }\n}\n/**\n * A partial HTTP response which only includes the status and header data,\n * but no response body.\n *\n * `HttpHeaderResponse` is a `HttpEvent` available on the response\n * event stream, only when progress events are requested.\n *\n * @publicApi\n */\nclass HttpHeaderResponse extends HttpResponseBase {\n /**\n * Create a new `HttpHeaderResponse` with the given parameters.\n */\n constructor(init = {}) {\n super(init);\n this.type = HttpEventType.ResponseHeader;\n }\n /**\n * Copy this `HttpHeaderResponse`, overriding its contents with the\n * given parameter hash.\n */\n clone(update = {}) {\n // Perform a straightforward initialization of the new HttpHeaderResponse,\n // overriding the current parameters with new ones if given.\n return new HttpHeaderResponse({\n headers: update.headers || this.headers,\n status: update.status !== undefined ? update.status : this.status,\n statusText: update.statusText || this.statusText,\n url: update.url || this.url || undefined,\n });\n }\n}\n/**\n * A full HTTP response, including a typed response body (which may be `null`\n * if one was not returned).\n *\n * `HttpResponse` is a `HttpEvent` available on the response event\n * stream.\n *\n * @publicApi\n */\nclass HttpResponse extends HttpResponseBase {\n /**\n * Construct a new `HttpResponse`.\n */\n constructor(init = {}) {\n super(init);\n this.type = HttpEventType.Response;\n this.body = init.body !== undefined ? init.body : null;\n }\n clone(update = {}) {\n return new HttpResponse({\n body: (update.body !== undefined) ? update.body : this.body,\n headers: update.headers || this.headers,\n status: (update.status !== undefined) ? update.status : this.status,\n statusText: update.statusText || this.statusText,\n url: update.url || this.url || undefined,\n });\n }\n}\n/**\n * A response that represents an error or failure, either from a\n * non-successful HTTP status, an error while executing the request,\n * or some other failure which occurred during the parsing of the response.\n *\n * Any error returned on the `Observable` response stream will be\n * wrapped in an `HttpErrorResponse` to provide additional context about\n * the state of the HTTP layer when the error occurred. The error property\n * will contain either a wrapped Error object or the error response returned\n * from the server.\n *\n * @publicApi\n */\nclass HttpErrorResponse extends HttpResponseBase {\n constructor(init) {\n // Initialize with a default status of 0 / Unknown Error.\n super(init, 0, 'Unknown Error');\n this.name = 'HttpErrorResponse';\n /**\n * Errors are never okay, even when the status code is in the 2xx success range.\n */\n this.ok = false;\n // If the response was successful, then this was a parse error. Otherwise, it was\n // a protocol-level failure of some sort. Either the request failed in transit\n // or the server returned an unsuccessful status code.\n if (this.status >= 200 && this.status < 300) {\n this.message = `Http failure during parsing for ${init.url || '(unknown url)'}`;\n }\n else {\n this.message = `Http failure response for ${init.url || '(unknown url)'}: ${init.status} ${init.statusText}`;\n }\n this.error = init.error || null;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Constructs an instance of `HttpRequestOptions` from a source `HttpMethodOptions` and\n * the given `body`. This function clones the object and adds the body.\n *\n * Note that the `responseType` *options* value is a String that identifies the\n * single data type of the response.\n * A single overload version of the method handles each response type.\n * The value of `responseType` cannot be a union, as the combined signature could imply.\n *\n */\nfunction addBody(options, body) {\n return {\n body,\n headers: options.headers,\n context: options.context,\n observe: options.observe,\n params: options.params,\n reportProgress: options.reportProgress,\n responseType: options.responseType,\n withCredentials: options.withCredentials,\n };\n}\n/**\n * Performs HTTP requests.\n * This service is available as an injectable class, with methods to perform HTTP requests.\n * Each request method has multiple signatures, and the return type varies based on\n * the signature that is called (mainly the values of `observe` and `responseType`).\n *\n * Note that the `responseType` *options* value is a String that identifies the\n * single data type of the response.\n * A single overload version of the method handles each response type.\n * The value of `responseType` cannot be a union, as the combined signature could imply.\n\n *\n * @usageNotes\n * Sample HTTP requests for the [Tour of Heroes](/tutorial/toh-pt0) application.\n *\n * ### HTTP Request Example\n *\n * ```\n * // GET heroes whose name contains search term\n * searchHeroes(term: string): observable{\n *\n * const params = new HttpParams({fromString: 'name=term'});\n * return this.httpClient.request('GET', this.heroesUrl, {responseType:'json', params});\n * }\n * ```\n *\n * Alternatively, the parameter string can be used without invoking HttpParams\n * by directly joining to the URL.\n * ```\n * this.httpClient.request('GET', this.heroesUrl + '?' + 'name=term', {responseType:'json'});\n * ```\n *\n *\n * ### JSONP Example\n * ```\n * requestJsonp(url, callback = 'callback') {\n * return this.httpClient.jsonp(this.heroesURL, callback);\n * }\n * ```\n *\n * ### PATCH Example\n * ```\n * // PATCH one of the heroes' name\n * patchHero (id: number, heroName: string): Observable<{}> {\n * const url = `${this.heroesUrl}/${id}`; // PATCH api/heroes/42\n * return this.httpClient.patch(url, {name: heroName}, httpOptions)\n * .pipe(catchError(this.handleError('patchHero')));\n * }\n * ```\n *\n * @see [HTTP Guide](guide/http)\n * @see [HTTP Request](api/common/http/HttpRequest)\n *\n * @publicApi\n */\nclass HttpClient {\n constructor(handler) {\n this.handler = handler;\n }\n /**\n * Constructs an observable for a generic HTTP request that, when subscribed,\n * fires the request through the chain of registered interceptors and on to the\n * server.\n *\n * You can pass an `HttpRequest` directly as the only parameter. In this case,\n * the call returns an observable of the raw `HttpEvent` stream.\n *\n * Alternatively you can pass an HTTP method as the first parameter,\n * a URL string as the second, and an options hash containing the request body as the third.\n * See `addBody()`. In this case, the specified `responseType` and `observe` options determine the\n * type of returned observable.\n * * The `responseType` value determines how a successful response body is parsed.\n * * If `responseType` is the default `json`, you can pass a type interface for the resulting\n * object as a type parameter to the call.\n *\n * The `observe` value determines the return type, according to what you are interested in\n * observing.\n * * An `observe` value of events returns an observable of the raw `HttpEvent` stream, including\n * progress events by default.\n * * An `observe` value of response returns an observable of `HttpResponse`,\n * where the `T` parameter depends on the `responseType` and any optionally provided type\n * parameter.\n * * An `observe` value of body returns an observable of `` with the same `T` body type.\n *\n */\n request(first, url, options = {}) {\n let req;\n // First, check whether the primary argument is an instance of `HttpRequest`.\n if (first instanceof HttpRequest) {\n // It is. The other arguments must be undefined (per the signatures) and can be\n // ignored.\n req = first;\n }\n else {\n // It's a string, so it represents a URL. Construct a request based on it,\n // and incorporate the remaining arguments (assuming `GET` unless a method is\n // provided.\n // Figure out the headers.\n let headers = undefined;\n if (options.headers instanceof HttpHeaders) {\n headers = options.headers;\n }\n else {\n headers = new HttpHeaders(options.headers);\n }\n // Sort out parameters.\n let params = undefined;\n if (!!options.params) {\n if (options.params instanceof HttpParams) {\n params = options.params;\n }\n else {\n params = new HttpParams({ fromObject: options.params });\n }\n }\n // Construct the request.\n req = new HttpRequest(first, url, (options.body !== undefined ? options.body : null), {\n headers,\n context: options.context,\n params,\n reportProgress: options.reportProgress,\n // By default, JSON is assumed to be returned for all calls.\n responseType: options.responseType || 'json',\n withCredentials: options.withCredentials,\n });\n }\n // Start with an Observable.of() the initial request, and run the handler (which\n // includes all interceptors) inside a concatMap(). This way, the handler runs\n // inside an Observable chain, which causes interceptors to be re-run on every\n // subscription (this also makes retries re-run the handler, including interceptors).\n const events$ = of(req).pipe(concatMap((req) => this.handler.handle(req)));\n // If coming via the API signature which accepts a previously constructed HttpRequest,\n // the only option is to get the event stream. Otherwise, return the event stream if\n // that is what was requested.\n if (first instanceof HttpRequest || options.observe === 'events') {\n return events$;\n }\n // The requested stream contains either the full response or the body. In either\n // case, the first step is to filter the event stream to extract a stream of\n // responses(s).\n const res$ = events$.pipe(filter((event) => event instanceof HttpResponse));\n // Decide which stream to return.\n switch (options.observe || 'body') {\n case 'body':\n // The requested stream is the body. Map the response stream to the response\n // body. This could be done more simply, but a misbehaving interceptor might\n // transform the response body into a different format and ignore the requested\n // responseType. Guard against this by validating that the response is of the\n // requested type.\n switch (req.responseType) {\n case 'arraybuffer':\n return res$.pipe(map((res) => {\n // Validate that the body is an ArrayBuffer.\n if (res.body !== null && !(res.body instanceof ArrayBuffer)) {\n throw new Error('Response is not an ArrayBuffer.');\n }\n return res.body;\n }));\n case 'blob':\n return res$.pipe(map((res) => {\n // Validate that the body is a Blob.\n if (res.body !== null && !(res.body instanceof Blob)) {\n throw new Error('Response is not a Blob.');\n }\n return res.body;\n }));\n case 'text':\n return res$.pipe(map((res) => {\n // Validate that the body is a string.\n if (res.body !== null && typeof res.body !== 'string') {\n throw new Error('Response is not a string.');\n }\n return res.body;\n }));\n case 'json':\n default:\n // No validation needed for JSON responses, as they can be of any type.\n return res$.pipe(map((res) => res.body));\n }\n case 'response':\n // The response stream was requested directly, so return it.\n return res$;\n default:\n // Guard against new future observe types being added.\n throw new Error(`Unreachable: unhandled observe type ${options.observe}}`);\n }\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `DELETE` request to execute on the server. See the individual overloads for\n * details on the return type.\n *\n * @param url The endpoint URL.\n * @param options The HTTP options to send with the request.\n *\n */\n delete(url, options = {}) {\n return this.request('DELETE', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `GET` request to execute on the server. See the individual overloads for\n * details on the return type.\n */\n get(url, options = {}) {\n return this.request('GET', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `HEAD` request to execute on the server. The `HEAD` method returns\n * meta information about the resource without transferring the\n * resource itself. See the individual overloads for\n * details on the return type.\n */\n head(url, options = {}) {\n return this.request('HEAD', url, options);\n }\n /**\n * Constructs an `Observable` that, when subscribed, causes a request with the special method\n * `JSONP` to be dispatched via the interceptor pipeline.\n * The [JSONP pattern](https://en.wikipedia.org/wiki/JSONP) works around limitations of certain\n * API endpoints that don't support newer,\n * and preferable [CORS](https://developer.mozilla.org/en-US/docs/Web/HTTP/CORS) protocol.\n * JSONP treats the endpoint API as a JavaScript file and tricks the browser to process the\n * requests even if the API endpoint is not located on the same domain (origin) as the client-side\n * application making the request.\n * The endpoint API must support JSONP callback for JSONP requests to work.\n * The resource API returns the JSON response wrapped in a callback function.\n * You can pass the callback function name as one of the query parameters.\n * Note that JSONP requests can only be used with `GET` requests.\n *\n * @param url The resource URL.\n * @param callbackParam The callback function name.\n *\n */\n jsonp(url, callbackParam) {\n return this.request('JSONP', url, {\n params: new HttpParams().append(callbackParam, 'JSONP_CALLBACK'),\n observe: 'body',\n responseType: 'json',\n });\n }\n /**\n * Constructs an `Observable` that, when subscribed, causes the configured\n * `OPTIONS` request to execute on the server. This method allows the client\n * to determine the supported HTTP methods and other capabilites of an endpoint,\n * without implying a resource action. See the individual overloads for\n * details on the return type.\n */\n options(url, options = {}) {\n return this.request('OPTIONS', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `PATCH` request to execute on the server. See the individual overloads for\n * details on the return type.\n */\n patch(url, body, options = {}) {\n return this.request('PATCH', url, addBody(options, body));\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `POST` request to execute on the server. The server responds with the location of\n * the replaced resource. See the individual overloads for\n * details on the return type.\n */\n post(url, body, options = {}) {\n return this.request('POST', url, addBody(options, body));\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `PUT` request to execute on the server. The `PUT` method replaces an existing resource\n * with a new set of values.\n * See the individual overloads for details on the return type.\n */\n put(url, body, options = {}) {\n return this.request('PUT', url, addBody(options, body));\n }\n}\nHttpClient.ɵfac = function HttpClient_Factory(t) { return new (t || HttpClient)(ɵngcc0.ɵɵinject(HttpHandler)); };\nHttpClient.ɵprov = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjectable({ token: HttpClient, factory: HttpClient.ɵfac });\nHttpClient.ctorParameters = () => [\n { type: HttpHandler }\n];\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(HttpClient, [{\n type: Injectable\n }], function () { return [{ type: HttpHandler }]; }, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * `HttpHandler` which applies an `HttpInterceptor` to an `HttpRequest`.\n *\n *\n */\nclass HttpInterceptorHandler {\n constructor(next, interceptor) {\n this.next = next;\n this.interceptor = interceptor;\n }\n handle(req) {\n return this.interceptor.intercept(req, this.next);\n }\n}\n/**\n * A multi-provider token that represents the array of registered\n * `HttpInterceptor` objects.\n *\n * @publicApi\n */\nconst HTTP_INTERCEPTORS = new InjectionToken('HTTP_INTERCEPTORS');\nclass NoopInterceptor {\n intercept(req, next) {\n return next.handle(req);\n }\n}\nNoopInterceptor.ɵfac = function NoopInterceptor_Factory(t) { return new (t || NoopInterceptor)(); };\nNoopInterceptor.ɵprov = /*@__PURE__*/ ɵngcc0.ɵɵdefineInjectable({ token: NoopInterceptor, factory: NoopInterceptor.ɵfac });\n(function () { (typeof ngDevMode === \"undefined\" || ngDevMode) && ɵngcc0.ɵsetClassMetadata(NoopInterceptor, [{\n type: Injectable\n }], null, null); })();\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Every request made through JSONP needs a callback name that's unique across the\n// whole page. Each request is assigned an id and the callback name is constructed\n// from that. The next id to be assigned is tracked in a global variable here that\n// is shared among all applications on the page.\nlet nextRequestId = 0;\n// Error text given when a JSONP script is injected, but doesn't invoke the callback\n// passed in its URL.\nconst JSONP_ERR_NO_CALLBACK = 'JSONP injected script did not invoke callback.';\n// Error text given when a request is passed to the JsonpClientBackend that doesn't\n// have a request method JSONP.\nconst JSONP_ERR_WRONG_METHOD = 'JSONP requests must use JSONP request method.';\nconst JSONP_ERR_WRONG_RESPONSE_TYPE = 'JSONP requests must use Json response type.';\n/**\n * DI token/abstract type representing a map of JSONP callbacks.\n *\n * In the browser, this should always be the `window` object.\n *\n *\n */\nclass JsonpCallbackContext {\n}\n/**\n * Processes an `HttpRequest` with the JSONP method,\n * by performing JSONP style requests.\n * @see `HttpHandler`\n * @see `HttpXhrBackend`\n *\n * @publicApi\n */\nclass JsonpClientBackend {\n constructor(callbackMap, document) {\n this.callbackMap = callbackMap;\n this.document = document;\n /**\n * A resolved promise that can be used to schedule microtasks in the event handlers.\n */\n this.resolvedPromise = Promise.resolve();\n }\n /**\n * Get the name of the next callback method, by incrementing the global `nextRequestId`.\n */\n nextCallback() {\n return `ng_jsonp_callback_${nextRequestId++}`;\n }\n /**\n * Processes a JSONP request and returns an event stream of the results.\n * @param req The request object.\n * @returns An observable of the response events.\n *\n */\n handle(req) {\n // Firstly, check both the method and response type. If either doesn't match\n // then the request was improperly routed here and cannot be handled.\n if (req.method !== 'JSONP') {\n throw new Error(JSONP_ERR_WRONG_METHOD);\n }\n else if (req.responseType !== 'json') {\n throw new Error(JSONP_ERR_WRONG_RESPONSE_TYPE);\n }\n // Everything else happens inside the Observable boundary.\n return new Observable((observer) => {\n // The first step to make a request is to generate the callback name, and replace the\n // callback placeholder in the URL with the name. Care has to be taken here to ensure\n // a trailing &, if matched, gets inserted back into the URL in the correct place.\n const callback = this.nextCallback();\n const url = req.urlWithParams.replace(/=JSONP_CALLBACK(&|$)/, `=${callback}$1`);\n // Construct the